Aveyron, Occitanie, Francei
| Regional Level Types | |
|---|---|
| Aveyron | Department |
| Occitanie | Region |
| France | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Rodez | 28,337 (2016) |
| Millau | 23,307 (2016) |
| Villefranche-de-Rouergue | 14,030 (2016) |
| Saint-Affrique | 8,548 (2016) |
| Decazeville | 7,268 (2016) |
| Luc-la-Primaube | 5,267 (2016) |
Mindat Locality ID:
18944
Long-form identifier:
mindat:1:2:18944:3
GUID (UUID V4):
5d264391-1461-4a54-8222-11d3d0622698
Other/historical names associated with this locality:
Midi-Pyrénées
Other Languages:
French:
Aveyron, Occitanie, France
German:
Département Aveyron, Okzitanien, Frankreich
Italian:
Aveyron, Occitania, Francia
Russian:
Аверон, Окситания, Франция
Simplified Chinese:
阿韦龙省, 奥克西塔尼大区, 法国
Spanish:
Aveyron, Occitania, Francia
Afrikaans:
Aveyron, Oksitanië, Frankryk
Albanian:
Aveyron, Oksitania, Franca
Arabic:
أفيرون, أوسيتاني, فرنسا
Aragonese:
Avairon, Occitania, Francia
Armenian:
Ավերոն, Օկսիտանիա, Ֆրանսիա
Azeri:
Averon , Oksitaniya , Fransa
Basque:
Aveyron, Okzitania, Frantzia
Belarusian:
Аверон , рэгіён Аксітанія, Францыя
Belarusian (Tarashkevitsa):
Авэрон, Аксытанія, Францыя
Bengali:
এভেরন, ফ্রান্স
Breton:
Aveyron, Okitania, Bro-C'hall
Bulgarian:
Аверон, Окситания, Франция
Catalan:
Avairon, Occitània, França
Cebuano:
Aveyron, Occitanie, Pransiya
Chuvash:
Аверон, Франци
Czech:
Aveyron, Okcitánie, Francie
Danish:
Aveyron, Occitanie, Frankrig
Dutch:
Aveyron, Occitanie, Frankrijk
Esperanto:
Aveyron, Okcitanio, Francio
Estonian:
Aveyroni departemang, Prantsusmaa
Farsi/Persian:
آویرون, اکسیتنی, فرانسه
Finnish:
Aveyron, Oksitania , Ranska
Franco-Provençal:
Avêron, France
Galician:
Aveyron, Occitania, Francia
Georgian:
ავერონი, საფრანგეთი
Greek:
Αβερόν, Οξιτανία, Γαλλία
Gujarati:
એવેરોન, ફ્રાન્સ
Hakka:
Aveyron-sén, Fap-koet
Hebrew:
אוורון, אוקסיטניה, צרפת
Hindi:
एवेरौन, ओसीटानिया, फ़्रान्स
Hungarian:
Aveyron, Franciaország
Indonesian:
Aveyron, Ositania, Perancis
Interlingua:
Departimento Aveyron, Francia
Japanese:
アヴェロン県, オクシタニー地域圏, フランス
Judaeo-Spanish:
Aveyron, Fransia
Kannada:
ಅವೇಯ್ರ್ಓನ್, ಫ್ರಾನ್ಸ್
Kapampangan:
Aveyron, Pransiya
Kazakh (Cyrillic Script):
Аверон, Франция
Kongo:
Aveyron, Fwalansa
Korean:
아베롱주, 옥시타니, 프랑스
Latin:
Avario, Occitania, Francia
Latvian:
Aveirona, Francija
Limburgian:
Aveyron, Occitanië, Frankriek
Lithuanian:
Averonas, Oksitanija, Prancūzija
Lombard:
Aveyron, Frància
Low Saxon/Low German:
Aveyron, Frankriek
Luxembourgish:
Departement Aveyron, Occitanie, Frankräich
Macedonian:
Аверон, Франција
Malagasy:
Aveyron, Frantsa
Malay:
Aveyron, Perancis
Marathi:
अॅव्हेरों, फ्रान्स
Minnan / Hokkien-Taiwanese:
Aveyron, Hoat-kok
Northern Sami:
Aveyron, Frankriika
Norwegian:
Aveyron, Occitanie, Frankrike
Norwegian (Nynorsk):
Aveyron, Frankrike
Occitan:
Avairon, Occitània, França
Piedmontese:
Aveyron, Fransa
Polish:
Aveyron, Oksytania, Francja
Portuguese:
Aveyron, Occitânia, França
Romanian:
Aveyron, Occitania, Franța
Scots:
Aveyron, Occitanie, Fraunce
Scottish Gaelic:
Aveyron, An Fhraing
Serbian:
Аверон, Окситанија, Француска
Serbo-Croatian:
Aveyron, Francuska
Sinhalese:
අවෙයිරොන්, ප්රංශය
Slovak:
Aveyron, Occitánia, Francúzsko
Slovenian:
Aveyron, Francija
Swahili:
Aveyron, Ufaransa
Swedish:
Aveyron, Occitanien, Frankrike
Tajik (Cyrillic Script):
Аверон, Фаронса
Tamil:
அவேய்றோன், பிரான்சு
Telugu:
అవేరాన్, ఫ్రాన్సు
Thai:
จังหวัดอาแวรง, แคว้นอ็อกซีตานี, ประเทศฝรั่งเศส
Tibetan (Standard):
ཨ་ཝེ་རོང་།, ཧྥ་རན་སི།
Traditional Chinese:
阿韋龍, 奧斯坦尼, 法國
Turkish:
Aveyron, Occitanie, Fransa
Ukrainian:
Аверон, Окситанія, Франція
Urdu:
اویرون, اوکیتانی, فرانس
Vietnamese:
Aveyron, Occitanie, Pháp
Volapük:
Aveyron, Loxitän, Fransän
Waray:
Aveyron, Occitanie, Fransya
Welsh:
Aveyron, Ocsitania, Ffrainc
Western Punjabi:
ضلع ایویرون, فرانس
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities313 valid minerals. 2 erroneous literature entries.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Acanthite Formula: Ag2S Localities: |
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 Localities: |
| ⓘ Adamite ? Formula: Zn2(AsO4)(OH) Description: EDS anaélyses done by the AJW association showed olivenite and a term where Cu/Zn ratio is 1 (zincolivenite ?) |
| ⓘ Aegirine Formula: NaFe3+Si2O6 Localities: Description: Microlites at the contact basanite/gneiss.
Acmite. |
| ⓘ 'Agardite' |
| ⓘ Agardite-(Ce) Formula: CeCu6(AsO4)3(OH)6 · 3H2O Localities: |
| ⓘ Agardite-(La) Formula: LaCu6(AsO4)3(OH)6 · 3H2O Localities: References: |
| ⓘ Agardite-(Y) Formula: YCu6(AsO4)3(OH)6 · 3H2O Localities: Habit: Fiber Colour: Clear green |
| ⓘ Åkermanite Formula: Ca2Mg[Si2O7] |
| ⓘ Albite Formula: Na(AlSi3O8) Localities: Description: Retromorphic phase. |
| ⓘ Albite var. Oligoclase Formula: (Na,Ca)[Al(Si,Al)Si2O8] Localities: |
| ⓘ Allophane Formula: (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 Localities: |
| ⓘ 'Almandine-Pyrope Series' Description: In coronites. |
| ⓘ 'Alum Group' Formula: XAl(SO4)2 · 12H2O |
| ⓘ Alumoåkermanite Formula: (CaNa)Al[Si2O7] |
| ⓘ Alunite Formula: KAl3(SO4)2(OH)6 |
| ⓘ 'Alunite Supergroup' Formula: AD3(XO4)2(OH)6 |
| ⓘ Alunogen Formula: Al2(SO4)3 · 17H2O Localities: Découverte de Lassalle, Decazeville coal basin, Decazeville, Villefranche-de-Rouergue, Aveyron, Occitanie, France Cransac, Villefranche-de-Rouergue, Aveyron, Occitanie, France Le Gua, Aubin, Aubin, Villefranche-de-Rouergue, Aveyron, Occitanie, France Saint-Georges-de-Luzençon, Millau, Aveyron, Occitanie, France |
| ⓘ Ammoniojarosite Formula: (NH4)Fe3+3(SO4)2(OH)6 |
| ⓘ 'Amphibole Supergroup' Formula: AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 Description: Brown titanium-rich amphibole at the contact between ilmenite and plagioclase. |
| ⓘ Analcime Formula: Na(AlSi2O6) · H2O Localities: |
| ⓘ Anatase Formula: TiO2 |
| ⓘ Andalusite Formula: Al2(SiO4)O |
| ⓘ 'Andorite' Formula: AgPbSb3S6 |
| ⓘ Andradite Formula: Ca3Fe3+2(SiO4)3 Habit: Dodecahedron Colour: Brown-red |
| ⓘ Anglesite Formula: PbSO4 Localities: Reported from at least 10 localities in this region. |
| ⓘ Anhydrite Formula: CaSO4 |
| ⓘ Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 |
| ⓘ Annabergite Formula: Ni3(AsO4)2 · 8H2O Localities: |
| ⓘ Anorthite Formula: Ca(Al2Si2O8) Localities: Lapanouse-de-Sévérac slag locality, Sévérac-d'Aveyron, Rodez, Aveyron, Occitanie, France Cransac, Villefranche-de-Rouergue, Aveyron, Occitanie, France Arvieu coronitic metanorite outcrop, Pont-de-Salars, Millau, Aveyron, Occitanie, France Bage reservoir, Pont-de-Salars, Millau, Aveyron, Occitanie, France Pentezac, Arvieu coronitic metanorite outcrop, Alrance, Millau, Aveyron, Occitanie, France Habit: Tabular prism Colour: Colorless |
| ⓘ Anorthite var. Labradorite Formula: (Ca,Na)[Al(Al,Si)Si2O8] |
| ⓘ Anthophyllite Formula: ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| ⓘ Antigorite Formula: Mg3(Si2O5)(OH)4 |
| ⓘ Antlerite Formula: Cu3(SO4)(OH)4 Localities: |
| ⓘ 'Apatite' ? Formula: Ca5(PO4)3(Cl/F/OH) |
| ⓘ 'Apophyllite Group' Formula: AB4[Si8O22]X · 8H2O |
| ⓘ Aragonite Formula: CaCO3 Localities: Reported from at least 9 localities in this region. References: |
| ⓘ Arseniosiderite Formula: Ca2Fe3+3(AsO4)3O2 · 3H2O |
| ⓘ Arsenopyrite Formula: FeAsS Localities: Reported from at least 8 localities in this region. |
| ⓘ Arthurite ? Formula: CuFe3+2(AsO4)2(OH)2 · 4H2O |
| ⓘ Atelestite Formula: Bi2(AsO4)O(OH) |
| ⓘ Augite Formula: (CaxMgyFez)(Mgy1Fez1)Si2O6 Localities: |
| ⓘ Aurichalcite Formula: (Zn,Cu)5(CO3)2(OH)6 Localities: La Baume, Villefranche-de-Rouergue, Villefranche-de-Rouergue, Aveyron, Occitanie, France La Vidale mine, Asprières, Villefranche-de-Rouergue, Aveyron, Occitanie, France Falgayrolles, Monteils, Villefranche-de-Rouergue, Aveyron, Occitanie, France Bréziès, Asprières, Villefranche-de-Rouergue, Aveyron, Occitanie, France References: |
| ⓘ Autunite Formula: Ca(UO2)2(PO4)2 · 10-12H2O Localities: Reported from at least 9 localities in this region. |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 Localities: Reported from at least 14 localities in this region. |
| ⓘ Bariopharmacosiderite Formula: Ba0.5Fe3+4(AsO4)3(OH)4 · 5H2O Localities: |
| ⓘ Baryte Formula: BaSO4 Localities: Reported from at least 20 localities in this region. |
| ⓘ Bayldonite Formula: PbCu3(AsO4)2(OH)2 Localities: |
| ✪ Bazhenovite Formula: Ca8S2(S3)(S2O3)(OH)12 · 20H2O Habit: Lamellar Colour: Yellow-Orange |
| ⓘ Beudantite Formula: PbFe3(AsO4)(SO4)(OH)6 Localities: Le Bastit, Najac, Villefranche-de-Rouergue, Aveyron, Occitanie, France Falgayrolles, Monteils, Villefranche-de-Rouergue, Aveyron, Occitanie, France Puech de Compolibat, Compolibat, Villefranche-de-Rouergue, Aveyron, Occitanie, France La Baume, Villefranche-de-Rouergue, Villefranche-de-Rouergue, Aveyron, Occitanie, France Le Kaymar, Pruines, Rodez, Aveyron, Occitanie, France References: |
| ⓘ 'Beudantite-Segnitite Series' |
| ⓘ Beyerite Formula: Ca(BiO)2(CO3)2 Localities: |
| ⓘ 'Bindheimite' Formula: Pb2Sb2O6O Localities: La Baume, Villefranche-de-Rouergue, Villefranche-de-Rouergue, Aveyron, Occitanie, France Le Serre, Le Bas Ségala, Villefranche-de-Rouergue, Aveyron, Occitanie, France Bar, Bor-et-Bar, Villefranche-de-Rouergue, Aveyron, Occitanie, France Falgayrolles, Monteils, Villefranche-de-Rouergue, Aveyron, Occitanie, France References: |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ Birunite ? Formula: Ca18(SiO3)8.5(CO3)8.5SO4 · 15H2O(?) |
| ⓘ Bismite Formula: Bi2O3 |
| ⓘ Bismuth Formula: Bi |
| ⓘ Bismuthinite Formula: Bi2S3 Localities: Reported from at least 7 localities in this region. References: |
| ⓘ Bismutite Formula: (BiO)2CO3 Localities: Prévinquières Mine, Florentin-la-Capelle, Rodez, Aveyron, Occitanie, France Falgayrolles, Monteils, Villefranche-de-Rouergue, Aveyron, Occitanie, France Le Bastit, Najac, Villefranche-de-Rouergue, Aveyron, Occitanie, France Bréziès, Asprières, Villefranche-de-Rouergue, Aveyron, Occitanie, France Le Kaymar, Pruines, Rodez, Aveyron, Occitanie, France Description: Bismutite sélénifère |
| ⓘ Bornite Formula: Cu5FeS4 Localities: Reported from at least 7 localities in this region. References: |
| ⓘ Boulangerite Formula: Pb5Sb4S11 Localities: |
| ⓘ Bournonite Formula: PbCuSbS3 Localities: Reported from at least 11 localities in this region. |
| ⓘ Brianyoungite ? Formula: Zn3(CO3,SO4)(OH)4 |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 Localities: Reported from at least 15 localities in this region. |
| ⓘ Cacoxenite Formula: Fe3+24AlO6(PO4)17(OH)12 · 75H2O Localities: Prévinquières Mine, Florentin-la-Capelle, Rodez, Aveyron, Occitanie, France Prévinquières area, Rieupeyroux, Villefranche-de-Rouergue, Aveyron, Occitanie, France Puech de Leguo quarry, La Capelle-Bleys, Villefranche-de-Rouergue, Aveyron, Occitanie, France Le Kaymar, Pruines, Rodez, Aveyron, Occitanie, France References: |
| ⓘ Calcite Formula: CaCO3 Localities: Reported from at least 19 localities in this region. |
| ⓘ Caledonite Formula: Pb5Cu2(SO4)3(CO3)(OH)6 Localities: Falgayrolles, Monteils, Villefranche-de-Rouergue, Aveyron, Occitanie, France Le Bastit, Najac, Villefranche-de-Rouergue, Aveyron, Occitanie, France La Baume, Villefranche-de-Rouergue, Villefranche-de-Rouergue, Aveyron, Occitanie, France Bréziès, Asprières, Villefranche-de-Rouergue, Aveyron, Occitanie, France |
| ⓘ Carminite Formula: PbFe3+2(AsO4)2(OH)2 Localities: |
| ⓘ Carnotite Formula: K2(UO2)2(VO4)2 · 3H2O Localities: |
| ⓘ Cassiterite Formula: SnO2 |
| ⓘ Čechite ? Formula: PbFe2+(VO4)(OH) |
| ⓘ Celestine Formula: SrSO4 |
| ⓘ Cerussite Formula: PbCO3 Localities: Reported from at least 16 localities in this region. |
| ⓘ Cesàrolite Formula: Pb(Mn4+)3O6(OH)2 |
| ⓘ 'Chabazite' Localities: References: |
| ⓘ 'Chabazite var. Phacolite' |
| ⓘ Chabazite-Ca Formula: (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| ⓘ Chalcanthite Formula: CuSO4 · 5H2O Localities: |
| ⓘ Chalcoalumite Formula: CuAl4(SO4)(OH)12 · 3H2O |
| ⓘ Chalcocite Formula: Cu2S Localities: Reported from at least 7 localities in this region. |
| ⓘ Chalcomenite Formula: CuSeO3 · 2H2O Localities: |
| ⓘ Formula: Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O Locality: Falgayrolles, Monteils, Villefranche-de-Rouergue, Aveyron, Occitanie, France - erroneously reported |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Reported from at least 29 localities in this region. |
| ⓘ Chenevixite Formula: Cu2Fe3+2(AsO4)2(OH)4 |
| ⓘ Chenite Formula: Pb4Cu(SO4)2(OH)6 |
| ⓘ Cheralite Formula: CaTh(PO4)2 Habit: Globule Colour: Colorless |
| ⓘ 'Chlorite Group' Description: Retromorphic phase. |
| ⓘ Chloritoid Formula: (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| ⓘ Chromite Formula: Fe2+Cr3+2O4 |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 Localities: Colour: blue Description: chrysocolla |
| ⓘ Churchite-(Y) Formula: Y(PO4) · 2H2O |
| ⓘ Cinnabar Formula: HgS |
| ⓘ Claudetite Formula: As2O3 |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ 'Clinopyroxene Subgroup' |
| ⓘ Cobaltite Formula: CoAsS |
| ⓘ Coffinite Formula: U(SiO4) · nH2O |
| ⓘ Conichalcite Formula: CaCu(AsO4)(OH) Localities: Fluorite mine, Valzergues, Villefranche-de-Rouergue, Aveyron, Occitanie, France Falgayrolles, Monteils, Villefranche-de-Rouergue, Aveyron, Occitanie, France Le Bastit, Najac, Villefranche-de-Rouergue, Aveyron, Occitanie, France La Sarrie, Saint André de Najac, Najac, Villefranche-de-Rouergue, Aveyron, Occitanie, France Les Bayles, Cénomes, Montagnol, Millau, Aveyron, Occitanie, France Habit: Ball Colour: Clear green |
| ⓘ Connellite Formula: Cu19(SO4)(OH)32Cl4 · 3H2O Localities: |
| ⓘ Copper Formula: Cu Localities: Reported from at least 7 localities in this region. Description: Cementation phase, in fluorite cleavages. |
| ⓘ Cordierite Formula: (Mg,Fe)2Al3(AlSi5O18) Localities: |
| ⓘ Corkite Formula: PbFe3(PO4)(SO4)(OH)6 Localities: References: Georges FAVREAU collection + EDX analysisIdentified by Georges Favreau: SEM-EDS |
| ⓘ Formula: Cu5(AsO4)2(OH)4 Locality: Falgayrolles, Monteils, Villefranche-de-Rouergue, Aveyron, Occitanie, France - erroneously reported |
| ✪ Cornwallite Formula: Cu5(AsO4)2(OH)4 |
| ⓘ Coronadite Formula: Pb(Mn4+6Mn3+2)O16 |
| ⓘ Corundum Formula: Al2O3 |
| ⓘ Corundum var. Ruby Formula: Al2O3 |
| ⓘ Cosalite Formula: Pb2Bi2S5 |
| ⓘ Covellite Formula: CuS Localities: Reported from at least 13 localities in this region. |
| ⓘ Crandallite Formula: CaAl3(PO4)(PO3OH)(OH)6 |
| ⓘ Cryptomelane Formula: K(Mn4+7Mn3+)O16 Localities: |
| ⓘ Cuprite Formula: Cu2O Localities: Reported from at least 11 localities in this region. |
| ⓘ Cuprite var. Chalcotrichite Formula: Cu2O |
| ⓘ Cuspidine Formula: Ca8(Si2O7)2F4 |
| ⓘ Cyanotrichite Formula: Cu4Al2(SO4)(OH)12 · 2H2O Localities: References: |
| ⓘ Cyrilovite Formula: NaFe3+3(PO4)2(OH)4 · 2H2O |
| ⓘ Delafossite Formula: CuFeO2 |
| ⓘ Depmeierite Formula: Na8(Al6Si6O24)(PO4,CO3)1-x · 3H2O (x |
| ⓘ Descloizite Formula: PbZn(VO4)(OH) |
| ⓘ Devilline Formula: CaCu4(SO4)2(OH)6 · 3H2O Localities: References: |
| ⓘ Digenite Formula: Cu9S5 Localities: Reported from at least 6 localities in this region. References: |
| ⓘ Diopside Formula: CaMgSi2O6 Localities: Description: Schilleritized diopside or endiopside. |
| ⓘ Dolomite Formula: CaMg(CO3)2 Localities: |
| ⓘ Duftite Formula: PbCu(AsO4)(OH) Localities: |
| ⓘ Elyite Formula: Pb4Cu(SO4)O2(OH)4 · H2O Localities: |
| ⓘ Emplectite Formula: CuBiS2 |
| ⓘ Enargite Formula: Cu3AsS4 |
| ⓘ Enstatite Formula: Mg2Si2O6 Localities: Description: In coronites. |
| ⓘ Enstatite var. Bronzite Formula: (Mg,Fe2+)2[SiO3]2 |
| ⓘ 'Enstatite-Ferrosilite Series' Description: Recrystallized in gneiss xenoliths. |
| ✪ Esseneite Formula: CaFe3+[AlSiO6] Habit: Acicular Colour: Brown to dark green |
| ⓘ Ettringite Formula: Ca6Al2(SO4)3(OH)12 · 26H2O Localities: Habit: Acicular Colour: White |
| ⓘ Faujasite-Na Formula: (Na2,Ca,Mg)3.5[Al7Si17O48] · 32H2O |
| ⓘ Fayalite ? Formula: Fe2+2SiO4 |
| ⓘ 'Fayalite-Forsterite Series' |
| ⓘ Ferberite Formula: FeWO4 |
| ⓘ Ferricoronadite Formula: Pb(Mn4+6Fe3+2)O16 |
| ⓘ 'Ferri-gehlenite' Formula: Ca2Fe3+[AlSiO7] |
| ⓘ Ferrihollandite Formula: Ba(Mn4+6Fe3+2)O16 |
| ⓘ Fluocerite-(Ce) Formula: CeF3 |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F Habit: Hexagonal elongated prism Colour: Blue |
| ✪ Fluorellestadite Formula: Ca5(SiO4)1.5(SO4)1.5F Habit: Acicular Colour: Pale green to colorless |
| ⓘ Fluorite Formula: CaF2 Localities: Reported from at least 11 localities in this region. References: |
| ⓘ Fluorite var. Stink-Fluss Formula: CaF2 |
| ⓘ Forsterite Formula: Mg2SiO4 |
| ⓘ Fraipontite ? Formula: (Zn,Al)3((Si,Al)2O5)(OH)4 |
| ⓘ Francevillite Formula: Ba(UO2)2(VO4)2 · 5H2O Localities: |
| ⓘ 'Freibergite Subgroup' Formula: (Ag6,[Ag6]4+)(Cu4 C2+2)Sb4S12S0-1 |
| ⓘ Freieslebenite Formula: AgPbSbS3 Localities: La Baume, Villefranche-de-Rouergue, Villefranche-de-Rouergue, Aveyron, Occitanie, France La Vidale mine, Asprières, Villefranche-de-Rouergue, Aveyron, Occitanie, France La Diege mine, Sonnac, Villefranche-de-Rouergue, Aveyron, Occitanie, France La Boule, Le Kaymar, Pruines, Rodez, Aveyron, Occitanie, France |
| ⓘ Galena Formula: PbS Localities: Reported from at least 21 localities in this region. References: |
| ⓘ Galena var. Silver-bearing Galena Formula: PbS with Ag |
| ⓘ Gartrellite Formula: PbCuFe3+(AsO4)2(OH) · H2O |
| ⓘ Gedrite Formula: ◻{Mg2}{Mg3Al2}(Al2Si6O22)(OH)2 |
| ⓘ Gehlenite Formula: Ca2Al[AlSiO7] |
| ⓘ Gersdorffite Formula: NiAsS Localities: Reported from at least 6 localities in this region. References: |
| ⓘ Gibbsite Formula: Al(OH)3 |
| ⓘ 'Gismondine Subgroup' |
| ⓘ Giuseppettite Formula: (Na,K,Ca)7-8(Al6Si6O24)(SO4,Cl)1-2 |
| ⓘ 'Glass' Localities: |
| ⓘ Goethite Formula: α-Fe3+O(OH) Localities: Reported from at least 13 localities in this region. |
| ⓘ Gold Formula: Au Localities: |
| ⓘ Gold var. Electrum Formula: (Au,Ag) |
| ⓘ Goudeyite Formula: AlCu6(AsO4)3(OH)6 · 3H2O |
| ⓘ Graphite Formula: C Localities: |
| ⓘ Greifensteinite Formula: Ca2Fe2+5Be4(PO4)6(OH)4 · 6H2O |
| ⓘ Grossular Formula: Ca3Al2(SiO4)3 Habit: Dodecahedron Colour: Brown-red |
| ⓘ Gypsum Formula: CaSO4 · 2H2O Localities: Reported from at least 14 localities in this region. References: |
| ⓘ Gyrolite Formula: NaCa16Si23AlO60(OH)8 · 14H2O |
| ⓘ Halotrichite Formula: FeAl2(SO4)4 · 22H2O |
| ⓘ Hannebachite Formula: CaSO3 · H2O |
| ⓘ Hedenbergite Formula: CaFe2+Si2O6 |
| ⓘ Hejtmanite ? Formula: Ba2Mn2+4Ti2(Si2O7)2O2(OH)2F2 |
| ⓘ Hematite Formula: Fe2O3 Localities: Reported from at least 11 localities in this region. |
| ⓘ Hemimorphite Formula: Zn4Si2O7(OH)2 · H2O Localities: Reported from at least 6 localities in this region. |
| ⓘ Hercynite Formula: Fe2+Al2O4 Description: Hercynite, in small grains, is included in montmorillonite spherules.
Surprisingly, this association closely looks like the clay/magnesioferrite spherules resulting of meteorite impacts. |
| ⓘ Hydrocerussite Formula: Pb3(CO3)2(OH)2 Localities: |
| ⓘ Hydrozincite Formula: Zn5(CO3)2(OH)6 Localities: References: |
| ⓘ 'Hypersthene' Formula: (Mg,Fe)SiO3 Localities: Description: In coronites. |
| ⓘ Idaite Formula: Cu5FeS6 |
| ⓘ 'Iddingsite' Formula: MgO · Fe2O3 · 3SiO2 · 4H2O |
| ⓘ Ilmenite Formula: Fe2+TiO3 |
| ⓘ Iodargyrite Formula: AgI Localities: |
| ⓘ Jarosite Formula: KFe3+3(SO4)2(OH)6 |
| ⓘ Kaersutite Formula: NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| ⓘ Kalinite Formula: KAl(SO4)2 · 11H2O Localities: |
| ⓘ Kalsilite Formula: KAlSiO4 Habit: Grain Colour: ? |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 |
| ⓘ Kapundaite Formula: NaCaFe4(PO4)4(OH)3 · 5H2O |
| ⓘ 'K Feldspar' |
| ⓘ Khesinite Formula: Ca4(Mg3Fe3+9)O4(Fe3+9Si3)O36 |
| ⓘ Kintoreite Formula: PbFe3(PO4)(PO3OH)(OH)6 |
| ⓘ Klockmannite Formula: CuSe |
| ⓘ Kobellite Formula: Pb22Cu4(Bi,Sb)30S69 |
| ⓘ Kottenheimite Formula: Ca 3Si(SO4)2(OH)6 · 12H2O |
| ⓘ 'K-petalite' Formula: KAlSi4O10 |
| ⓘ Ktenasite ? Formula: ZnCu4(SO4)2(OH)6 · 6H2O |
| ⓘ Kushiroite Formula: CaAl[AlSiO6] |
| ⓘ Kutnohorite Formula: CaMn2+(CO3)2 |
| ⓘ Kyanite Formula: Al2(SiO4)O Localities: |
| ⓘ Lanarkite Formula: Pb2(SO4)O |
| ⓘ Langite Formula: Cu4(SO4)(OH)6 · 2H2O Localities: Reported from at least 6 localities in this region. |
| ⓘ Larnite Formula: Ca2SiO4 |
| ⓘ Latiumite ? Formula: (Ca,K)4(Si,Al)5O11(SO4,CO3) |
| ⓘ Laumontite Formula: CaAl2Si4O12 · 4H2O |
| ⓘ Leadhillite Formula: Pb4(CO3)2(SO4)(OH)2 Localities: References: |
| ⓘ Lepidocrocite Formula: γ-Fe3+O(OH) Localities: References: |
| ⓘ Leucite Formula: K(AlSi2O6) Habit: Trapezohedron Colour: Colorless |
| ⓘ Leucophosphite Formula: KFe3+2(PO4)2(OH) · 2H2O |
| ⓘ 'Leucoxene' |
| ⓘ Libethenite Formula: Cu2(PO4)(OH) Localities: |
| ⓘ 'Limonite' Localities: Reported from at least 6 localities in this region. |
| ⓘ Linarite Formula: PbCu(SO4)(OH)2 Localities: Reported from at least 11 localities in this region. |
| ⓘ Linnaeite Formula: Co2+Co3+2S4 |
| ⓘ Lithiophorite Formula: (Al,Li)MnO2(OH)2 |
| ⓘ Luzonite Formula: Cu3AsS4 |
| ⓘ Magnesioferrite Formula: MgFe3+2O4 Habit: Octahedral Colour: Dark brown |
| ⓘ Magnesio-hornblende Formula: ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 Localities: Reported from at least 6 localities in this region. Description: Centimetric octahedral twinnings. |
| ⓘ Magnetite var. Titanium-bearing Magnetite Formula: Fe2+(Fe3+,Ti)2O4 |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 Localities: Reported from at least 23 localities in this region. |
| ⓘ Manganite Formula: Mn3+O(OH) Localities: References: |
| ⓘ Marcasite Formula: FeS2 Localities: Reported from at least 17 localities in this region. References: |
| ⓘ Mattheddleite Formula: Pb5(SiO4)1.5(SO4)1.5(Cl,OH) |
| ⓘ Melanterite Formula: Fe2+(H2O)6SO4 · H2O |
| ⓘ 'Melilite Group' Formula: Ca2M(XSiO7) Habit: Blocky or tabular Colour: Orange to red |
| ⓘ Mesolite Formula: Na2Ca2Si9Al6O30 · 8H2O |
| ⓘ Meta-autunite Formula: Ca(UO2)2(PO4)2 · 6H2O |
| ⓘ Metatorbernite Formula: Cu(UO2)2(PO4)2 · 8H2O Localities: References: |
| ⓘ Metauranocircite Formula: Ba(UO2)2(PO4)2 · 7H2O |
| ⓘ Meurigite-K Formula: KFe3+8(PO4)6(OH)7 · 6.5H2O |
| ⓘ 'Mica Group' |
| ⓘ Millerite Formula: NiS Localities: Description: Bundles of needles up to 3 millimeters long in dolomite. |
| ⓘ Mimetite Formula: Pb5(AsO4)3Cl Localities: Reported from at least 8 localities in this region. |
| ⓘ Minium Formula: Pb3O4 |
| ⓘ Mixite Formula: BiCu6(AsO4)3(OH)6 · 3H2O Localities: |
| ⓘ Molybdenite Formula: MoS2 |
| ⓘ Montmorillonite Formula: (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ Moraesite Formula: Be2(PO4)(OH) · 4H2O |
| ⓘ Mottramite Formula: PbCu(VO4)(OH) Localities: |
| ⓘ Munakataite Formula: Pb2Cu2(Se4+O3)(SO4)(OH)4 Localities: La Vidale, La Vidale vein, Asprières, Villefranche-de-Rouergue, Aveyron, Occitanie, France La Vidale mine, Asprières, Villefranche-de-Rouergue, Aveyron, Occitanie, France Bréziès, Asprières, Villefranche-de-Rouergue, Aveyron, Occitanie, France La Baume, Villefranche-de-Rouergue, Villefranche-de-Rouergue, Aveyron, Occitanie, France La Maladrerie, Villefranche-de-Rouergue, Villefranche-de-Rouergue, Aveyron, Occitanie, France |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: Saint-Geniez, Pays d'Olt, Aveyron, Occitanie, France Puech de Compolibat, Compolibat, Villefranche-de-Rouergue, Aveyron, Occitanie, France La Buscalie, Aubin, Villefranche-de-Rouergue, Aveyron, Occitanie, France Laubarède, La Boriatte, Firmi, Villefranche-de-Rouergue, Aveyron, Occitanie, France Prévinquières Mine, Florentin-la-Capelle, Rodez, Aveyron, Occitanie, France Description: Muscovite 2M with 32.4 % solid solution paragonite. |
| ⓘ Muscovite var. Fuchsite Formula: K(Al,Cr)3Si3O10(OH)2 |
| ⓘ 'Muscovite-1M' |
| ⓘ Natrodufrénite Formula: NaFe2+Fe3+5(PO4)4(OH)6 · 2H2O |
| ⓘ Natrolite Formula: Na2Al2Si3O10 · 2H2O Localities: |
| ⓘ Nepheline Formula: Na3K(Al4Si4O16) Localities: References: |
| ⓘ Nickeline Formula: NiAs |
| ⓘ Nontronite Formula: Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O Localities: |
| ⓘ Offretite Formula: KCaMg(Si13Al5)O36 · 15H2O Localities: References: |
| ⓘ Oldhamite Formula: (Ca,Mg)S Habit: Grain Colour: Pale grey |
| ⓘ Olivenite Formula: Cu2(AsO4)(OH) Localities: |
| ⓘ Opal Formula: SiO2 · nH2O |
| ⓘ Orpiment Formula: As2S3 |
| ⓘ Orschallite Formula: Ca3(SO3)2(SO4) · 12H2O Habit: poorly crystallized Colour: White to dirty yellow |
| ⓘ 'Orthopyroxene Subgroup' |
| ⓘ Oxyplumboroméite Formula: Pb2Sb2O6O |
| ⓘ Pararammelsbergite Formula: NiAs2 Localities: |
| ⓘ Pargasite Formula: NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| ⓘ Parnauite Formula: Cu9(AsO4)2(SO4)(OH)10 · 7H2O Localities: |
| ⓘ Pearceite Formula: [Ag6As2S7][Ag9CuS4] Localities: |
| ⓘ Perovskite Formula: CaTiO3 Habit: Octahedral Colour: Orange |
| ✪ Petewilliamsite Formula: (Ni,Co)30(As2O7)15 Locality: La Maladrerie, Villefranche-de-Rouergue, Villefranche-de-Rouergue, Aveyron, Occitanie, France Colour: pink |
| ⓘ 'Petroleum var. Bitumen' Localities: |
| ⓘ Pharmacosiderite Formula: KFe3+4(AsO4)3(OH)4 · 6-7H2O Localities: Castailhac, Golinhac, Rodez, Aveyron, Occitanie, France La Fage, Monteils, Villefranche-de-Rouergue, Aveyron, Occitanie, France Le Kaymar, Pruines, Rodez, Aveyron, Occitanie, France Le Bastit, Najac, Villefranche-de-Rouergue, Aveyron, Occitanie, France Falgayrolles, Monteils, Villefranche-de-Rouergue, Aveyron, Occitanie, France ? (more information) References: |
| ⓘ 'Phillipsite Subgroup' Localities: Puech de Vermus, Espalion, Rodez, Aveyron, Occitanie, France Détroit de Rodez, Rodez, Aveyron, Occitanie, France RD 537 road works, Le Bousquet d'Orlaguet, Sainte-Geneviève-sur-Argence, Argences en Aubrac, Rodez, Aveyron, Occitanie, France Rataboul Quarry, Laguiole, Rodez, Aveyron, Occitanie, France Prades-d'Aubrac, Rodez, Aveyron, Occitanie, France |
| ⓘ Phosgenite ? Formula: Pb2CO3Cl2 |
| ⓘ Phosphuranylite Formula: KCa(H3O)3(UO2)7(PO4)4O4 · 8H2O |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ Pliniusite Formula: Ca5(VO4)3F |
| ⓘ Plumbogummite Formula: PbAl3(PO4)(PO3OH)(OH)6 Localities: |
| ⓘ Polybasite Formula: [Ag6Sb2S7][Ag9CuS4] |
| ⓘ Portlandite Formula: Ca(OH)2 Habit: Lamellar Colour: Grey to pale green |
| ⓘ Posnjakite Formula: Cu4(SO4)(OH)6 · H2O Localities: |
| ⓘ Prehnite ? Formula: Ca2Al2Si3O10(OH)2 |
| ⓘ Pseudobrookite Formula: Fe2TiO5 |
| ⓘ Pseudomalachite Formula: Cu5(PO4)2(OH)4 Localities: Le Bastit, Najac, Villefranche-de-Rouergue, Aveyron, Occitanie, France Puech de Compolibat, Compolibat, Villefranche-de-Rouergue, Aveyron, Occitanie, France Falgayrolles, Monteils, Villefranche-de-Rouergue, Aveyron, Occitanie, France La Fage, Monteils, Villefranche-de-Rouergue, Aveyron, Occitanie, France ? (more information) |
| ⓘ 'Pseudowollastonite' Formula: CaSiO3 |
| ⓘ 'Psilomelane' Localities: |
| ⓘ Pyrargyrite Formula: Ag3SbS3 |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 33 localities in this region. |
| ⓘ Pyrite var. Bravoite Formula: (Fe,Ni)S2 Localities: |
| ⓘ Pyrolusite Formula: Mn4+O2 Localities: References: |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl Localities: Reported from at least 24 localities in this region. References: |
| ⓘ 'Pyroxene Group' Formula: ADSi2O6 |
| ⓘ Pyrrhotite Formula: Fe1-xS Localities: |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 38 localities in this region. |
| ⓘ Quartz var. Chalcedony Formula: SiO2 |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 Localities: |
| ⓘ Rammelsbergite Formula: NiAs2 Localities: |
| ⓘ Ramsbeckite Formula: (Cu,Zn)15(SO4)4(OH)22 · 6H2O |
| ✪ Rankinite Formula: Ca3Si2O7 Colour: Pale yellow |
| ⓘ Raspite Formula: Pb(WO4) |
| ⓘ Realgar Formula: As4S4 |
| ⓘ Rhabdophane-(Ce) Formula: Ce(PO4) · 0.6H2O Localities: |
| ⓘ Rhabdophane-(Ce) var. Lead-bearing Rhabdophane-(Ce) Formula: (Ce,La,Pb)(PO4) · H2O |
| ⓘ Rhodochrosite Formula: MnCO3 |
| ⓘ Rooseveltite Formula: Bi(AsO4) |
| ⓘ Rosasite Formula: (Cu,Zn)2(CO3)(OH)2 Localities: Falgayrolles, Monteils, Villefranche-de-Rouergue, Aveyron, Occitanie, France La Baume, Villefranche-de-Rouergue, Villefranche-de-Rouergue, Aveyron, Occitanie, France Bréziès, Asprières, Villefranche-de-Rouergue, Aveyron, Occitanie, France La Maladrerie, Villefranche-de-Rouergue, Villefranche-de-Rouergue, Aveyron, Occitanie, France |
| ⓘ Rutile Formula: TiO2 Localities: |
| ⓘ Sabugalite Formula: HAl(UO2)4(PO4)4 · 16H2O Localities: |
| ⓘ Salammoniac Formula: NH4Cl Localities: |
| ⓘ Saléeite Formula: Mg(UO2)2(PO4)2 · 10H2O |
| ⓘ Sanidine Formula: K(AlSi3O8) Localities: References: |
| ⓘ Santabarbaraite Formula: Fe3+3(PO4)2(OH)3 · 5H2O |
| ⓘ Scheelite Formula: Ca(WO4) Localities: |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Localities: References: |
| ⓘ Schreibersite Formula: (Fe,Ni)3P |
| ⓘ Schulenbergite Formula: (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| ⓘ Scolecite ? Formula: CaAl2Si3O10 · 3H2O Description: So far, all analyzed "scolecite" have turned to be natrolite. |
| ⓘ Scorodite Formula: Fe3+AsO4 · 2H2O Localities: |
| ⓘ Segnitite Formula: PbFe3+3AsO4(AsO3OH)(OH)6 Localities: |
| ⓘ Semseyite Formula: Pb9Sb8S21 |
| ⓘ Serpierite Formula: Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| ⓘ Siderite Formula: FeCO3 Localities: Reported from at least 9 localities in this region. |
| ⓘ Siderite var. Manganese-bearing Siderite Formula: (Fe,Mn)CO3 Description: 5 % Mn. |
| ⓘ Siegenite Formula: CoNi2S4 |
| ⓘ Silver Formula: Ag Localities: Reported from at least 6 localities in this region. References: |
| ⓘ Skutterudite Formula: CoAs3 Localities: References: |
| ⓘ Slavíkite Formula: (H3O+)3Mg6Fe15(SO4)21(OH)18 · 98H2O Localities: |
| ⓘ Smithsonite Formula: ZnCO3 Localities: Falgayrolles, Monteils, Villefranche-de-Rouergue, Aveyron, Occitanie, France Asprières, Villefranche-de-Rouergue, Aveyron, Occitanie, France La Baume, Villefranche-de-Rouergue, Villefranche-de-Rouergue, Aveyron, Occitanie, France La Vidale mine, Asprières, Villefranche-de-Rouergue, Aveyron, Occitanie, France Bréziès, Asprières, Villefranche-de-Rouergue, Aveyron, Occitanie, France |
| ⓘ Spangolite Formula: Cu6Al(SO4)(OH)12Cl · 3H2O |
| ⓘ Sphalerite Formula: ZnS Localities: Reported from at least 17 localities in this region. |
| ⓘ Spinel Formula: MgAl2O4 Localities: |
| ⓘ Srebrodolskite Formula: Ca2Fe3+2O5 |
| ⓘ Staurolite Formula: Fe2+2Al9Si4O23(OH) |
| ⓘ 'Stibiconite' Formula: Sb3+Sb5+2O6(OH) |
| ⓘ Stibnite Formula: Sb2S3 |
| ⓘ Stolzite Formula: Pb(WO4) Localities: |
| ⓘ Studtite Formula: [(UO2)(O2)(H2O)2] · H2O |
| ⓘ Sulphur Formula: S8 Localities: Reported from at least 7 localities in this region. |
| ⓘ Susannite Formula: Pb4(CO3)2(SO4)(OH)2 |
| ⓘ Syngenite Formula: K2Ca(SO4)2 · H2O Habit: Tabular Colour: Colorless |
| ⓘ Tacharanite Formula: Ca12Al2Si18O33 (OH)36 |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 |
| ⓘ 'Tennantite Subgroup' Formula: Cu6(Cu4C2+2)As4S12S |
| ⓘ 'Tennantite-Tetrahedrite Series' Localities: Reported from at least 6 localities in this region. |
| ⓘ Tenorite Formula: CuO Localities: |
| ✪ Ternesite Formula: Ca5(SiO4)2(SO4) Habit: Flat prisms Colour: Colorless, gray, green |
| ⓘ Tetradymite Formula: Bi2Te2S |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S Localities: Reported from at least 6 localities in this region. References: |
| ⓘ Thaumasite Formula: Ca3(SO4)[Si(OH)6](CO3) · 12H2O Localities: |
| ⓘ Theisite ? Formula: Cu5Zn5(AsO4,SbO4)2(OH)14 |
| ⓘ Thomsonite-Ca Formula: NaCa2[Al5Si5O20] · 6H2O Localities: |
| ⓘ Titanite Formula: CaTi(SiO4)O Localities: |
| ⓘ Tobermorite Formula: Ca4Si6O17(H2O)2 · (Ca · 3H2O) |
| ⓘ Torbernite Formula: Cu(UO2)2(PO4)2 · 12H2O Localities: Reported from at least 9 localities in this region. |
| ⓘ 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z |
| ⓘ Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ Tschermakite Formula: ◻(Ca2)(Mg3Al2)(Al2Si6O22)(OH)2 Localities: Description: Microlites at the contact basanite/quartz and basanite/gneiss. |
| ⓘ Tschermigite Formula: (NH4)Al(SO4)2 · 12H2O |
| ⓘ Tsumcorite Formula: PbZn2(AsO4)2 · 2H2O |
| ⓘ Tuscanite ? Formula: KCa6(Si,Al)10O22(SO4,CO3)2(OH) · H2O |
| ⓘ Tyuyamunite Formula: Ca(UO2)2(VO4)2 · 5-8H2O |
| ⓘ 'UM1995-36-SOSiO:AlHPb' Formula: Pb27(Al1.6Mn0.4)(Si6O15)2(SO4)2O10(OH)24 |
| ⓘ 'UM2005-16-O:CaFe' Formula: CaFe4O7 |
| ⓘ 'Unnamed (Ba-analogue of K-petalite)' Formula: BaAl(Si3Al)O10 |
| ⓘ 'Unnamed (Calcium Sodium Titanium Niobium Oxide)' Formula: (Ca,Na)2(Ti,Nb)O4 |
| ⓘ 'Unnamed (Calcium Sulfate Silicate)' Formula: Ca2(S,Si)2O7 |
| ⓘ 'Unnamed (Fe(II)-Fe(III)-analogue of Shulamitite)' Formula: Fe2+3TiFe3+Fe3+O8 |
| ⓘ 'Unnamed (Fe Sulphide III)' Formula: (Fe,Ni)10S9 |
| ⓘ 'Unnamed (Hydrous Calcium Magnesium Aluminium Silicate)' Formula: Ca5Mg(Al,Fe)Si5(O,OH)17(OH) |
| ⓘ 'Unnamed (Hydrous Calcium Magnesium Aluminium Silicate II)' Formula: Ca3(Mg,K,Fe)(Al,Fe,Ti)4Si4(O,OH)18(OH) (?) |
| ⓘ 'Unnamed (Hydrous Calcium Magnesium Iron Silicate)' Formula: Ca5Mg(Fe,Al)Si5(O,OH)17(OH) |
| ⓘ 'Unnamed (Magnesium Iron Chromium Oxide)' Formula: (Mg,Mn,Zn)2(Fe,Al,Mn)4Cr2O11 |
| ⓘ 'Unnamed (Magnesium Iron Oxide)' Formula: (Mg,Mn,Zn)2(Fe,Al,Mn)4Fe2O11 |
| ⓘ 'Unnamed (Mg-analogue of Grandiferrite)' Formula: MgFe4O7 |
| ⓘ 'Unnamed (Mg-Ti-[]-analogue of Batiferrite)' Formula: (Mg,Mn)Ti2{(Ti,Fe)◻}Fe8O19 |
| ⓘ Uraninite Formula: UO2 Localities: |
| ⓘ Uraninite var. Pitchblende Formula: UO2 |
| ⓘ Uranocircite Formula: Ba(UO2)2(PO4)2 · 10H2O Localities: |
| ⓘ Uranophane Formula: Ca(UO2)2(SiO3OH)2 · 5H2O Localities: Description: Uranotile alpha |
| ⓘ Uvarovite Formula: Ca3Cr2(SiO4)3 Habit: Dodecahedron Colour: Green |
| ⓘ Vanadinite Formula: Pb5(VO4)3Cl Locality: L'Hermie quarry, Port-d'Agrès, Saint-Parthem, Villefranche-de-Rouergue, Aveyron, Occitanie, France Habit: |
| ⓘ Variscite Formula: AlPO4 · 2H2O |
| ⓘ Vaterite Formula: CaCO3 |
| ⓘ Vermiculite Formula: Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| ⓘ Vivianite Formula: Fe2+Fe2+2(PO4)2 · 8H2O Localities: Description: Occurs in burning coal measures. References: |
| ⓘ Wavellite Formula: Al3(PO4)2(OH,F)3 · 5H2O |
| ⓘ 'Wolframite Group' Localities: |
| ⓘ Wollastonite Formula: Ca3(Si3O9) Habit: Laths Colour: Colorless, pale yellow |
| ⓘ Wulfenite Formula: Pb(MoO4) Localities: Reported from at least 12 localities in this region. |
| ⓘ Xenotime-(Y) Formula: Y(PO4) |
| ⓘ Ye'elimite Formula: Ca4Al6(SO4)O12 |
| ✪ Zálesíite Formula: CaCu6(AsO4)2(AsO3OH)(OH)6 · 3H2O Habit: Fiber Colour: Clear green |
| ⓘ Zincolibethenite Formula: CuZn(PO4)(OH) |
| ⓘ Zincolivenite Formula: CuZn(AsO4)(OH) |
| ⓘ Zircon Formula: Zr(SiO4) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Gold | 1.AA.05 | Au |
| ⓘ | var. Electrum | 1.AA.05 | (Au,Ag) |
| ⓘ | Copper | 1.AA.05 | Cu |
| ⓘ | Silver | 1.AA.05 | Ag |
| ⓘ | Schreibersite | 1.BD.05 | (Fe,Ni)3P |
| ⓘ | Bismuth | 1.CA.05 | Bi |
| ⓘ | Graphite | 1.CB.05a | C |
| ⓘ | Sulphur | 1.CC.05 | S8 |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Digenite | 2.BA.10 | Cu9S5 |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Acanthite | 2.BA.35 | Ag2S |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Klockmannite | 2.CA.05b | CuSe |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Idaite | 2.CB.15a | Cu5FeS6 |
| ⓘ | Nickeline | 2.CC.05 | NiAs |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Millerite | 2.CC.20 | NiS |
| ⓘ | Galena var. Silver-bearing Galena | 2.CD.10 | PbS with Ag |
| ⓘ | Oldhamite | 2.CD.10 | (Ca,Mg)S |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Cinnabar | 2.CD.15a | HgS |
| ⓘ | Linnaeite | 2.DA.05 | Co2+Co3+2S4 |
| ⓘ | Siegenite | 2.DA.05 | CoNi2S4 |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Stibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Tetradymite | 2.DC.05 | Bi2Te2S |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | var. Bravoite | 2.EB.05a | (Fe,Ni)S2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Pararammelsbergite | 2.EB.10e | NiAs2 |
| ⓘ | Rammelsbergite | 2.EB.15a | NiAs2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Gersdorffite | 2.EB.25 | NiAsS |
| ⓘ | Cobaltite | 2.EB.25 | CoAsS |
| ⓘ | Skutterudite | 2.EC.05 | CoAs3 |
| ⓘ | Realgar | 2.FA.15a | As4S4 |
| ⓘ | Orpiment | 2.FA.30 | As2S3 |
| ⓘ | Bazhenovite | 2.FD.50 | Ca8S2(S3)(S2O3)(OH)12 · 20H2O |
| ⓘ | Pyrargyrite | 2.GA.05 | Ag3SbS3 |
| ⓘ | Bournonite | 2.GA.50 | PbCuSbS3 |
| ⓘ | 'Freibergite Subgroup' | 2.GB.05 | (Ag6,[Ag6]4+)(Cu4 C2+2)Sb4S12S0-1 |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | 'Tennantite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)As4S12S |
| ⓘ | Pearceite | 2.GB.15 | [Ag6As2S7][Ag9CuS4] |
| ⓘ | Polybasite | 2.GB.15 | [Ag6Sb2S7][Ag9CuS4] |
| ⓘ | Emplectite | 2.HA.05 | CuBiS2 |
| ⓘ | Kobellite | 2.HB.10a | Pb22Cu4(Bi,Sb)30S69 |
| ⓘ | Semseyite | 2.HC.10d | Pb9Sb8S21 |
| ⓘ | Boulangerite | 2.HC.15 | Pb5Sb4S11 |
| ⓘ | Cosalite | 2.JB.10 | Pb2Bi2S5 |
| ⓘ | Freieslebenite | 2.JB.15 | AgPbSbS3 |
| ⓘ | Enargite | 2.KA.05 | Cu3AsS4 |
| ⓘ | Luzonite | 2.KA.10 | Cu3AsS4 |
| Group 3 - Halides | |||
| ⓘ | Iodargyrite | 3.AA.10 | AgI |
| ⓘ | Salammoniac | 3.AA.25 | NH4Cl |
| ⓘ | Fluorite var. Stink-Fluss | 3.AB.25 | CaF2 |
| ⓘ | 3.AB.25 | CaF2 | |
| ⓘ | Fluocerite-(Ce) | 3.AC.15 | CeF3 |
| ⓘ | Connellite | 3.DA.25 | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | α-Fe3+O(OH) |
| ⓘ | Cuprite | 4.AA.10 | Cu2O |
| ⓘ | var. Chalcotrichite | 4.AA.10 | Cu2O |
| ⓘ | Tenorite | 4.AB.10 | CuO |
| ⓘ | Delafossite | 4.AB.15 | CuFeO2 |
| ⓘ | Srebrodolskite | 4.AC.10 | Ca2Fe3+2O5 |
| ⓘ | Spinel | 4.BB.05 | MgAl2O4 |
| ⓘ | Chromite | 4.BB.05 | Fe2+Cr3+2O4 |
| ⓘ | Magnesioferrite | 4.BB.05 | MgFe3+2O4 |
| ⓘ | Hercynite | 4.BB.05 | Fe2+Al2O4 |
| ⓘ | Magnetite var. Titanium-bearing Magnetite | 4.BB.05 | Fe2+(Fe3+,Ti)2O4 |
| ⓘ | 4.BB.05 | Fe2+Fe3+2O4 | |
| ⓘ | Minium | 4.BD.05 | Pb3O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Corundum var. Ruby | 4.CB.05 | Al2O3 |
| ⓘ | 4.CB.05 | Al2O3 | |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Pseudobrookite | 4.CB.15 | Fe2TiO5 |
| ⓘ | Claudetite | 4.CB.45 | As2O3 |
| ⓘ | Bismite | 4.CB.60 | Bi2O3 |
| ⓘ | Perovskite | 4.CC.30 | CaTiO3 |
| ⓘ | Quartz var. Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | Opal | 4.DA.10 | SiO2 · nH2O |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | Ferberite | 4.DB.30 | FeWO4 |
| ⓘ | 'Wolframite Group' | 4.DB.30 va | |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Raspite | 4.DG.20 | Pb(WO4) |
| ⓘ | Oxyplumboroméite | 4.DH. | Pb2Sb2O6O |
| ⓘ | 'Stibiconite' | 4.DH.20 | Sb3+Sb5+2O6(OH) |
| ⓘ | 'Bindheimite' | 4.DH.20 | Pb2Sb2O6O |
| ⓘ | Ferrihollandite | 4.DK. | Ba(Mn4+6Fe3+2)O16 |
| ⓘ | Ferricoronadite | 4.DK.4.DK. | Pb(Mn4+6Fe3+2)O16 |
| ⓘ | Coronadite | 4.DK.05a | Pb(Mn4+6Mn3+2)O16 |
| ⓘ | Cryptomelane | 4.DK.05a | K(Mn4+7Mn3+)O16 |
| ⓘ | Uraninite var. Pitchblende | 4.DL.05 | UO2 |
| ⓘ | 4.DL.05 | UO2 | |
| ⓘ | Manganite | 4.FD.15 | Mn3+O(OH) |
| ⓘ | Portlandite | 4.FE.05 | Ca(OH)2 |
| ⓘ | Gibbsite | 4.FE.10 | Al(OH)3 |
| ⓘ | Lepidocrocite | 4.FE.15 | γ-Fe3+O(OH) |
| ⓘ | Lithiophorite | 4.FE.25 | (Al,Li)MnO2(OH)2 |
| ⓘ | Cesàrolite | 4.FG.10 | Pb(Mn4+)3O6(OH)2 |
| ⓘ | Studtite | 4.GA.15 | [(UO2)(O2)(H2O)2] · H2O |
| ⓘ | Carnotite | 4.HB.05 | K2(UO2)2(VO4)2 · 3H2O |
| ⓘ | Francevillite | 4.HB.15 | Ba(UO2)2(VO4)2 · 5H2O |
| ⓘ | Tyuyamunite | 4.HB.25 | Ca(UO2)2(VO4)2 · 5-8H2O |
| ⓘ | Hannebachite | 4.JE.10 | CaSO3 · H2O |
| ⓘ | Orschallite | 4.JE.15 | Ca3(SO3)2(SO4) · 12H2O |
| ⓘ | Chalcomenite | 4.JH.05 | CuSeO3 · 2H2O |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Siderite var. Manganese-bearing Siderite | 5.AB.05 | (Fe,Mn)CO3 |
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Smithsonite | 5.AB.05 | ZnCO3 |
| ⓘ | Rhodochrosite | 5.AB.05 | MnCO3 |
| ⓘ | Kutnohorite | 5.AB.10 | CaMn2+(CO3)2 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Vaterite | 5.AB.20 | CaCO3 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Rosasite | 5.BA.10 | (Cu,Zn)2(CO3)(OH)2 |
| ⓘ | Hydrozincite | 5.BA.15 | Zn5(CO3)2(OH)6 |
| ⓘ | Aurichalcite | 5.BA.15 | (Zn,Cu)5(CO3)2(OH)6 |
| ⓘ | Hydrocerussite | 5.BE.10 | Pb3(CO3)2(OH)2 |
| ⓘ | Phosgenite ? | 5.BE.20 | Pb2CO3Cl2 |
| ⓘ | Bismutite | 5.BE.25 | (BiO)2CO3 |
| ⓘ | Beyerite | 5.BE.35 | Ca(BiO)2(CO3)2 |
| ⓘ | Brianyoungite ? | 5.BF.30 | Zn3(CO3,SO4)(OH)4 |
| ⓘ | Leadhillite | 5.BF.40 | Pb4(CO3)2(SO4)(OH)2 |
| ⓘ | Susannite | 5.BF.40 | Pb4(CO3)2(SO4)(OH)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anhydrite | 7.AD.30 | CaSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Celestine | 7.AD.35 | SrSO4 |
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Antlerite | 7.BB.15 | Cu3(SO4)(OH)4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Ammoniojarosite | 7.BC.10 | (NH4)Fe3+3(SO4)2(OH)6 |
| ⓘ | Alunite | 7.BC.10 | KAl3(SO4)2(OH)6 |
| ⓘ | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Ye'elimite | 7.BC.15 | Ca4Al6(SO4)O12 |
| ⓘ | Caledonite | 7.BC.50 | Pb5Cu2(SO4)3(CO3)(OH)6 |
| ⓘ | Linarite | 7.BC.65 | PbCu(SO4)(OH)2 |
| ⓘ | Munakataite | 7.BC.65 | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| ⓘ | Chenite | 7.BC.70 | Pb4Cu(SO4)2(OH)6 |
| ⓘ | Lanarkite | 7.BD.40 | Pb2(SO4)O |
| ⓘ | Chalcanthite | 7.CB.20 | CuSO4 · 5H2O |
| ⓘ | Melanterite | 7.CB.35 | Fe2+(H2O)6SO4 · H2O |
| ⓘ | Alunogen | 7.CB.45 | Al2(SO4)3 · 17H2O |
| ⓘ | Halotrichite | 7.CB.85 | FeAl2(SO4)4 · 22H2O |
| ⓘ | Kalinite | 7.CC.15 | KAl(SO4)2 · 11H2O |
| ⓘ | Tschermigite | 7.CC.20 | (NH4)Al(SO4)2 · 12H2O |
| ⓘ | Syngenite | 7.CD.35 | K2Ca(SO4)2 · H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Langite | 7.DD.10 | Cu4(SO4)(OH)6 · 2H2O |
| ⓘ | Posnjakite | 7.DD.10 | Cu4(SO4)(OH)6 · H2O |
| ⓘ | Spangolite | 7.DD.15 | Cu6Al(SO4)(OH)12Cl · 3H2O |
| ⓘ | Ktenasite ? | 7.DD.20 | ZnCu4(SO4)2(OH)6 · 6H2O |
| ⓘ | Serpierite | 7.DD.30 | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| ⓘ | Devilline | 7.DD.30 | CaCu4(SO4)2(OH)6 · 3H2O |
| ⓘ | Ramsbeckite | 7.DD.60 | (Cu,Zn)15(SO4)4(OH)22 · 6H2O |
| ⓘ | Chalcoalumite | 7.DD.75 | CuAl4(SO4)(OH)12 · 3H2O |
| ⓘ | Schulenbergite | 7.DD.80 | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| ⓘ | Cyanotrichite | 7.DE.10 | Cu4Al2(SO4)(OH)12 · 2H2O |
| ⓘ | Slavíkite | 7.DF.30 | (H3O+)3Mg6Fe15(SO4)21(OH)18 · 98H2O |
| ⓘ | Elyite | 7.DF.65 | Pb4Cu(SO4)O2(OH)4 · H2O |
| ⓘ | Thaumasite | 7.DG.15 | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| ⓘ | Ettringite | 7.DG.15 | Ca6Al2(SO4)3(OH)12 · 26H2O |
| ⓘ | Birunite ? | 7.DG.15 | Ca18(SiO3)8.5(CO3)8.5SO4 · 15H2O(?) |
| ⓘ | Kottenheimite | 7.DG.15 | Ca 3Si(SO4)2(OH)6 · 12H2O |
| ⓘ | Stolzite | 7.GA.05 | Pb(WO4) |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Xenotime-(Y) | 8.AD.35 | Y(PO4) |
| ⓘ | Cheralite | 8.AD.50 | CaTh(PO4)2 |
| ⓘ | Rooseveltite | 8.AD.50 | Bi(AsO4) |
| ⓘ | Olivenite | 8.BB.30 | Cu2(AsO4)(OH) |
| ⓘ | Zincolibethenite | 8.BB.30 | CuZn(PO4)(OH) |
| ⓘ | Libethenite | 8.BB.30 | Cu2(PO4)(OH) |
| ⓘ | Adamite ? | 8.BB.30 | Zn2(AsO4)(OH) |
| ⓘ | Zincolivenite | 8.BB.30 | CuZn(AsO4)(OH) |
| ⓘ | Cornwallite | 8.BD.05 | Cu5(AsO4)2(OH)4 |
| ⓘ | Pseudomalachite | 8.BD.05 | Cu5(PO4)2(OH)4 |
| ⓘ | Cornubite ? | 8.BD.30 | Cu5(AsO4)2(OH)4 |
| ⓘ | Theisite ? | 8.BE.75 | Cu5Zn5(AsO4,SbO4)2(OH)14 |
| ⓘ | Carminite | 8.BH.30 | PbFe3+2(AsO4)2(OH)2 |
| ⓘ | Conichalcite | 8.BH.35 | CaCu(AsO4)(OH) |
| ⓘ | Duftite | 8.BH.35 | PbCu(AsO4)(OH) |
| ⓘ | Mottramite | 8.BH.40 | PbCu(VO4)(OH) |
| ⓘ | Descloizite | 8.BH.40 | PbZn(VO4)(OH) |
| ⓘ | Čechite ? | 8.BH.40 | PbFe2+(VO4)(OH) |
| ⓘ | Bayldonite | 8.BH.45 | PbCu3(AsO4)2(OH)2 |
| ⓘ | Corkite | 8.BL.05 | PbFe3(PO4)(SO4)(OH)6 |
| ⓘ | Beudantite | 8.BL.05 | PbFe3(AsO4)(SO4)(OH)6 |
| ⓘ | Segnitite | 8.BL.10 | PbFe3+3AsO4(AsO3OH)(OH)6 |
| ⓘ | Crandallite | 8.BL.10 | CaAl3(PO4)(PO3OH)(OH)6 |
| ⓘ | Plumbogummite | 8.BL.10 | PbAl3(PO4)(PO3OH)(OH)6 |
| ⓘ | Kintoreite | 8.BL.10 | PbFe3(PO4)(PO3OH)(OH)6 |
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| ⓘ | Vanadinite | 8.BN.05 | Pb5(VO4)3Cl |
| ⓘ | Pliniusite | 8.BN.05 | Ca5(VO4)3F |
| ⓘ | Mimetite | 8.BN.05 | Pb5(AsO4)3Cl |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Atelestite | 8.BO.15 | Bi2(AsO4)O(OH) |
| ⓘ | Scorodite | 8.CD.10 | Fe3+AsO4 · 2H2O |
| ⓘ | Variscite | 8.CD.10 | AlPO4 · 2H2O |
| ⓘ | Annabergite | 8.CE.40 | Ni3(AsO4)2 · 8H2O |
| ⓘ | Vivianite | 8.CE.40 | Fe2+Fe2+2(PO4)2 · 8H2O |
| ⓘ | Santabarbaraite | 8.CE.80 | Fe3+3(PO4)2(OH)3 · 5H2O |
| ⓘ | Tsumcorite | 8.CG.15 | PbZn2(AsO4)2 · 2H2O |
| ⓘ | Gartrellite | 8.CG.20 | PbCuFe3+(AsO4)2(OH) · H2O |
| ⓘ | Rhabdophane-(Ce) var. Lead-bearing Rhabdophane-(Ce) | 8.CJ.45 | (Ce,La,Pb)(PO4) · H2O |
| ⓘ | 8.CJ.45 | Ce(PO4) · 0.6H2O | |
| ⓘ | Churchite-(Y) | 8.CJ.50 | Y(PO4) · 2H2O |
| ⓘ | Moraesite | 8.DA.05 | Be2(PO4)(OH) · 4H2O |
| ⓘ | Greifensteinite | 8.DA.10 | Ca2Fe2+5Be4(PO4)6(OH)4 · 6H2O |
| ⓘ | Arthurite ? | 8.DC.15 | CuFe3+2(AsO4)2(OH)2 · 4H2O |
| ⓘ | Cacoxenite | 8.DC.40 | Fe3+24AlO6(PO4)17(OH)12 · 75H2O |
| ⓘ | Wavellite | 8.DC.50 | Al3(PO4)2(OH,F)3 · 5H2O |
| ⓘ | Chenevixite | 8.DD.05 | Cu2Fe3+2(AsO4)2(OH)4 |
| ⓘ | Chalcophyllite ? | 8.DF.30 | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| ⓘ | Parnauite | 8.DF.35 | Cu9(AsO4)2(SO4)(OH)10 · 7H2O |
| ⓘ | Leucophosphite | 8.DH.10 | KFe3+2(PO4)2(OH) · 2H2O |
| ⓘ | Arseniosiderite | 8.DH.30 | Ca2Fe3+3(AsO4)3O2 · 3H2O |
| ⓘ | Kapundaite | 8.DH.80 | NaCaFe4(PO4)4(OH)3 · 5H2O |
| ⓘ | Meurigite-K | 8.DJ.20 | KFe3+8(PO4)6(OH)7 · 6.5H2O |
| ⓘ | Pharmacosiderite | 8.DK.10 | KFe3+4(AsO4)3(OH)4 · 6-7H2O |
| ⓘ | Bariopharmacosiderite | 8.DK.10 | Ba0.5Fe3+4(AsO4)3(OH)4 · 5H2O |
| ⓘ | Natrodufrénite | 8.DK.15 | NaFe2+Fe3+5(PO4)4(OH)6 · 2H2O |
| ⓘ | Cyrilovite | 8.DL.10 | NaFe3+3(PO4)2(OH)4 · 2H2O |
| ⓘ | Zálesíite | 8.DL.15 | CaCu6(AsO4)2(AsO3OH)(OH)6 · 3H2O |
| ⓘ | Mixite | 8.DL.15 | BiCu6(AsO4)3(OH)6 · 3H2O |
| ⓘ | Agardite-(La) | 8.DL.15 | LaCu6(AsO4)3(OH)6 · 3H2O |
| ⓘ | Agardite-(Ce) | 8.DL.15 | CeCu6(AsO4)3(OH)6 · 3H2O |
| ⓘ | Goudeyite | 8.DL.15 | AlCu6(AsO4)3(OH)6 · 3H2O |
| ⓘ | Agardite-(Y) | 8.DL.15 | YCu6(AsO4)3(OH)6 · 3H2O |
| ⓘ | Autunite | 8.EB.05 | Ca(UO2)2(PO4)2 · 10-12H2O |
| ⓘ | Saléeite | 8.EB.05 | Mg(UO2)2(PO4)2 · 10H2O |
| ⓘ | Uranocircite | 8.EB.05 | Ba(UO2)2(PO4)2 · 10H2O |
| ⓘ | Torbernite | 8.EB.05 | Cu(UO2)2(PO4)2 · 12H2O |
| ⓘ | Meta-autunite | 8.EB.10 | Ca(UO2)2(PO4)2 · 6H2O |
| ⓘ | Metatorbernite | 8.EB.10 | Cu(UO2)2(PO4)2 · 8H2O |
| ⓘ | Metauranocircite | 8.EB.10 | Ba(UO2)2(PO4)2 · 7H2O |
| ⓘ | Sabugalite | 8.EB.55 | HAl(UO2)4(PO4)4 · 16H2O |
| ⓘ | Phosphuranylite | 8.EC.10 | KCa(H3O)3(UO2)7(PO4)4O4 · 8H2O |
| ⓘ | Petewilliamsite | 8.FA.25 | (Ni,Co)30(As2O7)15 |
| Group 9 - Silicates | |||
| ⓘ | Fayalite ? | 9.AC.05 | Fe2+2SiO4 |
| ⓘ | Forsterite | 9.AC.05 | Mg2SiO4 |
| ⓘ | Larnite | 9.AD.05 | Ca2SiO4 |
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Uvarovite | 9.AD.25 | Ca3Cr2(SiO4)3 |
| ⓘ | Grossular | 9.AD.25 | Ca3Al2(SiO4)3 |
| ⓘ | Andradite | 9.AD.25 | Ca3Fe3+2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Coffinite | 9.AD.30 | U(SiO4) · nH2O |
| ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | Kyanite | 9.AF.15 | Al2(SiO4)O |
| ⓘ | Staurolite | 9.AF.30 | Fe2+2Al9Si4O23(OH) |
| ⓘ | Chloritoid | 9.AF.85 | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
| ⓘ | Ternesite | 9.AH.20 | Ca5(SiO4)2(SO4) |
| ⓘ | Fluorellestadite | 9.AH.25 | Ca5(SiO4)1.5(SO4)1.5F |
| ⓘ | Mattheddleite | 9.AH.25 | Pb5(SiO4)1.5(SO4)1.5(Cl,OH) |
| ⓘ | Uranophane | 9.AK.15 | Ca(UO2)2(SiO3OH)2 · 5H2O |
| ⓘ | 'Ferri-gehlenite' | 9.BB.10 | Ca2Fe3+[AlSiO7] |
| ⓘ | Åkermanite | 9.BB.10 | Ca2Mg[Si2O7] |
| ⓘ | Alumoåkermanite | 9.BB.10 | (CaNa)Al[Si2O7] |
| ⓘ | Gehlenite | 9.BB.10 | Ca2Al[AlSiO7] |
| ⓘ | Rankinite | 9.BC.15 | Ca3Si2O7 |
| ⓘ | Hemimorphite | 9.BD.10 | Zn4Si2O7(OH)2 · H2O |
| ⓘ | Cuspidine | 9.BE.17 | Ca8(Si2O7)2F4 |
| ⓘ | Hejtmanite ? | 9.BE.55 | Ba2Mn2+4Ti2(Si2O7)2O2(OH)2F2 |
| ⓘ | 'Pseudowollastonite' | 9.CA.20 | CaSiO3 |
| ⓘ | Cordierite | 9.CJ.10 | (Mg,Fe)2Al3(AlSi5O18) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Enstatite var. Bronzite | 9.DA.05 | (Mg,Fe2+)2[SiO3]2 |
| ⓘ | 9.DA.05 | Mg2Si2O6 | |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Augite | 9.DA.15 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ | Hedenbergite | 9.DA.15 | CaFe2+Si2O6 |
| ⓘ | Kushiroite | 9.DA.15 | CaAl[AlSiO6] |
| ⓘ | Esseneite | 9.DA.15 | CaFe3+[AlSiO6] |
| ⓘ | Aegirine | 9.DA.25 | NaFe3+Si2O6 |
| ⓘ | Gedrite | 9.DD.05 | ◻{Mg2}{Mg3Al2}(Al2Si6O22)(OH)2 |
| ⓘ | Anthophyllite | 9.DD.05 | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| ⓘ | Tschermakite | 9.DE.10 | ◻(Ca2)(Mg3Al2)(Al2Si6O22)(OH)2 |
| ⓘ | Magnesio-hornblende | 9.DE.10 | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Pargasite | 9.DE.15 | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| ⓘ | Kaersutite | 9.DE.15 | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| ⓘ | Wollastonite | 9.DG.05 | Ca3(Si3O9) |
| ⓘ | Tobermorite | 9.DG.10 | Ca4Si6O17(H2O)2 · (Ca · 3H2O) |
| ⓘ | Khesinite | 9.DH.40 | Ca4(Mg3Fe3+9)O4(Fe3+9Si3)O36 |
| ⓘ | Prehnite ? | 9.DP.20 | Ca2Al2Si3O10(OH)2 |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | var. Fuchsite | 9.EC.15 | K(Al,Cr)3Si3O10(OH)2 |
| ⓘ | Montmorillonite | 9.EC.40 | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ | Nontronite | 9.EC.40 | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| ⓘ | Vermiculite | 9.EC.50 | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Antigorite | 9.ED.15 | Mg3(Si2O5)(OH)4 |
| ⓘ | Fraipontite ? | 9.ED.15 | (Zn,Al)3((Si,Al)2O5)(OH)4 |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Allophane | 9.ED.20 | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| ⓘ | Gyrolite | 9.EE.30 | NaCa16Si23AlO60(OH)8 · 14H2O |
| ⓘ | Latiumite ? | 9.EG.45 | (Ca,K)4(Si,Al)5O11(SO4,CO3) |
| ⓘ | Tuscanite ? | 9.EG.45 | KCa6(Si,Al)10O22(SO4,CO3)2(OH) · H2O |
| ⓘ | Kalsilite | 9.FA.05 | KAlSiO4 |
| ⓘ | Nepheline | 9.FA.05 | Na3K(Al4Si4O16) |
| ⓘ | Sanidine | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Anorthite var. Labradorite | 9.FA.35 | (Ca,Na)[Al(Al,Si)Si2O8] |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Oligoclase | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ | Anorthite | 9.FA.35 | Ca(Al2Si2O8) |
| ⓘ | Depmeierite | 9.FB.05 | Na8(Al6Si6O24)(PO4,CO3)1-x · 3H2O (x |
| ⓘ | Giuseppettite | 9.FB.05 | (Na,K,Ca)7-8(Al6Si6O24)(SO4,Cl)1-2 |
| ⓘ | Scolecite ? | 9.GA.05 | CaAl2Si3O10 · 3H2O |
| ⓘ | Natrolite | 9.GA.05 | Na2Al2Si3O10 · 2H2O |
| ⓘ | Mesolite | 9.GA.05 | Na2Ca2Si9Al6O30 · 8H2O |
| ⓘ | Thomsonite-Ca | 9.GA.10 | NaCa2[Al5Si5O20] · 6H2O |
| ⓘ | Analcime | 9.GB.05 | Na(AlSi2O6) · H2O |
| ⓘ | Leucite | 9.GB.05 | K(AlSi2O6) |
| ⓘ | Laumontite | 9.GB.10 | CaAl2Si4O12 · 4H2O |
| ⓘ | Chabazite-Ca | 9.GD.10 | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| ⓘ | Offretite | 9.GD.25 | KCaMg(Si13Al5)O36 · 15H2O |
| ⓘ | Faujasite-Na | 9.GD.30 | (Na2,Ca,Mg)3.5[Al7Si17O48] · 32H2O |
| ⓘ | Tacharanite | 9.HA.75 | Ca12Al2Si18O33 (OH)36 |
| Unclassified | |||
| ⓘ | 'Unnamed (Fe(II)-Fe(III)-analogue of Shulamitite)' | - | Fe2+3TiFe3+Fe3+O8 |
| ⓘ | 'Unnamed (Magnesium Iron Chromium Oxide)' | - | (Mg,Mn,Zn)2(Fe,Al,Mn)4Cr2O11 |
| ⓘ | 'Muscovite-1M' | - | |
| ⓘ | 'UM2005-16-O:CaFe' | - | CaFe4O7 |
| ⓘ | 'Unnamed (Calcium Sulfate Silicate)' | - | Ca2(S,Si)2O7 |
| ⓘ | 'Unnamed (Magnesium Iron Oxide)' | - | (Mg,Mn,Zn)2(Fe,Al,Mn)4Fe2O11 |
| ⓘ | 'Unnamed (Mg-analogue of Grandiferrite)' | - | MgFe4O7 |
| ⓘ | 'Beudantite-Segnitite Series' | - | |
| ⓘ | 'Unnamed (Fe Sulphide III)' | - | (Fe,Ni)10S9 |
| ⓘ | 'Unnamed (Mg-Ti-[]-analogue of Batiferrite)' | - | (Mg,Mn)Ti2{(Ti,Fe)◻}Fe8O19 |
| ⓘ | 'Agardite' | - | |
| ⓘ | 'Unnamed (Ba-analogue of K-petalite)' | - | BaAl(Si3Al)O10 |
| ⓘ | 'Unnamed (Calcium Sodium Titanium Niobium Oxide)' | - | (Ca,Na)2(Ti,Nb)O4 |
| ⓘ | 'UM1995-36-SOSiO:AlHPb' | - | Pb27(Al1.6Mn0.4)(Si6O15)2(SO4)2O10(OH)24 |
| ⓘ | 'Unnamed (Hydrous Calcium Magnesium Iron Silicate)' | - | Ca5Mg(Fe,Al)Si5(O,OH)17(OH) |
| ⓘ | 'Unnamed (Hydrous Calcium Magnesium Aluminium Silicate)' | - | Ca5Mg(Al,Fe)Si5(O,OH)17(OH) |
| ⓘ | 'K-petalite' | - | KAlSi4O10 |
| ⓘ | 'Unnamed (Hydrous Calcium Magnesium Aluminium Silicate II)' | - | Ca3(Mg,K,Fe)(Al,Fe,Ti)4Si4(O,OH)18(OH) (?) |
| ⓘ | 'Petroleum var. Bitumen' | - | |
| ⓘ | 'Melilite Group' | - | Ca2M(XSiO7) |
| ⓘ | 'Psilomelane' | - | |
| ⓘ | 'Andorite' | - | AgPbSb3S6 |
| ⓘ | 'Apophyllite Group' | - | AB4[Si8O22]X · 8H2O |
| ⓘ | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Amphibole Supergroup' | - | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Alum Group' | - | XAl(SO4)2 · 12H2O |
| ⓘ | 'Chabazite' | - | |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Leucoxene' | - | |
| ⓘ | 'Mica Group' | - | |
| ⓘ | 'Iddingsite' | - | MgO · Fe2O3 · 3SiO2 · 4H2O |
| ⓘ | 'Clinopyroxene Subgroup' | - | |
| ⓘ | 'Alunite Supergroup' | - | AD3(XO4)2(OH)6 |
| ⓘ | 'Almandine-Pyrope Series' | - | |
| ⓘ | 'Fayalite-Forsterite Series' | - | |
| ⓘ | 'Enstatite-Ferrosilite Series' | - | |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Pyroxene Group' | - | ADSi2O6 |
| ⓘ | 'Gismondine Subgroup' | - | |
| ⓘ | 'Orthopyroxene Subgroup' | - | |
| ⓘ | 'Tennantite-Tetrahedrite Series' | - | |
| ⓘ | 'Chabazite var. Phacolite' | - | |
| ⓘ | 'Phillipsite Subgroup' | - | |
| ⓘ | 'Glass' | - | |
| ⓘ | 'Apatite' ? | - | Ca5(PO4)3(Cl/F/OH) |
| ⓘ | 'Hypersthene' | - | (Mg,Fe)SiO3 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Adamite | Zn2(AsO4)(OH) |
| H | ⓘ Agardite-(Y) | YCu6(AsO4)3(OH)6 · 3H2O |
| H | ⓘ Agardite-(Ce) | CeCu6(AsO4)3(OH)6 · 3H2O |
| H | ⓘ Agardite-(La) | LaCu6(AsO4)3(OH)6 · 3H2O |
| H | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| H | ⓘ Alum Group | XAl(SO4)2 · 12H2O |
| H | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| H | ⓘ Alunogen | Al2(SO4)3 · 17H2O |
| H | ⓘ Ammoniojarosite | (NH4)Fe33+(SO4)2(OH)6 |
| H | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| H | ⓘ Analcime | Na(AlSi2O6) · H2O |
| H | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| H | ⓘ Anthophyllite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| H | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| H | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| H | ⓘ Apophyllite Group | AB4[Si8O22]X · 8H2O |
| H | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| H | ⓘ Arthurite | CuFe23+(AsO4)2(OH)2 · 4H2O |
| H | ⓘ Atelestite | Bi2(AsO4)O(OH) |
| H | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| H | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Bariopharmacosiderite | Ba0.5Fe43+(AsO4)3(OH)4 · 5H2O |
| H | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| H | ⓘ Bazhenovite | Ca8S2(S3)(S2O3)(OH)12 · 20H2O |
| H | ⓘ Beudantite | PbFe3(AsO4)(SO4)(OH)6 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| H | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| H | ⓘ Carminite | PbFe23+(AsO4)2(OH)2 |
| H | ⓘ Carnotite | K2(UO2)2(VO4)2 · 3H2O |
| H | ⓘ Čechite | PbFe2+(VO4)(OH) |
| H | ⓘ Cesàrolite | Pb(Mn4+)3O6(OH)2 |
| H | ⓘ Chalcomenite | CuSeO3 · 2H2O |
| H | ⓘ Chalcanthite | CuSO4 · 5H2O |
| H | ⓘ Chalcoalumite | CuAl4(SO4)(OH)12 · 3H2O |
| H | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| H | ⓘ Chenevixite | Cu2Fe23+(AsO4)2(OH)4 |
| H | ⓘ Chenite | Pb4Cu(SO4)2(OH)6 |
| H | ⓘ Chloritoid | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Churchite-(Y) | Y(PO4) · 2H2O |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Coffinite | U(SiO4) · nH2O |
| H | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| H | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| H | ⓘ Corkite | PbFe3(PO4)(SO4)(OH)6 |
| H | ⓘ Cornubite | Cu5(AsO4)2(OH)4 |
| H | ⓘ Cornwallite | Cu5(AsO4)2(OH)4 |
| H | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| H | ⓘ Cyrilovite | NaFe33+(PO4)2(OH)4 · 2H2O |
| H | ⓘ Descloizite | PbZn(VO4)(OH) |
| H | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| H | ⓘ Duftite | PbCu(AsO4)(OH) |
| H | ⓘ Elyite | Pb4Cu(SO4)O2(OH)4 · H2O |
| H | ⓘ Ettringite | Ca6Al2(SO4)3(OH)12 · 26H2O |
| H | ⓘ Fraipontite | (Zn,Al)3((Si,Al)2O5)(OH)4 |
| H | ⓘ Francevillite | Ba(UO2)2(VO4)2 · 5H2O |
| H | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| H | ⓘ Gartrellite | PbCuFe3+(AsO4)2(OH) · H2O |
| H | ⓘ Gedrite | ◻{Mg2}{Mg3Al2}(Al2Si6O22)(OH)2 |
| H | ⓘ Gibbsite | Al(OH)3 |
| H | ⓘ Goethite | α-Fe3+O(OH) |
| H | ⓘ Goudeyite | AlCu6(AsO4)3(OH)6 · 3H2O |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Gyrolite | NaCa16Si23AlO60(OH)8 · 14H2O |
| H | ⓘ Halotrichite | FeAl2(SO4)4 · 22H2O |
| H | ⓘ Hejtmanite | Ba2Mn42+Ti2(Si2O7)2O2(OH)2F2 |
| H | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| H | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| H | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| H | ⓘ Hannebachite | CaSO3 · H2O |
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| H | ⓘ Kalinite | KAl(SO4)2 · 11H2O |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Kintoreite | PbFe3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Ktenasite | ZnCu4(SO4)2(OH)6 · 6H2O |
| H | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| H | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| H | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| H | ⓘ Lepidocrocite | γ-Fe3+O(OH) |
| H | ⓘ Leucophosphite | KFe23+(PO4)2(OH) · 2H2O |
| H | ⓘ Libethenite | Cu2(PO4)(OH) |
| H | ⓘ Linarite | PbCu(SO4)(OH)2 |
| H | ⓘ Lithiophorite | (Al,Li)MnO2(OH)2 |
| H | ⓘ Manganite | Mn3+O(OH) |
| H | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Mattheddleite | Pb5(SiO4)1.5(SO4)1.5(Cl,OH) |
| H | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
| H | ⓘ Mesolite | Na2Ca2Si9Al6O30 · 8H2O |
| H | ⓘ Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| H | ⓘ Metauranocircite | Ba(UO2)2(PO4)2 · 7H2O |
| H | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| H | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| H | ⓘ Moraesite | Be2(PO4)(OH) · 4H2O |
| H | ⓘ Mottramite | PbCu(VO4)(OH) |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| H | ⓘ Natrodufrénite | NaFe2+Fe53+(PO4)4(OH)6 · 2H2O |
| H | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| H | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| H | ⓘ Offretite | KCaMg(Si13Al5)O36 · 15H2O |
| H | ⓘ Olivenite | Cu2(AsO4)(OH) |
| H | ⓘ Opal | SiO2 · nH2O |
| H | ⓘ Orschallite | Ca3(SO3)2(SO4) · 12H2O |
| H | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| H | ⓘ Parnauite | Cu9(AsO4)2(SO4)(OH)10 · 7H2O |
| H | ⓘ Phosphuranylite | KCa(H3O)3(UO2)7(PO4)4O4 · 8H2O |
| H | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| H | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Portlandite | Ca(OH)2 |
| H | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| H | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| H | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| H | ⓘ Ramsbeckite | (Cu,Zn)15(SO4)4(OH)22 · 6H2O |
| H | ⓘ Rhabdophane-(Ce) | Ce(PO4) · 0.6H2O |
| H | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| H | ⓘ Sabugalite | HAl(UO2)4(PO4)4 · 16H2O |
| H | ⓘ Salammoniac | NH4Cl |
| H | ⓘ Saléeite | Mg(UO2)2(PO4)2 · 10H2O |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| H | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
| H | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| H | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
| H | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| H | ⓘ Slavíkite | (H3O+)3Mg6Fe15(SO4)21(OH)18 · 98H2O |
| H | ⓘ Spangolite | Cu6Al(SO4)(OH)12Cl · 3H2O |
| H | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| H | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| H | ⓘ Studtite | [(UO2)(O2)(H2O)2] · H2O |
| H | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| H | ⓘ Syngenite | K2Ca(SO4)2 · H2O |
| H | ⓘ Tacharanite | Ca12Al2Si18O33 (OH)36 |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| H | ⓘ Theisite | Cu5Zn5(AsO4,SbO4)2(OH)14 |
| H | ⓘ Thomsonite-Ca | NaCa2[Al5Si5O20] · 6H2O |
| H | ⓘ Tobermorite | Ca4Si6O17(H2O)2 · (Ca · 3H2O) |
| H | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Tschermakite | ◻(Ca2)(Mg3Al2)(Al2Si6O22)(OH)2 |
| H | ⓘ Tschermigite | (NH4)Al(SO4)2 · 12H2O |
| H | ⓘ Tsumcorite | PbZn2(AsO4)2 · 2H2O |
| H | ⓘ Tuscanite | KCa6(Si,Al)10O22(SO4,CO3)2(OH) · H2O |
| H | ⓘ Tyuyamunite | Ca(UO2)2(VO4)2 · 5-8H2O |
| H | ⓘ Uranocircite | Ba(UO2)2(PO4)2 · 10H2O |
| H | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| H | ⓘ Variscite | AlPO4 · 2H2O |
| H | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| H | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| H | ⓘ Wavellite | Al3(PO4)2(OH,F)3 · 5H2O |
| H | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| H | ⓘ Faujasite-Na | (Na2,Ca,Mg)3.5[Al7Si17O48] · 32H2O |
| H | ⓘ Iddingsite | MgO · Fe2O3 · 3SiO2 · 4H2O |
| H | ⓘ Zálesíite | CaCu6(AsO4)2(AsO3OH)(OH)6 · 3H2O |
| H | ⓘ Meurigite-K | KFe83+(PO4)6(OH)7 · 6.5H2O |
| H | ⓘ Rhabdophane-(Ce) var. Lead-bearing Rhabdophane-(Ce) | (Ce,La,Pb)(PO4) · H2O |
| H | ⓘ Greifensteinite | Ca2Fe52+Be4(PO4)6(OH)4 · 6H2O |
| H | ⓘ Santabarbaraite | Fe33+(PO4)2(OH)3 · 5H2O |
| H | ⓘ Zincolibethenite | CuZn(PO4)(OH) |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| H | ⓘ Alunite Supergroup | AD3(XO4)2(OH)6 |
| H | ⓘ Zincolivenite | CuZn(AsO4)(OH) |
| H | ⓘ Munakataite | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| H | ⓘ Kapundaite | NaCaFe4(PO4)4(OH)3 · 5H2O |
| H | ⓘ Depmeierite | Na8(Al6Si6O24)(PO4,CO3)1-x · 3H2O (x |
| H | ⓘ Birunite | Ca18(SiO3)8.5(CO3)8.5SO4 · 15H2O(?) |
| H | ⓘ Kottenheimite | Ca 3Si(SO4)2(OH)6 · 12H2O |
| H | ⓘ UM1995-36-SOSiO:AlHPb | Pb27(Al1.6Mn0.4)(Si6O15)2(SO4)2O10(OH)24 |
| H | ⓘ Unnamed (Hydrous Calcium Magnesium Aluminium Silicate) | Ca5Mg(Al,Fe)Si5(O,OH)17(OH) |
| H | ⓘ Unnamed (Hydrous Calcium Magnesium Iron Silicate) | Ca5Mg(Fe,Al)Si5(O,OH)17(OH) |
| H | ⓘ Unnamed (Hydrous Calcium Magnesium Aluminium Silicate II) | Ca3(Mg,K,Fe)(Al,Fe,Ti)4Si4(O,OH)18(OH) (?) |
| Li | Lithium | |
| Li | ⓘ Lithiophorite | (Al,Li)MnO2(OH)2 |
| Be | Beryllium | |
| Be | ⓘ Moraesite | Be2(PO4)(OH) · 4H2O |
| Be | ⓘ Greifensteinite | Ca2Fe52+Be4(PO4)6(OH)4 · 6H2O |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Beyerite | Ca(BiO)2(CO3)2 |
| C | ⓘ Bismutite | (BiO)2CO3 |
| C | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Graphite | C |
| C | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| C | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| C | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| C | ⓘ Latiumite | (Ca,K)4(Si,Al)5O11(SO4,CO3) |
| C | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Phosgenite | Pb2CO3Cl2 |
| C | ⓘ Rhodochrosite | MnCO3 |
| C | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Smithsonite | ZnCO3 |
| C | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| C | ⓘ Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| C | ⓘ Tuscanite | KCa6(Si,Al)10O22(SO4,CO3)2(OH) · H2O |
| C | ⓘ Vaterite | CaCO3 |
| C | ⓘ Siderite var. Manganese-bearing Siderite | (Fe,Mn)CO3 |
| C | ⓘ Depmeierite | Na8(Al6Si6O24)(PO4,CO3)1-x · 3H2O (x |
| C | ⓘ Birunite | Ca18(SiO3)8.5(CO3)8.5SO4 · 15H2O(?) |
| N | Nitrogen | |
| N | ⓘ Ammoniojarosite | (NH4)Fe33+(SO4)2(OH)6 |
| N | ⓘ Salammoniac | NH4Cl |
| N | ⓘ Tschermigite | (NH4)Al(SO4)2 · 12H2O |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ Adamite | Zn2(AsO4)(OH) |
| O | ⓘ Aegirine | NaFe3+Si2O6 |
| O | ⓘ Agardite-(Y) | YCu6(AsO4)3(OH)6 · 3H2O |
| O | ⓘ Agardite-(Ce) | CeCu6(AsO4)3(OH)6 · 3H2O |
| O | ⓘ Agardite-(La) | LaCu6(AsO4)3(OH)6 · 3H2O |
| O | ⓘ Åkermanite | Ca2Mg[Si2O7] |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| O | ⓘ Alum Group | XAl(SO4)2 · 12H2O |
| O | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| O | ⓘ Alunogen | Al2(SO4)3 · 17H2O |
| O | ⓘ Ammoniojarosite | (NH4)Fe33+(SO4)2(OH)6 |
| O | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| O | ⓘ Analcime | Na(AlSi2O6) · H2O |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Andalusite | Al2(SiO4)O |
| O | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Anhydrite | CaSO4 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| O | ⓘ Anorthite | Ca(Al2Si2O8) |
| O | ⓘ Anthophyllite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| O | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| O | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| O | ⓘ Apophyllite Group | AB4[Si8O22]X · 8H2O |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| O | ⓘ Arthurite | CuFe23+(AsO4)2(OH)2 · 4H2O |
| O | ⓘ Atelestite | Bi2(AsO4)O(OH) |
| O | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| O | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| O | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Bariopharmacosiderite | Ba0.5Fe43+(AsO4)3(OH)4 · 5H2O |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| O | ⓘ Bazhenovite | Ca8S2(S3)(S2O3)(OH)12 · 20H2O |
| O | ⓘ Beudantite | PbFe3(AsO4)(SO4)(OH)6 |
| O | ⓘ Beyerite | Ca(BiO)2(CO3)2 |
| O | ⓘ Bindheimite | Pb2Sb2O6O |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Bismite | Bi2O3 |
| O | ⓘ Bismutite | (BiO)2CO3 |
| O | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| O | ⓘ Carminite | PbFe23+(AsO4)2(OH)2 |
| O | ⓘ Carnotite | K2(UO2)2(VO4)2 · 3H2O |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Čechite | PbFe2+(VO4)(OH) |
| O | ⓘ Celestine | SrSO4 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Cesàrolite | Pb(Mn4+)3O6(OH)2 |
| O | ⓘ Chalcomenite | CuSeO3 · 2H2O |
| O | ⓘ Chalcanthite | CuSO4 · 5H2O |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Chalcoalumite | CuAl4(SO4)(OH)12 · 3H2O |
| O | ⓘ Cuprite var. Chalcotrichite | Cu2O |
| O | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| O | ⓘ Chenevixite | Cu2Fe23+(AsO4)2(OH)4 |
| O | ⓘ Chenite | Pb4Cu(SO4)2(OH)6 |
| O | ⓘ Chloritoid | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| O | ⓘ Chromite | Fe2+Cr23+O4 |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Churchite-(Y) | Y(PO4) · 2H2O |
| O | ⓘ Claudetite | As2O3 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Coffinite | U(SiO4) · nH2O |
| O | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| O | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| O | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| O | ⓘ Corkite | PbFe3(PO4)(SO4)(OH)6 |
| O | ⓘ Cornubite | Cu5(AsO4)2(OH)4 |
| O | ⓘ Cornwallite | Cu5(AsO4)2(OH)4 |
| O | ⓘ Coronadite | Pb(Mn64+Mn23+)O16 |
| O | ⓘ Corundum | Al2O3 |
| O | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Cuspidine | Ca8(Si2O7)2F4 |
| O | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| O | ⓘ Cyrilovite | NaFe33+(PO4)2(OH)4 · 2H2O |
| O | ⓘ Delafossite | CuFeO2 |
| O | ⓘ Descloizite | PbZn(VO4)(OH) |
| O | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Duftite | PbCu(AsO4)(OH) |
| O | ⓘ Elyite | Pb4Cu(SO4)O2(OH)4 · H2O |
| O | ⓘ Enstatite | Mg2Si2O6 |
| O | ⓘ Esseneite | CaFe3+[AlSiO6] |
| O | ⓘ Ettringite | Ca6Al2(SO4)3(OH)12 · 26H2O |
| O | ⓘ Fayalite | Fe22+SiO4 |
| O | ⓘ Ferberite | FeWO4 |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Fluorellestadite | Ca5(SiO4)1.5(SO4)1.5F |
| O | ⓘ Forsterite | Mg2SiO4 |
| O | ⓘ Fraipontite | (Zn,Al)3((Si,Al)2O5)(OH)4 |
| O | ⓘ Francevillite | Ba(UO2)2(VO4)2 · 5H2O |
| O | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| O | ⓘ Gartrellite | PbCuFe3+(AsO4)2(OH) · H2O |
| O | ⓘ Gedrite | ◻{Mg2}{Mg3Al2}(Al2Si6O22)(OH)2 |
| O | ⓘ Gehlenite | Ca2Al[AlSiO7] |
| O | ⓘ Gibbsite | Al(OH)3 |
| O | ⓘ Giuseppettite | (Na,K,Ca)7-8(Al6Si6O24)(SO4,Cl)1-2 |
| O | ⓘ Goethite | α-Fe3+O(OH) |
| O | ⓘ Goudeyite | AlCu6(AsO4)3(OH)6 · 3H2O |
| O | ⓘ Grossular | Ca3Al2(SiO4)3 |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Gyrolite | NaCa16Si23AlO60(OH)8 · 14H2O |
| O | ⓘ Halotrichite | FeAl2(SO4)4 · 22H2O |
| O | ⓘ Hedenbergite | CaFe2+Si2O6 |
| O | ⓘ Hejtmanite | Ba2Mn42+Ti2(Si2O7)2O2(OH)2F2 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| O | ⓘ Hercynite | Fe2+Al2O4 |
| O | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| O | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| O | ⓘ Hypersthene | (Mg,Fe)SiO3 |
| O | ⓘ Hannebachite | CaSO3 · H2O |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| O | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| O | ⓘ Kalinite | KAl(SO4)2 · 11H2O |
| O | ⓘ Kalsilite | KAlSiO4 |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Kintoreite | PbFe3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Ktenasite | ZnCu4(SO4)2(OH)6 · 6H2O |
| O | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| O | ⓘ Kyanite | Al2(SiO4)O |
| O | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| O | ⓘ Lanarkite | Pb2(SO4)O |
| O | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| O | ⓘ Larnite | Ca2SiO4 |
| O | ⓘ Latiumite | (Ca,K)4(Si,Al)5O11(SO4,CO3) |
| O | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| O | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| O | ⓘ Lepidocrocite | γ-Fe3+O(OH) |
| O | ⓘ Leucophosphite | KFe23+(PO4)2(OH) · 2H2O |
| O | ⓘ Libethenite | Cu2(PO4)(OH) |
| O | ⓘ Linarite | PbCu(SO4)(OH)2 |
| O | ⓘ Lithiophorite | (Al,Li)MnO2(OH)2 |
| O | ⓘ Leucite | K(AlSi2O6) |
| O | ⓘ Magnesioferrite | MgFe23+O4 |
| O | ⓘ Manganite | Mn3+O(OH) |
| O | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Mattheddleite | Pb5(SiO4)1.5(SO4)1.5(Cl,OH) |
| O | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
| O | ⓘ Mesolite | Na2Ca2Si9Al6O30 · 8H2O |
| O | ⓘ Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| O | ⓘ Metauranocircite | Ba(UO2)2(PO4)2 · 7H2O |
| O | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| O | ⓘ Mimetite | Pb5(AsO4)3Cl |
| O | ⓘ Minium | Pb3O4 |
| O | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| O | ⓘ Moraesite | Be2(PO4)(OH) · 4H2O |
| O | ⓘ Mottramite | PbCu(VO4)(OH) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| O | ⓘ Natrodufrénite | NaFe2+Fe53+(PO4)4(OH)6 · 2H2O |
| O | ⓘ Nepheline | Na3K(Al4Si4O16) |
| O | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| O | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| O | ⓘ Offretite | KCaMg(Si13Al5)O36 · 15H2O |
| O | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Olivenite | Cu2(AsO4)(OH) |
| O | ⓘ Opal | SiO2 · nH2O |
| O | ⓘ Orschallite | Ca3(SO3)2(SO4) · 12H2O |
| O | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| O | ⓘ Parnauite | Cu9(AsO4)2(SO4)(OH)10 · 7H2O |
| O | ⓘ Perovskite | CaTiO3 |
| O | ⓘ Phosphuranylite | KCa(H3O)3(UO2)7(PO4)4O4 · 8H2O |
| O | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| O | ⓘ Phosgenite | Pb2CO3Cl2 |
| O | ⓘ Uraninite var. Pitchblende | UO2 |
| O | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Portlandite | Ca(OH)2 |
| O | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| O | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| O | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| O | ⓘ Pseudobrookite | Fe2TiO5 |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Ramsbeckite | (Cu,Zn)15(SO4)4(OH)22 · 6H2O |
| O | ⓘ Rankinite | Ca3Si2O7 |
| O | ⓘ Raspite | Pb(WO4) |
| O | ⓘ Rhabdophane-(Ce) | Ce(PO4) · 0.6H2O |
| O | ⓘ Rhodochrosite | MnCO3 |
| O | ⓘ Rooseveltite | Bi(AsO4) |
| O | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| O | ⓘ Corundum var. Ruby | Al2O3 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Sabugalite | HAl(UO2)4(PO4)4 · 16H2O |
| O | ⓘ Saléeite | Mg(UO2)2(PO4)2 · 10H2O |
| O | ⓘ Sanidine | K(AlSi3O8) |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| O | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
| O | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| O | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
| O | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Slavíkite | (H3O+)3Mg6Fe15(SO4)21(OH)18 · 98H2O |
| O | ⓘ Smithsonite | ZnCO3 |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Spangolite | Cu6Al(SO4)(OH)12Cl · 3H2O |
| O | ⓘ Spinel | MgAl2O4 |
| O | ⓘ Srebrodolskite | Ca2Fe23+O5 |
| O | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| O | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| O | ⓘ Stolzite | Pb(WO4) |
| O | ⓘ Studtite | [(UO2)(O2)(H2O)2] · H2O |
| O | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| O | ⓘ Syngenite | K2Ca(SO4)2 · H2O |
| O | ⓘ Tacharanite | Ca12Al2Si18O33 (OH)36 |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Tenorite | CuO |
| O | ⓘ Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| O | ⓘ Theisite | Cu5Zn5(AsO4,SbO4)2(OH)14 |
| O | ⓘ Thomsonite-Ca | NaCa2[Al5Si5O20] · 6H2O |
| O | ⓘ Titanite | CaTi(SiO4)O |
| O | ⓘ Magnetite var. Titanium-bearing Magnetite | Fe2+(Fe3+,Ti)2O4 |
| O | ⓘ Tobermorite | Ca4Si6O17(H2O)2 · (Ca · 3H2O) |
| O | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| O | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Tschermakite | ◻(Ca2)(Mg3Al2)(Al2Si6O22)(OH)2 |
| O | ⓘ Tschermigite | (NH4)Al(SO4)2 · 12H2O |
| O | ⓘ Tsumcorite | PbZn2(AsO4)2 · 2H2O |
| O | ⓘ Tuscanite | KCa6(Si,Al)10O22(SO4,CO3)2(OH) · H2O |
| O | ⓘ Tyuyamunite | Ca(UO2)2(VO4)2 · 5-8H2O |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Uranocircite | Ba(UO2)2(PO4)2 · 10H2O |
| O | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| O | ⓘ Uvarovite | Ca3Cr2(SiO4)3 |
| O | ⓘ Vanadinite | Pb5(VO4)3Cl |
| O | ⓘ Variscite | AlPO4 · 2H2O |
| O | ⓘ Vaterite | CaCO3 |
| O | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| O | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| O | ⓘ Wavellite | Al3(PO4)2(OH,F)3 · 5H2O |
| O | ⓘ Wulfenite | Pb(MoO4) |
| O | ⓘ Wollastonite | Ca3(Si3O9) |
| O | ⓘ Xenotime-(Y) | Y(PO4) |
| O | ⓘ Ye'elimite | Ca4Al6(SO4)O12 |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Enstatite var. Bronzite | (Mg,Fe2+)2[SiO3]2 |
| O | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| O | ⓘ Cheralite | CaTh(PO4)2 |
| O | ⓘ Faujasite-Na | (Na2,Ca,Mg)3.5[Al7Si17O48] · 32H2O |
| O | ⓘ Iddingsite | MgO · Fe2O3 · 3SiO2 · 4H2O |
| O | ⓘ Zálesíite | CaCu6(AsO4)2(AsO3OH)(OH)6 · 3H2O |
| O | ⓘ Meurigite-K | KFe83+(PO4)6(OH)7 · 6.5H2O |
| O | ⓘ Ternesite | Ca5(SiO4)2(SO4) |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Pseudowollastonite | CaSiO3 |
| O | ⓘ Pyroxene Group | ADSi2O6 |
| O | ⓘ Siderite var. Manganese-bearing Siderite | (Fe,Mn)CO3 |
| O | ⓘ Rhabdophane-(Ce) var. Lead-bearing Rhabdophane-(Ce) | (Ce,La,Pb)(PO4) · H2O |
| O | ⓘ Greifensteinite | Ca2Fe52+Be4(PO4)6(OH)4 · 6H2O |
| O | ⓘ Santabarbaraite | Fe33+(PO4)2(OH)3 · 5H2O |
| O | ⓘ Ferri-gehlenite | Ca2Fe3+[AlSiO7] |
| O | ⓘ Zincolibethenite | CuZn(PO4)(OH) |
| O | ⓘ Petewilliamsite | (Ni,Co)30(As2O7)15 |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| O | ⓘ Alunite Supergroup | AD3(XO4)2(OH)6 |
| O | ⓘ Melilite Group | Ca2M(XSiO7) |
| O | ⓘ Zincolivenite | CuZn(AsO4)(OH) |
| O | ⓘ Munakataite | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| O | ⓘ UM2005-16-O:CaFe | CaFe4O7 |
| O | ⓘ Alumoåkermanite | (CaNa)Al[Si2O7] |
| O | ⓘ Kushiroite | CaAl[AlSiO6] |
| O | ⓘ Kapundaite | NaCaFe4(PO4)4(OH)3 · 5H2O |
| O | ⓘ Depmeierite | Na8(Al6Si6O24)(PO4,CO3)1-x · 3H2O (x |
| O | ⓘ Birunite | Ca18(SiO3)8.5(CO3)8.5SO4 · 15H2O(?) |
| O | ⓘ Kottenheimite | Ca 3Si(SO4)2(OH)6 · 12H2O |
| O | ⓘ UM1995-36-SOSiO:AlHPb | Pb27(Al1.6Mn0.4)(Si6O15)2(SO4)2O10(OH)24 |
| O | ⓘ Ferrihollandite | Ba(Mn64+Fe23+)O16 |
| O | ⓘ Oxyplumboroméite | Pb2Sb2O6O |
| O | ⓘ Khesinite | Ca4(Mg3Fe93+)O4(Fe93+Si3)O36 |
| O | ⓘ Ferricoronadite | Pb(Mn64+Fe23+)O16 |
| O | ⓘ K-petalite | KAlSi4O10 |
| O | ⓘ Unnamed (Mg-analogue of Grandiferrite) | MgFe4O7 |
| O | ⓘ Unnamed (Hydrous Calcium Magnesium Aluminium Silicate) | Ca5Mg(Al,Fe)Si5(O,OH)17(OH) |
| O | ⓘ Unnamed (Hydrous Calcium Magnesium Iron Silicate) | Ca5Mg(Fe,Al)Si5(O,OH)17(OH) |
| O | ⓘ Unnamed (Hydrous Calcium Magnesium Aluminium Silicate II) | Ca3(Mg,K,Fe)(Al,Fe,Ti)4Si4(O,OH)18(OH) (?) |
| O | ⓘ Unnamed (Calcium Sodium Titanium Niobium Oxide) | (Ca,Na)2(Ti,Nb)O4 |
| O | ⓘ Unnamed (Ba-analogue of K-petalite) | BaAl(Si3Al)O10 |
| O | ⓘ Unnamed (Mg-Ti-[]-analogue of Batiferrite) | (Mg,Mn)Ti2{(Ti,Fe)◻}Fe8O19 |
| O | ⓘ Unnamed (Magnesium Iron Chromium Oxide) | (Mg,Mn,Zn)2(Fe,Al,Mn)4Cr2O11 |
| O | ⓘ Unnamed (Magnesium Iron Oxide) | (Mg,Mn,Zn)2(Fe,Al,Mn)4Fe2O11 |
| O | ⓘ Unnamed (Fe(II)-Fe(III)-analogue of Shulamitite) | Fe32+TiFe3+Fe3+O8 |
| O | ⓘ Unnamed (Calcium Sulfate Silicate) | Ca2(S,Si)2O7 |
| O | ⓘ Pliniusite | Ca5(VO4)3F |
| F | Fluorine | |
| F | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Cuspidine | Ca8(Si2O7)2F4 |
| F | ⓘ Fluocerite-(Ce) | CeF3 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorellestadite | Ca5(SiO4)1.5(SO4)1.5F |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Hejtmanite | Ba2Mn42+Ti2(Si2O7)2O2(OH)2F2 |
| F | ⓘ Wavellite | Al3(PO4)2(OH,F)3 · 5H2O |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | ⓘ Fluorite var. Stink-Fluss | CaF2 |
| F | ⓘ Pliniusite | Ca5(VO4)3F |
| Na | Sodium | |
| Na | ⓘ Aegirine | NaFe3+Si2O6 |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Analcime | Na(AlSi2O6) · H2O |
| Na | ⓘ Cyrilovite | NaFe33+(PO4)2(OH)4 · 2H2O |
| Na | ⓘ Giuseppettite | (Na,K,Ca)7-8(Al6Si6O24)(SO4,Cl)1-2 |
| Na | ⓘ Gyrolite | NaCa16Si23AlO60(OH)8 · 14H2O |
| Na | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| Na | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Na | ⓘ Mesolite | Na2Ca2Si9Al6O30 · 8H2O |
| Na | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Na | ⓘ Natrodufrénite | NaFe2+Fe53+(PO4)4(OH)6 · 2H2O |
| Na | ⓘ Nepheline | Na3K(Al4Si4O16) |
| Na | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Na | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Na | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Thomsonite-Ca | NaCa2[Al5Si5O20] · 6H2O |
| Na | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Na | ⓘ Faujasite-Na | (Na2,Ca,Mg)3.5[Al7Si17O48] · 32H2O |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Na | ⓘ Alumoåkermanite | (CaNa)Al[Si2O7] |
| Na | ⓘ Kapundaite | NaCaFe4(PO4)4(OH)3 · 5H2O |
| Na | ⓘ Depmeierite | Na8(Al6Si6O24)(PO4,CO3)1-x · 3H2O (x |
| Na | ⓘ Unnamed (Calcium Sodium Titanium Niobium Oxide) | (Ca,Na)2(Ti,Nb)O4 |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Åkermanite | Ca2Mg[Si2O7] |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Anthophyllite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| Mg | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Chloritoid | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Enstatite | Mg2Si2O6 |
| Mg | ⓘ Forsterite | Mg2SiO4 |
| Mg | ⓘ Gedrite | ◻{Mg2}{Mg3Al2}(Al2Si6O22)(OH)2 |
| Mg | ⓘ Hypersthene | (Mg,Fe)SiO3 |
| Mg | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| Mg | ⓘ Magnesioferrite | MgFe23+O4 |
| Mg | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| Mg | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Mg | ⓘ Offretite | KCaMg(Si13Al5)O36 · 15H2O |
| Mg | ⓘ Oldhamite | (Ca,Mg)S |
| Mg | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Mg | ⓘ Saléeite | Mg(UO2)2(PO4)2 · 10H2O |
| Mg | ⓘ Slavíkite | (H3O+)3Mg6Fe15(SO4)21(OH)18 · 98H2O |
| Mg | ⓘ Spinel | MgAl2O4 |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Tschermakite | ◻(Ca2)(Mg3Al2)(Al2Si6O22)(OH)2 |
| Mg | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Mg | ⓘ Enstatite var. Bronzite | (Mg,Fe2+)2[SiO3]2 |
| Mg | ⓘ Faujasite-Na | (Na2,Ca,Mg)3.5[Al7Si17O48] · 32H2O |
| Mg | ⓘ Iddingsite | MgO · Fe2O3 · 3SiO2 · 4H2O |
| Mg | ⓘ Khesinite | Ca4(Mg3Fe93+)O4(Fe93+Si3)O36 |
| Mg | ⓘ Unnamed (Mg-analogue of Grandiferrite) | MgFe4O7 |
| Mg | ⓘ Unnamed (Hydrous Calcium Magnesium Aluminium Silicate) | Ca5Mg(Al,Fe)Si5(O,OH)17(OH) |
| Mg | ⓘ Unnamed (Hydrous Calcium Magnesium Iron Silicate) | Ca5Mg(Fe,Al)Si5(O,OH)17(OH) |
| Mg | ⓘ Unnamed (Hydrous Calcium Magnesium Aluminium Silicate II) | Ca3(Mg,K,Fe)(Al,Fe,Ti)4Si4(O,OH)18(OH) (?) |
| Mg | ⓘ Unnamed (Mg-Ti-[]-analogue of Batiferrite) | (Mg,Mn)Ti2{(Ti,Fe)◻}Fe8O19 |
| Mg | ⓘ Unnamed (Magnesium Iron Chromium Oxide) | (Mg,Mn,Zn)2(Fe,Al,Mn)4Cr2O11 |
| Mg | ⓘ Unnamed (Magnesium Iron Oxide) | (Mg,Mn,Zn)2(Fe,Al,Mn)4Fe2O11 |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| Al | ⓘ Alum Group | XAl(SO4)2 · 12H2O |
| Al | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| Al | ⓘ Alunogen | Al2(SO4)3 · 17H2O |
| Al | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Al | ⓘ Analcime | Na(AlSi2O6) · H2O |
| Al | ⓘ Andalusite | Al2(SiO4)O |
| Al | ⓘ Anorthite | Ca(Al2Si2O8) |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| Al | ⓘ Chalcoalumite | CuAl4(SO4)(OH)12 · 3H2O |
| Al | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| Al | ⓘ Chloritoid | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Al | ⓘ Corundum | Al2O3 |
| Al | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| Al | ⓘ Esseneite | CaFe3+[AlSiO6] |
| Al | ⓘ Ettringite | Ca6Al2(SO4)3(OH)12 · 26H2O |
| Al | ⓘ Fraipontite | (Zn,Al)3((Si,Al)2O5)(OH)4 |
| Al | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Al | ⓘ Gedrite | ◻{Mg2}{Mg3Al2}(Al2Si6O22)(OH)2 |
| Al | ⓘ Gehlenite | Ca2Al[AlSiO7] |
| Al | ⓘ Gibbsite | Al(OH)3 |
| Al | ⓘ Giuseppettite | (Na,K,Ca)7-8(Al6Si6O24)(SO4,Cl)1-2 |
| Al | ⓘ Goudeyite | AlCu6(AsO4)3(OH)6 · 3H2O |
| Al | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Al | ⓘ Gyrolite | NaCa16Si23AlO60(OH)8 · 14H2O |
| Al | ⓘ Halotrichite | FeAl2(SO4)4 · 22H2O |
| Al | ⓘ Hercynite | Fe2+Al2O4 |
| Al | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| Al | ⓘ Kalinite | KAl(SO4)2 · 11H2O |
| Al | ⓘ Kalsilite | KAlSiO4 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Kyanite | Al2(SiO4)O |
| Al | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Al | ⓘ Latiumite | (Ca,K)4(Si,Al)5O11(SO4,CO3) |
| Al | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Al | ⓘ Lithiophorite | (Al,Li)MnO2(OH)2 |
| Al | ⓘ Leucite | K(AlSi2O6) |
| Al | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| Al | ⓘ Mesolite | Na2Ca2Si9Al6O30 · 8H2O |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Al | ⓘ Nepheline | Na3K(Al4Si4O16) |
| Al | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Al | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Al | ⓘ Offretite | KCaMg(Si13Al5)O36 · 15H2O |
| Al | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Al | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Al | ⓘ Corundum var. Ruby | Al2O3 |
| Al | ⓘ Sabugalite | HAl(UO2)4(PO4)4 · 16H2O |
| Al | ⓘ Sanidine | K(AlSi3O8) |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
| Al | ⓘ Spangolite | Cu6Al(SO4)(OH)12Cl · 3H2O |
| Al | ⓘ Spinel | MgAl2O4 |
| Al | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Al | ⓘ Tacharanite | Ca12Al2Si18O33 (OH)36 |
| Al | ⓘ Thomsonite-Ca | NaCa2[Al5Si5O20] · 6H2O |
| Al | ⓘ Tschermakite | ◻(Ca2)(Mg3Al2)(Al2Si6O22)(OH)2 |
| Al | ⓘ Tschermigite | (NH4)Al(SO4)2 · 12H2O |
| Al | ⓘ Tuscanite | KCa6(Si,Al)10O22(SO4,CO3)2(OH) · H2O |
| Al | ⓘ Variscite | AlPO4 · 2H2O |
| Al | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Al | ⓘ Wavellite | Al3(PO4)2(OH,F)3 · 5H2O |
| Al | ⓘ Ye'elimite | Ca4Al6(SO4)O12 |
| Al | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Al | ⓘ Faujasite-Na | (Na2,Ca,Mg)3.5[Al7Si17O48] · 32H2O |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Al | ⓘ Ferri-gehlenite | Ca2Fe3+[AlSiO7] |
| Al | ⓘ Alumoåkermanite | (CaNa)Al[Si2O7] |
| Al | ⓘ Kushiroite | CaAl[AlSiO6] |
| Al | ⓘ Depmeierite | Na8(Al6Si6O24)(PO4,CO3)1-x · 3H2O (x |
| Al | ⓘ UM1995-36-SOSiO:AlHPb | Pb27(Al1.6Mn0.4)(Si6O15)2(SO4)2O10(OH)24 |
| Al | ⓘ K-petalite | KAlSi4O10 |
| Al | ⓘ Unnamed (Hydrous Calcium Magnesium Aluminium Silicate) | Ca5Mg(Al,Fe)Si5(O,OH)17(OH) |
| Al | ⓘ Unnamed (Hydrous Calcium Magnesium Iron Silicate) | Ca5Mg(Fe,Al)Si5(O,OH)17(OH) |
| Al | ⓘ Unnamed (Hydrous Calcium Magnesium Aluminium Silicate II) | Ca3(Mg,K,Fe)(Al,Fe,Ti)4Si4(O,OH)18(OH) (?) |
| Al | ⓘ Unnamed (Ba-analogue of K-petalite) | BaAl(Si3Al)O10 |
| Al | ⓘ Unnamed (Magnesium Iron Chromium Oxide) | (Mg,Mn,Zn)2(Fe,Al,Mn)4Cr2O11 |
| Al | ⓘ Unnamed (Magnesium Iron Oxide) | (Mg,Mn,Zn)2(Fe,Al,Mn)4Fe2O11 |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ Aegirine | NaFe3+Si2O6 |
| Si | ⓘ Åkermanite | Ca2Mg[Si2O7] |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| Si | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Si | ⓘ Analcime | Na(AlSi2O6) · H2O |
| Si | ⓘ Andalusite | Al2(SiO4)O |
| Si | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Si | ⓘ Anorthite | Ca(Al2Si2O8) |
| Si | ⓘ Anthophyllite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| Si | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Apophyllite Group | AB4[Si8O22]X · 8H2O |
| Si | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Chloritoid | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Coffinite | U(SiO4) · nH2O |
| Si | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Si | ⓘ Cuspidine | Ca8(Si2O7)2F4 |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Enstatite | Mg2Si2O6 |
| Si | ⓘ Esseneite | CaFe3+[AlSiO6] |
| Si | ⓘ Fayalite | Fe22+SiO4 |
| Si | ⓘ Fluorellestadite | Ca5(SiO4)1.5(SO4)1.5F |
| Si | ⓘ Forsterite | Mg2SiO4 |
| Si | ⓘ Fraipontite | (Zn,Al)3((Si,Al)2O5)(OH)4 |
| Si | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Si | ⓘ Gedrite | ◻{Mg2}{Mg3Al2}(Al2Si6O22)(OH)2 |
| Si | ⓘ Gehlenite | Ca2Al[AlSiO7] |
| Si | ⓘ Giuseppettite | (Na,K,Ca)7-8(Al6Si6O24)(SO4,Cl)1-2 |
| Si | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Si | ⓘ Gyrolite | NaCa16Si23AlO60(OH)8 · 14H2O |
| Si | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Si | ⓘ Hejtmanite | Ba2Mn42+Ti2(Si2O7)2O2(OH)2F2 |
| Si | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Si | ⓘ Hypersthene | (Mg,Fe)SiO3 |
| Si | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| Si | ⓘ Kalsilite | KAlSiO4 |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Kyanite | Al2(SiO4)O |
| Si | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Si | ⓘ Larnite | Ca2SiO4 |
| Si | ⓘ Latiumite | (Ca,K)4(Si,Al)5O11(SO4,CO3) |
| Si | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Si | ⓘ Leucite | K(AlSi2O6) |
| Si | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| Si | ⓘ Mattheddleite | Pb5(SiO4)1.5(SO4)1.5(Cl,OH) |
| Si | ⓘ Mesolite | Na2Ca2Si9Al6O30 · 8H2O |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Si | ⓘ Nepheline | Na3K(Al4Si4O16) |
| Si | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Si | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Si | ⓘ Offretite | KCaMg(Si13Al5)O36 · 15H2O |
| Si | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Opal | SiO2 · nH2O |
| Si | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Si | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Rankinite | Ca3Si2O7 |
| Si | ⓘ Sanidine | K(AlSi3O8) |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Si | ⓘ Tacharanite | Ca12Al2Si18O33 (OH)36 |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| Si | ⓘ Thomsonite-Ca | NaCa2[Al5Si5O20] · 6H2O |
| Si | ⓘ Titanite | CaTi(SiO4)O |
| Si | ⓘ Tobermorite | Ca4Si6O17(H2O)2 · (Ca · 3H2O) |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Tschermakite | ◻(Ca2)(Mg3Al2)(Al2Si6O22)(OH)2 |
| Si | ⓘ Tuscanite | KCa6(Si,Al)10O22(SO4,CO3)2(OH) · H2O |
| Si | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| Si | ⓘ Uvarovite | Ca3Cr2(SiO4)3 |
| Si | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Si | ⓘ Wollastonite | Ca3(Si3O9) |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Enstatite var. Bronzite | (Mg,Fe2+)2[SiO3]2 |
| Si | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Si | ⓘ Faujasite-Na | (Na2,Ca,Mg)3.5[Al7Si17O48] · 32H2O |
| Si | ⓘ Iddingsite | MgO · Fe2O3 · 3SiO2 · 4H2O |
| Si | ⓘ Ternesite | Ca5(SiO4)2(SO4) |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Pseudowollastonite | CaSiO3 |
| Si | ⓘ Pyroxene Group | ADSi2O6 |
| Si | ⓘ Ferri-gehlenite | Ca2Fe3+[AlSiO7] |
| Si | ⓘ Melilite Group | Ca2M(XSiO7) |
| Si | ⓘ Alumoåkermanite | (CaNa)Al[Si2O7] |
| Si | ⓘ Kushiroite | CaAl[AlSiO6] |
| Si | ⓘ Depmeierite | Na8(Al6Si6O24)(PO4,CO3)1-x · 3H2O (x |
| Si | ⓘ Birunite | Ca18(SiO3)8.5(CO3)8.5SO4 · 15H2O(?) |
| Si | ⓘ Kottenheimite | Ca 3Si(SO4)2(OH)6 · 12H2O |
| Si | ⓘ UM1995-36-SOSiO:AlHPb | Pb27(Al1.6Mn0.4)(Si6O15)2(SO4)2O10(OH)24 |
| Si | ⓘ Khesinite | Ca4(Mg3Fe93+)O4(Fe93+Si3)O36 |
| Si | ⓘ K-petalite | KAlSi4O10 |
| Si | ⓘ Unnamed (Hydrous Calcium Magnesium Aluminium Silicate) | Ca5Mg(Al,Fe)Si5(O,OH)17(OH) |
| Si | ⓘ Unnamed (Hydrous Calcium Magnesium Iron Silicate) | Ca5Mg(Fe,Al)Si5(O,OH)17(OH) |
| Si | ⓘ Unnamed (Hydrous Calcium Magnesium Aluminium Silicate II) | Ca3(Mg,K,Fe)(Al,Fe,Ti)4Si4(O,OH)18(OH) (?) |
| Si | ⓘ Unnamed (Ba-analogue of K-petalite) | BaAl(Si3Al)O10 |
| Si | ⓘ Unnamed (Calcium Sulfate Silicate) | Ca2(S,Si)2O7 |
| P | Phosphorus | |
| P | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| P | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| P | ⓘ Churchite-(Y) | Y(PO4) · 2H2O |
| P | ⓘ Corkite | PbFe3(PO4)(SO4)(OH)6 |
| P | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Cyrilovite | NaFe33+(PO4)2(OH)4 · 2H2O |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Kintoreite | PbFe3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Leucophosphite | KFe23+(PO4)2(OH) · 2H2O |
| P | ⓘ Libethenite | Cu2(PO4)(OH) |
| P | ⓘ Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| P | ⓘ Metauranocircite | Ba(UO2)2(PO4)2 · 7H2O |
| P | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| P | ⓘ Moraesite | Be2(PO4)(OH) · 4H2O |
| P | ⓘ Natrodufrénite | NaFe2+Fe53+(PO4)4(OH)6 · 2H2O |
| P | ⓘ Phosphuranylite | KCa(H3O)3(UO2)7(PO4)4O4 · 8H2O |
| P | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| P | ⓘ Rhabdophane-(Ce) | Ce(PO4) · 0.6H2O |
| P | ⓘ Sabugalite | HAl(UO2)4(PO4)4 · 16H2O |
| P | ⓘ Saléeite | Mg(UO2)2(PO4)2 · 10H2O |
| P | ⓘ Schreibersite | (Fe,Ni)3P |
| P | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| P | ⓘ Uranocircite | Ba(UO2)2(PO4)2 · 10H2O |
| P | ⓘ Variscite | AlPO4 · 2H2O |
| P | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| P | ⓘ Wavellite | Al3(PO4)2(OH,F)3 · 5H2O |
| P | ⓘ Xenotime-(Y) | Y(PO4) |
| P | ⓘ Cheralite | CaTh(PO4)2 |
| P | ⓘ Meurigite-K | KFe83+(PO4)6(OH)7 · 6.5H2O |
| P | ⓘ Rhabdophane-(Ce) var. Lead-bearing Rhabdophane-(Ce) | (Ce,La,Pb)(PO4) · H2O |
| P | ⓘ Greifensteinite | Ca2Fe52+Be4(PO4)6(OH)4 · 6H2O |
| P | ⓘ Santabarbaraite | Fe33+(PO4)2(OH)3 · 5H2O |
| P | ⓘ Zincolibethenite | CuZn(PO4)(OH) |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| P | ⓘ Kapundaite | NaCaFe4(PO4)4(OH)3 · 5H2O |
| P | ⓘ Depmeierite | Na8(Al6Si6O24)(PO4,CO3)1-x · 3H2O (x |
| S | Sulfur | |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Alum Group | XAl(SO4)2 · 12H2O |
| S | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| S | ⓘ Alunogen | Al2(SO4)3 · 17H2O |
| S | ⓘ Ammoniojarosite | (NH4)Fe33+(SO4)2(OH)6 |
| S | ⓘ Andorite | AgPbSb3S6 |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Anhydrite | CaSO4 |
| S | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Bazhenovite | Ca8S2(S3)(S2O3)(OH)12 · 20H2O |
| S | ⓘ Beudantite | PbFe3(AsO4)(SO4)(OH)6 |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Boulangerite | Pb5Sb4S11 |
| S | ⓘ Bournonite | PbCuSbS3 |
| S | ⓘ Pyrite var. Bravoite | (Fe,Ni)S2 |
| S | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| S | ⓘ Celestine | SrSO4 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcanthite | CuSO4 · 5H2O |
| S | ⓘ Chalcoalumite | CuAl4(SO4)(OH)12 · 3H2O |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| S | ⓘ Chenite | Pb4Cu(SO4)2(OH)6 |
| S | ⓘ Cinnabar | HgS |
| S | ⓘ Cobaltite | CoAsS |
| S | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| S | ⓘ Corkite | PbFe3(PO4)(SO4)(OH)6 |
| S | ⓘ Cosalite | Pb2Bi2S5 |
| S | ⓘ Covellite | CuS |
| S | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| S | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| S | ⓘ Digenite | Cu9S5 |
| S | ⓘ Elyite | Pb4Cu(SO4)O2(OH)4 · H2O |
| S | ⓘ Emplectite | CuBiS2 |
| S | ⓘ Enargite | Cu3AsS4 |
| S | ⓘ Ettringite | Ca6Al2(SO4)3(OH)12 · 26H2O |
| S | ⓘ Fluorellestadite | Ca5(SiO4)1.5(SO4)1.5F |
| S | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| S | ⓘ Freieslebenite | AgPbSbS3 |
| S | ⓘ Galena | PbS |
| S | ⓘ Gersdorffite | NiAsS |
| S | ⓘ Giuseppettite | (Na,K,Ca)7-8(Al6Si6O24)(SO4,Cl)1-2 |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Halotrichite | FeAl2(SO4)4 · 22H2O |
| S | ⓘ Hannebachite | CaSO3 · H2O |
| S | ⓘ Idaite | Cu5FeS6 |
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| S | ⓘ Kalinite | KAl(SO4)2 · 11H2O |
| S | ⓘ Kobellite | Pb22Cu4(Bi,Sb)30S69 |
| S | ⓘ Ktenasite | ZnCu4(SO4)2(OH)6 · 6H2O |
| S | ⓘ Lanarkite | Pb2(SO4)O |
| S | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| S | ⓘ Latiumite | (Ca,K)4(Si,Al)5O11(SO4,CO3) |
| S | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| S | ⓘ Linarite | PbCu(SO4)(OH)2 |
| S | ⓘ Linnaeite | Co2+Co23+S4 |
| S | ⓘ Luzonite | Cu3AsS4 |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Mattheddleite | Pb5(SiO4)1.5(SO4)1.5(Cl,OH) |
| S | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
| S | ⓘ Millerite | NiS |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Oldhamite | (Ca,Mg)S |
| S | ⓘ Orpiment | As2S3 |
| S | ⓘ Orschallite | Ca3(SO3)2(SO4) · 12H2O |
| S | ⓘ Parnauite | Cu9(AsO4)2(SO4)(OH)10 · 7H2O |
| S | ⓘ Pearceite | [Ag6As2S7][Ag9CuS4] |
| S | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| S | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| S | ⓘ Pyrargyrite | Ag3SbS3 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Ramsbeckite | (Cu,Zn)15(SO4)4(OH)22 · 6H2O |
| S | ⓘ Realgar | As4S4 |
| S | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| S | ⓘ Semseyite | Pb9Sb8S21 |
| S | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| S | ⓘ Siegenite | CoNi2S4 |
| S | ⓘ Slavíkite | (H3O+)3Mg6Fe15(SO4)21(OH)18 · 98H2O |
| S | ⓘ Spangolite | Cu6Al(SO4)(OH)12Cl · 3H2O |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Sulphur | S8 |
| S | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| S | ⓘ Syngenite | K2Ca(SO4)2 · H2O |
| S | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| S | ⓘ Tetradymite | Bi2Te2S |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| S | ⓘ Tschermigite | (NH4)Al(SO4)2 · 12H2O |
| S | ⓘ Tuscanite | KCa6(Si,Al)10O22(SO4,CO3)2(OH) · H2O |
| S | ⓘ Ye'elimite | Ca4Al6(SO4)O12 |
| S | ⓘ Ternesite | Ca5(SiO4)2(SO4) |
| S | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| S | ⓘ Munakataite | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| S | ⓘ Birunite | Ca18(SiO3)8.5(CO3)8.5SO4 · 15H2O(?) |
| S | ⓘ Kottenheimite | Ca 3Si(SO4)2(OH)6 · 12H2O |
| S | ⓘ UM1995-36-SOSiO:AlHPb | Pb27(Al1.6Mn0.4)(Si6O15)2(SO4)2O10(OH)24 |
| S | ⓘ Unnamed (Fe Sulphide III) | (Fe,Ni)10S9 |
| S | ⓘ Unnamed (Calcium Sulfate Silicate) | Ca2(S,Si)2O7 |
| Cl | Chlorine | |
| Cl | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Cl | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Cl | ⓘ Giuseppettite | (Na,K,Ca)7-8(Al6Si6O24)(SO4,Cl)1-2 |
| Cl | ⓘ Mattheddleite | Pb5(SiO4)1.5(SO4)1.5(Cl,OH) |
| Cl | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Cl | ⓘ Phosgenite | Pb2CO3Cl2 |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Cl | ⓘ Salammoniac | NH4Cl |
| Cl | ⓘ Spangolite | Cu6Al(SO4)(OH)12Cl · 3H2O |
| Cl | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Carnotite | K2(UO2)2(VO4)2 · 3H2O |
| K | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| K | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| K | ⓘ Giuseppettite | (Na,K,Ca)7-8(Al6Si6O24)(SO4,Cl)1-2 |
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| K | ⓘ Kalinite | KAl(SO4)2 · 11H2O |
| K | ⓘ Kalsilite | KAlSiO4 |
| K | ⓘ Latiumite | (Ca,K)4(Si,Al)5O11(SO4,CO3) |
| K | ⓘ Leucophosphite | KFe23+(PO4)2(OH) · 2H2O |
| K | ⓘ Leucite | K(AlSi2O6) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Nepheline | Na3K(Al4Si4O16) |
| K | ⓘ Offretite | KCaMg(Si13Al5)O36 · 15H2O |
| K | ⓘ Phosphuranylite | KCa(H3O)3(UO2)7(PO4)4O4 · 8H2O |
| K | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| K | ⓘ Sanidine | K(AlSi3O8) |
| K | ⓘ Syngenite | K2Ca(SO4)2 · H2O |
| K | ⓘ Tuscanite | KCa6(Si,Al)10O22(SO4,CO3)2(OH) · H2O |
| K | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| K | ⓘ Meurigite-K | KFe83+(PO4)6(OH)7 · 6.5H2O |
| K | ⓘ K-petalite | KAlSi4O10 |
| K | ⓘ Unnamed (Hydrous Calcium Magnesium Aluminium Silicate II) | Ca3(Mg,K,Fe)(Al,Fe,Ti)4Si4(O,OH)18(OH) (?) |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Åkermanite | Ca2Mg[Si2O7] |
| Ca | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Ca | ⓘ Anhydrite | CaSO4 |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Anorthite | Ca(Al2Si2O8) |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| Ca | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Ca | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| Ca | ⓘ Bazhenovite | Ca8S2(S3)(S2O3)(OH)12 · 20H2O |
| Ca | ⓘ Beyerite | Ca(BiO)2(CO3)2 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| Ca | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| Ca | ⓘ Cuspidine | Ca8(Si2O7)2F4 |
| Ca | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Esseneite | CaFe3+[AlSiO6] |
| Ca | ⓘ Ettringite | Ca6Al2(SO4)3(OH)12 · 26H2O |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorellestadite | Ca5(SiO4)1.5(SO4)1.5F |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Gehlenite | Ca2Al[AlSiO7] |
| Ca | ⓘ Giuseppettite | (Na,K,Ca)7-8(Al6Si6O24)(SO4,Cl)1-2 |
| Ca | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Gyrolite | NaCa16Si23AlO60(OH)8 · 14H2O |
| Ca | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Ca | ⓘ Hannebachite | CaSO3 · H2O |
| Ca | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| Ca | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| Ca | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Ca | ⓘ Larnite | Ca2SiO4 |
| Ca | ⓘ Latiumite | (Ca,K)4(Si,Al)5O11(SO4,CO3) |
| Ca | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Ca | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| Ca | ⓘ Mesolite | Na2Ca2Si9Al6O30 · 8H2O |
| Ca | ⓘ Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| Ca | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Ca | ⓘ Offretite | KCaMg(Si13Al5)O36 · 15H2O |
| Ca | ⓘ Oldhamite | (Ca,Mg)S |
| Ca | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Orschallite | Ca3(SO3)2(SO4) · 12H2O |
| Ca | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Ca | ⓘ Perovskite | CaTiO3 |
| Ca | ⓘ Phosphuranylite | KCa(H3O)3(UO2)7(PO4)4O4 · 8H2O |
| Ca | ⓘ Portlandite | Ca(OH)2 |
| Ca | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Ca | ⓘ Rankinite | Ca3Si2O7 |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
| Ca | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| Ca | ⓘ Srebrodolskite | Ca2Fe23+O5 |
| Ca | ⓘ Syngenite | K2Ca(SO4)2 · H2O |
| Ca | ⓘ Tacharanite | Ca12Al2Si18O33 (OH)36 |
| Ca | ⓘ Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| Ca | ⓘ Thomsonite-Ca | NaCa2[Al5Si5O20] · 6H2O |
| Ca | ⓘ Titanite | CaTi(SiO4)O |
| Ca | ⓘ Tobermorite | Ca4Si6O17(H2O)2 · (Ca · 3H2O) |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Tschermakite | ◻(Ca2)(Mg3Al2)(Al2Si6O22)(OH)2 |
| Ca | ⓘ Tuscanite | KCa6(Si,Al)10O22(SO4,CO3)2(OH) · H2O |
| Ca | ⓘ Tyuyamunite | Ca(UO2)2(VO4)2 · 5-8H2O |
| Ca | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| Ca | ⓘ Uvarovite | Ca3Cr2(SiO4)3 |
| Ca | ⓘ Vaterite | CaCO3 |
| Ca | ⓘ Wollastonite | Ca3(Si3O9) |
| Ca | ⓘ Ye'elimite | Ca4Al6(SO4)O12 |
| Ca | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Ca | ⓘ Cheralite | CaTh(PO4)2 |
| Ca | ⓘ Faujasite-Na | (Na2,Ca,Mg)3.5[Al7Si17O48] · 32H2O |
| Ca | ⓘ Zálesíite | CaCu6(AsO4)2(AsO3OH)(OH)6 · 3H2O |
| Ca | ⓘ Ternesite | Ca5(SiO4)2(SO4) |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Pseudowollastonite | CaSiO3 |
| Ca | ⓘ Greifensteinite | Ca2Fe52+Be4(PO4)6(OH)4 · 6H2O |
| Ca | ⓘ Ferri-gehlenite | Ca2Fe3+[AlSiO7] |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ca | ⓘ Melilite Group | Ca2M(XSiO7) |
| Ca | ⓘ Fluorite var. Stink-Fluss | CaF2 |
| Ca | ⓘ UM2005-16-O:CaFe | CaFe4O7 |
| Ca | ⓘ Alumoåkermanite | (CaNa)Al[Si2O7] |
| Ca | ⓘ Kushiroite | CaAl[AlSiO6] |
| Ca | ⓘ Kapundaite | NaCaFe4(PO4)4(OH)3 · 5H2O |
| Ca | ⓘ Birunite | Ca18(SiO3)8.5(CO3)8.5SO4 · 15H2O(?) |
| Ca | ⓘ Kottenheimite | Ca 3Si(SO4)2(OH)6 · 12H2O |
| Ca | ⓘ Khesinite | Ca4(Mg3Fe93+)O4(Fe93+Si3)O36 |
| Ca | ⓘ Unnamed (Hydrous Calcium Magnesium Aluminium Silicate) | Ca5Mg(Al,Fe)Si5(O,OH)17(OH) |
| Ca | ⓘ Unnamed (Hydrous Calcium Magnesium Iron Silicate) | Ca5Mg(Fe,Al)Si5(O,OH)17(OH) |
| Ca | ⓘ Unnamed (Hydrous Calcium Magnesium Aluminium Silicate II) | Ca3(Mg,K,Fe)(Al,Fe,Ti)4Si4(O,OH)18(OH) (?) |
| Ca | ⓘ Unnamed (Calcium Sodium Titanium Niobium Oxide) | (Ca,Na)2(Ti,Nb)O4 |
| Ca | ⓘ Unnamed (Calcium Sulfate Silicate) | Ca2(S,Si)2O7 |
| Ca | ⓘ Pliniusite | Ca5(VO4)3F |
| Ti | Titanium | |
| Ti | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Hejtmanite | Ba2Mn42+Ti2(Si2O7)2O2(OH)2F2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| Ti | ⓘ Perovskite | CaTiO3 |
| Ti | ⓘ Pseudobrookite | Fe2TiO5 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTi(SiO4)O |
| Ti | ⓘ Magnetite var. Titanium-bearing Magnetite | Fe2+(Fe3+,Ti)2O4 |
| Ti | ⓘ Unnamed (Hydrous Calcium Magnesium Aluminium Silicate II) | Ca3(Mg,K,Fe)(Al,Fe,Ti)4Si4(O,OH)18(OH) (?) |
| Ti | ⓘ Unnamed (Calcium Sodium Titanium Niobium Oxide) | (Ca,Na)2(Ti,Nb)O4 |
| Ti | ⓘ Unnamed (Mg-Ti-[]-analogue of Batiferrite) | (Mg,Mn)Ti2{(Ti,Fe)◻}Fe8O19 |
| Ti | ⓘ Unnamed (Fe(II)-Fe(III)-analogue of Shulamitite) | Fe32+TiFe3+Fe3+O8 |
| V | Vanadium | |
| V | ⓘ Carnotite | K2(UO2)2(VO4)2 · 3H2O |
| V | ⓘ Čechite | PbFe2+(VO4)(OH) |
| V | ⓘ Descloizite | PbZn(VO4)(OH) |
| V | ⓘ Francevillite | Ba(UO2)2(VO4)2 · 5H2O |
| V | ⓘ Mottramite | PbCu(VO4)(OH) |
| V | ⓘ Tyuyamunite | Ca(UO2)2(VO4)2 · 5-8H2O |
| V | ⓘ Vanadinite | Pb5(VO4)3Cl |
| V | ⓘ Pliniusite | Ca5(VO4)3F |
| Cr | Chromium | |
| Cr | ⓘ Chromite | Fe2+Cr23+O4 |
| Cr | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Cr | ⓘ Uvarovite | Ca3Cr2(SiO4)3 |
| Cr | ⓘ Unnamed (Magnesium Iron Chromium Oxide) | (Mg,Mn,Zn)2(Fe,Al,Mn)4Cr2O11 |
| Mn | Manganese | |
| Mn | ⓘ Cesàrolite | Pb(Mn4+)3O6(OH)2 |
| Mn | ⓘ Chloritoid | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| Mn | ⓘ Coronadite | Pb(Mn64+Mn23+)O16 |
| Mn | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| Mn | ⓘ Hejtmanite | Ba2Mn42+Ti2(Si2O7)2O2(OH)2F2 |
| Mn | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| Mn | ⓘ Lithiophorite | (Al,Li)MnO2(OH)2 |
| Mn | ⓘ Manganite | Mn3+O(OH) |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Mn | ⓘ Rhodochrosite | MnCO3 |
| Mn | ⓘ Siderite var. Manganese-bearing Siderite | (Fe,Mn)CO3 |
| Mn | ⓘ UM1995-36-SOSiO:AlHPb | Pb27(Al1.6Mn0.4)(Si6O15)2(SO4)2O10(OH)24 |
| Mn | ⓘ Ferrihollandite | Ba(Mn64+Fe23+)O16 |
| Mn | ⓘ Ferricoronadite | Pb(Mn64+Fe23+)O16 |
| Mn | ⓘ Unnamed (Mg-Ti-[]-analogue of Batiferrite) | (Mg,Mn)Ti2{(Ti,Fe)◻}Fe8O19 |
| Mn | ⓘ Unnamed (Magnesium Iron Chromium Oxide) | (Mg,Mn,Zn)2(Fe,Al,Mn)4Cr2O11 |
| Mn | ⓘ Unnamed (Magnesium Iron Oxide) | (Mg,Mn,Zn)2(Fe,Al,Mn)4Fe2O11 |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Aegirine | NaFe3+Si2O6 |
| Fe | ⓘ Ammoniojarosite | (NH4)Fe33+(SO4)2(OH)6 |
| Fe | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| Fe | ⓘ Arthurite | CuFe23+(AsO4)2(OH)2 · 4H2O |
| Fe | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Bariopharmacosiderite | Ba0.5Fe43+(AsO4)3(OH)4 · 5H2O |
| Fe | ⓘ Beudantite | PbFe3(AsO4)(SO4)(OH)6 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Pyrite var. Bravoite | (Fe,Ni)S2 |
| Fe | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| Fe | ⓘ Carminite | PbFe23+(AsO4)2(OH)2 |
| Fe | ⓘ Čechite | PbFe2+(VO4)(OH) |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chenevixite | Cu2Fe23+(AsO4)2(OH)4 |
| Fe | ⓘ Chloritoid | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| Fe | ⓘ Chromite | Fe2+Cr23+O4 |
| Fe | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Fe | ⓘ Corkite | PbFe3(PO4)(SO4)(OH)6 |
| Fe | ⓘ Cyrilovite | NaFe33+(PO4)2(OH)4 · 2H2O |
| Fe | ⓘ Delafossite | CuFeO2 |
| Fe | ⓘ Esseneite | CaFe3+[AlSiO6] |
| Fe | ⓘ Fayalite | Fe22+SiO4 |
| Fe | ⓘ Ferberite | FeWO4 |
| Fe | ⓘ Gartrellite | PbCuFe3+(AsO4)2(OH) · H2O |
| Fe | ⓘ Goethite | α-Fe3+O(OH) |
| Fe | ⓘ Halotrichite | FeAl2(SO4)4 · 22H2O |
| Fe | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Hercynite | Fe2+Al2O4 |
| Fe | ⓘ Hypersthene | (Mg,Fe)SiO3 |
| Fe | ⓘ Idaite | Cu5FeS6 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | ⓘ Kintoreite | PbFe3(PO4)(PO3OH)(OH)6 |
| Fe | ⓘ Lepidocrocite | γ-Fe3+O(OH) |
| Fe | ⓘ Leucophosphite | KFe23+(PO4)2(OH) · 2H2O |
| Fe | ⓘ Magnesioferrite | MgFe23+O4 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
| Fe | ⓘ Natrodufrénite | NaFe2+Fe53+(PO4)4(OH)6 · 2H2O |
| Fe | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Fe | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| Fe | ⓘ Pseudobrookite | Fe2TiO5 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Schreibersite | (Fe,Ni)3P |
| Fe | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| Fe | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Slavíkite | (H3O+)3Mg6Fe15(SO4)21(OH)18 · 98H2O |
| Fe | ⓘ Srebrodolskite | Ca2Fe23+O5 |
| Fe | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Fe | ⓘ Magnetite var. Titanium-bearing Magnetite | Fe2+(Fe3+,Ti)2O4 |
| Fe | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Fe | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| Fe | ⓘ Enstatite var. Bronzite | (Mg,Fe2+)2[SiO3]2 |
| Fe | ⓘ Iddingsite | MgO · Fe2O3 · 3SiO2 · 4H2O |
| Fe | ⓘ Meurigite-K | KFe83+(PO4)6(OH)7 · 6.5H2O |
| Fe | ⓘ Siderite var. Manganese-bearing Siderite | (Fe,Mn)CO3 |
| Fe | ⓘ Greifensteinite | Ca2Fe52+Be4(PO4)6(OH)4 · 6H2O |
| Fe | ⓘ Santabarbaraite | Fe33+(PO4)2(OH)3 · 5H2O |
| Fe | ⓘ Ferri-gehlenite | Ca2Fe3+[AlSiO7] |
| Fe | ⓘ UM2005-16-O:CaFe | CaFe4O7 |
| Fe | ⓘ Kapundaite | NaCaFe4(PO4)4(OH)3 · 5H2O |
| Fe | ⓘ Ferrihollandite | Ba(Mn64+Fe23+)O16 |
| Fe | ⓘ Khesinite | Ca4(Mg3Fe93+)O4(Fe93+Si3)O36 |
| Fe | ⓘ Ferricoronadite | Pb(Mn64+Fe23+)O16 |
| Fe | ⓘ Unnamed (Mg-analogue of Grandiferrite) | MgFe4O7 |
| Fe | ⓘ Unnamed (Hydrous Calcium Magnesium Aluminium Silicate) | Ca5Mg(Al,Fe)Si5(O,OH)17(OH) |
| Fe | ⓘ Unnamed (Hydrous Calcium Magnesium Iron Silicate) | Ca5Mg(Fe,Al)Si5(O,OH)17(OH) |
| Fe | ⓘ Unnamed (Hydrous Calcium Magnesium Aluminium Silicate II) | Ca3(Mg,K,Fe)(Al,Fe,Ti)4Si4(O,OH)18(OH) (?) |
| Fe | ⓘ Unnamed (Mg-Ti-[]-analogue of Batiferrite) | (Mg,Mn)Ti2{(Ti,Fe)◻}Fe8O19 |
| Fe | ⓘ Unnamed (Fe Sulphide III) | (Fe,Ni)10S9 |
| Fe | ⓘ Unnamed (Magnesium Iron Chromium Oxide) | (Mg,Mn,Zn)2(Fe,Al,Mn)4Cr2O11 |
| Fe | ⓘ Unnamed (Magnesium Iron Oxide) | (Mg,Mn,Zn)2(Fe,Al,Mn)4Fe2O11 |
| Fe | ⓘ Unnamed (Fe(II)-Fe(III)-analogue of Shulamitite) | Fe32+TiFe3+Fe3+O8 |
| Co | Cobalt | |
| Co | ⓘ Cobaltite | CoAsS |
| Co | ⓘ Linnaeite | Co2+Co23+S4 |
| Co | ⓘ Siegenite | CoNi2S4 |
| Co | ⓘ Skutterudite | CoAs3 |
| Co | ⓘ Petewilliamsite | (Ni,Co)30(As2O7)15 |
| Ni | Nickel | |
| Ni | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| Ni | ⓘ Pyrite var. Bravoite | (Fe,Ni)S2 |
| Ni | ⓘ Gersdorffite | NiAsS |
| Ni | ⓘ Millerite | NiS |
| Ni | ⓘ Nickeline | NiAs |
| Ni | ⓘ Pararammelsbergite | NiAs2 |
| Ni | ⓘ Rammelsbergite | NiAs2 |
| Ni | ⓘ Schreibersite | (Fe,Ni)3P |
| Ni | ⓘ Siegenite | CoNi2S4 |
| Ni | ⓘ Petewilliamsite | (Ni,Co)30(As2O7)15 |
| Ni | ⓘ Unnamed (Fe Sulphide III) | (Fe,Ni)10S9 |
| Cu | Copper | |
| Cu | ⓘ Agardite-(Y) | YCu6(AsO4)3(OH)6 · 3H2O |
| Cu | ⓘ Agardite-(Ce) | CeCu6(AsO4)3(OH)6 · 3H2O |
| Cu | ⓘ Agardite-(La) | LaCu6(AsO4)3(OH)6 · 3H2O |
| Cu | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| Cu | ⓘ Arthurite | CuFe23+(AsO4)2(OH)2 · 4H2O |
| Cu | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Bournonite | PbCuSbS3 |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| Cu | ⓘ Chalcomenite | CuSeO3 · 2H2O |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcanthite | CuSO4 · 5H2O |
| Cu | ⓘ Chalcoalumite | CuAl4(SO4)(OH)12 · 3H2O |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Cuprite var. Chalcotrichite | Cu2O |
| Cu | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| Cu | ⓘ Chenevixite | Cu2Fe23+(AsO4)2(OH)4 |
| Cu | ⓘ Chenite | Pb4Cu(SO4)2(OH)6 |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| Cu | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Cu | ⓘ Cornubite | Cu5(AsO4)2(OH)4 |
| Cu | ⓘ Cornwallite | Cu5(AsO4)2(OH)4 |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| Cu | ⓘ Copper | Cu |
| Cu | ⓘ Delafossite | CuFeO2 |
| Cu | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Cu | ⓘ Digenite | Cu9S5 |
| Cu | ⓘ Duftite | PbCu(AsO4)(OH) |
| Cu | ⓘ Elyite | Pb4Cu(SO4)O2(OH)4 · H2O |
| Cu | ⓘ Emplectite | CuBiS2 |
| Cu | ⓘ Enargite | Cu3AsS4 |
| Cu | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Cu | ⓘ Gartrellite | PbCuFe3+(AsO4)2(OH) · H2O |
| Cu | ⓘ Goudeyite | AlCu6(AsO4)3(OH)6 · 3H2O |
| Cu | ⓘ Idaite | Cu5FeS6 |
| Cu | ⓘ Klockmannite | CuSe |
| Cu | ⓘ Kobellite | Pb22Cu4(Bi,Sb)30S69 |
| Cu | ⓘ Ktenasite | ZnCu4(SO4)2(OH)6 · 6H2O |
| Cu | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| Cu | ⓘ Libethenite | Cu2(PO4)(OH) |
| Cu | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Cu | ⓘ Luzonite | Cu3AsS4 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| Cu | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| Cu | ⓘ Mottramite | PbCu(VO4)(OH) |
| Cu | ⓘ Olivenite | Cu2(AsO4)(OH) |
| Cu | ⓘ Parnauite | Cu9(AsO4)2(SO4)(OH)10 · 7H2O |
| Cu | ⓘ Pearceite | [Ag6As2S7][Ag9CuS4] |
| Cu | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| Cu | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| Cu | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| Cu | ⓘ Ramsbeckite | (Cu,Zn)15(SO4)4(OH)22 · 6H2O |
| Cu | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Cu | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| Cu | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| Cu | ⓘ Spangolite | Cu6Al(SO4)(OH)12Cl · 3H2O |
| Cu | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Cu | ⓘ Tenorite | CuO |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | ⓘ Theisite | Cu5Zn5(AsO4,SbO4)2(OH)14 |
| Cu | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| Cu | ⓘ Zálesíite | CaCu6(AsO4)2(AsO3OH)(OH)6 · 3H2O |
| Cu | ⓘ Zincolibethenite | CuZn(PO4)(OH) |
| Cu | ⓘ Zincolivenite | CuZn(AsO4)(OH) |
| Cu | ⓘ Munakataite | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| Zn | Zinc | |
| Zn | ⓘ Adamite | Zn2(AsO4)(OH) |
| Zn | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Zn | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| Zn | ⓘ Descloizite | PbZn(VO4)(OH) |
| Zn | ⓘ Fraipontite | (Zn,Al)3((Si,Al)2O5)(OH)4 |
| Zn | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Zn | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| Zn | ⓘ Ktenasite | ZnCu4(SO4)2(OH)6 · 6H2O |
| Zn | ⓘ Ramsbeckite | (Cu,Zn)15(SO4)4(OH)22 · 6H2O |
| Zn | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Zn | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| Zn | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| Zn | ⓘ Smithsonite | ZnCO3 |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Theisite | Cu5Zn5(AsO4,SbO4)2(OH)14 |
| Zn | ⓘ Tsumcorite | PbZn2(AsO4)2 · 2H2O |
| Zn | ⓘ Zincolibethenite | CuZn(PO4)(OH) |
| Zn | ⓘ Zincolivenite | CuZn(AsO4)(OH) |
| Zn | ⓘ Unnamed (Magnesium Iron Chromium Oxide) | (Mg,Mn,Zn)2(Fe,Al,Mn)4Cr2O11 |
| Zn | ⓘ Unnamed (Magnesium Iron Oxide) | (Mg,Mn,Zn)2(Fe,Al,Mn)4Fe2O11 |
| As | Arsenic | |
| As | ⓘ Adamite | Zn2(AsO4)(OH) |
| As | ⓘ Agardite-(Y) | YCu6(AsO4)3(OH)6 · 3H2O |
| As | ⓘ Agardite-(Ce) | CeCu6(AsO4)3(OH)6 · 3H2O |
| As | ⓘ Agardite-(La) | LaCu6(AsO4)3(OH)6 · 3H2O |
| As | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| As | ⓘ Arthurite | CuFe23+(AsO4)2(OH)2 · 4H2O |
| As | ⓘ Atelestite | Bi2(AsO4)O(OH) |
| As | ⓘ Bariopharmacosiderite | Ba0.5Fe43+(AsO4)3(OH)4 · 5H2O |
| As | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| As | ⓘ Beudantite | PbFe3(AsO4)(SO4)(OH)6 |
| As | ⓘ Carminite | PbFe23+(AsO4)2(OH)2 |
| As | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| As | ⓘ Chenevixite | Cu2Fe23+(AsO4)2(OH)4 |
| As | ⓘ Claudetite | As2O3 |
| As | ⓘ Cobaltite | CoAsS |
| As | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| As | ⓘ Cornubite | Cu5(AsO4)2(OH)4 |
| As | ⓘ Cornwallite | Cu5(AsO4)2(OH)4 |
| As | ⓘ Duftite | PbCu(AsO4)(OH) |
| As | ⓘ Enargite | Cu3AsS4 |
| As | ⓘ Gartrellite | PbCuFe3+(AsO4)2(OH) · H2O |
| As | ⓘ Gersdorffite | NiAsS |
| As | ⓘ Goudeyite | AlCu6(AsO4)3(OH)6 · 3H2O |
| As | ⓘ Luzonite | Cu3AsS4 |
| As | ⓘ Mimetite | Pb5(AsO4)3Cl |
| As | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| As | ⓘ Nickeline | NiAs |
| As | ⓘ Olivenite | Cu2(AsO4)(OH) |
| As | ⓘ Orpiment | As2S3 |
| As | ⓘ Pararammelsbergite | NiAs2 |
| As | ⓘ Parnauite | Cu9(AsO4)2(SO4)(OH)10 · 7H2O |
| As | ⓘ Pearceite | [Ag6As2S7][Ag9CuS4] |
| As | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| As | ⓘ Rammelsbergite | NiAs2 |
| As | ⓘ Realgar | As4S4 |
| As | ⓘ Rooseveltite | Bi(AsO4) |
| As | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| As | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
| As | ⓘ Skutterudite | CoAs3 |
| As | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| As | ⓘ Theisite | Cu5Zn5(AsO4,SbO4)2(OH)14 |
| As | ⓘ Tsumcorite | PbZn2(AsO4)2 · 2H2O |
| As | ⓘ Zálesíite | CaCu6(AsO4)2(AsO3OH)(OH)6 · 3H2O |
| As | ⓘ Petewilliamsite | (Ni,Co)30(As2O7)15 |
| As | ⓘ Zincolivenite | CuZn(AsO4)(OH) |
| Se | Selenium | |
| Se | ⓘ Chalcomenite | CuSeO3 · 2H2O |
| Se | ⓘ Klockmannite | CuSe |
| Se | ⓘ Munakataite | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| Sr | Strontium | |
| Sr | ⓘ Celestine | SrSO4 |
| Y | Yttrium | |
| Y | ⓘ Agardite-(Y) | YCu6(AsO4)3(OH)6 · 3H2O |
| Y | ⓘ Churchite-(Y) | Y(PO4) · 2H2O |
| Y | ⓘ Xenotime-(Y) | Y(PO4) |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | ⓘ Unnamed (Calcium Sodium Titanium Niobium Oxide) | (Ca,Na)2(Ti,Nb)O4 |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
| Ag | ⓘ Andorite | AgPbSb3S6 |
| Ag | ⓘ Gold var. Electrum | (Au,Ag) |
| Ag | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Ag | ⓘ Freieslebenite | AgPbSbS3 |
| Ag | ⓘ Iodargyrite | AgI |
| Ag | ⓘ Pearceite | [Ag6As2S7][Ag9CuS4] |
| Ag | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| Ag | ⓘ Pyrargyrite | Ag3SbS3 |
| Ag | ⓘ Silver | Ag |
| Ag | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sb | Antimony | |
| Sb | ⓘ Andorite | AgPbSb3S6 |
| Sb | ⓘ Bindheimite | Pb2Sb2O6O |
| Sb | ⓘ Boulangerite | Pb5Sb4S11 |
| Sb | ⓘ Bournonite | PbCuSbS3 |
| Sb | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Sb | ⓘ Freieslebenite | AgPbSbS3 |
| Sb | ⓘ Kobellite | Pb22Cu4(Bi,Sb)30S69 |
| Sb | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| Sb | ⓘ Pyrargyrite | Ag3SbS3 |
| Sb | ⓘ Semseyite | Pb9Sb8S21 |
| Sb | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| Sb | ⓘ Stibnite | Sb2S3 |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Sb | ⓘ Theisite | Cu5Zn5(AsO4,SbO4)2(OH)14 |
| Sb | ⓘ Oxyplumboroméite | Pb2Sb2O6O |
| Te | Tellurium | |
| Te | ⓘ Tetradymite | Bi2Te2S |
| I | Iodine | |
| I | ⓘ Iodargyrite | AgI |
| Ba | Barium | |
| Ba | ⓘ Bariopharmacosiderite | Ba0.5Fe43+(AsO4)3(OH)4 · 5H2O |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Francevillite | Ba(UO2)2(VO4)2 · 5H2O |
| Ba | ⓘ Hejtmanite | Ba2Mn42+Ti2(Si2O7)2O2(OH)2F2 |
| Ba | ⓘ Metauranocircite | Ba(UO2)2(PO4)2 · 7H2O |
| Ba | ⓘ Uranocircite | Ba(UO2)2(PO4)2 · 10H2O |
| Ba | ⓘ Ferrihollandite | Ba(Mn64+Fe23+)O16 |
| Ba | ⓘ Unnamed (Ba-analogue of K-petalite) | BaAl(Si3Al)O10 |
| La | Lanthanum | |
| La | ⓘ Agardite-(La) | LaCu6(AsO4)3(OH)6 · 3H2O |
| La | ⓘ Rhabdophane-(Ce) var. Lead-bearing Rhabdophane-(Ce) | (Ce,La,Pb)(PO4) · H2O |
| Ce | Cerium | |
| Ce | ⓘ Agardite-(Ce) | CeCu6(AsO4)3(OH)6 · 3H2O |
| Ce | ⓘ Fluocerite-(Ce) | CeF3 |
| Ce | ⓘ Rhabdophane-(Ce) | Ce(PO4) · 0.6H2O |
| Ce | ⓘ Rhabdophane-(Ce) var. Lead-bearing Rhabdophane-(Ce) | (Ce,La,Pb)(PO4) · H2O |
| W | Tungsten | |
| W | ⓘ Ferberite | FeWO4 |
| W | ⓘ Raspite | Pb(WO4) |
| W | ⓘ Scheelite | Ca(WO4) |
| W | ⓘ Stolzite | Pb(WO4) |
| Au | Gold | |
| Au | ⓘ Gold var. Electrum | (Au,Ag) |
| Au | ⓘ Gold | Au |
| Hg | Mercury | |
| Hg | ⓘ Cinnabar | HgS |
| Pb | Lead | |
| Pb | ⓘ Andorite | AgPbSb3S6 |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| Pb | ⓘ Beudantite | PbFe3(AsO4)(SO4)(OH)6 |
| Pb | ⓘ Bindheimite | Pb2Sb2O6O |
| Pb | ⓘ Boulangerite | Pb5Sb4S11 |
| Pb | ⓘ Bournonite | PbCuSbS3 |
| Pb | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| Pb | ⓘ Carminite | PbFe23+(AsO4)2(OH)2 |
| Pb | ⓘ Čechite | PbFe2+(VO4)(OH) |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Cesàrolite | Pb(Mn4+)3O6(OH)2 |
| Pb | ⓘ Chenite | Pb4Cu(SO4)2(OH)6 |
| Pb | ⓘ Corkite | PbFe3(PO4)(SO4)(OH)6 |
| Pb | ⓘ Coronadite | Pb(Mn64+Mn23+)O16 |
| Pb | ⓘ Cosalite | Pb2Bi2S5 |
| Pb | ⓘ Descloizite | PbZn(VO4)(OH) |
| Pb | ⓘ Duftite | PbCu(AsO4)(OH) |
| Pb | ⓘ Elyite | Pb4Cu(SO4)O2(OH)4 · H2O |
| Pb | ⓘ Freieslebenite | AgPbSbS3 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Gartrellite | PbCuFe3+(AsO4)2(OH) · H2O |
| Pb | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| Pb | ⓘ Kintoreite | PbFe3(PO4)(PO3OH)(OH)6 |
| Pb | ⓘ Kobellite | Pb22Cu4(Bi,Sb)30S69 |
| Pb | ⓘ Lanarkite | Pb2(SO4)O |
| Pb | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| Pb | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Pb | ⓘ Mattheddleite | Pb5(SiO4)1.5(SO4)1.5(Cl,OH) |
| Pb | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Pb | ⓘ Minium | Pb3O4 |
| Pb | ⓘ Mottramite | PbCu(VO4)(OH) |
| Pb | ⓘ Phosgenite | Pb2CO3Cl2 |
| Pb | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Pb | ⓘ Raspite | Pb(WO4) |
| Pb | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
| Pb | ⓘ Semseyite | Pb9Sb8S21 |
| Pb | ⓘ Stolzite | Pb(WO4) |
| Pb | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| Pb | ⓘ Tsumcorite | PbZn2(AsO4)2 · 2H2O |
| Pb | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
| Pb | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| Pb | ⓘ Rhabdophane-(Ce) var. Lead-bearing Rhabdophane-(Ce) | (Ce,La,Pb)(PO4) · H2O |
| Pb | ⓘ Munakataite | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| Pb | ⓘ UM1995-36-SOSiO:AlHPb | Pb27(Al1.6Mn0.4)(Si6O15)2(SO4)2O10(OH)24 |
| Pb | ⓘ Oxyplumboroméite | Pb2Sb2O6O |
| Pb | ⓘ Ferricoronadite | Pb(Mn64+Fe23+)O16 |
| Bi | Bismuth | |
| Bi | ⓘ Atelestite | Bi2(AsO4)O(OH) |
| Bi | ⓘ Beyerite | Ca(BiO)2(CO3)2 |
| Bi | ⓘ Bismite | Bi2O3 |
| Bi | ⓘ Bismuth | Bi |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Bismutite | (BiO)2CO3 |
| Bi | ⓘ Cosalite | Pb2Bi2S5 |
| Bi | ⓘ Emplectite | CuBiS2 |
| Bi | ⓘ Kobellite | Pb22Cu4(Bi,Sb)30S69 |
| Bi | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| Bi | ⓘ Rooseveltite | Bi(AsO4) |
| Bi | ⓘ Tetradymite | Bi2Te2S |
| Th | Thorium | |
| Th | ⓘ Cheralite | CaTh(PO4)2 |
| U | Uranium | |
| U | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| U | ⓘ Carnotite | K2(UO2)2(VO4)2 · 3H2O |
| U | ⓘ Coffinite | U(SiO4) · nH2O |
| U | ⓘ Francevillite | Ba(UO2)2(VO4)2 · 5H2O |
| U | ⓘ Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| U | ⓘ Metauranocircite | Ba(UO2)2(PO4)2 · 7H2O |
| U | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| U | ⓘ Phosphuranylite | KCa(H3O)3(UO2)7(PO4)4O4 · 8H2O |
| U | ⓘ Uraninite var. Pitchblende | UO2 |
| U | ⓘ Sabugalite | HAl(UO2)4(PO4)4 · 16H2O |
| U | ⓘ Saléeite | Mg(UO2)2(PO4)2 · 10H2O |
| U | ⓘ Studtite | [(UO2)(O2)(H2O)2] · H2O |
| U | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| U | ⓘ Tyuyamunite | Ca(UO2)2(VO4)2 · 5-8H2O |
| U | ⓘ Uraninite | UO2 |
| U | ⓘ Uranocircite | Ba(UO2)2(PO4)2 · 10H2O |
| U | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
Fossils
There are 35 fossil localities from the PaleoBioDB database within this region.BETA TEST - These data are provided on an experimental basis and are taken from external databases. Mindat.org has no control currently over the accuracy of these data.
| Occurrences | 1115 | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Youngest Fossil Listed | 23.0 Ma (Oligocene) | ||||||||||||||||||
| Oldest Fossil Listed | 305 Ma (Carboniferous) | ||||||||||||||||||
| Stratigraphic Units |
| ||||||||||||||||||
| Fossils from Region | Click here to show the list. | ||||||||||||||||||
| Fossil Localities | Click to show 35 fossil localities |
- Occitanie
- Aveyron
- Millau
- Early Jurassic🐚 Antignes
- Middle Jurassic🐚 Calcaires à Stipites Causses Basin
- Early Jurassic🐚 Camplon
- Early Jurassic🐚 Canals
- Jurassic🐚 Causses Basin
- Paleozoic🐚 Combelade
- Early Jurassic🐚 Cornus
- Middle Jurassic🐚 Gardies
- Early Jurassic🐚 Larbussel
- Early Jurassic🐚 Lauras
- Early Jurassic🐚 Le Bourg
- Early Jurassic🐚 Le Clapier
- Early Jurassic🐚 Le Liquier
- Jurassic🐚 Merdans quarry tracksite
- Early Jurassic🐚 Peyre tracksite
- Jurassic🐚 Riviere
- Early Jurassic🐚 Rivière-sur-Tarn
- Millau
- Aveyron
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Aveyron |
|---|---|
| Wikidata ID: | Q3216 |
| GeoNames ID: | 3035691 |
Localities in this Region
- Occitanie
- Aveyron
- ⭔Gages
- ⭔Millau
- ⭔Agen-d'Aveyron
- ⭔Aguessac
- ⭔Alrance
- Arvieu coronitic metanorite outcrop
- ⭔Arnac-sur-Dourdou
- ⭔Arques
- ⭔Arvieu
- ⭔Auriac-Lagast
- ⭔Ayssènes
- ⭔Balaguier-sur-Rance
- ⭔Belmont-sur-Rance
- ⭔Brasc
- ⭔Broquiès
- ⭔Brousse-le-Château
- ⭔Brusque
- ⭔Calmels-et-le-Viala
- ⭔Camarès
- ⭔Canet-de-Salars
- ⭔Castelnau-Pégayrols
- ⭔Combret
- ⭔Compeyre
- ⭔Comprégnac
- ⭔Comps-la-Grand-Ville
- ⭔Connac
- ⭔Cornus
- ⭔Coupiac
- ⭔Creissels
- ⭔Curan
- ⭔Durenque
- ⭔Fayet
- ⭔Flavin
- ⭔Fondamente
- ⭔Gissac
- ⭔L'Hospitalet-du-Larzac
- ⭔La Bastide-Pradines
- ⭔La Bastide-Solages
- ⭔La Cavalerie
- ⭔La Couvertoirade
- ⭔La Cresse
- ⭔La Roque-Sainte-Marguerite
- ⭔La Selve
- ⭔La Serre
- ⭔Lapanouse-de-Cernon
- ⭔Laval-Roquecezière
- ⭔Le Clapier
- ⭔Le Truel
- ⭔Le Vibal
- ⭔Lédergues
- ⭔Les Costes-Gozon
- ⭔Lestrade-et-Thouels
- ⭔Marnhagues-et-Latour
- ⭔Martrin
- ⭔Mélagues
- ⭔Millau
- ⭔Montagnol
- ⭔Montclar
- ⭔Montfranc
- ⭔Montjaux
- ⭔Montlaur
- ⭔Mostuéjouls
- ⭔Mounes-Prohencoux
- ⭔Murasson
- ⭔Nant
- ⭔Paulhe
- ⭔Peux-et-Couffouleux
- ⭔Peyreleau
- ⭔Plaisance
- ⭔Pont-de-Salars
- ⭔Pousthomy
- ⭔Prades-Salars
- ⭔Rebourguil
- ⭔Réquista
- ⭔Rivière-sur-Tarn
- ⭔Roquefort-sur-Soulzon
- ⭔Rullac-Saint-Cirq
- ⭔Saint-Affrique
- ⭔Saint-André-de-Vézines
- ⭔Saint-Beaulize
- ⭔Saint-Beauzély
- ⭔Saint-Félix-de-Sorgues
- ⭔Saint-Georges-de-Luzençon
- ⭔Saint-Izaire
- ⭔Saint-Jean-d'Alcapiès
- ⭔Saint-Jean-Delnous
- ⭔Saint-Jean-du-Bruel
- ⭔Saint-Jean-et-Saint-Paul
- ⭔Saint-Juéry
- ⭔Saint-Laurent-de-Lévézou
- ⭔Saint-Léons
- ⭔Saint-Rome-de-Cernon
- ⭔Saint-Rome-de-Tarn
- ⭔Saint-Sernin-sur-Rance
- ⭔Saint-Sever-du-Moustier
- ⭔Saint-Victor-et-Melvieu
- ⭔Sainte-Eulalie-de-Cernon
- ⭔Salles-Curan
- ⭔Salmiech
- ⭔Sauclières
- ⭔Ségur
- ⭔Sylvanès
- ⭔Tauriac-de-Camarès
- ⭔Tournemire
- ⭔Trémouilles
- ⭔Vabres-l'Abbaye
- ⭔Verrières
- ⭔Versols-et-Lapeyre
- ⭔Veyreau
- ⭔Vézins-de-Lévézou
- ⭔Viala-du-Pas-de-Jaux
- ⭔Viala-du-Tarn
- ⭔Villefranche-de-Panat
- Pays d'Olt
- ⭔Rodez
- ⭔Argences en Aubrac
- Arvieu coronitic metanorite outcrop
- ⭔Bertholène
- ⭔Bessuéjouls
- ⭔Bozouls
- ⭔Brommat
- ⭔Campagnac
- ⭔Campouriez
- ⭔Campuac
- ⭔Cantoin
- ⭔Cassuéjouls
- ⭔Castelnau-de-Mandailles
- ⭔Clairvaux-d'Aveyron
- ⭔Condom-d'Aubrac
- ⭔Conques-en-Rouergue
- ⭔Coubisou
- ⭔Cruéjouls
- ⭔Curières
- Détroit de Rodez
- ⭔Druelle Balsac
- ⭔Entraygues-sur-Truyère
- ⭔Espalion
- ⭔Espeyrac
- ⭔Estaing
- ⭔Florentin-la-Capelle
- ⭔Gabriac
- ⭔Gaillac-d'Aveyron
- ⭔Golinhac
- ⭔Huparlac
- ⭔La Capelle-Bonance
- ⭔La Loubière
- ⭔Lacroix-Barrez
- ⭔Laguiole
- ⭔Laissac-Sévérac l'Église
- ⭔Lassouts
- ⭔Le Cayrol
- ⭔Le Fel
- ⭔Le Monastère
- ⭔Le Nayrac
- ⭔Luc-la-Primaube
- Aveyron
- Occitanie
- Aveyron
- Rodez
- ⭔Marcillac-Vallon
- ⭔Montézic
- ⭔Montpeyroux
- ⭔Montrozier
- ⭔Mouret
- ⭔Mur-de-Barrez
- ⭔Muret-le-Château
- ⭔Murols
- ⭔Nauviale
- ⭔Olemps
- ⭔Onet-le-Château
- ⭔Palmas d'Aveyron
- ⭔Pierrefiche
- ⭔Pomayrols
- ⭔Prades-d'Aubrac
- ⭔Pruines
- ⭔Rodelle
- ⭔Rodez
- ⭔Saint-Amans-des-Cots
- ⭔Saint-Chély-d'Aubrac
- ⭔Saint-Christophe-Vallon
- ⭔Saint-Côme-d'Olt
- ⭔Saint-Félix-de-Lunel
- ⭔Saint-Geniez-d'Olt-et-d'Aubrac
- ⭔Saint-Hippolyte
- ⭔Saint-Laurent-d'Olt
- ⭔Saint-Martin-de-Lenne
- ⭔Saint-Saturnin-de-Lenne
- ⭔Saint-Symphorien-de-Thénières
- ⭔Sainte-Eulalie-d'Olt
- ⭔Sainte-Radegonde
- ⭔Salles-la-Source
- ⭔Sébazac-Concourès
- ⭔Sébrazac
- ⭔Sénergues
- ⭔Sévérac-d'Aveyron
- ⭔Soulages-Bonneval
- ⭔Taussac
- ⭔Thérondels
- ⭔Valady
- ⭔Villecomtal
- ⭔Vimenet
- ⭔Villefranche-de-Rouergue
- ⭔Almont-les-Junies
- ⭔Ambeyrac
- ⭔Anglars-Saint-Félix
- ⭔Asprières
- ⭔Aubin
- ⭔Auzits
- ⭔Balaguier-d'Olt
- ⭔Baraqueville
- ⭔Belcastel
- ⭔Boisse-Penchot
- ⭔Bor-et-Bar
- ⭔Bouillac
- ⭔Bournazel
- ⭔Boussac
- ⭔Brandonnet
- ⭔Cabanès
- ⭔Calmont
- ⭔Camboulazet
- ⭔Camjac
- ⭔Capdenac-Gare
- ⭔Cassagnes-Bégonhès
- ⭔Castanet
- ⭔Castelmary
- ⭔Causse-et-Diège
- ⭔Centrès
- ⭔Colombiès
- ⭔Compolibat
- ⭔Cransac
- ⭔Crespin
- ⭔Decazeville
- ⭔Drulhe
- ⭔Escandolières
- ⭔Firmi
- ⭔Flagnac
- ⭔Foissac
- ⭔Galgan
- ⭔Goutrens
- ⭔Gramond
- ⭔La Capelle-Balaguier
- ⭔La Capelle-Bleys
- ⭔La Fouillade
- ⭔La Rouquette
- ⭔La Salvetat-Peyralès
- ⭔Lanuéjouls
- ⭔Le Bas Ségala
- ⭔Les Albres
- ⭔Lescure-Jaoul
- ⭔Livinhac-le-Haut
- Penchot
- ⭔Lugan
- ⭔Lunac
- ⭔Maleville
- ⭔Manhac
- ⭔Martiel
- ⭔Mayran
- ⭔Meljac
- ⭔Montbazens
- ⭔Monteils
- ⭔Montsalès
- ⭔Morlhon-le-Haut
- ⭔Moyrazès
- ⭔Najac
- ⭔Naucelle
- ⭔Naussac
- ⭔Ols-et-Rinhodes
- ⭔Peyrusse-le-Roc
- ⭔Pradinas
- ⭔Prévinquières
- ⭔Privezac
- ⭔Quins
- ⭔Rieupeyroux
- ⭔Rignac
- ⭔Roussennac
- ⭔Saint-André-de-Najac
- ⭔Saint-Igest
- ⭔Saint-Just-sur-Viaur
- ⭔Saint-Parthem
- ⭔Saint-Rémy
- ⭔Saint-Santin
- ⭔Sainte-Croix
- ⭔Sainte-Juliette-sur-Viaur
- ⭔Salles-Courbatiès
- ⭔Salvagnac-Cajarc
- ⭔Sanvensa
- ⭔Saujac
- ⭔Sauveterre-de-Rouergue
- ⭔Savignac
- ⭔Sonnac
- ⭔Tauriac-de-Naucelle
- ⭔Tayrac
- ⭔Toulonjac
- ⭔Vailhourles
- ⭔Valzergues
- ⭔Vaureilles
- ⭔Villefranche-de-Rouergue
- ⭔Villeneuve
- ⭔Viviez
- Rodez
- Aveyron
Other Regions, Features and Areas that Intersect
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther RegionsReferences
Découverte de Lassalle, Decazeville coal basin, Decazeville, Villefranche-de-Rouergue, Aveyron, Occitanie, France