Agder, Norwayi
| Regional Level Types | |
|---|---|
| Agder | County |
| Norway | Country |
This page is currently not sponsored. Click here to sponsor this page.
Area:
9,158 km2
Neighbouring regions:
Type:
Museums in region:
Mindat Locality ID:
14334
Long-form identifier:
mindat:1:2:14334:4
GUID (UUID V4):
91926614-9d63-40d2-98d9-6faf2d8d918a
Other Languages:
French:
Agder, Norvège
German:
Agder, Norwegen
Italian:
Agder, Norvegia
Norwegian:
Agder, Norge
Russian:
Эуст-Агдер, Норвегия
Simplified Chinese:
阿格德爾, 挪威
Spanish:
Reino de Agder, Noruega
Afrikaans:
Agder, Noorweë
Albanian:
Aust-Agder, Norvegjia
Arabic:
أوست أغدر, النرويج
Armenian:
Վեստ-Ագդեր, Նորվեգիա
Asturian:
Agder, Noruega
Basque:
Aust-Agder, Norvegia
Bavarian:
Aust-Agder, Norwegn
Belarusian:
Эўст-Агдэр, Нарвегія
Belarusian (Tarashkevitsa):
Эўст-Агдэр, Нарвэгія
Bengali:
ভেস্ত আগদের, নরওয়ে
Bishnupriya Manipuri:
ঔস্ট-অগ্দের, নরৱে
Bosnian:
Aust-Agder, Norveška
Breton:
Agder, Norvegia
Bulgarian:
Ауст-Агдер, Норвегия
Catalan:
Aust-Agder, Noruega
Cebuano:
Aust-Agder fylke, Norway
Cornish:
Aust-Agder, Norgagh
Croatian:
Aust-Agder, Norveška
Czech:
Agder, Norsko
Danish:
Agder, Norge
Dutch:
Agder, Noorwegen
Dutch Low Saxon:
Agder, Noorwegen
Esperanto:
Aust-Agder, Norvegio
Estonian:
Agder, Norra
Farsi/Persian:
اوست آدر, نروژ
Finnish:
Agder, Norja
Georgian:
ეუსტ-აგდერი, ნორვეგია
Greek:
Άγκντερ, Νορβηγία
Gujarati:
વેસ્ટ-એડર, નોર્વે
Hebrew:
מזרח אגדר, נורבגיה
Hindi:
वेस्ट-एग्डर, नॉर्वे
Hungarian:
Aust-Agder megye, Norvégia
Icelandic:
Agðir, Noregur
Indonesian:
Aust-Agder, Norwegia
Japanese:
アグデル, ノルウェー
Kannada:
ವೆಸ್ಟ್-ಆಗ್ಡರ್, ಕಾಮೌ
Korean:
아그데르주, 노르웨이
Latin:
Aust-Agder, Norvegia
Latvian:
Vestagdere, Norvēģija
Limburgian:
Aust-Agder, Noorwege
Lithuanian:
Rytų Agderis, Norvegija
Low Saxon/Low German:
Agder, Norwegen
Luxembourgish:
Agder, Norwegen
Macedonian:
Аустагдер, Норвешка
Malay:
Vest-Agder, Norway
Marathi:
वेस्ट-एजडर, नॉर्वे
Minnan / Hokkien-Taiwanese:
Aust-Agder, Lo̍k-ui
Nauruan:
Aust-Agder, Norwei
Northern Sami:
Nuorta-Agdera fylka, Norga
Norwegian (Nynorsk):
Agder, Noreg
Occitan:
Aust-Agder, Norvègia
Ossetian:
Эуст-Агдер, Норвеги
Polish:
Agder, Norwegia
Portuguese:
Aust-Agder, Noruega
Romanian:
Aust-Agder, Norvegia
Samogitian:
Rītū Agderis, Nuorvegėjė
Scots:
Aust-Agder, Norawa
Serbian:
Источни Агдер, Норвешка
Sinhalese:
වෙස්ට්-අග්ඩර්, නෝර්වේ
Slovak:
Aust-Agder, Nórsko
Slovenian:
Aust-Agder, Norveška
South Azerbaijani:
اوست اگدر, نوروژ
Swahili:
Aust-Agder, Norwei
Swedish:
Agder, Norge
Tamil:
அக்டர், நோர்வே
Telugu:
వెస్ట్-ఆగ్డర్, నార్వే
Thai:
เทศมณฑลอักเดอร์, นอร์เวย์
Turkish:
Aust-Agder, Norveç
Ukrainian:
Агдер, Норвегія
Urdu:
آوست-آگدیر, ناروے
Vietnamese:
Aust-Agder, Na Uy
Waray:
Aust-Agder, Noruega
West Frisian:
Agder, Noarwegen
Western Punjabi:
اسٹاگڈر, ناروے
Before 1 January 2020 the Agder county was divided in two counties, Vest-Agder and Aust-Agder.
Vest-Agder and Aust-Agder counties ceased to exist as an official, autonomous entity.
From 01.01.2020 the Vest- and Aust-Agder counties were joined together as one large Agder county.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities270 valid minerals. 9 (TL) - type locality of valid minerals. 5 (FRL) - first recorded locality of unapproved mineral/variety/etc. 6 erroneous literature entries.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Abhurite Formula: Sn21Cl16(OH)14O6 Description: Found on corroded tin ingots.
Antropogenic formed materiale. |
| ⓘ Acanthite Formula: Ag2S Localities: |
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 Localities: Reported from at least 9 localities in this region. |
| ⓘ 'Aeschynite' |
| ⓘ Aeschynite-(Ce) Formula: (Ce,Ca,Fe,Th)(Ti,Nb)2(O,OH)6 |
| ⓘ 'Aeschynite Group' Formula: AD2O6 |
| ⓘ Aeschynite-(Y) (TL) Formula: (Y,Ln,Ca,Th)(Ti,Nb)2(O,OH)6 Localities: Reported from at least 28 localities in this region. Type Locality: Urstad Feldspar Mine, Hidra, Flekkefjord, Agder, Norway Habit: Platy after {010}, with the dominant form {010}, {130}, {001}. Forms also observed: {110}, {120}, {111}, {101}, [001} Colour: Brownish black, metamict with thin brownish alteration Description: Brøgger (1879) gave a crystallographic description of a black mineral from Urstad without chemical analysis. He thought it to be identical with aeschynite (From Miask, which later was named aeschynite-(Ce)). In Brøgger (1906) the mineral were described in detail, and gave it the name Blomstrandine. He states on p. 104 the that aeschynite from Miask is a Cerium-Aeschynit and that the blomstrandine from Hitterö was a "Yttrium-Aeschynit".
A part of a crystal weighing 3kg and chunks up to 20 kg has been noted. References: Brøgger, W.C. (1879) XXVI. Untersuchungen norwegischer Mineralien II. Zeitschrift für Kristallographie - Crystalline Materials, 3 (1) 471-487 doi:10.1524/zkri.1879.3.1.471 |
| ⓘ Albite Formula: Na(AlSi3O8) Localities: Reported from at least 161 localities in this region. |
| ⓘ Albite var. Andesine Formula: (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ Albite var. Cleavelandite Formula: Na(AlSi3O8) Localities: Reported from at least 26 localities in this region. |
| ⓘ Albite var. Oligoclase Formula: (Na,Ca)[Al(Si,Al)Si2O8] Localities: Reported from at least 42 localities in this region. |
| ⓘ Albite var. Oligoclase-Albite Formula: Na(AlSi3O8) Localities: |
| ⓘ Albite var. Peristerite Formula: Na(AlSi3O8) |
| ⓘ 'Alkali Feldspar' Localities: Reported from at least 33 localities in this region. |
| ⓘ Allanite-(Ce) Formula: (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) Localities: Reported from at least 37 localities in this region. Description: described as orthite |
| ⓘ 'Allanite Group' Formula: (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) Localities: Reported from at least 59 localities in this region. |
| ⓘ Allophane Formula: (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 Localities: Reported from at least 9 localities in this region. |
| ⓘ 'Almandine-Pyrope Series' Description: Garnet porphyroblasts are common at the locality, forming porphyroblasts up to (and perhaps exceeding) 5 cm. Crude crystals up to about 2-2.5cm could also be found associated with quartz. The garnet is inferred as a almandine-pyrope series based on the geological environment ( upper amphibolite to granulite facies meta-sediments), color ( rose-pink) and specific gravity (~3.9). |
| ⓘ 'Almandine-Pyrope Series var. Rhodolite' Formula: Mg3Al2(SiO4)3 Locality: Gjerstad, Agder, Norway |
| ⓘ 'Almandine-Spessartine Series' Localities: Reported from at least 68 localities in this region. Habit: Dark crystals with high lustre. Size up to minimum 4 cm. The garnets are found in feldspar, smokey quartz and inbetween biotite sheets. The latter ones are normally flattened. Description: Garnets from the nearby Frøyså 3 quarry has been analyzed and found to be a spessartine with a significant almandine content(Larsen 1980). No analysis has been done on garnets from Frøyså 1 |
| ⓘ 'Amphibole Supergroup' Formula: AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 Localities: Reported from at least 40 localities in this region. |
| ⓘ 'Amphibole Supergroup var. Uralite' Formula: AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 Locality: Stoa, Arendal, Agder, Norway |
| ⓘ Analcime Formula: Na(AlSi2O6) · H2O Localities: Reported from at least 8 localities in this region. |
| ⓘ Anatase Formula: TiO2 Localities: |
| ⓘ 'Ancylite' Locality: Hiltveit, Iveland, Agder, Norway |
| ⓘ Ancylite-(Ce) Formula: CeSr(CO3)2(OH) · H2O Localities: |
| ⓘ 'Ancylite Group' Formula: (M3+ xM2+2-x)(CO3)2[(OH)x · (2-x)H2O] Localities: Habit: spherulitic aggregates Colour: Yellow Description: Maybe calcioancylite-(Ce) or ancylite-(Ce) References: |
| ⓘ Andalusite Formula: Al2(SiO4)O Localities: |
| ⓘ Andradite Formula: Ca3Fe3+2(SiO4)3 Localities: Reported from at least 9 localities in this region. References: |
| ⓘ Andradite var. Colophonite Formula: Ca3Fe3+2(SiO4)3 |
| ⓘ 'Andradite-Grossular Series' Localities: Colour: Brownish-orange to brownish-red |
| ⓘ Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 |
| ⓘ Anthophyllite Formula: ◻{Mg2}{Mg5}(Si8O22)(OH)2 Localities: Reported from at least 6 localities in this region. |
| ⓘ 'Anthophyllite-Gedrite Series' |
| ⓘ Antigorite Formula: Mg3(Si2O5)(OH)4 |
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) Localities: Reported from at least 62 localities in this region. Colour: white |
| ⓘ 'Apatite var. Moroxite' Localities: |
| ⓘ 'Apophyllite Group' Formula: AB4[Si8O22]X · 8H2O Localities: |
| ⓘ Arsenopyrite Formula: FeAsS Localities: Reported from at least 9 localities in this region. |
| ⓘ 'Asbestos' Localities: |
| ⓘ 'Atheriastite' Formula: near Ca5MgFeAl6Si8O32 · 5H2O |
| ⓘ Augite Formula: (CaxMgyFez)(Mgy1Fez1)Si2O6 Localities: Reported from at least 7 localities in this region. |
| ⓘ Aurichalcite Formula: (Zn,Cu)5(CO3)2(OH)6 |
| ⓘ Axinite-(Fe) Formula: Ca2Fe2+Al2BSi4O15OH Locality: Kjenlie Mine (Østre Kjenlie Mine), Kjenlie Mines, Klodeborg Mines, Øyestad, Arendal, Agder, Norway Description: Found in Vestre Kjenli Gruve |
| ⓘ 'Axinite Group' Localities: |
| ⓘ Axinite-(Mn) Formula: Ca2Mn2+Al2BSi4O15(OH) Localities: References: |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 Localities: |
| ⓘ Babingtonite (TL) Formula: Ca2(Fe,Mn)FeSi5O14(OH) Localities: Reported from at least 8 localities in this region. Type Locality: Arendal Iron Mines, Arendal, Agder, Norway References: |
| ⓘ Baryte Formula: BaSO4 Localities: Reported from at least 10 localities in this region. Description: The occurence is a baryte vein, containing mostly massive baryte with crystal lined vugs. The crystals are normally thin,square plates where the individual crystal can be several cm on the edge. A second generation w/ smaller transparent crystals are found on brown calcite. References: |
| ⓘ 'Bastnäsite' Formula: (Ce/Nd/Y/REE)(CO3)F Localities: |
| ⓘ Bastnäsite-(Ce) Formula: Ce(CO3)F Localities: Reported from at least 8 localities in this region. |
| ⓘ Bavenite Formula: Ca4Be2Al2Si9O26(OH)2 Localities: Reported from at least 14 localities in this region. References: |
| ⓘ Beidellite ? Formula: (Na,Ca0.5)0.3Al2((Si,Al)4O10)(OH)2 · nH2O Localities: Description: Described as beidellite by Barth (1940). According to Isachsen & Rosenqvist (1948) it is probably a mixture of montmorillonite and " bauxite-minerals" |
| ⓘ Bertrandite Formula: Be4(Si2O7)(OH)2 Localities: Reported from at least 11 localities in this region. |
| ⓘ Beryl Formula: Be3Al2(Si6O18) Localities: Reported from at least 95 localities in this region. Habit: hexagonal crystals, frequently terminated Colour: yellow to green References: |
| ⓘ Beryl var. Aquamarine Formula: Be3Al2Si6O18 Localities: |
| ⓘ Beryl var. Heliodor Formula: Be3Al2(Si6O18) |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 Localities: Reported from at least 326 localities in this region. |
| ⓘ Bismite Formula: Bi2O3 Localities: Description: Occurs between plates of cleavelandite References: |
| ⓘ Bismuth Formula: Bi Localities: Reported from at least 7 localities in this region. |
| ⓘ Bismuthinite Formula: Bi2S3 Localities: Reported from at least 17 localities in this region. |
| ⓘ Bismutite Formula: (BiO)2CO3 Localities: Reported from at least 6 localities in this region. |
| ⓘ Bityite Formula: CaLiAl2(AlBeSi2O10)(OH)2 Locality: Iveland, Agder, Norway |
| ⓘ Formula: CuSO4 · 7H2O Locality: Flåt Nickel Mines, Flåt, Evje og Hornnes, Agder, Norway - erroneously reported Description: Boothite occured on the walls and in loose rocks inside on of the mining buildings, where a roof took in water.
It was first identified at the Natural History Museum, Oslo, film 22215.
Reinvestigation of the results showed that the film corresponded more with melanterite than boothite. (pers. Com Gunnar Raade 18.04.1988 (Interne Notater s 137) |
| ⓘ Bornite Formula: Cu5FeS4 Localities: Reported from at least 10 localities in this region. |
| ⓘ Boulangerite Formula: Pb5Sb4S11 Locality: Ettedal Mine, Vegårshei, Agder, Norway |
| ⓘ Braunite Formula: Mn2+Mn3+6(SiO4)O8 |
| ⓘ Breithauptite Formula: NiSb Locality: Ettedal Mine, Vegårshei, Agder, Norway |
| ⓘ 'Britholite Group' Formula: (REE,Ca)5[(Si,P)O4]3X |
| ⓘ Britholite-(Y) ? Formula: (Y,Ca)5(SiO4)3OH Description: First described as "Britholite-(Y)" by Griffin et al. The analysis published in their paper however showed that the sample studied had a high content of F (1.18 wt%), thus > 50 apfu and should be a fluorbritholite according to the revision of the nomenclature of the apatite supergroup (Ferraris et al 2010). Britholite-(Y) may occur at the locality but further studies are necessary. |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 |
| ⓘ Brookite Formula: TiO2 |
| ⓘ Cahnite Formula: Ca2[B(OH)4](AsO4) Description: Bugge (1951) found cahnite as small crystals (1-2mm) in calcite-marble found in the dumps of the mine. |
| ⓘ Calcioancylite-(Ce) Formula: (Ce,Ca,Sr)CO3(OH,H2O) Localities: |
| ⓘ Calcite Formula: CaCO3 Localities: Reported from at least 74 localities in this region. |
| ⓘ Carlosbarbosaite Formula: (UO2)2Nb2O6(OH)2 · 2H2O |
| ⓘ Carnotite Formula: K2(UO2)2(VO4)2 · 3H2O |
| ⓘ Cerianite-(Ce) Formula: (Ce4+,Th)O2 Localities: Habit: thick tabular imperfectly developed crystals < 2 cm Colour: reddish brown orange yellow Description: Cerianite-(Ce) occur in pseudomorphoses after monazite-(Ce), together with fluocerite-(Ce) ,Törnebohmite-(Ce) and a younger generation monazite-(Ce). |
| ⓘ 'Chabazite' Localities: Reported from at least 8 localities in this region. |
| ⓘ Chabazite-Ca Formula: (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O Localities: |
| ⓘ Chalcanthite ? Formula: CuSO4 · 5H2O Habit: Rounded crystals and masses Colour: Blue Description: A blue copper sulphate was collected near the mine entrance, most likely to be chalcantite. |
| ⓘ Chalcocite Formula: Cu2S Localities: Reported from at least 8 localities in this region. |
| ⓘ 'Chalcodite' Formula: K(Fe3+,Mg,Fe2+)8(Si,Al)12(O,OH)27 |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Reported from at least 41 localities in this region. |
| ⓘ Chamosite Formula: (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| ⓘ Chernovite-(Y) Formula: Y(AsO4) Locality: Gjerstad, Agder, Norway Description: As inclusion in titanite from a pegmatite |
| ⓘ Chlorapatite Formula: Ca5(PO4)3Cl Localities: Reported from at least 7 localities in this region. |
| ⓘ 'Chlorite Group' Localities: Reported from at least 46 localities in this region. |
| ⓘ Chondrodite Formula: Mg5(SiO4)2F2 |
| ⓘ Chrysoberyl Formula: BeAl2O4 Localities: Reported from at least 11 localities in this region. |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 Localities: |
| ⓘ Chrysotile Formula: Mg3(Si2O5)(OH)4 |
| ⓘ Churchite-(Y) Formula: Y(PO4) · 2H2O Description: Bjørlykke/Hysingjord describe churchite-(Y) from "the Microlite-quarry", Landås. The mineral occures as a white crust on topaz. |
| ⓘ Clarkeite Formula: (Na,Ca,Pb)(UO2)O(OH) · 0-1H2O Colour: brown Description: Occurs in zonated alteration products of uraninite, consisting from a uraninite-core and outwards; clarkeite, fourmarierite, kasolite and uranophane. |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 Localities: Ravneberget Quarry, Søndeled, Risør, Agder, Norway Moland Industrial Site, Akland, Risør, Agder, Norway Åneland 02 Feldspar Quarry (Smænelia), Åneland, Evje og Hornnes, Agder, Norway Gamle Mine, Strømsheia (Straumsheia), Valle, Agder, Norway Landsverk 1 Feldspar Quarry (Jokeli), Landsverk, Evje og Hornnes, Agder, Norway ? (more information) |
| ⓘ Clinofergusonite-(Y) Formula: YNbO4 Locality: Arendal, Agder, Norway |
| ⓘ Clinohumite Formula: Mg9(SiO4)4F2 Localities: References: |
| ⓘ 'Clinopyroxene Subgroup' Localities: Reported from at least 13 localities in this region. Description: Between enderbite and dehydration zone. |
| ⓘ Clinozoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) Localities: Reported from at least 10 localities in this region. |
| ⓘ 'Coal blend' Localities: |
| ⓘ Cobaltite Formula: CoAsS Localities: |
| ⓘ Coffinite Formula: U(SiO4) · nH2O Localities: Habit: crust & film Colour: black Description: on feldspar and quartz |
| ⓘ Columbite-(Fe) Formula: Fe2+Nb2O6 Localities: Reported from at least 17 localities in this region. |
| ⓘ 'Columbite-(Fe)-Columbite-(Mn) Series' Localities: Reported from at least 22 localities in this region. Description: As lamellar exsolution from niobian rutile ("ilmenorutile") (Ramdohr 1955). |
| ⓘ 'Columbite-(Fe)-Tantalite-(Fe) Series' |
| ⓘ Columbite-(Mn) Formula: Mn2+Nb2O6 Localities: |
| ⓘ 'Columbite-Tantalite' Habit: Poorly developed crystals > 5cm Description: Not analyzed, Identified as a columbite/tantalite mineral based on physical appearance, strak color, hardness, specific gravity, lustre and geological environment. Specific gravity combined with previous analysis of similar material from other quarries in the area may indicate manganotantalite. |
| ⓘ Copiapite Formula: Fe2+Fe3+4(SO4)6(OH)2 · 20H2O |
| ⓘ Copper Formula: Cu |
| ⓘ Cordierite Formula: (Mg,Fe)2Al3(AlSi5O18) Localities: Reported from at least 18 localities in this region. |
| ⓘ Cordierite var. Iolite Formula: (Mg,Fe)2Al3(AlSi5O18) Locality: Tvedestrand, Agder, Norway |
| ⓘ Corundum Formula: Al2O3 Localities: Reported from at least 10 localities in this region. Habit: (0001) and (1120), more rarely (1011). Colour: Purplered - violet. Description: Usual size of basal plane is 1 - 4 cm, but crystals up to 10 cm is known. Thickness of crystals are usualy to 1 cm. |
| ⓘ Corundum var. Ruby Formula: Al2O3 |
| ⓘ Cotunnite Formula: PbCl2 Description: As thin inclusions in plaets of abhurite
Antropogenic formed materiale. |
| ⓘ Covellite Formula: CuS Locality: Hiltveit, Iveland, Agder, Norway Description: Pedersen (2007) says that the covellite was found in the "Hiltveittunnel". |
| ⓘ Cummingtonite Formula: ◻{Mg2}{Mg5}(Si8O22)(OH)2 Localities: Description: Finegrained masses of fibrous crystals as pseudomorphs of olivine |
| ⓘ Cuprite Formula: Cu2O |
| ⓘ Cuprite var. Chalcotrichite Formula: Cu2O |
| ⓘ Curite Formula: Pb3(H2O)2[(UO2)4O4(OH)3]2 Locality: Fone, Gjerstad, Agder, Norway Description: One sample of curite labelled "Fone in Gjerstad" are kept in the collections of British Museum (National History). |
| ⓘ Cyprine ? Formula: Ca19Cu2+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10](OH)(OH)9 Description: Mentioned in Kjerulf (1879), and a cyprine sample collected by Kjerulf is in the collection of MGM, Oslo labelled "Strømsheien", but locality has not been confirmed later. Identity based on color. |
| ⓘ Datolite (TL) Formula: CaB(SiO4)(OH) Localities: Type Locality: Nødebro Mine (Nøddebro), Øyestad, Arendal, Agder, Norway |
| ⓘ Datolite var. Botryolite (FRL) Localities: |
| ⓘ 'Davidite' Description: Identified from an old specimen in the mineral collection at Natural History Museum, Oslo |
| ⓘ Davidite-(Ce) (TL) Formula: Ce(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 Localities: Habit: elongated masses with rough semi-linear outlines attaining lengths of 20 cms or more Description: often intergrown with ilmenite and rutile |
| ⓘ Formula: La(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 Locality: Frikstad 03 Feldspar Quarry (Tuftane), Frikstad, Iveland, Agder, Norway - erroneously reported Description: Erronously reported by Hansen (2001) |
| ⓘ 'Delessite' Formula: (Mg,Fe,Fe,Al)(Si,Al)4O10(O,OH)8 |
| ⓘ Devilline Formula: CaCu4(SO4)2(OH)6 · 3H2O Description: Collected by P. Chr. Sæbø in 1988 |
| ⓘ Diaspore Formula: AlO(OH) Localities: Description: As alteration around corundum |
| ⓘ Digenite Formula: Cu9S5 |
| ⓘ Diopside Formula: CaMgSi2O6 Localities: Reported from at least 22 localities in this region. Description: Crystals oup to 14 x 7 cm |
| ⓘ Diopside var. Salite |
| ⓘ Djurleite Formula: Cu31S16 |
| ⓘ Dolomite Formula: CaMg(CO3)2 Localities: |
| ⓘ Dravite Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) Localities: |
| ⓘ 'Dravite-Schorl Series' |
| ⓘ Dumortierite Formula: Al(Al2O)(Al2O)2(SiO4)3(BO3) Localities: Reported from at least 6 localities in this region. Description: Found in alteration assemblages after cordierite |
| ⓘ Elbaite ? Formula: Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) Localities: |
| ⓘ Enstatite Formula: Mg2Si2O6 |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) Localities: Reported from at least 58 localities in this region. Description: Found in the farsundite close to the contact with the pegmatite |
| ⓘ Epidote var. Withamite ? Formula: {Ca2}{Al2(Fe3+,Mn)}(Si2O7)(SiO4)O(OH) Description: Morton and Carter state that "we suggest that the red epidote from Herefoss (0. 50 wt. per cent MnO + Mn203) may be withamite. |
| ⓘ 'Epidote Supergroup' Formula: (A1A2)(M1M2M3)O4[Si2O7][SiO4]O10 |
| ⓘ Euclase Formula: BeAl(SiO4)(OH) Description: Occure in small amounts (1%) in pseudomorphoses after beryl. |
| ⓘ 'Euxenite Group' Localities: Reported from at least 22 localities in this region. |
| ⓘ Euxenite-(Y) Formula: (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 Localities: Reported from at least 107 localities in this region. Description: The mineral occurs in long ruler-like crystals. References: |
| ⓘ 'Euxenite-(Y)-Polycrase-(Y) Series' Localities: References: |
| ⓘ 'Farsundite' Localities: |
| ⓘ 'Fayalite-Forsterite Series' Localities: Reported from at least 6 localities in this region. |
| ⓘ 'Feldspar Group' Localities: Reported from at least 108 localities in this region. |
| ⓘ 'Feldspar Group var. Antiperthite' |
| ⓘ 'Feldspar Group var. Perthite' Localities: Reported from at least 13 localities in this region. |
| ⓘ 'Feldspar Group var. Sunstone' Localities: References: |
| ⓘ 'Fergusonite' Localities: Reported from at least 35 localities in this region. |
| ⓘ Fergusonite-(Y) Formula: YNbO4 Localities: Reported from at least 20 localities in this region. References: |
| ⓘ Fergusonite-(Y) var. Risörite Formula: (Y,Er)(Nb,Ti,Ta)(O,OH)4 |
| ⓘ Ferrimolybdite Formula: Fe2(MoO4)3 · nH2O Description: Sample in the collection of Naturhstorisk Museum, Oslo. |
| ⓘ Ferro-actinolite Formula: ◻Ca2Fe2+5(Si8O22)(OH)2 |
| ⓘ Ferro-hornblende Formula: ◻Ca2(Fe2+4Al)(Si7Al)O22(OH)2 Locality: Arendal, Agder, Norway |
| ⓘ Ferrosilite Formula: Fe2+2Si2O6 Locality: Hidra, Flekkefjord, Agder, Norway |
| ⓘ Fersmite Formula: (Ca,Ce,Na)(Nb,Ta,Ti)2(O,OH,F)6 Localities: |
| ⓘ Fluocerite-(Ce) Formula: CeF3 Localities: Description: Intergrown with cerianite-(Ce) as pseudomorphoses after monazite-(Ce). |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F Localities: Reported from at least 13 localities in this region. |
| ⓘ Fluorapophyllite-(K) Formula: KCa4(Si8O20)(F,OH) · 8H2O Localities: |
| ⓘ Fluorbritholite-(Y) Formula: (Y,Ca)5(SiO4)3F Habit: Occurs as crystals 5-20cm large crystals, metamict amorphous Colour: Light tan to chocolate brown with greasy to adamantine lustre on fracture surfaces Description: First described as "Britholite-(Y)" by Griffin et al. The analysis published in their paper however shoved that the sample studied had a high content of F (1.18 wt%), thus > 50 apfu and should be a fluorbritholite according to the revision of the nomenclature of the apatite supergroup (Ferraris et al 2010). See also type description of fluorbritholite-(Y) (Pekov et al 2011)
Occurs as crystals 5-20cm large crystals, metamict amorphous. Contains microsopic inclusions of several phases (apatite-CaF, tombarthite-(Y), calcite and possible thalenite-(Y) ? ) |
| ⓘ Fluorite Formula: CaF2 Localities: Reported from at least 37 localities in this region. |
| ⓘ Fluorite var. Yttrofluorite Formula: (Ca1-xYx)F2+x where 0.05< x Localities: |
| ⓘ 'Fluor-uvite-Uvite Series' |
| ⓘ Fourmarierite Formula: Pb(UO2)4O3(OH)4 · 4H2O Localities: Colour: Dark brown to red Description: In concentric zones in "gummite"- pseudomorhs after uraninite |
| ⓘ 'Freibergite Subgroup' Formula: (Ag6,[Ag6]4+)(Cu4 C2+2)Sb4S12S0-1 Locality: Ettedal Mine, Vegårshei, Agder, Norway |
| ⓘ Friedelite Formula: Mn2+8Si6O15(OH,Cl)10 |
| ⓘ 'Gabbronite' |
| ⓘ 'Gadolinite' Localities: Reported from at least 26 localities in this region. |
| ⓘ 'Gadolinite Supergroup' Formula: A2MQ2T2O8φ2 |
| ⓘ Gadolinite-(Y) Formula: Y2Fe2+Be2Si2O10 Localities: Reported from at least 34 localities in this region. Description: Up to 10 cm long crystals |
| ⓘ Gahnite Formula: ZnAl2O4 Localities: Reported from at least 7 localities in this region. |
| ⓘ Galena Formula: PbS Localities: Reported from at least 11 localities in this region. |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 Localities: Reported from at least 59 localities in this region. |
| ⓘ 'Garnierite' |
| ⓘ Gedrite Formula: ◻{Mg2}{Mg3Al2}(Al2Si6O22)(OH)2 Localities: |
| ⓘ Glaucocerinite Formula: (Zn1-xAlx)(OH)2(SO4)x/2 · nH2O |
| ⓘ Goethite Formula: α-Fe3+O(OH) Localities: Reported from at least 14 localities in this region. Description: Occure as pseudomorphoses after pyrite. |
| ⓘ Gold Formula: Au Localities: Reported from at least 8 localities in this region. Description: . |
| ⓘ Gold var. Electrum Formula: (Au,Ag) Localities: |
| ⓘ Grandidierite Formula: (Mg,Fe2+)(Al,Fe3+)3(SiO4)(BO3)O2 Locality: Bøylefoss Bridge, Froland, Agder, Norway |
| ⓘ Graphite Formula: C Localities: Reported from at least 14 localities in this region. Description: Blades up to 2 cm in diametre. |
| ⓘ Grossular Formula: Ca3Al2(SiO4)3 Localities: Reported from at least 6 localities in this region. |
| ⓘ 'Grossular-Pyrope Series' |
| ⓘ Groutite Formula: Mn3+O(OH) Localities: Description: Found as nice needle-shaped crystals, and are identified with x-ray (XRD/XRF?)by Bugge in 1962. |
| ⓘ Gudmundite Formula: FeSbS Locality: Ettedal Mine, Vegårshei, Agder, Norway Description: As inclusions in galena. |
| ⓘ 'Gummite' Localities: |
| ⓘ 'Gummite var. Yttrogummite' |
| ⓘ Gypsum Formula: CaSO4 · 2H2O Localities: |
| ⓘ Hedenbergite ? Formula: CaFe2+Si2O6 Description: Showed to be augite (Nordrum 2000) |
| ⓘ Hellandite-(Y) Formula: (Ca,REE)4Y2Al◻2(B4Si4O22) (OH)2 Locality: Solås Pegmatite, Iveland, Agder, Norway |
| ⓘ Hematite Formula: Fe2O3 Localities: Reported from at least 26 localities in this region. |
| ⓘ Hercynite Formula: Fe2+Al2O4 Localities: |
| ⓘ Hercynite var. Picotite Formula: (Fe,Mg)(Al,Cr)2O4 |
| ⓘ Hessite Formula: Ag2Te Localities: Description: As inclusions to 0,3 mm in galena. |
| ⓘ Heulandite-Ca Formula: (Ca,Na)5(Si27Al9)O72 · 26H2O Localities: Description: Half the crystal analyzed contained calcian heulandite-K (Nordrum et al 2003) |
| ⓘ Heulandite-K Formula: (K,Ca,Na)5(Si27Al9)O72 · 26H2O Localities: Description: In crystals of heulandite (half the crystal analyzed contained calcian heulandite-K , Nordrum et al 2003) |
| ⓘ 'Heulandite Subgroup' Formula: (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O Localities: Reported from at least 10 localities in this region. |
| ⓘ Hisingerite Formula: Fe3+2(Si2O5)(OH)4 · 2H2O Localities: |
| ⓘ 'Högbomite' Formula: (Mg,Fe)2(Al,Ti)5O10 Localities: |
| ⓘ 'Hornblende Root Name Group' Formula: ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 Localities: Reported from at least 20 localities in this region. |
| ⓘ 'Hydrogarnet' Locality: Blengsvatn, Froland, Agder, Norway |
| ⓘ Hydrohalite Formula: NaCl · 2H2O Description: Konnerup-Madsen (1979) describes liquid inclusions in quartz in the Farsund granite. Hydrohalite occurs as a phase in the liquid inclusions below - 7 C degrees, and dissociate again at - 7 to 0,8 degrees C. Hydrohalite, will thus (theoretically) occure naturallly in the upper parts of the granite during cold winter months. |
| ⓘ Hydroxycalciomicrolite ? Formula: Ca1.5Ta2O6(OH) Locality: Landås, Iveland, Agder, Norway Description: Hydroxycalciomicrolite was entered by Van King in 04-02-2014, based on the study by Hogarth (1961) and a chemical anlysis first published in Bjørlykke (1933) (Bjørlykke paper is not listed among the referenmces in in Hogarth 1961).
However, a chemical analysis alone is not enough to identify this as a hydoxylcalciomicrolite, a structural analysis is also needed (cf. Atencio et al., 2010, on the nomenclature on the Pyrochlore supergroup). Knut Edvard larsen comment 03.2022. |
| ⓘ Hydroxylbastnäsite-(La) Formula: (La,Nd,Ce)(CO3)(OH,F) |
| ⓘ 'Hypersthene' Formula: (Mg,Fe)SiO3 Localities: |
| ⓘ 'Iddingsite' Formula: MgO · Fe2O3 · 3SiO2 · 4H2O Locality: Åna-Sira, Flekkefjord, Agder, Norway |
| ⓘ Ilmenite Formula: Fe2+TiO3 Localities: Reported from at least 67 localities in this region. References: |
| ⓘ Ilvaite Formula: CaFe3+Fe2+2(Si2O7)O(OH) Locality: Åna-Sira, Flekkefjord, Agder, Norway Description: Finegrained aggregates < 1 mm in diameter |
| ⓘ Kainosite-(Y) (TL) Formula: Ca2(Y,Ce)2(Si4O12)(CO3) · H2O Localities: |
| ⓘ Kamphaugite-(Y) Formula: Ca(Y,REE)(CO3)2(OH) · H2O Localities: |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 |
| ⓘ Kasolite Formula: Pb(UO2)(SiO4) · H2O Localities: |
| ⓘ Keiviite-(Y) Formula: Y2Si2O7 Localities: Reported from at least 6 localities in this region. Description: First described as Thalenite by Schetelig (1931). later showed to be a beta-phase of Y2Si2O7 with a thortveitite structure (neumann 1985). This is identical with the mineral described as Keiviite -(Y) from Kola, Russia by Voloshin et al (1983) (Gunnar Raade, pers. commentary 1988)
References: |
| ⓘ 'K Feldspar' Localities: Reported from at least 89 localities in this region. |
| ⓘ 'K Feldspar var. Adularia' Formula: KAlSi3O8 Localities: |
| ⓘ Kornerupine Formula: Mg3Al6(Si,Al,B)5O21(OH) Localities: Colour: bluishgreen to pale yellow |
| ⓘ Kyanite Formula: Al2(SiO4)O Localities: |
| ⓘ Langite Formula: Cu4(SO4)(OH)6 · 2H2O Localities: |
| ⓘ Lanthanite-(Nd) Formula: (Nd,La)2(CO3)3 · 8H2O Localities: |
| ⓘ Laumontite Formula: CaAl2Si4O12 · 4H2O Localities: Reported from at least 7 localities in this region. |
| ⓘ Lead Formula: Pb |
| ⓘ 'Lepidolite' Localities: |
| ⓘ Formula: K(AlSi2O6) Locality: Langsæv Mine, Steinsås, Barbudalen, Arendal, Agder, Norway - erroneously reported Description: Probably analcime |
| ⓘ Liandratite Formula: U(Nb,Ta)2O8 Locality: Ivedal, Iveland, Agder, Norway |
| ⓘ 'Limonite' Localities: |
| ⓘ Linnaeite ? Formula: Co2+Co3+2S4 Description: The mineral is not investigated good enough to be shure it's linnaeite, but it belong to the linnaeite group. |
| ⓘ 'Lithian Muscovite' Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Lizardite Formula: Mg3(Si2O5)(OH)4 Locality: Hovden, Bykle, Agder, Norway Colour: yellow Description: yellow spots in carbonate matrix |
| ⓘ Löllingite Formula: FeAs2 Description: As tiny inclusions in blades of abhurite |
| ⓘ Magnesiodumortierite Formula: Mg(Al2OH)(Al2O)2(SiO4)3(BO3) Localities: |
| ⓘ Magnesio-hornblende Formula: ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 Localities: Reported from at least 139 localities in this region. Habit: thin plates in feldspar References: |
| ⓘ Magnetite var. Lodestone Formula: Fe2+Fe3+2O4 Locality: Hammersmark, Sirdal, Agder, Norway |
| ⓘ Magnetite var. Titanium-bearing Magnetite Formula: Fe2+(Fe3+,Ti)2O4 Locality: Åna-Sira, Flekkefjord, Agder, Norway |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 Localities: Reported from at least 14 localities in this region. |
| ⓘ 'Manganese Oxides' ? |
| ⓘ Manganite Formula: Mn3+O(OH) Localities: |
| ⓘ Marcasite Formula: FeS2 Localities: |
| ⓘ Margarite Formula: CaAl2(Al2Si2O10)(OH)2 |
| ⓘ Marialite Formula: Na4Al3Si9O24Cl |
| ⓘ Matildite Formula: AgBiS2 Locality: Ettedal Mine, Vegårshei, Agder, Norway |
| ⓘ Meionite Formula: Ca4Al6Si6O24CO3 Localities: Description: Analysed samples by A.O.Larsen |
| ⓘ Melanterite Formula: Fe2+(H2O)6SO4 · H2O Localities: Description: First descruibed as boothite, but reinvestigation of the results showed it to be melanterite |
| ⓘ Mesolite Formula: Na2Ca2Si9Al6O30 · 8H2O |
| ⓘ 'Metanocerin' |
| ⓘ 'Meteoritic Iron' Description: Meteorite is ~16.6 wt% metallic iron (plus accompanying Ni&Co). |
| ⓘ 'Mica Group' Localities: Reported from at least 6 localities in this region. |
| ⓘ Microcline (TL) Formula: K(AlSi3O8) Localities: Reported from at least 260 localities in this region. Type Locality: Arendal, Agder, Norway |
| ⓘ Microcline var. Amazonite Formula: K(AlSi3O8) Localities: Reported from at least 14 localities in this region. Description: Amazonite from the Landsverk 1 is probably the best found in Norway. The colour can be very intense green, and large pieces are used for cutting cabochons.
In the past many tons of cutting-grade have been mined. A lot of the material was exported to the gemstone industry in Idar-Oberstein, Germany. |
| ⓘ 'Microlite Group' Formula: A2-mTa2X6-wZ-n Localities: Reported from at least 14 localities in this region. Colour: brownish yellow References: Kristiansen, Roy (1993) Nye analyser av norske microlitter [New analyses of Norwegian Microlites]. Mineralogisk-Geologisk Museum - Universitetet i Oslo - Interne notater, Geologisk Museums venner. 207-211analysis by A.V. Voloshin, a bismuthian microlite (s.l.) |
| ⓘ 'Microperthite' |
| ⓘ Milarite Formula: K(◻H2O)Ca2(Be2Al)[Si12O30] Localities: |
| ⓘ Millerite Formula: NiS Habit: Short prismatic Description: Occure in zones close to younger pegmatites that have metamorphed the ore. |
| ⓘ Minium Formula: Pb3O4 |
| ⓘ Molybdenite Formula: MoS2 Localities: Reported from at least 55 localities in this region. Description: Large masses of molybdenite wwiging up to 5 ton has been found. In 1914 a 9 ton mass of quartz and 90% molybdenite was found. |
| ⓘ 'Molybdenite-2H' Formula: MoS2 |
| ⓘ Molybdite ? Formula: MoO3 Description: Sample in the collection of Naturhistorisk Museum in Oslo (from J.Schetelig 1915, labelled molybdite. Neumann (1985) question the identification, might possibly be a ferrimolybdite. |
| ⓘ 'Monazite' Formula: REE(PO4) Localities: Reported from at least 75 localities in this region. |
| ⓘ Monazite-(Ce) Formula: Ce(PO4) Localities: Reported from at least 45 localities in this region. Description: The Landsverk 1 quarry has yielded several specimens with intriguing monazite-(Ce)crystals like this one:
https://www.mindat.org/photo-21294.html
Originally, the monazite was partly/completely hidden under chloritized biotite, which had to be removed. References: |
| ⓘ Monazite-(Nd) Formula: Nd(PO4) Description: Selbekk (2010) reports the presence of Nd-dominated zones in predominantly Ce-rich monazite. He deemed it therefore correct to list monazite-(Nd) as a valid species for this locality.
He did not specify in which of the Rostadheia quarries this discovery was made.
Unfortunately, these quarries are off-limit for collectors, and it is therefor impossible to try to collect more samples for further study. |
| ⓘ Montmorillonite Formula: (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O Localities: |
| ⓘ 'Moonstone' |
| ⓘ ' Locality: Iveland, Agder, Norway - erroneously reported Description: A sample marked "Iveland, Nedenäs (Sic!), Norway" studied by Clark & Fejer (1978) showed to be an ilmenorutile |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 256 localities in this region. |
| ⓘ Muscovite var. Fuchsite Formula: K(Al,Cr)3Si3O10(OH)2 Localities: |
| ⓘ Muscovite var. Illite Formula: K0.65Al2.0[Al0.65Si3.35O10](OH)2 Locality: Tvedestrand, Agder, Norway |
| ⓘ Muscovite var. Iron(II)-bearing muscovite |
| ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 7 localities in this region. |
| ⓘ 'Muscovite-1M' Localities: |
| ⓘ Natrolite Formula: Na2Al2Si3O10 · 2H2O Localities: |
| ⓘ 'Neolite' |
| ⓘ Neotocite Formula: (Mn,Fe,Mg)SiO3 · H2O |
| ⓘ Nickelhexahydrite ? Formula: Ni(SO4) · 6H2O Locality: Evje og Hornnes, Agder, Norway |
| ⓘ Nickeline Formula: NiAs Localities: Description: Small grains together with small silver treads. Described by Vogt (1884, 1886) as "kobbernikkel" |
| ⓘ Okayamalite Formula: Ca2B[BSiO7] Description: Second known occurrence of the mineral.
Okayamalite probably was formed by a desilication-dehydroxylation process of the associated datolite.
|
| ⓘ Opal Formula: SiO2 · nH2O |
| ⓘ Opal var. Opal-AN Formula: SiO2 · nH2O |
| ⓘ Orthoclase Formula: K(AlSi3O8) Localities: Reported from at least 7 localities in this region. |
| ⓘ 'Orthopyroxene Subgroup' Localities: Reported from at least 15 localities in this region. |
| ⓘ Palygorskite Formula: ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O Localities: Description: Observed in a crack in a dike which cossses the pegmatite |
| ⓘ Papikeite (TL) Formula: NaMg2(Mg3Al2}(Al3Si5O22)(OH)2 Type Locality: Papikeite type locality, Ærøya, Arendal, Agder, Norway |
| ⓘ Parauranophane Formula: Ca(UO2)2(SiO3OH)2 · 5H2O Locality: Gloserheia, Froland, Agder, Norway |
| ⓘ Pargasite Formula: NaCa2(Mg4Al)(Si6Al2)O22(OH)2 Localities: |
| ⓘ Pectolite Formula: NaCa2Si3O8(OH) |
| ⓘ Pentlandite Formula: (NixFey)Σ9S8 Localities: |
| ⓘ Perrierite-(Ce) Formula: Ce4MgFe3+2Ti2(Si2O7)2O8 Habit: subhedral Description: 5 cm long, metamict subhedral crystals. Identified by heating and XRD at NHM, Oslo |
| ⓘ Phenakite Formula: Be2SiO4 Locality: Tveit, Iveland, Agder, Norway Description: Vogt (1911) describes phenakite from a pegmatite at Tveit, occuring in pseudomorphoses after beryl together with bertrandite. Possible Tveit 3 |
| ⓘ Phlogopite Formula: KMg3(AlSi3O10)(OH)2 Localities: Reported from at least 18 localities in this region. |
| ⓘ Phlogopite var. Iron-bearing Phlogopite Formula: K(Mg,Fe2+)3AlSi3O10(F,OH)2 Localities: |
| ⓘ Piemontite Formula: (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) Localities: |
| ⓘ 'Pinite' |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 Localities: Reported from at least 232 localities in this region. |
| ⓘ Powellite Formula: Ca(MoO4) |
| ⓘ Prehnite Formula: Ca2Al2Si3O10(OH)2 Localities: Reported from at least 15 localities in this region. |
| ⓘ Preiswerkite Formula: NaMg2Al(Al2Si2O10)(OH)2 Locality: Blengsvatn, Froland, Agder, Norway |
| ⓘ Pumpellyite-(Fe2+) Formula: Ca2Fe2+Al2(Si2O7)(SiO4)(OH,O)2 · H2O |
| ⓘ 'Pumpellyite Subgroup' Formula: Ca2XAl2[Si2O6(OH)][SiO4](OH)2A Localities: Reported from at least 9 localities in this region. |
| ⓘ Pyrargyrite Formula: Ag3SbS3 Locality: Ettedal Mine, Vegårshei, Agder, Norway Description: As inclusions in galena. |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 85 localities in this region. Description: Pyrite occurs predominantly as cubes in the Landsverk 1 quarry.
Considerable amounts have been found in a chloritized zone not far into the quarry in the north wall.
However, nowadays it is getting increasingly harder to get out good crystals, if at all. It might very well be the case that this zone is depleted.
Elsewhere in the quarry, pyrite is rare.
An attractive rarity are pyrite crystals perched on crusts of tiny microcline crystals, sometimes forming a geode. |
| ⓘ Pyrobelonite Formula: PbMn2+(VO4)(OH) |
| ⓘ 'Pyrochlore Group' Formula: A2Nb2(O,OH)6Z Localities: |
| ⓘ 'Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977)' Formula: (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) Locality: Gjerstad, Agder, Norway Description: as inclusion in titanite from a pegmatite |
| ⓘ 'Pyrochlore Group var. Yttropyrochlore (of Hogarth 1977)' Formula: A2Nb2(O,OH)6Z |
| ⓘ 'Pyrochlore Supergroup' Formula: A2-mD2X6-wZ1-n Localities: |
| ⓘ 'Pyrochlore Supergroup var. Betafite (of Hogarth 1977)' Formula: (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) Localities: |
| ⓘ Pyrolusite Formula: Mn4+O2 Localities: Description: In composite groupings of needlelike lustrous crystals. |
| ⓘ Pyrope Formula: Mg3Al2(SiO4)3 Localities: |
| ⓘ Pyrophanite Formula: Mn2+TiO3 Localities: |
| ⓘ 'Pyroxene Group' Formula: ADSi2O6 Localities: Reported from at least 6 localities in this region. |
| ⓘ Pyrrhotite Formula: Fe1-xS Localities: Reported from at least 29 localities in this region. |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 465 localities in this region. Description: Quartz forms beautiful crystals and groups of crystals in the Landsverk 1 quarry, with unusual growth phenomena.
-Combinations with stilpnomelane and/or chlorite
-Gemstone quality rock crystal, citrine and smoky quartz
-Multiple zonated crystals
-Crystals with one or more generations overgrowing a primary crystal covered by stilpnomelane/chlorite
During its lifespan the Landsverk 1 quarry has produced huge amounts of quartz crystals, and has great potential for future finds.
The combination with stilpnomelane seems to be rare worldwide as judging from Mindat, and the quality from Landsverk 1 is superior as compared with that of other localities. |
| ⓘ Quartz var. Amethyst Formula: SiO2 Localities: Åvesland 04 Uranium Mine (Einerkilen 1), Åvesland, Evje og Hornnes, Agder, Norway Landsverk 1 Feldspar Quarry (Jokeli), Landsverk, Evje og Hornnes, Agder, Norway Ljosland 10 Feldspar Quarry (Storsynken), Ljosland, Iveland, Agder, Norway Ljosland 04 (Thortveitittgruva), Knipan (Knipane), Ljosland, Iveland, Agder, Norway Klodeborg og Landvik Quarry, Stoa, Arendal, Agder, Norway |
| ⓘ Quartz var. Citrine Formula: SiO2 |
| ⓘ Quartz var. Rock Crystal Formula: SiO2 Localities: |
| ⓘ Quartz var. Rose Quartz Formula: SiO2 Localities: |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 Localities: Reported from at least 57 localities in this region. |
| ⓘ Ramsdellite Formula: Mn4+O2 Localities: Description: Neumann, H. (1959): Contributions to the mineralogy of Norway No. 1. An introduction. Norsk Geologisk Tidsskrift 39:231-236 |
| ⓘ Ranciéite Formula: (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O |
| ⓘ Rhabdophane-(Ce) Formula: Ce(PO4) · 0.6H2O Localities: Description: As light-brown, fine grained and rounded masses, occuring in spessartine. References: |
| ⓘ Rhodochrosite Formula: MnCO3 Localities: |
| ⓘ Rhodonite Formula: CaMn3Mn[Si5O15] Localities: |
| ⓘ Romanèchite Formula: (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| ⓘ Rozenite Formula: FeSO4 · 4H2O Localities: |
| ⓘ Rutile Formula: TiO2 Localities: Reported from at least 58 localities in this region. |
| ⓘ Rutile var. Ilmenorutile Formula: (Ti,Nb)O2 Localities: Reported from at least 18 localities in this region. |
| ⓘ Rutile var. Nigrine Formula: TiO2 Locality: Fagerliknatten, Vegårshei, Agder, Norway |
| ⓘ Rutile var. Niobium-bearing Rutile Formula: (Ti,Nb)O2 Locality: Håverstad, Iveland, Agder, Norway |
| ⓘ Samarskite-(Y) Formula: YFe3+Nb2O8 Localities: Reported from at least 25 localities in this region. Colour: black to brown. metamict Description: Always surrounded by columbite |
| ⓘ Saponite Formula: Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| ⓘ Sapphirine Formula: Mg4(Mg3Al9)O4[Si3Al9O36] Localities: Reported from at least 7 localities in this region. |
| ⓘ 'Scapolite' Localities: Reported from at least 28 localities in this region. |
| ⓘ 'Scapolite var. Wernerite' |
| ⓘ Schapbachite Formula: Ag0.4Pb0.2Bi0.4S Locality: Ettedal Mine, Vegårshei, Agder, Norway |
| ⓘ 'Scheteligite' Formula: (Ca,Fe,Mn,Sb,Bi,Y)2(Ti,Ta,Nb,W)2(O,OH)7 Description: Bjørlykke (1937) described scheteligite as a new mineral from Torvelona. |
| ⓘ Schoepite Formula: (UO2)8O2(OH)12 · 12H2O Locality: Ås, Evje og Hornnes, Agder, Norway |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Localities: Reported from at least 6 localities in this region. Description: Described as "black tourmaline by BJørlykke (1937) |
| ⓘ Schröckingerite Formula: NaCa3(UO2)(CO3)3(SO4)F · 10H2O Localities: |
| ⓘ Scolecite Formula: CaAl2Si3O10 · 3H2O |
| ⓘ Sepiolite Formula: Mg4(Si6O15)(OH)2 · 6H2O Description: an applegreen mineral showed to consist of a mixture of clinozoisite an sepiolite (Garmo 2003) |
| ⓘ 'Serpentine Subgroup' Formula: D3[Si2O5](OH)4 Localities: Reported from at least 6 localities in this region. |
| ⓘ Siderite Formula: FeCO3 Locality: Kåbuland, Iveland, Agder, Norway Description: Found in "Thorveitittgruva" |
| ⓘ Siderophyllite Formula: KFe2+2Al(Al2Si2O10)(OH)2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Siderophyllite var. Magnesium-bearing Siderophyllite Formula: K(Fe2+,Mg)2Al(Si2Al2)O10(OH)2 Localities: |
| ⓘ Siegenite Formula: CoNi2S4 |
| ⓘ Sillimanite Formula: Al2(SiO4)O Localities: Reported from at least 11 localities in this region. |
| ⓘ Silver Formula: Ag Localities: Reported from at least 7 localities in this region. Habit: Thin treads |
| ⓘ Skutterudite Formula: CoAs3 |
| ⓘ Smithsonite Formula: ZnCO3 Description: As very tiny, white crystals forming a crust as secondary producct on or near sphalerite embedded in quartz matrix. |
| ⓘ Spessartine Formula: Mn2+3Al2(SiO4)3 Localities: Reported from at least 31 localities in this region. |
| ⓘ Sphalerite Formula: ZnS Localities: Reported from at least 16 localities in this region. |
| ⓘ Sphalerite var. Marmatite Formula: (Zn,Fe)S |
| ⓘ Spinel Formula: MgAl2O4 Localities: Reported from at least 15 localities in this region. References: |
| ⓘ Spinel var. Pleonaste Formula: (Mg,Fe)Al2O4 Localities: Description: Scheerer (1845) mention pleonast found in nodules of marble near Kristiansand. Neumann (1985) assumes that this refers to the area around Eg farm |
| ⓘ Staurolite Formula: Fe2+2Al9Si4O23(OH) |
| ⓘ Stellerite Formula: Ca4(Si28Al8)O72 · 28H2O Localities: |
| ⓘ Stephanite Formula: Ag5SbS4 Locality: Ettedal Mine, Vegårshei, Agder, Norway Description: As inclusions in galena, from 0,2 x 0,2 mm to 0,3 x 0,3 mm size. |
| ⓘ Stibnite Formula: Sb2S3 Locality: Aurstad, Farsund, Agder, Norway |
| ⓘ Stilbite-Ca Formula: NaCa4(Si27Al9)O72 · 28H2O Localities: |
| ⓘ 'Stilbite Subgroup' Formula: M6-7[Al8-9Si27-28O72] · nH2O Localities: Reported from at least 13 localities in this region. |
| ⓘ Stilpnomelane Formula: (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| ⓘ Sulphur Formula: S8 Localities: Description: One sample in the collection of Mineralogical Museum of Oslo. |
| ⓘ Sylvite Formula: KCl Description: Konnerup-Madsen (1979) describes sylvite in liquid inclusions in quartz in granites of the Farsund plutonic complex. |
| ⓘ 'Synchysite Group' Description: Occurs as powdery fracture-fillings in a mineral possibly being thorogummite. Possible synchisite-(Ce) |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 Localities: |
| ⓘ 'Tantalite' Formula: (Mn,Fe)(Ta,Nb)2O6 Localities: Reported from at least 10 localities in this region. |
| ⓘ Tantalite-(Fe) Formula: Fe2+Ta2O6 Localities: Description: In the collection of the Natural History Museum, Oslo References: |
| ⓘ Tantalite-(Mn) Formula: Mn2+Ta2O6 Localities: Reported from at least 9 localities in this region. References: |
| ⓘ 'Tapiolite' ? Formula: (Fe,Mn)(Ta,Nb)2O6 Locality: Iveland, Agder, Norway Description: A tapiolite with locality "Iveland", is registred in British Museum (Natural History). |
| ⓘ Tellurobismuthite Formula: Bi2Te3 |
| ⓘ Tengerite-(Y) Formula: Y2(CO3)3 · 2-3H2O Localities: Reported from at least 12 localities in this region. |
| ⓘ 'Tennantite Subgroup' Formula: Cu6(Cu4C2+2)As4S12S |
| ⓘ 'Tennantite-Tetrahedrite Series' Locality: Neskilen Mines, Arendal, Agder, Norway |
| ⓘ Thalénite-(Y) ? Formula: Y3Si3O10F Localities: Reported from at least 8 localities in this region. Description: Found in the "Thalenittbruddet"
It is a high probabality that the metamict mineral that has been described from the pegmatites of Evje-Iveland area as thalenite-(Y), in fact is keiviite-(Y)
(ref: Neumann 1985, p 157 + pers. commentary Gunnar Raade 1988)Neumann, H. (1985): Norges Mineraler. Norges geologiske Undersøkelse Skrifter 68, p 157 + pers. commentary Gunnar Raade 1988 References: |
| ⓘ 'Thomsonite Subgroup' Localities: Habit: Small fibrous, radiating spherulites |
| ⓘ Thorianite Formula: ThO2 Localities: |
| ⓘ Thorite Formula: Th(SiO4) Localities: Reported from at least 28 localities in this region. |
| ⓘ Thorite var. Orangite Formula: Th(SiO4) Localities: |
| ⓘ Thorite var. Thorogummite Formula: (Th,U)(SiO4)1-x(OH)4x Localities: Habit: earthy, soft Colour: yellowish-gray to light brown; cream white Description: Occurs as 2 types: 1-In aggregates with calcite. 2- Cream white earthy pseudomorphs after uraninite cubes |
| ⓘ Thorite var. Uranothorite Formula: (Th,U)SiO4 Localities: |
| ⓘ Thortveitite (TL) Formula: Sc2Si2O7 Localities: Reported from at least 20 localities in this region. Description: Found in september 1910 by Olaus Thortveit in Ljoslandsknipan, identied at Mineralogical-Geologycal Museum of Oslo by Schetelig. But already in 1903, P. Schei found a mineral noted as Epidote?, in Landsverk, Evje, this was later identified as Thortveitit, |
| ⓘ Titanite Formula: CaTi(SiO4)O Localities: Reported from at least 52 localities in this region. |
| ⓘ Titanite var. Keilhauite (FRL) Formula: (Ca,Y3+)(Ti,Al,Fe3+)[SiO4]O Type Locality: Feldspar Quarry, Buøya, Arendal, Agder, Norway |
| ⓘ Titanite var. Yttrium-bearing Titanite (FRL) Formula: (Ca,Y)TiSiO5 Localities: Reported from at least 13 localities in this region. Type Locality: Feldspar Quarry, Buøya, Arendal, Agder, Norway |
| ⓘ ' Formula: Y4(Si,H4)4O12-x(OH)4+2x Localities: Type Locality: Høgetveit Feldspar Quarries, Evje og Hornnes, Agder, Norway Description: Descredited by IMA 2016. A re-examination of original material shows that all samples are heterogeneous, and hence not constituted by a single mineral. IMA Proposal 16-K |
| ⓘ Topaz Formula: Al2(SiO4)(F,OH)2 Localities: Reported from at least 23 localities in this region. |
| ⓘ Torbernite Formula: Cu(UO2)2(PO4)2 · 12H2O Description: Found as small (0,3-1mm) crystals on a loose boulder with strongly altered feldspar (pegmatite). The pegmatite source has not been found. |
| ⓘ Törnebohmite-(Ce) Formula: Ce2Al(SiO4)2(OH) Description: Törnebohmite-(Ce) occured in pseudomorphoses after monazite-(Ce), together with fluocerite-(Ce), Cerianite-(Ce) and a younger generation monazite-(Ce). |
| ⓘ 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z Localities: Reported from at least 28 localities in this region. |
| ⓘ Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 Localities: Reported from at least 7 localities in this region. |
| ⓘ Triplite Formula: Mn2+2(PO4)F References: |
| ⓘ Tschermakite Formula: ◻(Ca2)(Mg3Al2)(Al2Si6O22)(OH)2 |
| ⓘ Tveitite-(Y) Formula: (Y, Na)6Ca6Ca6(Ca,Na)F42 Localities: |
| ⓘ Ullmannite Formula: NiSbS Locality: Ettedal Mine, Vegårshei, Agder, Norway Description: As inclusions in galena, as isolated irregular laths up to 100 µm long.
Cobaltian ullmannite also oocurs as elongated, irregular grains intergrown with pyrrhotite along its margins in galena (Naik et al 1976) |
| ⓘ 'UM2000-35-O:FeNbScTaTi' Formula: (Sc,Fe2+,Fe3+,Mn)(Ti,Sn,Zr)1.5(Nb,Ta,W)1.33O8 |
| ⓘ Uraninite Formula: UO2 Localities: Reported from at least 22 localities in this region. |
| ⓘ Uraninite var. Cleveite Formula: UO2 Localities: |
| ⓘ Uraninite var. Thorian Uraninite Formula: (U,Th)O2 Locality: Auselmyra, Tvedestrand, Agder, Norway |
| ⓘ Uranophane Formula: Ca(UO2)2(SiO3OH)2 · 5H2O Localities: Reported from at least 7 localities in this region. Habit: film; spherulitic aggregates Description: Mostly as 0,10 mm thin film on magnetite |
| ⓘ Vanadinite Formula: Pb5(VO4)3Cl |
| ⓘ Vandendriesscheite Formula: PbU7O22 · 12H2O Habit: aggregates of extremely small crystals Colour: orange-yellow Description: Only found in one sample as aggregates of small crystals on a plate of magnetite. |
| ⓘ Vermiculite Formula: Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| ⓘ Vesuvianite Formula: Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 Localities: Reported from at least 11 localities in this region. Habit: Elongated prismatic or short prismatic crystals up to 7-10 cm with prominent basis {001}and prisms. Forms observed: {001},{110},{210},{100},{111},{331},{101},{312} Colour: Dark greenish brown to caledonian brown Description: Nice dark green crystals to 10cm have been found. References: |
| ⓘ Violarite Formula: Fe2+Ni3+2S4 Localities: |
| ⓘ Vivianite Formula: Fe2+Fe2+2(PO4)2 · 8H2O |
| ⓘ Formula: Ca0.3(Cr,Mg,Fe)2((Si,Al)4O10)(OH)2 · 4H2O Locality: Kleggåsen Ruby Quarry, Froland, Agder, Norway - erroneously reported Colour: green Description: Found at the locality in a small body of strong hydrothermal alteration as a thin green crust around altered corundum crystals.
Nilssen & Raade (1973) found 1.5% Cr2O3 in this clay mineral, and identified it as volkonskoite based on the powder x-ray diffraction pattern. This is obviously too little Cr to qualify as volkonskoite, which requires Cr as a site dominant ion. See Foord et al. (1987) for discussion. |
| ⓘ Willyamite Formula: CoSbS Locality: Ettedal Mine, Vegårshei, Agder, Norway Description: As inclusions in galena, as equidimensional grains up to 60 µm across complexly intergrown with pyrrhotite and breihauptite (Naik et al. 1976) |
| ⓘ Wittichenite Formula: Cu3BiS3 |
| ⓘ Woodwardite Formula: Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| ⓘ Wroewolfeite Formula: Cu4(SO4)(OH)6 · 2H2O |
| ⓘ 'Xenotime' Locality: Gloserheia, Froland, Agder, Norway |
| ⓘ Xenotime-(Y) (TL) Formula: Y(PO4) Localities: Reported from at least 69 localities in this region. Type Locality: Hidra, Flekkefjord, Agder, Norway Description: Berzelius (1828); described as "Phosphorsyrad Ytterjord", with locality given as "Lindesnes" and found by Mr. Tank d.y.(the Yuonger). Name Xenotime first used by F. S. Beudant (1832). Scheerer corrected the type locality information to Hitterø, according to unpublished notes by Mr. Tank. |
| ⓘ Yttrialite-(Y) Formula: (Y,Th)2Si2O7 Localities: Habit: masses Colour: Dark reddish brown, metamict Description: Usually surruonded by biotite and partly covered by a thick crust of tengerite-(Y). Difficult to distingush from Keiviite-(Y) (Thalenite-(Y) in hand specimens.
Chemical composition close to theoretical formula RE2Si2O7 References: |
| ⓘ Yttrotantalite-(Y) Formula: (Y,U,Fe2+)(Ta,Nb)(O,OH)4 Localities: Reported from at least 8 localities in this region. Description: Nb/Ta ratio 0,8 (Frigstad 1968) |
| ⓘ 'Zeolite Group' Locality: Haugen, Evje og Hornnes, Agder, Norway |
| ⓘ 'Zinnwaldite' Localities: |
| ⓘ Zircon Formula: Zr(SiO4) Localities: Reported from at least 90 localities in this region. |
| ⓘ Zircon var. Alvite (FRL) Formula: Zr(SiO4) Localities: Reported from at least 30 localities in this region. Type Locality: Alve Feldspar Quarry, Tromøy, Arendal, Agder, Norway Description: A metamict zircon variety. References: |
| ⓘ Zircon var. Hafnian Zircon Formula: (Zr,Hf)SiO4 Locality: Iveland, Agder, Norway Description: Levinson & Borup describe zircon crystals growing on a thortveitite crystal, that in analysis gives 23% (+/-10%) HfO2. |
| ⓘ Zircon var. Malacon Formula: Zr(SiO4) Localities: Reported from at least 11 localities in this region. |
| ⓘ Zircon var. Oerstedtite (FRL) Formula: Zr(SiO4) Localities: Type Locality: Arendal, Agder, Norway |
| ⓘ Zoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) Localities: |
| ⓘ Zoisite var. Thulite Formula: {Ca2}{Al,Mn3+3}(Si2O7)(SiO4)O(OH) Localities: |
| ⓘ Zoubekite ? Formula: AgPb4Sb4S10 Locality: Ettedal Mine, Vegårshei, Agder, Norway Description: The mineral Naik (1975) describe as Phase C is indistinguishable from zoubekite on available data. |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Copper | 1.AA.05 | Cu |
| ⓘ | Gold | 1.AA.05 | Au |
| ⓘ | Lead | 1.AA.05 | Pb |
| ⓘ | Gold var. Electrum | 1.AA.05 | (Au,Ag) |
| ⓘ | Silver | 1.AA.05 | Ag |
| ⓘ | Bismuth | 1.CA.05 | Bi |
| ⓘ | Graphite | 1.CB.05a | C |
| ⓘ | Sulphur | 1.CC.05 | S8 |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Djurleite | 2.BA.05 | Cu31S16 |
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Digenite | 2.BA.10 | Cu9S5 |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Acanthite | 2.BA.35 | Ag2S |
| ⓘ | Hessite | 2.BA.60 | Ag2Te |
| ⓘ | Pentlandite | 2.BB.15 | (NixFey)Σ9S8 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Sphalerite var. Marmatite | 2.CB.05a | (Zn,Fe)S |
| ⓘ | 2.CB.05a | ZnS | |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Breithauptite | 2.CC.05 | NiSb |
| ⓘ | Nickeline | 2.CC.05 | NiAs |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Millerite | 2.CC.20 | NiS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Violarite | 2.DA.05 | Fe2+Ni3+2S4 |
| ⓘ | Siegenite | 2.DA.05 | CoNi2S4 |
| ⓘ | Linnaeite ? | 2.DA.05 | Co2+Co3+2S4 |
| ⓘ | Stibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Tellurobismuthite | 2.DC.05 | Bi2Te3 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Löllingite | 2.EB.15a | FeAs2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Gudmundite | 2.EB.20 | FeSbS |
| ⓘ | Ullmannite | 2.EB.25 | NiSbS |
| ⓘ | Willyamite | 2.EB.25 | CoSbS |
| ⓘ | Cobaltite | 2.EB.25 | CoAsS |
| ⓘ | Skutterudite | 2.EC.05 | CoAs3 |
| ⓘ | Pyrargyrite | 2.GA.05 | Ag3SbS3 |
| ⓘ | Wittichenite | 2.GA.20 | Cu3BiS3 |
| ⓘ | 'Freibergite Subgroup' | 2.GB.05 | (Ag6,[Ag6]4+)(Cu4 C2+2)Sb4S12S0-1 |
| ⓘ | 'Tennantite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)As4S12S |
| ⓘ | Stephanite | 2.GB.10 | Ag5SbS4 |
| ⓘ | Boulangerite | 2.HC.15 | Pb5Sb4S11 |
| ⓘ | Zoubekite ? | 2.HC.35 | AgPb4Sb4S10 |
| ⓘ | Schapbachite | 2.JA.15 | Ag0.4Pb0.2Bi0.4S |
| ⓘ | Matildite | 2.JA.20 | AgBiS2 |
| Group 3 - Halides | |||
| ⓘ | Sylvite | 3.AA.20 | KCl |
| ⓘ | Fluorite var. Yttrofluorite | 3.AB.25 | (Ca1-xYx)F2+x where 0.05< x |
| ⓘ | 3.AB.25 | CaF2 | |
| ⓘ | Tveitite-(Y) | 3.AB.30 | (Y, Na)6Ca6Ca6(Ca,Na)F42 |
| ⓘ | Cotunnite | 3.AB.85 | PbCl2 |
| ⓘ | Fluocerite-(Ce) | 3.AC.15 | CeF3 |
| ⓘ | Hydrohalite | 3.BA.05 | NaCl · 2H2O |
| ⓘ | Abhurite | 3.DA.30 | Sn21Cl16(OH)14O6 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | 'Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977)' | 4.00. | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| ⓘ | 'Microlite Group' | 4.00. | A2-mTa2X6-wZ-n |
| ⓘ | 'Pyrochlore Group var. Yttropyrochlore (of Hogarth 1977)' | 4.00. | A2Nb2(O,OH)6Z |
| ⓘ | '' | 4.00. | A2Nb2(O,OH)6Z |
| ⓘ | Goethite | 4.00. | α-Fe3+O(OH) |
| ⓘ | Cuprite var. Chalcotrichite | 4.AA.10 | Cu2O |
| ⓘ | 4.AA.10 | Cu2O | |
| ⓘ | Chrysoberyl | 4.BA.05 | BeAl2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Gahnite | 4.BB.05 | ZnAl2O4 |
| ⓘ | Spinel var. Pleonaste | 4.BB.05 | (Mg,Fe)Al2O4 |
| ⓘ | Hercynite | 4.BB.05 | Fe2+Al2O4 |
| ⓘ | var. Picotite | 4.BB.05 | (Fe,Mg)(Al,Cr)2O4 |
| ⓘ | Magnetite var. Lodestone | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Spinel | 4.BB.05 | MgAl2O4 |
| ⓘ | Magnetite var. Titanium-bearing Magnetite | 4.BB.05 | Fe2+(Fe3+,Ti)2O4 |
| ⓘ | Minium | 4.BD.05 | Pb3O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Pyrophanite | 4.CB.05 | Mn2+TiO3 |
| ⓘ | Corundum var. Ruby | 4.CB.05 | Al2O3 |
| ⓘ | 4.CB.05 | Al2O3 | |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Bismite | 4.CB.60 | Bi2O3 |
| ⓘ | Davidite-(La) ? | 4.CC.40 | La(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| ⓘ | Davidite-(Ce) (TL) | 4.CC.40 | Ce(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| ⓘ | Quartz var. Amethyst | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Citrine | 4.DA.05 | SiO2 |
| ⓘ | var. Rose Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Rock Crystal | 4.DA.05 | SiO2 |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | Opal | 4.DA.10 | SiO2 · nH2O |
| ⓘ | var. Opal-AN | 4.DA.10 | SiO2 · nH2O |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | var. Niobium-bearing Rutile | 4.DB.05 | (Ti,Nb)O2 |
| ⓘ | var. Nigrine | 4.DB.05 | TiO2 |
| ⓘ | var. Ilmenorutile | 4.DB.05 | (Ti,Nb)O2 |
| ⓘ | Ramsdellite | 4.DB.15a | Mn4+O2 |
| ⓘ | Samarskite-(Y) | 4.DB.25 | YFe3+Nb2O8 |
| ⓘ | Columbite-(Mn) | 4.DB.35 | Mn2+Nb2O6 |
| ⓘ | Tantalite-(Mn) | 4.DB.35 | Mn2+Ta2O6 |
| ⓘ | Tantalite-(Fe) | 4.DB.35 | Fe2+Ta2O6 |
| ⓘ | Columbite-(Fe) | 4.DB.35 | Fe2+Nb2O6 |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Brookite | 4.DD.10 | TiO2 |
| ⓘ | Aeschynite-(Ce) | 4.DF.05 | (Ce,Ca,Fe,Th)(Ti,Nb)2(O,OH)6 |
| ⓘ | Aeschynite-(Y) (TL) | 4.DF.05 | (Y,Ln,Ca,Th)(Ti,Nb)2(O,OH)6 |
| ⓘ | Fersmite | 4.DG.05 | (Ca,Ce,Na)(Nb,Ta,Ti)2(O,OH,F)6 |
| ⓘ | Euxenite-(Y) | 4.DG.05 | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| ⓘ | Yttrotantalite-(Y) | 4.DG.10 | (Y,U,Fe2+)(Ta,Nb)(O,OH)4 |
| ⓘ | Clinofergusonite-(Y) | 4.DG.10 | YNbO4 |
| ⓘ | Hydroxycalciomicrolite ? | 4.DH.15 | Ca1.5Ta2O6(OH) |
| ⓘ | Liandratite | 4.DH.35 | U(Nb,Ta)2O8 |
| ⓘ | Romanèchite | 4.DK.10 | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| ⓘ | 'Aeschynite Group' | 4.DL.05 | AD2O6 |
| ⓘ | Cerianite-(Ce) | 4.DL.05 | (Ce4+,Th)O2 |
| ⓘ | Thorianite | 4.DL.05 | ThO2 |
| ⓘ | Uraninite var. Thorian Uraninite | 4.DL.05 | (U,Th)O2 |
| ⓘ | var. Cleveite | 4.DL.05 | UO2 |
| ⓘ | 4.DL.05 | UO2 | |
| ⓘ | Molybdite ? | 4.E0.10 | MoO3 |
| ⓘ | Groutite | 4.FD.10 | Mn3+O(OH) |
| ⓘ | Diaspore | 4.FD.10 | AlO(OH) |
| ⓘ | Manganite | 4.FD.15 | Mn3+O(OH) |
| ⓘ | Ranciéite | 4.FL.40 | (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O |
| ⓘ | Schoepite | 4.GA.05 | (UO2)8O2(OH)12 · 12H2O |
| ⓘ | Fourmarierite | 4.GB.25 | Pb(UO2)4O3(OH)4 · 4H2O |
| ⓘ | Vandendriesscheite | 4.GB.40 | PbU7O22 · 12H2O |
| ⓘ | Curite | 4.GB.55 | Pb3(H2O)2[(UO2)4O4(OH)3]2 |
| ⓘ | Carlosbarbosaite | 4.GB.75 | (UO2)2Nb2O6(OH)2 · 2H2O |
| ⓘ | Clarkeite | 4.GC.05 | (Na,Ca,Pb)(UO2)O(OH) · 0-1H2O |
| ⓘ | Carnotite | 4.HB.05 | K2(UO2)2(VO4)2 · 3H2O |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Rhodochrosite | 5.AB.05 | MnCO3 |
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Smithsonite | 5.AB.05 | ZnCO3 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Aurichalcite | 5.BA.15 | (Zn,Cu)5(CO3)2(OH)6 |
| ⓘ | Bastnäsite-(Ce) | 5.BD.20a | Ce(CO3)F |
| ⓘ | Hydroxylbastnäsite-(La) | 5.BD.20a | (La,Nd,Ce)(CO3)(OH,F) |
| ⓘ | Bismutite | 5.BE.25 | (BiO)2CO3 |
| ⓘ | Tengerite-(Y) | 5.CC.10 | Y2(CO3)3 · 2-3H2O |
| ⓘ | Lanthanite-(Nd) | 5.CC.25 | (Nd,La)2(CO3)3 · 8H2O |
| ⓘ | Calcioancylite-(Ce) | 5.DC.05 | (Ce,Ca,Sr)CO3(OH,H2O) |
| ⓘ | Ancylite-(Ce) | 5.DC.05 | CeSr(CO3)2(OH) · H2O |
| ⓘ | Kamphaugite-(Y) | 5.DC.10 | Ca(Y,REE)(CO3)2(OH) · H2O |
| ⓘ | Schröckingerite | 5.EG.05 | NaCa3(UO2)(CO3)3(SO4)F · 10H2O |
| Group 6 - Borates | |||
| ⓘ | Cahnite | 6.AC.70 | Ca2[B(OH)4](AsO4) |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Rozenite | 7.CB.15 | FeSO4 · 4H2O |
| ⓘ | Chalcanthite ? | 7.CB.20 | CuSO4 · 5H2O |
| ⓘ | Nickelhexahydrite ? | 7.CB.25 | Ni(SO4) · 6H2O |
| ⓘ | Melanterite | 7.CB.35 | Fe2+(H2O)6SO4 · H2O |
| ⓘ | Boothite ? | 7.CB.35 | CuSO4 · 7H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Copiapite | 7.DB.35 | Fe2+Fe3+4(SO4)6(OH)2 · 20H2O |
| ⓘ | Langite | 7.DD.10 | Cu4(SO4)(OH)6 · 2H2O |
| ⓘ | Wroewolfeite | 7.DD.10 | Cu4(SO4)(OH)6 · 2H2O |
| ⓘ | Devilline | 7.DD.30 | CaCu4(SO4)2(OH)6 · 3H2O |
| ⓘ | Glaucocerinite | 7.DD.35 | (Zn1-xAlx)(OH)2(SO4)x/2 · nH2O |
| ⓘ | Woodwardite | 7.DD.35 | Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| ⓘ | Fergusonite-(Y) | 7.GA.05 | YNbO4 |
| ⓘ | Powellite | 7.GA.05 | Ca(MoO4) |
| ⓘ | Fergusonite-(Y) var. Risörite | 7.GA.05 | (Y,Er)(Nb,Ti,Ta)(O,OH)4 |
| ⓘ | Ferrimolybdite | 7.GB.30 | Fe2(MoO4)3 · nH2O |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Xenotime-(Y) (TL) | 8.AD.35 | Y(PO4) |
| ⓘ | Chernovite-(Y) | 8.AD.35 | Y(AsO4) |
| ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| ⓘ | Monazite-(Nd) | 8.AD.50 | Nd(PO4) |
| ⓘ | Triplite | 8.BB.10 | Mn2+2(PO4)F |
| ⓘ | Pyrobelonite | 8.BH.40 | PbMn2+(VO4)(OH) |
| ⓘ | Chlorapatite | 8.BN.05 | Ca5(PO4)3Cl |
| ⓘ | Vanadinite | 8.BN.05 | Pb5(VO4)3Cl |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Vivianite | 8.CE.40 | Fe2+Fe2+2(PO4)2 · 8H2O |
| ⓘ | Rhabdophane-(Ce) | 8.CJ.45 | Ce(PO4) · 0.6H2O |
| ⓘ | Churchite-(Y) | 8.CJ.50 | Y(PO4) · 2H2O |
| ⓘ | Torbernite | 8.EB.05 | Cu(UO2)2(PO4)2 · 12H2O |
| Group 9 - Silicates | |||
| ⓘ | Chrysotile | 9.. | Mg3(Si2O5)(OH)4 |
| ⓘ | Phenakite | 9.AA.05 | Be2SiO4 |
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Pyrope | 9.AD.25 | Mg3Al2(SiO4)3 |
| ⓘ | Andradite var. Colophonite | 9.AD.25 | Ca3Fe3+2(SiO4)3 |
| ⓘ | Grossular | 9.AD.25 | Ca3Al2(SiO4)3 |
| ⓘ | Andradite | 9.AD.25 | Ca3Fe3+2(SiO4)3 |
| ⓘ | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| ⓘ | Zircon var. Alvite (TL) | 9.AD.30 | Zr(SiO4) |
| ⓘ | var. Malacon | 9.AD.30 | Zr(SiO4) |
| ⓘ | 9.AD.30 | Zr(SiO4) | |
| ⓘ | var. Oerstedtite (TL) | 9.AD.30 | Zr(SiO4) |
| ⓘ | Coffinite | 9.AD.30 | U(SiO4) · nH2O |
| ⓘ | Zircon var. Hafnian Zircon | 9.AD.30 | (Zr,Hf)SiO4 |
| ⓘ | Thorite | 9.AD.30 | Th(SiO4) |
| ⓘ | var. Thorogummite | 9.AD.30 | (Th,U)(SiO4)1-x(OH)4x |
| ⓘ | var. Uranothorite | 9.AD.30 | (Th,U)SiO4 |
| ⓘ | var. Orangite | 9.AD.30 | Th(SiO4) |
| ⓘ | 'Tombarthite-(Y)' ? (TL) | 9.AD.35 | Y4(Si,H4)4O12-x(OH)4+2x |
| ⓘ | Euclase | 9.AE.10 | BeAl(SiO4)(OH) |
| ⓘ | Sillimanite | 9.AF.05 | Al2(SiO4)O |
| ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | Kyanite | 9.AF.15 | Al2(SiO4)O |
| ⓘ | Staurolite | 9.AF.30 | Fe2+2Al9Si4O23(OH) |
| ⓘ | Topaz | 9.AF.35 | Al2(SiO4)(F,OH)2 |
| ⓘ | Chondrodite | 9.AF.45 | Mg5(SiO4)2F2 |
| ⓘ | Clinohumite | 9.AF.55 | Mg9(SiO4)4F2 |
| ⓘ | Braunite | 9.AG.05 | Mn2+Mn3+6(SiO4)O8 |
| ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
| ⓘ | var. Yttrium-bearing Titanite (TL) | 9.AG.15 | (Ca,Y)TiSiO5 |
| ⓘ | var. Keilhauite (TL) | 9.AG.15 | (Ca,Y3+)(Ti,Al,Fe3+)[SiO4]O |
| ⓘ | Törnebohmite-(Ce) | 9.AG.45 | Ce2Al(SiO4)2(OH) |
| ⓘ | Fluorbritholite-(Y) | 9.AH.25 | (Y,Ca)5(SiO4)3F |
| ⓘ | Britholite-(Y) ? | 9.AH.25 | (Y,Ca)5(SiO4)3OH |
| ⓘ | Grandidierite | 9.AJ.05 | (Mg,Fe2+)(Al,Fe3+)3(SiO4)(BO3)O2 |
| ⓘ | Dumortierite | 9.AJ.10 | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| ⓘ | Magnesiodumortierite | 9.AJ.10 | Mg(Al2OH)(Al2O)2(SiO4)3(BO3) |
| ⓘ | Datolite var. Botryolite (TL) | 9.AJ.20 | CaB(SiO4)(OH) |
| ⓘ | Gadolinite-(Y) | 9.AJ.20 | Y2Fe2+Be2Si2O10 |
| ⓘ | Datolite (TL) | 9.AJ.20 | CaB(SiO4)(OH) |
| ⓘ | Kasolite | 9.AK.15 | Pb(UO2)(SiO4) · H2O |
| ⓘ | Parauranophane | 9.AK.15 | Ca(UO2)2(SiO3OH)2 · 5H2O |
| ⓘ | Uranophane | 9.AK.15 | Ca(UO2)2(SiO3OH)2 · 5H2O |
| ⓘ | Okayamalite | 9.BB.10 | Ca2B[BSiO7] |
| ⓘ | Yttrialite-(Y) | 9.BC.05 | (Y,Th)2Si2O7 |
| ⓘ | Keiviite-(Y) | 9.BC.05 | Y2Si2O7 |
| ⓘ | Thortveitite (TL) | 9.BC.05 | Sc2Si2O7 |
| ⓘ | Bertrandite | 9.BD.05 | Be4(Si2O7)(OH)2 |
| ⓘ | Axinite-(Fe) | 9.BD.20 | Ca2Fe2+Al2BSi4O15OH |
| ⓘ | Axinite-(Mn) | 9.BD.20 | Ca2Mn2+Al2BSi4O15(OH) |
| ⓘ | Ilvaite | 9.BE.07 | CaFe3+Fe2+2(Si2O7)O(OH) |
| ⓘ | Perrierite-(Ce) | 9.BE.70 | Ce4MgFe3+2Ti2(Si2O7)2O8 |
| ⓘ | Clinozoisite | 9.BG.05a | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Piemontite | 9.BG.05a | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| ⓘ | Epidote var. Withamite ? | 9.BG.05a | {Ca2}{Al2(Fe3+,Mn)}(Si2O7)(SiO4)O(OH) |
| ⓘ | Allanite-(Ce) | 9.BG.05b | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ | Zoisite | 9.BG.10 | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | var. Thulite | 9.BG.10 | {Ca2}{Al,Mn3+3}(Si2O7)(SiO4)O(OH) |
| ⓘ | Pumpellyite-(Fe2+) | 9.BG.20 | Ca2Fe2+Al2(Si2O7)(SiO4)(OH,O)2 · H2O |
| ⓘ | Vesuvianite | 9.BG.35 | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ | Cyprine ? | 9.BG.35 | Ca19Cu2+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10](OH)(OH)9 |
| ⓘ | Thalénite-(Y) ? | 9.BJ.20 | Y3Si3O10F |
| ⓘ | Kornerupine | 9.BJ.50 | Mg3Al6(Si,Al,B)5O21(OH) |
| ⓘ | Kainosite-(Y) (TL) | 9.CF.10 | Ca2(Y,Ce)2(Si4O12)(CO3) · H2O |
| ⓘ | Beryl var. Heliodor | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | var. Aquamarine | 9.CJ.05 | Be3Al2Si6O18 |
| ⓘ | 9.CJ.05 | Be3Al2(Si6O18) | |
| ⓘ | Cordierite | 9.CJ.10 | (Mg,Fe)2Al3(AlSi5O18) |
| ⓘ | var. Iolite | 9.CJ.10 | (Mg,Fe)2Al3(AlSi5O18) |
| ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Elbaite ? | 9.CK.05 | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Milarite | 9.CM.05 | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| ⓘ | Ferrosilite | 9.DA.05 | Fe2+2Si2O6 |
| ⓘ | Enstatite | 9.DA.05 | Mg2Si2O6 |
| ⓘ | Augite | 9.DA.15 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ | Diopside var. Salite | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Hedenbergite ? | 9.DA.15 | CaFe2+Si2O6 |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Anthophyllite | 9.DD.05 | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| ⓘ | Papikeite (TL) | 9.DD.05 | NaMg2(Mg3Al2}(Al3Si5O22)(OH)2 |
| ⓘ | Gedrite | 9.DD.05 | ◻{Mg2}{Mg3Al2}(Al2Si6O22)(OH)2 |
| ⓘ | Cummingtonite | 9.DE.05 | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Ferro-actinolite | 9.DE.10 | ◻Ca2Fe2+5(Si8O22)(OH)2 |
| ⓘ | Ferro-hornblende | 9.DE.10 | ◻Ca2(Fe2+4Al)(Si7Al)O22(OH)2 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Magnesio-hornblende | 9.DE.10 | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| ⓘ | Tschermakite | 9.DE.10 | ◻(Ca2)(Mg3Al2)(Al2Si6O22)(OH)2 |
| ⓘ | Pargasite | 9.DE.15 | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| ⓘ | Bavenite | 9.DF.25 | Ca4Be2Al2Si9O26(OH)2 |
| ⓘ | Pectolite | 9.DG.05 | NaCa2Si3O8(OH) |
| ⓘ | Sapphirine | 9.DH.45 | Mg4(Mg3Al9)O4[Si3Al9O36] |
| ⓘ | Rhodonite | 9.DK.05 | CaMn3Mn[Si5O15] |
| ⓘ | Babingtonite (TL) | 9.DK.05 | Ca2(Fe,Mn)FeSi5O14(OH) |
| ⓘ | Hellandite-(Y) | 9.DK.20 | (Ca,REE)4Y2Al◻2(B4Si4O22) (OH)2 |
| ⓘ | Prehnite | 9.DP.20 | Ca2Al2Si3O10(OH)2 |
| ⓘ | Fluorapophyllite-(K) | 9.EA.15 | KCa4(Si8O20)(F,OH) · 8H2O |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Muscovite var. Fuchsite | 9.EC.15 | K(Al,Cr)3Si3O10(OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | var. Iron(II)-bearing muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | var. Illite | 9.EC.15 | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ | Preiswerkite | 9.EC.20 | NaMg2Al(Al2Si2O10)(OH)2 |
| ⓘ | Siderophyllite | 9.EC.20 | KFe2+2Al(Al2Si2O10)(OH)2 |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Siderophyllite var. Magnesium-bearing Siderophyllite | 9.EC.20 | K(Fe2+,Mg)2Al(Si2Al2)O10(OH)2 |
| ⓘ | Phlogopite var. Iron-bearing Phlogopite | 9.EC.20 | K(Mg,Fe2+)3AlSi3O10(F,OH)2 |
| ⓘ | Margarite | 9.EC.30 | CaAl2(Al2Si2O10)(OH)2 |
| ⓘ | Bityite | 9.EC.35 | CaLiAl2(AlBeSi2O10)(OH)2 |
| ⓘ | Montmorillonite | 9.EC.40 | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ | Beidellite ? | 9.EC.40 | (Na,Ca0.5)0.3Al2((Si,Al)4O10)(OH)2 · nH2O |
| ⓘ | Volkonskoite ? | 9.EC.40 | Ca0.3(Cr,Mg,Fe)2((Si,Al)4O10)(OH)2 · 4H2O |
| ⓘ | Saponite | 9.EC.45 | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| ⓘ | Vermiculite | 9.EC.50 | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| ⓘ | Chamosite | 9.EC.55 | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Hisingerite | 9.ED.10 | Fe3+2(Si2O5)(OH)4 · 2H2O |
| ⓘ | Lizardite | 9.ED.15 | Mg3(Si2O5)(OH)4 |
| ⓘ | Antigorite | 9.ED.15 | Mg3(Si2O5)(OH)4 |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Neotocite | 9.ED.20 | (Mn,Fe,Mg)SiO3 · H2O |
| ⓘ | Allophane | 9.ED.20 | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| ⓘ | Friedelite | 9.EE.10 | Mn2+8Si6O15(OH,Cl)10 |
| ⓘ | Palygorskite | 9.EE.20 | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| ⓘ | Sepiolite | 9.EE.25 | Mg4(Si6O15)(OH)2 · 6H2O |
| ⓘ | Stilpnomelane | 9.EG.40 | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| ⓘ | 'Chalcodite' | 9.EG.40 | K(Fe3+,Mg,Fe2+)8(Si,Al)12(O,OH)27 |
| ⓘ | Microcline (TL) | 9.FA.30 | K(AlSi3O8) |
| ⓘ | var. Amazonite | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite var. Oligoclase | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ | var. Oligoclase-Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Peristerite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | 9.FA.35 | Na(AlSi3O8) | |
| ⓘ | var. Cleavelandite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Andesine | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ | Marialite | 9.FB.15 | Na4Al3Si9O24Cl |
| ⓘ | Meionite | 9.FB.15 | Ca4Al6Si6O24CO3 |
| ⓘ | 'Zeolite Group' | 9.G0. | |
| ⓘ | Natrolite | 9.GA.05 | Na2Al2Si3O10 · 2H2O |
| ⓘ | Mesolite | 9.GA.05 | Na2Ca2Si9Al6O30 · 8H2O |
| ⓘ | Scolecite | 9.GA.05 | CaAl2Si3O10 · 3H2O |
| ⓘ | Analcime | 9.GB.05 | Na(AlSi2O6) · H2O |
| ⓘ | Leucite ? | 9.GB.05 | K(AlSi2O6) |
| ⓘ | Laumontite | 9.GB.10 | CaAl2Si4O12 · 4H2O |
| ⓘ | Chabazite-Ca | 9.GD.10 | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| ⓘ | Heulandite-K | 9.GE.05 | (K,Ca,Na)5(Si27Al9)O72 · 26H2O |
| ⓘ | Heulandite-Ca | 9.GE.05 | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| ⓘ | Stilbite-Ca | 9.GE.10 | NaCa4(Si27Al9)O72 · 28H2O |
| ⓘ | Stellerite | 9.GE.15 | Ca4(Si28Al8)O72 · 28H2O |
| ⓘ | 'Atheriastite' | 9.HA.52 | near Ca5MgFeAl6Si8O32 · 5H2O |
| Unclassified | |||
| ⓘ | 'Scapolite var. Wernerite' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| ⓘ | 'Axinite Group' | - | |
| ⓘ | 'Pyrochlore Supergroup var. Betafite (of Hogarth 1977)' | - | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| ⓘ | 'Gummite var. Yttrogummite' | - | |
| ⓘ | 'Grossular-Pyrope Series' | - | |
| ⓘ | 'Microperthite' | - | |
| ⓘ | 'Pyrochlore Supergroup' | - | A2-mD2X6-wZ1-n |
| ⓘ | 'Molybdenite-2H' | - | MoS2 |
| ⓘ | 'Mossite' ? | - | |
| ⓘ | 'Thomsonite Subgroup' | - | |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chabazite' | - | |
| ⓘ | 'Manganese Oxides' ? | - | |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Davidite' | - | |
| ⓘ | 'Lithian Muscovite' | - | KAl2(AlSi3O10)(OH)2 |
| ⓘ | 'Serpentine Subgroup' | - | D3[Si2O5](OH)4 |
| ⓘ | 'Feldspar Group var. Sunstone' | - | |
| ⓘ | 'Orthopyroxene Subgroup' | - | |
| ⓘ | 'Britholite Group' | - | (REE,Ca)5[(Si,P)O4]3X |
| ⓘ | 'Ancylite Group' | - | (M3+ xM2+2-x)(CO3)2[(OH)x · (2-x)H2O] |
| ⓘ | 'Hydrogarnet' | - | |
| ⓘ | 'Amphibole Supergroup' | - | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ | 'K Feldspar var. Adularia' | - | KAlSi3O8 |
| ⓘ | 'Aeschynite' | - | |
| ⓘ | 'Farsundite' | - | |
| ⓘ | 'Gadolinite Supergroup' | - | A2MQ2T2O8φ2 |
| ⓘ | 'Euxenite Group' | - | |
| ⓘ | 'Alkali Feldspar' | - | |
| ⓘ | 'Allanite Group' | - | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| ⓘ | 'Coal blend' | - | |
| ⓘ | 'Euxenite-(Y)-Polycrase-(Y) Series' | - | |
| ⓘ | 'Synchysite Group' | - | |
| ⓘ | 'Feldspar Group var. Antiperthite' | - | |
| ⓘ | 'Neolite' | - | |
| ⓘ | 'Apophyllite Group' | - | AB4[Si8O22]X · 8H2O |
| ⓘ | 'Metanocerin' | - | |
| ⓘ | 'Asbestos' | - | |
| ⓘ | 'Anthophyllite-Gedrite Series' | - | |
| ⓘ | 'Fergusonite' | - | |
| ⓘ | 'Bastnäsite' | - | (Ce/Nd/Y/REE)(CO3)F |
| ⓘ | 'Muscovite-1M' | - | |
| ⓘ | 'Garnierite' | - | |
| ⓘ | 'Gadolinite' | - | |
| ⓘ | 'Meteoritic Iron' | - | |
| ⓘ | 'Epidote Supergroup' | - | (A1A2)(M1M2M3)O4[Si2O7][SiO4]O10 |
| ⓘ | 'Almandine-Pyrope Series' | - | |
| ⓘ | 'Lepidolite' | - | |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Clinopyroxene Subgroup' | - | |
| ⓘ | 'Iddingsite' | - | MgO · Fe2O3 · 3SiO2 · 4H2O |
| ⓘ | 'Mica Group' | - | |
| ⓘ | 'Almandine-Pyrope Series var. Rhodolite' | - | Mg3Al2(SiO4)3 |
| ⓘ | 'Monazite' | - | REE(PO4) |
| ⓘ | 'Feldspar Group var. Perthite' | - | |
| ⓘ | 'Xenotime' | - | |
| ⓘ | 'Andradite-Grossular Series' | - | |
| ⓘ | 'Moonstone' | - | |
| ⓘ | 'Pumpellyite Subgroup' | - | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| ⓘ | 'Scheteligite' | - | (Ca,Fe,Mn,Sb,Bi,Y)2(Ti,Ta,Nb,W)2(O,OH)7 |
| ⓘ | 'Stilbite Subgroup' | - | M6-7[Al8-9Si27-28O72] · nH2O |
| ⓘ | 'Tantalite' | - | (Mn,Fe)(Ta,Nb)2O6 |
| ⓘ | 'Tapiolite' ? | - | (Fe,Mn)(Ta,Nb)2O6 |
| ⓘ | 'Zinnwaldite' | - | |
| ⓘ | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
| ⓘ | 'Amphibole Supergroup var. Uralite' | - | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ | 'Almandine-Spessartine Series' | - | |
| ⓘ | 'Hypersthene' | - | (Mg,Fe)SiO3 |
| ⓘ | 'Delessite' | - | (Mg,Fe,Fe,Al)(Si,Al)4O10(O,OH)8 |
| ⓘ | 'Pyroxene Group' | - | ADSi2O6 |
| ⓘ | 'Tennantite-Tetrahedrite Series' | - | |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Apatite var. Moroxite' | - | Ca5(PO4)3(Cl/F/OH) |
| ⓘ | 'Fluor-uvite-Uvite Series' | - | |
| ⓘ | 'Columbite-Tantalite' | - | |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Gabbronite' | - | |
| ⓘ | 'Gummite' | - | |
| ⓘ | 'Heulandite Subgroup' | - | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Fayalite-Forsterite Series' | - | |
| ⓘ | 'Pinite' | - | |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'Högbomite' | - | (Mg,Fe)2(Al,Ti)5O10 |
| ⓘ | 'Ancylite' | - | |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| ⓘ | 'Scapolite' | - | |
| ⓘ | 'Dravite-Schorl Series' | - | |
| ⓘ | 'Columbite-(Fe)-Tantalite-(Fe) Series' | - | |
| ⓘ | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
| ⓘ | 'UM2000-35-O:FeNbScTaTi' | - | (Sc,Fe2+,Fe3+,Mn)(Ti,Sn,Zr)1.5(Nb,Ta,W)1.33O8 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Abhurite | Sn21Cl16(OH)14O6 |
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Aeschynite-(Ce) | (Ce,Ca,Fe,Th)(Ti,Nb)2(O,OH)6 |
| H | ⓘ Aeschynite-(Y) | (Y,Ln,Ca,Th)(Ti,Nb)2(O,OH)6 |
| H | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| H | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| H | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| H | ⓘ Analcime | Na(AlSi2O6) · H2O |
| H | ⓘ Ancylite-(Ce) | CeSr(CO3)2(OH) · H2O |
| H | ⓘ Anthophyllite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| H | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| H | ⓘ Apophyllite Group | AB4[Si8O22]X · 8H2O |
| H | ⓘ Atheriastite | near Ca5MgFeAl6Si8O32 · 5H2O |
| H | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Babingtonite | Ca2(Fe,Mn)FeSi5O14(OH) |
| H | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| H | ⓘ Beidellite | (Na,Ca0.5)0.3Al2((Si,Al)4O10)(OH)2 · nH2O |
| H | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| H | ⓘ Pyrochlore Supergroup var. Betafite (of Hogarth 1977) | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Bityite | CaLiAl2(AlBeSi2O10)(OH)2 |
| H | ⓘ Boothite | CuSO4 · 7H2O |
| H | ⓘ Britholite-(Y) | (Y,Ca)5(SiO4)3OH |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Cahnite | Ca2[B(OH)4](AsO4) |
| H | ⓘ Calcioancylite-(Ce) | (Ce,Ca,Sr)CO3(OH,H2O) |
| H | ⓘ Carnotite | K2(UO2)2(VO4)2 · 3H2O |
| H | ⓘ Chalcanthite | CuSO4 · 5H2O |
| H | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| H | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Churchite-(Y) | Y(PO4) · 2H2O |
| H | ⓘ Clarkeite | (Na,Ca,Pb)(UO2)O(OH) · 0-1H2O |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Coffinite | U(SiO4) · nH2O |
| H | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| H | ⓘ Cummingtonite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| H | ⓘ Curite | Pb3(H2O)2[(UO2)4O4(OH)3]2 |
| H | ⓘ Davidite-(Ce) | Ce(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| H | ⓘ Davidite-(La) | La(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| H | ⓘ Delessite | (Mg,Fe,Fe,Al)(Si,Al)4O10(O,OH)8 |
| H | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| H | ⓘ Diaspore | AlO(OH) |
| H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Datolite | CaB(SiO4)(OH) |
| H | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Euclase | BeAl(SiO4)(OH) |
| H | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| H | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| H | ⓘ Ferro-actinolite | ◻Ca2Fe52+(Si8O22)(OH)2 |
| H | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| H | ⓘ Fersmite | (Ca,Ce,Na)(Nb,Ta,Ti)2(O,OH,F)6 |
| H | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| H | ⓘ Fourmarierite | Pb(UO2)4O3(OH)4 · 4H2O |
| H | ⓘ Friedelite | Mn82+Si6O15(OH,Cl)10 |
| H | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| H | ⓘ Gedrite | ◻{Mg2}{Mg3Al2}(Al2Si6O22)(OH)2 |
| H | ⓘ Glaucocerinite | (Zn1-xAlx)(OH)2(SO4)x/2 · nH2O |
| H | ⓘ Goethite | α-Fe3+O(OH) |
| H | ⓘ Groutite | Mn3+O(OH) |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Hellandite-(Y) | (Ca,REE)4Y2Al◻2(B4Si4O22) (OH)2 |
| H | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| H | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| H | ⓘ Opal var. Opal-AN | SiO2 · nH2O |
| H | ⓘ Hydrohalite | NaCl · 2H2O |
| H | ⓘ Hydroxylbastnäsite-(La) | (La,Nd,Ce)(CO3)(OH,F) |
| H | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| H | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| H | ⓘ Kainosite-(Y) | Ca2(Y,Ce)2(Si4O12)(CO3) · H2O |
| H | ⓘ Kamphaugite-(Y) | Ca(Y,REE)(CO3)2(OH) · H2O |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Kasolite | Pb(UO2)(SiO4) · H2O |
| H | ⓘ Kornerupine | Mg3Al6(Si,Al,B)5O21(OH) |
| H | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| H | ⓘ Lanthanite-(Nd) | (Nd,La)2(CO3)3 · 8H2O |
| H | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| H | ⓘ Lizardite | Mg3(Si2O5)(OH)4 |
| H | ⓘ Magnesiodumortierite | Mg(Al2OH)(Al2O)2(SiO4)3(BO3) |
| H | ⓘ Axinite-(Mn) | Ca2Mn2+Al2BSi4O15(OH) |
| H | ⓘ Manganite | Mn3+O(OH) |
| H | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| H | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
| H | ⓘ Mesolite | Na2Ca2Si9Al6O30 · 8H2O |
| H | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| H | ⓘ Neotocite | (Mn,Fe,Mg)SiO3 · H2O |
| H | ⓘ Nickelhexahydrite | Ni(SO4) · 6H2O |
| H | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| H | ⓘ Opal | SiO2 · nH2O |
| H | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| H | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| H | ⓘ Pectolite | NaCa2Si3O8(OH) |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| H | ⓘ Preiswerkite | NaMg2Al(Al2Si2O10)(OH)2 |
| H | ⓘ Pumpellyite Subgroup | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| H | ⓘ Pumpellyite-(Fe2+) | Ca2Fe2+Al2(Si2O7)(SiO4)(OH,O)2 · H2O |
| H | ⓘ Pyrobelonite | PbMn2+(VO4)(OH) |
| H | ⓘ Pyrochlore Group | A2Nb2(O,OH)6Z |
| H | ⓘ Ranciéite | (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O |
| H | ⓘ Rhabdophane-(Ce) | Ce(PO4) · 0.6H2O |
| H | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| H | ⓘ Rozenite | FeSO4 · 4H2O |
| H | ⓘ Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| H | ⓘ Scheteligite | (Ca,Fe,Mn,Sb,Bi,Y)2(Ti,Ta,Nb,W)2(O,OH)7 |
| H | ⓘ Schoepite | (UO2)8O2(OH)12 · 12H2O |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Schröckingerite | NaCa3(UO2)(CO3)3(SO4)F · 10H2O |
| H | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
| H | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| H | ⓘ Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| H | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| H | ⓘ Stellerite | Ca4(Si28Al8)O72 · 28H2O |
| H | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| H | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Tengerite-(Y) | Y2(CO3)3 · 2-3H2O |
| H | ⓘ Thorite var. Thorogummite | (Th,U)(SiO4)1-x(OH)4x |
| H | ⓘ Zoisite var. Thulite | {Ca2}{Al,Mn33+}(Si2O7)(SiO4)O(OH) |
| H | ⓘ Tombarthite-(Y) | Y4(Si,H4)4O12-x(OH)4+2x |
| H | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| H | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| H | ⓘ Törnebohmite-(Ce) | Ce2Al(SiO4)2(OH) |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Tschermakite | ◻(Ca2)(Mg3Al2)(Al2Si6O22)(OH)2 |
| H | ⓘ Amphibole Supergroup var. Uralite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| H | ⓘ Parauranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| H | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| H | ⓘ Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| H | ⓘ Vandendriesscheite | PbU7O22 · 12H2O |
| H | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| H | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| H | ⓘ Volkonskoite | Ca0.3(Cr,Mg,Fe)2((Si,Al)4O10)(OH)2 · 4H2O |
| H | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| H | ⓘ Woodwardite | Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| H | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| H | ⓘ Pyrochlore Group var. Yttropyrochlore (of Hogarth 1977) | A2Nb2(O,OH)6Z |
| H | ⓘ Yttrotantalite-(Y) | (Y,U,Fe2+)(Ta,Nb)(O,OH)4 |
| H | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| H | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| H | ⓘ Heulandite-K | (K,Ca,Na)5(Si27Al9)O72 · 26H2O |
| H | ⓘ Iddingsite | MgO · Fe2O3 · 3SiO2 · 4H2O |
| H | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| H | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Fergusonite-(Y) var. Risörite | (Y,Er)(Nb,Ti,Ta)(O,OH)4 |
| H | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| H | ⓘ Lithian Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Phlogopite var. Iron-bearing Phlogopite | K(Mg,Fe2+)3AlSi3O10(F,OH)2 |
| H | ⓘ Epidote var. Withamite | {Ca2}{Al2(Fe3+,Mn)}(Si2O7)(SiO4)O(OH) |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| H | ⓘ Chalcodite | K(Fe3+,Mg,Fe2+)8(Si,Al)12(O,OH)27 |
| H | ⓘ Ancylite Group | (M3+ xM2+2-x)(CO3)2[(OH)x · (2-x)H2O] |
| H | ⓘ Carlosbarbosaite | (UO2)2Nb2O6(OH)2 · 2H2O |
| H | ⓘ Hydroxycalciomicrolite | Ca1.5Ta2O6(OH) |
| H | ⓘ Papikeite | NaMg2(Mg3Al2}(Al3Si5O22)(OH)2 |
| H | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| H | ⓘ Cyprine | Ca19Cu2+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10](OH)(OH)9 |
| H | ⓘ Siderophyllite var. Magnesium-bearing Siderophyllite | K(Fe2+,Mg)2Al(Si2Al2)O10(OH)2 |
| Li | Lithium | |
| Li | ⓘ Bityite | CaLiAl2(AlBeSi2O10)(OH)2 |
| Li | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Be | Beryllium | |
| Be | ⓘ Beryl var. Aquamarine | Be3Al2Si6O18 |
| Be | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| Be | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| Be | ⓘ Bityite | CaLiAl2(AlBeSi2O10)(OH)2 |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| Be | ⓘ Chrysoberyl | BeAl2O4 |
| Be | ⓘ Euclase | BeAl(SiO4)(OH) |
| Be | ⓘ Gadolinite-(Y) | Y2Fe2+Be2Si2O10 |
| Be | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| Be | ⓘ Phenakite | Be2SiO4 |
| Be | ⓘ Beryl var. Heliodor | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Cahnite | Ca2[B(OH)4](AsO4) |
| B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| B | ⓘ Datolite | CaB(SiO4)(OH) |
| B | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| B | ⓘ Grandidierite | (Mg,Fe2+)(Al,Fe3+)3(SiO4)(BO3)O2 |
| B | ⓘ Hellandite-(Y) | (Ca,REE)4Y2Al◻2(B4Si4O22) (OH)2 |
| B | ⓘ Kornerupine | Mg3Al6(Si,Al,B)5O21(OH) |
| B | ⓘ Magnesiodumortierite | Mg(Al2OH)(Al2O)2(SiO4)3(BO3) |
| B | ⓘ Axinite-(Mn) | Ca2Mn2+Al2BSi4O15(OH) |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| B | ⓘ Okayamalite | Ca2B[BSiO7] |
| C | Carbon | |
| C | ⓘ Ancylite-(Ce) | CeSr(CO3)2(OH) · H2O |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| C | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| C | ⓘ Bismutite | (BiO)2CO3 |
| C | ⓘ Calcioancylite-(Ce) | (Ce,Ca,Sr)CO3(OH,H2O) |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Graphite | C |
| C | ⓘ Hydroxylbastnäsite-(La) | (La,Nd,Ce)(CO3)(OH,F) |
| C | ⓘ Kainosite-(Y) | Ca2(Y,Ce)2(Si4O12)(CO3) · H2O |
| C | ⓘ Kamphaugite-(Y) | Ca(Y,REE)(CO3)2(OH) · H2O |
| C | ⓘ Lanthanite-(Nd) | (Nd,La)2(CO3)3 · 8H2O |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| C | ⓘ Rhodochrosite | MnCO3 |
| C | ⓘ Schröckingerite | NaCa3(UO2)(CO3)3(SO4)F · 10H2O |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Smithsonite | ZnCO3 |
| C | ⓘ Tengerite-(Y) | Y2(CO3)3 · 2-3H2O |
| C | ⓘ Ancylite Group | (M3+ xM2+2-x)(CO3)2[(OH)x · (2-x)H2O] |
| O | Oxygen | |
| O | ⓘ Abhurite | Sn21Cl16(OH)14O6 |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| O | ⓘ Aeschynite-(Ce) | (Ce,Ca,Fe,Th)(Ti,Nb)2(O,OH)6 |
| O | ⓘ Aeschynite-(Y) | (Y,Ln,Ca,Th)(Ti,Nb)2(O,OH)6 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| O | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| O | ⓘ Zircon var. Alvite | Zr(SiO4) |
| O | ⓘ Microcline var. Amazonite | K(AlSi3O8) |
| O | ⓘ Quartz var. Amethyst | SiO2 |
| O | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| O | ⓘ Analcime | Na(AlSi2O6) · H2O |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Ancylite-(Ce) | CeSr(CO3)2(OH) · H2O |
| O | ⓘ Andalusite | Al2(SiO4)O |
| O | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Anthophyllite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| O | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| O | ⓘ Apophyllite Group | AB4[Si8O22]X · 8H2O |
| O | ⓘ Beryl var. Aquamarine | Be3Al2Si6O18 |
| O | ⓘ Atheriastite | near Ca5MgFeAl6Si8O32 · 5H2O |
| O | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| O | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Babingtonite | Ca2(Fe,Mn)FeSi5O14(OH) |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| O | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| O | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| O | ⓘ Beidellite | (Na,Ca0.5)0.3Al2((Si,Al)4O10)(OH)2 · nH2O |
| O | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| O | ⓘ Pyrochlore Supergroup var. Betafite (of Hogarth 1977) | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Bismite | Bi2O3 |
| O | ⓘ Bismutite | (BiO)2CO3 |
| O | ⓘ Bityite | CaLiAl2(AlBeSi2O10)(OH)2 |
| O | ⓘ Boothite | CuSO4 · 7H2O |
| O | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| O | ⓘ Uraninite var. Thorian Uraninite | (U,Th)O2 |
| O | ⓘ Britholite-(Y) | (Y,Ca)5(SiO4)3OH |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Brookite | TiO2 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Cahnite | Ca2[B(OH)4](AsO4) |
| O | ⓘ Calcioancylite-(Ce) | (Ce,Ca,Sr)CO3(OH,H2O) |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Carnotite | K2(UO2)2(VO4)2 · 3H2O |
| O | ⓘ Cerianite-(Ce) | (Ce4+,Th)O2 |
| O | ⓘ Chalcanthite | CuSO4 · 5H2O |
| O | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| O | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| O | ⓘ Cuprite var. Chalcotrichite | Cu2O |
| O | ⓘ Chernovite-(Y) | Y(AsO4) |
| O | ⓘ Chlorapatite | Ca5(PO4)3Cl |
| O | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| O | ⓘ Chrysoberyl | BeAl2O4 |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Churchite-(Y) | Y(PO4) · 2H2O |
| O | ⓘ Quartz var. Citrine | SiO2 |
| O | ⓘ Clarkeite | (Na,Ca,Pb)(UO2)O(OH) · 0-1H2O |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Clinohumite | Mg9(SiO4)4F2 |
| O | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Coffinite | U(SiO4) · nH2O |
| O | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| O | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| O | ⓘ Corundum | Al2O3 |
| O | ⓘ Cummingtonite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Curite | Pb3(H2O)2[(UO2)4O4(OH)3]2 |
| O | ⓘ Davidite-(Ce) | Ce(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| O | ⓘ Davidite-(La) | La(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| O | ⓘ Delessite | (Mg,Fe,Fe,Al)(Si,Al)4O10(O,OH)8 |
| O | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| O | ⓘ Diaspore | AlO(OH) |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| O | ⓘ Datolite | CaB(SiO4)(OH) |
| O | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Enstatite | Mg2Si2O6 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Euclase | BeAl(SiO4)(OH) |
| O | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| O | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| O | ⓘ Clinofergusonite-(Y) | YNbO4 |
| O | ⓘ Fergusonite-(Y) | YNbO4 |
| O | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| O | ⓘ Ferro-actinolite | ◻Ca2Fe52+(Si8O22)(OH)2 |
| O | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| O | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| O | ⓘ Ferrosilite | Fe22+Si2O6 |
| O | ⓘ Tantalite-(Fe) | Fe2+Ta2O6 |
| O | ⓘ Fersmite | (Ca,Ce,Na)(Nb,Ta,Ti)2(O,OH,F)6 |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| O | ⓘ Fourmarierite | Pb(UO2)4O3(OH)4 · 4H2O |
| O | ⓘ Friedelite | Mn82+Si6O15(OH,Cl)10 |
| O | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| O | ⓘ Gadolinite-(Y) | Y2Fe2+Be2Si2O10 |
| O | ⓘ Gahnite | ZnAl2O4 |
| O | ⓘ Gedrite | ◻{Mg2}{Mg3Al2}(Al2Si6O22)(OH)2 |
| O | ⓘ Glaucocerinite | (Zn1-xAlx)(OH)2(SO4)x/2 · nH2O |
| O | ⓘ Goethite | α-Fe3+O(OH) |
| O | ⓘ Grandidierite | (Mg,Fe2+)(Al,Fe3+)3(SiO4)(BO3)O2 |
| O | ⓘ Grossular | Ca3Al2(SiO4)3 |
| O | ⓘ Groutite | Mn3+O(OH) |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Hedenbergite | CaFe2+Si2O6 |
| O | ⓘ Hellandite-(Y) | (Ca,REE)4Y2Al◻2(B4Si4O22) (OH)2 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hercynite | Fe2+Al2O4 |
| O | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| O | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| O | ⓘ Högbomite | (Mg,Fe)2(Al,Ti)5O10 |
| O | ⓘ Opal var. Opal-AN | SiO2 · nH2O |
| O | ⓘ Hydrohalite | NaCl · 2H2O |
| O | ⓘ Hypersthene | (Mg,Fe)SiO3 |
| O | ⓘ Hydroxylbastnäsite-(La) | (La,Nd,Ce)(CO3)(OH,F) |
| O | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Rutile var. Ilmenorutile | (Ti,Nb)O2 |
| O | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| O | ⓘ Kainosite-(Y) | Ca2(Y,Ce)2(Si4O12)(CO3) · H2O |
| O | ⓘ Kamphaugite-(Y) | Ca(Y,REE)(CO3)2(OH) · H2O |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Kasolite | Pb(UO2)(SiO4) · H2O |
| O | ⓘ Keiviite-(Y) | Y2Si2O7 |
| O | ⓘ Kornerupine | Mg3Al6(Si,Al,B)5O21(OH) |
| O | ⓘ Kyanite | Al2(SiO4)O |
| O | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| O | ⓘ Lanthanite-(Nd) | (Nd,La)2(CO3)3 · 8H2O |
| O | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| O | ⓘ Liandratite | U(Nb,Ta)2O8 |
| O | ⓘ Lizardite | Mg3(Si2O5)(OH)4 |
| O | ⓘ Leucite | K(AlSi2O6) |
| O | ⓘ Magnesiodumortierite | Mg(Al2OH)(Al2O)2(SiO4)3(BO3) |
| O | ⓘ Axinite-(Mn) | Ca2Mn2+Al2BSi4O15(OH) |
| O | ⓘ Manganite | Mn3+O(OH) |
| O | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| O | ⓘ Tantalite-(Mn) | Mn2+Ta2O6 |
| O | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| O | ⓘ Marialite | Na4Al3Si9O24Cl |
| O | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| O | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
| O | ⓘ Mesolite | Na2Ca2Si9Al6O30 · 8H2O |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| O | ⓘ Minium | Pb3O4 |
| O | ⓘ Molybdite | MoO3 |
| O | ⓘ Monazite | REE(PO4) |
| O | ⓘ Monazite-(Ce) | Ce(PO4) |
| O | ⓘ Monazite-(Nd) | Nd(PO4) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| O | ⓘ Neotocite | (Mn,Fe,Mg)SiO3 · H2O |
| O | ⓘ Nickelhexahydrite | Ni(SO4) · 6H2O |
| O | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| O | ⓘ Albite var. Oligoclase-Albite | Na(AlSi3O8) |
| O | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Opal | SiO2 · nH2O |
| O | ⓘ Thorite var. Orangite | Th(SiO4) |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| O | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| O | ⓘ Pectolite | NaCa2Si3O8(OH) |
| O | ⓘ Perrierite-(Ce) | Ce4MgFe23+Ti2(Si2O7)2O8 |
| O | ⓘ Phenakite | Be2SiO4 |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Powellite | Ca(MoO4) |
| O | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| O | ⓘ Preiswerkite | NaMg2Al(Al2Si2O10)(OH)2 |
| O | ⓘ Pumpellyite Subgroup | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| O | ⓘ Pumpellyite-(Fe2+) | Ca2Fe2+Al2(Si2O7)(SiO4)(OH,O)2 · H2O |
| O | ⓘ Pyrobelonite | PbMn2+(VO4)(OH) |
| O | ⓘ Pyrochlore Group | A2Nb2(O,OH)6Z |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| O | ⓘ Pyrophanite | Mn2+TiO3 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Ramsdellite | Mn4+O2 |
| O | ⓘ Ranciéite | (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O |
| O | ⓘ Rhabdophane-(Ce) | Ce(PO4) · 0.6H2O |
| O | ⓘ Rhodochrosite | MnCO3 |
| O | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| O | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| O | ⓘ Quartz var. Rose Quartz | SiO2 |
| O | ⓘ Rozenite | FeSO4 · 4H2O |
| O | ⓘ Corundum var. Ruby | Al2O3 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Samarskite-(Y) | YFe3+Nb2O8 |
| O | ⓘ Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| O | ⓘ Sapphirine | Mg4(Mg3Al9)O4[Si3Al9O36] |
| O | ⓘ Scheteligite | (Ca,Fe,Mn,Sb,Bi,Y)2(Ti,Ta,Nb,W)2(O,OH)7 |
| O | ⓘ Schoepite | (UO2)8O2(OH)12 · 12H2O |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Schröckingerite | NaCa3(UO2)(CO3)3(SO4)F · 10H2O |
| O | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
| O | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| O | ⓘ Sillimanite | Al2(SiO4)O |
| O | ⓘ Smithsonite | ZnCO3 |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| O | ⓘ Spinel | MgAl2O4 |
| O | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| O | ⓘ Stellerite | Ca4(Si28Al8)O72 · 28H2O |
| O | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| O | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| O | ⓘ Tapiolite | (Fe,Mn)(Ta,Nb)2O6 |
| O | ⓘ Tengerite-(Y) | Y2(CO3)3 · 2-3H2O |
| O | ⓘ Thalénite-(Y) | Y3Si3O10F |
| O | ⓘ Thorianite | ThO2 |
| O | ⓘ Thorite | Th(SiO4) |
| O | ⓘ Thorite var. Thorogummite | (Th,U)(SiO4)1-x(OH)4x |
| O | ⓘ Thortveitite | Sc2Si2O7 |
| O | ⓘ Zoisite var. Thulite | {Ca2}{Al,Mn33+}(Si2O7)(SiO4)O(OH) |
| O | ⓘ Titanite | CaTi(SiO4)O |
| O | ⓘ Magnetite var. Titanium-bearing Magnetite | Fe2+(Fe3+,Ti)2O4 |
| O | ⓘ Tombarthite-(Y) | Y4(Si,H4)4O12-x(OH)4+2x |
| O | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| O | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| O | ⓘ Törnebohmite-(Ce) | Ce2Al(SiO4)2(OH) |
| O | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Triplite | Mn22+(PO4)F |
| O | ⓘ Tschermakite | ◻(Ca2)(Mg3Al2)(Al2Si6O22)(OH)2 |
| O | ⓘ Amphibole Supergroup var. Uralite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Parauranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| O | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| O | ⓘ Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| O | ⓘ Vanadinite | Pb5(VO4)3Cl |
| O | ⓘ Vandendriesscheite | PbU7O22 · 12H2O |
| O | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| O | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| O | ⓘ Volkonskoite | Ca0.3(Cr,Mg,Fe)2((Si,Al)4O10)(OH)2 · 4H2O |
| O | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| O | ⓘ Woodwardite | Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| O | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| O | ⓘ Xenotime-(Y) | Y(PO4) |
| O | ⓘ Yttrialite-(Y) | (Y,Th)2Si2O7 |
| O | ⓘ Pyrochlore Group var. Yttropyrochlore (of Hogarth 1977) | A2Nb2(O,OH)6Z |
| O | ⓘ Yttrotantalite-(Y) | (Y,U,Fe2+)(Ta,Nb)(O,OH)4 |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Albite var. Peristerite | Na(AlSi3O8) |
| O | ⓘ Cordierite var. Iolite | (Mg,Fe)2Al3(AlSi5O18) |
| O | ⓘ Magnetite var. Lodestone | Fe2+Fe23+O4 |
| O | ⓘ Quartz var. Rock Crystal | SiO2 |
| O | ⓘ Epidote Supergroup | (A1A2)(M1M2M3)O4[Si2O7][SiO4]O10 |
| O | ⓘ Spinel var. Pleonaste | (Mg,Fe)Al2O4 |
| O | ⓘ Almandine-Pyrope Series var. Rhodolite | Mg3Al2(SiO4)3 |
| O | ⓘ Beryl var. Heliodor | Be3Al2(Si6O18) |
| O | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| O | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| O | ⓘ Heulandite-K | (K,Ca,Na)5(Si27Al9)O72 · 26H2O |
| O | ⓘ Iddingsite | MgO · Fe2O3 · 3SiO2 · 4H2O |
| O | ⓘ Okayamalite | Ca2B[BSiO7] |
| O | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| O | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| O | ⓘ Titanite var. Yttrium-bearing Titanite | (Ca,Y)TiSiO5 |
| O | ⓘ Titanite var. Keilhauite | (Ca,Y3+)(Ti,Al,Fe3+)[SiO4]O |
| O | ⓘ Thorite var. Uranothorite | (Th,U)SiO4 |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Pyroxene Group | ADSi2O6 |
| O | ⓘ Hercynite var. Picotite | (Fe,Mg)(Al,Cr)2O4 |
| O | ⓘ Fergusonite-(Y) var. Risörite | (Y,Er)(Nb,Ti,Ta)(O,OH)4 |
| O | ⓘ Andradite var. Colophonite | Ca3Fe23+(SiO4)3 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Zircon var. Oerstedtite | Zr(SiO4) |
| O | ⓘ Rutile var. Niobium-bearing Rutile | (Ti,Nb)O2 |
| O | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| O | ⓘ Lithian Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Zircon var. Hafnian Zircon | (Zr,Hf)SiO4 |
| O | ⓘ Phlogopite var. Iron-bearing Phlogopite | K(Mg,Fe2+)3AlSi3O10(F,OH)2 |
| O | ⓘ Rutile var. Nigrine | TiO2 |
| O | ⓘ Epidote var. Withamite | {Ca2}{Al2(Fe3+,Mn)}(Si2O7)(SiO4)O(OH) |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| O | ⓘ Uraninite var. Cleveite | UO2 |
| O | ⓘ Britholite Group | (REE,Ca)5[(Si,P)O4]3X |
| O | ⓘ Zircon var. Malacon | Zr(SiO4) |
| O | ⓘ Chalcodite | K(Fe3+,Mg,Fe2+)8(Si,Al)12(O,OH)27 |
| O | ⓘ Ancylite Group | (M3+ xM2+2-x)(CO3)2[(OH)x · (2-x)H2O] |
| O | ⓘ Fluorbritholite-(Y) | (Y,Ca)5(SiO4)3F |
| O | ⓘ Carlosbarbosaite | (UO2)2Nb2O6(OH)2 · 2H2O |
| O | ⓘ Aeschynite Group | AD2O6 |
| O | ⓘ Hydroxycalciomicrolite | Ca1.5Ta2O6(OH) |
| O | ⓘ Papikeite | NaMg2(Mg3Al2}(Al3Si5O22)(OH)2 |
| O | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| O | ⓘ Cyprine | Ca19Cu2+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10](OH)(OH)9 |
| O | ⓘ Gadolinite Supergroup | A2MQ2T2O8φ2 |
| O | ⓘ Siderophyllite var. Magnesium-bearing Siderophyllite | K(Fe2+,Mg)2Al(Si2Al2)O10(OH)2 |
| O | ⓘ UM2000-35-O:FeNbScTaTi | (Sc,Fe2+,Fe3+,Mn)(Ti,Sn,Zr)1.5(Nb,Ta,W)1.33O8 |
| F | Fluorine | |
| F | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| F | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| F | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| F | ⓘ Clinohumite | Mg9(SiO4)4F2 |
| F | ⓘ Davidite-(Ce) | Ce(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| F | ⓘ Davidite-(La) | La(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| F | ⓘ Fersmite | (Ca,Ce,Na)(Nb,Ta,Ti)2(O,OH,F)6 |
| F | ⓘ Fluocerite-(Ce) | CeF3 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Hydroxylbastnäsite-(La) | (La,Nd,Ce)(CO3)(OH,F) |
| F | ⓘ Schröckingerite | NaCa3(UO2)(CO3)3(SO4)F · 10H2O |
| F | ⓘ Thalénite-(Y) | Y3Si3O10F |
| F | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| F | ⓘ Triplite | Mn22+(PO4)F |
| F | ⓘ Tveitite-(Y) | (Y, Na)6Ca6Ca6(Ca,Na)F42 |
| F | ⓘ Amphibole Supergroup var. Uralite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| F | ⓘ Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| F | ⓘ Fluorite var. Yttrofluorite | (Ca1-xYx)F2+x where 0.05< x |
| F | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| F | ⓘ Phlogopite var. Iron-bearing Phlogopite | K(Mg,Fe2+)3AlSi3O10(F,OH)2 |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | ⓘ Fluorbritholite-(Y) | (Y,Ca)5(SiO4)3F |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Analcime | Na(AlSi2O6) · H2O |
| Na | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | ⓘ Beidellite | (Na,Ca0.5)0.3Al2((Si,Al)4O10)(OH)2 · nH2O |
| Na | ⓘ Pyrochlore Supergroup var. Betafite (of Hogarth 1977) | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| Na | ⓘ Clarkeite | (Na,Ca,Pb)(UO2)O(OH) · 0-1H2O |
| Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Fersmite | (Ca,Ce,Na)(Nb,Ta,Ti)2(O,OH,F)6 |
| Na | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Na | ⓘ Hydrohalite | NaCl · 2H2O |
| Na | ⓘ Marialite | Na4Al3Si9O24Cl |
| Na | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| Na | ⓘ Mesolite | Na2Ca2Si9Al6O30 · 8H2O |
| Na | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Na | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Na | ⓘ Albite var. Oligoclase-Albite | Na(AlSi3O8) |
| Na | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Na | ⓘ Pectolite | NaCa2Si3O8(OH) |
| Na | ⓘ Preiswerkite | NaMg2Al(Al2Si2O10)(OH)2 |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Schröckingerite | NaCa3(UO2)(CO3)3(SO4)F · 10H2O |
| Na | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Na | ⓘ Tveitite-(Y) | (Y, Na)6Ca6Ca6(Ca,Na)F42 |
| Na | ⓘ Albite var. Peristerite | Na(AlSi3O8) |
| Na | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Na | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Na | ⓘ Heulandite-K | (K,Ca,Na)5(Si27Al9)O72 · 26H2O |
| Na | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| Na | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Na | ⓘ Papikeite | NaMg2(Mg3Al2}(Al3Si5O22)(OH)2 |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Anthophyllite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| Mg | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Atheriastite | near Ca5MgFeAl6Si8O32 · 5H2O |
| Mg | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Clinohumite | Mg9(SiO4)4F2 |
| Mg | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Mg | ⓘ Cummingtonite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| Mg | ⓘ Delessite | (Mg,Fe,Fe,Al)(Si,Al)4O10(O,OH)8 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | ⓘ Enstatite | Mg2Si2O6 |
| Mg | ⓘ Gedrite | ◻{Mg2}{Mg3Al2}(Al2Si6O22)(OH)2 |
| Mg | ⓘ Grandidierite | (Mg,Fe2+)(Al,Fe3+)3(SiO4)(BO3)O2 |
| Mg | ⓘ Högbomite | (Mg,Fe)2(Al,Ti)5O10 |
| Mg | ⓘ Hypersthene | (Mg,Fe)SiO3 |
| Mg | ⓘ Kornerupine | Mg3Al6(Si,Al,B)5O21(OH) |
| Mg | ⓘ Lizardite | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Magnesiodumortierite | Mg(Al2OH)(Al2O)2(SiO4)3(BO3) |
| Mg | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| Mg | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Mg | ⓘ Neotocite | (Mn,Fe,Mg)SiO3 · H2O |
| Mg | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| Mg | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Mg | ⓘ Perrierite-(Ce) | Ce4MgFe23+Ti2(Si2O7)2O8 |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | ⓘ Preiswerkite | NaMg2Al(Al2Si2O10)(OH)2 |
| Mg | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| Mg | ⓘ Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| Mg | ⓘ Sapphirine | Mg4(Mg3Al9)O4[Si3Al9O36] |
| Mg | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| Mg | ⓘ Spinel | MgAl2O4 |
| Mg | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Tschermakite | ◻(Ca2)(Mg3Al2)(Al2Si6O22)(OH)2 |
| Mg | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Mg | ⓘ Volkonskoite | Ca0.3(Cr,Mg,Fe)2((Si,Al)4O10)(OH)2 · 4H2O |
| Mg | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Mg | ⓘ Cordierite var. Iolite | (Mg,Fe)2Al3(AlSi5O18) |
| Mg | ⓘ Spinel var. Pleonaste | (Mg,Fe)Al2O4 |
| Mg | ⓘ Almandine-Pyrope Series var. Rhodolite | Mg3Al2(SiO4)3 |
| Mg | ⓘ Iddingsite | MgO · Fe2O3 · 3SiO2 · 4H2O |
| Mg | ⓘ Hercynite var. Picotite | (Fe,Mg)(Al,Cr)2O4 |
| Mg | ⓘ Phlogopite var. Iron-bearing Phlogopite | K(Mg,Fe2+)3AlSi3O10(F,OH)2 |
| Mg | ⓘ Chalcodite | K(Fe3+,Mg,Fe2+)8(Si,Al)12(O,OH)27 |
| Mg | ⓘ Papikeite | NaMg2(Mg3Al2}(Al3Si5O22)(OH)2 |
| Mg | ⓘ Cyprine | Ca19Cu2+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10](OH)(OH)9 |
| Mg | ⓘ Siderophyllite var. Magnesium-bearing Siderophyllite | K(Fe2+,Mg)2Al(Si2Al2)O10(OH)2 |
| Al | Aluminium | |
| Al | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| Al | ⓘ Microcline var. Amazonite | K(AlSi3O8) |
| Al | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Al | ⓘ Analcime | Na(AlSi2O6) · H2O |
| Al | ⓘ Andalusite | Al2(SiO4)O |
| Al | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Beryl var. Aquamarine | Be3Al2Si6O18 |
| Al | ⓘ Atheriastite | near Ca5MgFeAl6Si8O32 · 5H2O |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| Al | ⓘ Beidellite | (Na,Ca0.5)0.3Al2((Si,Al)4O10)(OH)2 · nH2O |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Bityite | CaLiAl2(AlBeSi2O10)(OH)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| Al | ⓘ Chrysoberyl | BeAl2O4 |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Al | ⓘ Corundum | Al2O3 |
| Al | ⓘ Delessite | (Mg,Fe,Fe,Al)(Si,Al)4O10(O,OH)8 |
| Al | ⓘ Diaspore | AlO(OH) |
| Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| Al | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Euclase | BeAl(SiO4)(OH) |
| Al | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Al | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Al | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Al | ⓘ Gahnite | ZnAl2O4 |
| Al | ⓘ Gedrite | ◻{Mg2}{Mg3Al2}(Al2Si6O22)(OH)2 |
| Al | ⓘ Glaucocerinite | (Zn1-xAlx)(OH)2(SO4)x/2 · nH2O |
| Al | ⓘ Grandidierite | (Mg,Fe2+)(Al,Fe3+)3(SiO4)(BO3)O2 |
| Al | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Al | ⓘ Hellandite-(Y) | (Ca,REE)4Y2Al◻2(B4Si4O22) (OH)2 |
| Al | ⓘ Hercynite | Fe2+Al2O4 |
| Al | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Al | ⓘ Högbomite | (Mg,Fe)2(Al,Ti)5O10 |
| Al | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Kornerupine | Mg3Al6(Si,Al,B)5O21(OH) |
| Al | ⓘ Kyanite | Al2(SiO4)O |
| Al | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Al | ⓘ Leucite | K(AlSi2O6) |
| Al | ⓘ Magnesiodumortierite | Mg(Al2OH)(Al2O)2(SiO4)3(BO3) |
| Al | ⓘ Axinite-(Mn) | Ca2Mn2+Al2BSi4O15(OH) |
| Al | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| Al | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| Al | ⓘ Marialite | Na4Al3Si9O24Cl |
| Al | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| Al | ⓘ Mesolite | Na2Ca2Si9Al6O30 · 8H2O |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Al | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Al | ⓘ Albite var. Oligoclase-Albite | Na(AlSi3O8) |
| Al | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| Al | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Al | ⓘ Preiswerkite | NaMg2Al(Al2Si2O10)(OH)2 |
| Al | ⓘ Pumpellyite Subgroup | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| Al | ⓘ Pumpellyite-(Fe2+) | Ca2Fe2+Al2(Si2O7)(SiO4)(OH,O)2 · H2O |
| Al | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| Al | ⓘ Corundum var. Ruby | Al2O3 |
| Al | ⓘ Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| Al | ⓘ Sapphirine | Mg4(Mg3Al9)O4[Si3Al9O36] |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
| Al | ⓘ Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| Al | ⓘ Sillimanite | Al2(SiO4)O |
| Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Al | ⓘ Spinel | MgAl2O4 |
| Al | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Al | ⓘ Stellerite | Ca4(Si28Al8)O72 · 28H2O |
| Al | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Al | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Al | ⓘ Zoisite var. Thulite | {Ca2}{Al,Mn33+}(Si2O7)(SiO4)O(OH) |
| Al | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Al | ⓘ Törnebohmite-(Ce) | Ce2Al(SiO4)2(OH) |
| Al | ⓘ Tschermakite | ◻(Ca2)(Mg3Al2)(Al2Si6O22)(OH)2 |
| Al | ⓘ Amphibole Supergroup var. Uralite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Al | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Al | ⓘ Volkonskoite | Ca0.3(Cr,Mg,Fe)2((Si,Al)4O10)(OH)2 · 4H2O |
| Al | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | ⓘ Woodwardite | Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| Al | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Albite var. Peristerite | Na(AlSi3O8) |
| Al | ⓘ Cordierite var. Iolite | (Mg,Fe)2Al3(AlSi5O18) |
| Al | ⓘ Spinel var. Pleonaste | (Mg,Fe)Al2O4 |
| Al | ⓘ Almandine-Pyrope Series var. Rhodolite | Mg3Al2(SiO4)3 |
| Al | ⓘ Beryl var. Heliodor | Be3Al2(Si6O18) |
| Al | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Al | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Al | ⓘ Heulandite-K | (K,Ca,Na)5(Si27Al9)O72 · 26H2O |
| Al | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| Al | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Al | ⓘ Titanite var. Keilhauite | (Ca,Y3+)(Ti,Al,Fe3+)[SiO4]O |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Al | ⓘ Hercynite var. Picotite | (Fe,Mg)(Al,Cr)2O4 |
| Al | ⓘ Lithian Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Phlogopite var. Iron-bearing Phlogopite | K(Mg,Fe2+)3AlSi3O10(F,OH)2 |
| Al | ⓘ Epidote var. Withamite | {Ca2}{Al2(Fe3+,Mn)}(Si2O7)(SiO4)O(OH) |
| Al | ⓘ Chalcodite | K(Fe3+,Mg,Fe2+)8(Si,Al)12(O,OH)27 |
| Al | ⓘ Papikeite | NaMg2(Mg3Al2}(Al3Si5O22)(OH)2 |
| Al | ⓘ Cyprine | Ca19Cu2+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10](OH)(OH)9 |
| Al | ⓘ Siderophyllite var. Magnesium-bearing Siderophyllite | K(Fe2+,Mg)2Al(Si2Al2)O10(OH)2 |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| Si | ⓘ Zircon var. Alvite | Zr(SiO4) |
| Si | ⓘ Microcline var. Amazonite | K(AlSi3O8) |
| Si | ⓘ Quartz var. Amethyst | SiO2 |
| Si | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Si | ⓘ Analcime | Na(AlSi2O6) · H2O |
| Si | ⓘ Andalusite | Al2(SiO4)O |
| Si | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Si | ⓘ Anthophyllite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| Si | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Apophyllite Group | AB4[Si8O22]X · 8H2O |
| Si | ⓘ Beryl var. Aquamarine | Be3Al2Si6O18 |
| Si | ⓘ Atheriastite | near Ca5MgFeAl6Si8O32 · 5H2O |
| Si | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Babingtonite | Ca2(Fe,Mn)FeSi5O14(OH) |
| Si | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| Si | ⓘ Beidellite | (Na,Ca0.5)0.3Al2((Si,Al)4O10)(OH)2 · nH2O |
| Si | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Bityite | CaLiAl2(AlBeSi2O10)(OH)2 |
| Si | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| Si | ⓘ Britholite-(Y) | (Y,Ca)5(SiO4)3OH |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| Si | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Quartz var. Citrine | SiO2 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Clinohumite | Mg9(SiO4)4F2 |
| Si | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Coffinite | U(SiO4) · nH2O |
| Si | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Si | ⓘ Cummingtonite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| Si | ⓘ Delessite | (Mg,Fe,Fe,Al)(Si,Al)4O10(O,OH)8 |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| Si | ⓘ Datolite | CaB(SiO4)(OH) |
| Si | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Enstatite | Mg2Si2O6 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Euclase | BeAl(SiO4)(OH) |
| Si | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Si | ⓘ Ferro-actinolite | ◻Ca2Fe52+(Si8O22)(OH)2 |
| Si | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Si | ⓘ Ferrosilite | Fe22+Si2O6 |
| Si | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| Si | ⓘ Friedelite | Mn82+Si6O15(OH,Cl)10 |
| Si | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Si | ⓘ Gadolinite-(Y) | Y2Fe2+Be2Si2O10 |
| Si | ⓘ Gedrite | ◻{Mg2}{Mg3Al2}(Al2Si6O22)(OH)2 |
| Si | ⓘ Grandidierite | (Mg,Fe2+)(Al,Fe3+)3(SiO4)(BO3)O2 |
| Si | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Si | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Si | ⓘ Hellandite-(Y) | (Ca,REE)4Y2Al◻2(B4Si4O22) (OH)2 |
| Si | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Si | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| Si | ⓘ Opal var. Opal-AN | SiO2 · nH2O |
| Si | ⓘ Hypersthene | (Mg,Fe)SiO3 |
| Si | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Si | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| Si | ⓘ Kainosite-(Y) | Ca2(Y,Ce)2(Si4O12)(CO3) · H2O |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Kasolite | Pb(UO2)(SiO4) · H2O |
| Si | ⓘ Keiviite-(Y) | Y2Si2O7 |
| Si | ⓘ Kornerupine | Mg3Al6(Si,Al,B)5O21(OH) |
| Si | ⓘ Kyanite | Al2(SiO4)O |
| Si | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Si | ⓘ Lizardite | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Leucite | K(AlSi2O6) |
| Si | ⓘ Magnesiodumortierite | Mg(Al2OH)(Al2O)2(SiO4)3(BO3) |
| Si | ⓘ Axinite-(Mn) | Ca2Mn2+Al2BSi4O15(OH) |
| Si | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| Si | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| Si | ⓘ Marialite | Na4Al3Si9O24Cl |
| Si | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| Si | ⓘ Mesolite | Na2Ca2Si9Al6O30 · 8H2O |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Si | ⓘ Neotocite | (Mn,Fe,Mg)SiO3 · H2O |
| Si | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Si | ⓘ Albite var. Oligoclase-Albite | Na(AlSi3O8) |
| Si | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Opal | SiO2 · nH2O |
| Si | ⓘ Thorite var. Orangite | Th(SiO4) |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| Si | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Si | ⓘ Pectolite | NaCa2Si3O8(OH) |
| Si | ⓘ Perrierite-(Ce) | Ce4MgFe23+Ti2(Si2O7)2O8 |
| Si | ⓘ Phenakite | Be2SiO4 |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Si | ⓘ Preiswerkite | NaMg2Al(Al2Si2O10)(OH)2 |
| Si | ⓘ Pumpellyite Subgroup | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| Si | ⓘ Pumpellyite-(Fe2+) | Ca2Fe2+Al2(Si2O7)(SiO4)(OH,O)2 · H2O |
| Si | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Si | ⓘ Quartz var. Rose Quartz | SiO2 |
| Si | ⓘ Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| Si | ⓘ Sapphirine | Mg4(Mg3Al9)O4[Si3Al9O36] |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
| Si | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| Si | ⓘ Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| Si | ⓘ Sillimanite | Al2(SiO4)O |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Si | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Si | ⓘ Stellerite | Ca4(Si28Al8)O72 · 28H2O |
| Si | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Si | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Thalénite-(Y) | Y3Si3O10F |
| Si | ⓘ Thorite | Th(SiO4) |
| Si | ⓘ Thorite var. Thorogummite | (Th,U)(SiO4)1-x(OH)4x |
| Si | ⓘ Thortveitite | Sc2Si2O7 |
| Si | ⓘ Zoisite var. Thulite | {Ca2}{Al,Mn33+}(Si2O7)(SiO4)O(OH) |
| Si | ⓘ Titanite | CaTi(SiO4)O |
| Si | ⓘ Tombarthite-(Y) | Y4(Si,H4)4O12-x(OH)4+2x |
| Si | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Si | ⓘ Törnebohmite-(Ce) | Ce2Al(SiO4)2(OH) |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Tschermakite | ◻(Ca2)(Mg3Al2)(Al2Si6O22)(OH)2 |
| Si | ⓘ Amphibole Supergroup var. Uralite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Si | ⓘ Parauranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| Si | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| Si | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Si | ⓘ Volkonskoite | Ca0.3(Cr,Mg,Fe)2((Si,Al)4O10)(OH)2 · 4H2O |
| Si | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Si | ⓘ Yttrialite-(Y) | (Y,Th)2Si2O7 |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Albite var. Peristerite | Na(AlSi3O8) |
| Si | ⓘ Cordierite var. Iolite | (Mg,Fe)2Al3(AlSi5O18) |
| Si | ⓘ Quartz var. Rock Crystal | SiO2 |
| Si | ⓘ Epidote Supergroup | (A1A2)(M1M2M3)O4[Si2O7][SiO4]O10 |
| Si | ⓘ Almandine-Pyrope Series var. Rhodolite | Mg3Al2(SiO4)3 |
| Si | ⓘ Beryl var. Heliodor | Be3Al2(Si6O18) |
| Si | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Si | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Si | ⓘ Heulandite-K | (K,Ca,Na)5(Si27Al9)O72 · 26H2O |
| Si | ⓘ Iddingsite | MgO · Fe2O3 · 3SiO2 · 4H2O |
| Si | ⓘ Okayamalite | Ca2B[BSiO7] |
| Si | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| Si | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Si | ⓘ Titanite var. Yttrium-bearing Titanite | (Ca,Y)TiSiO5 |
| Si | ⓘ Titanite var. Keilhauite | (Ca,Y3+)(Ti,Al,Fe3+)[SiO4]O |
| Si | ⓘ Thorite var. Uranothorite | (Th,U)SiO4 |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Pyroxene Group | ADSi2O6 |
| Si | ⓘ Andradite var. Colophonite | Ca3Fe23+(SiO4)3 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Zircon var. Oerstedtite | Zr(SiO4) |
| Si | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| Si | ⓘ Lithian Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Zircon var. Hafnian Zircon | (Zr,Hf)SiO4 |
| Si | ⓘ Phlogopite var. Iron-bearing Phlogopite | K(Mg,Fe2+)3AlSi3O10(F,OH)2 |
| Si | ⓘ Epidote var. Withamite | {Ca2}{Al2(Fe3+,Mn)}(Si2O7)(SiO4)O(OH) |
| Si | ⓘ Britholite Group | (REE,Ca)5[(Si,P)O4]3X |
| Si | ⓘ Zircon var. Malacon | Zr(SiO4) |
| Si | ⓘ Chalcodite | K(Fe3+,Mg,Fe2+)8(Si,Al)12(O,OH)27 |
| Si | ⓘ Fluorbritholite-(Y) | (Y,Ca)5(SiO4)3F |
| Si | ⓘ Papikeite | NaMg2(Mg3Al2}(Al3Si5O22)(OH)2 |
| Si | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Cyprine | Ca19Cu2+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10](OH)(OH)9 |
| Si | ⓘ Siderophyllite var. Magnesium-bearing Siderophyllite | K(Fe2+,Mg)2Al(Si2Al2)O10(OH)2 |
| P | Phosphorus | |
| P | ⓘ Chlorapatite | Ca5(PO4)3Cl |
| P | ⓘ Churchite-(Y) | Y(PO4) · 2H2O |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Monazite | REE(PO4) |
| P | ⓘ Monazite-(Ce) | Ce(PO4) |
| P | ⓘ Monazite-(Nd) | Nd(PO4) |
| P | ⓘ Rhabdophane-(Ce) | Ce(PO4) · 0.6H2O |
| P | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| P | ⓘ Triplite | Mn22+(PO4)F |
| P | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| P | ⓘ Xenotime-(Y) | Y(PO4) |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| P | ⓘ Britholite Group | (REE,Ca)5[(Si,P)O4]3X |
| S | Sulfur | |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Boothite | CuSO4 · 7H2O |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Boulangerite | Pb5Sb4S11 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcanthite | CuSO4 · 5H2O |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Cobaltite | CoAsS |
| S | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| S | ⓘ Covellite | CuS |
| S | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| S | ⓘ Digenite | Cu9S5 |
| S | ⓘ Djurleite | Cu31S16 |
| S | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| S | ⓘ Galena | PbS |
| S | ⓘ Glaucocerinite | (Zn1-xAlx)(OH)2(SO4)x/2 · nH2O |
| S | ⓘ Gudmundite | FeSbS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| S | ⓘ Linnaeite | Co2+Co23+S4 |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Matildite | AgBiS2 |
| S | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| S | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
| S | ⓘ Millerite | NiS |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Nickelhexahydrite | Ni(SO4) · 6H2O |
| S | ⓘ Pentlandite | (NixFey)Σ9S8 |
| S | ⓘ Pyrargyrite | Ag3SbS3 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Rozenite | FeSO4 · 4H2O |
| S | ⓘ Schapbachite | Ag0.4Pb0.2Bi0.4S |
| S | ⓘ Schröckingerite | NaCa3(UO2)(CO3)3(SO4)F · 10H2O |
| S | ⓘ Siegenite | CoNi2S4 |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stephanite | Ag5SbS4 |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Sulphur | S8 |
| S | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| S | ⓘ Ullmannite | NiSbS |
| S | ⓘ Violarite | Fe2+Ni23+S4 |
| S | ⓘ Willyamite | CoSbS |
| S | ⓘ Wittichenite | Cu3BiS3 |
| S | ⓘ Woodwardite | Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| S | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| S | ⓘ Zoubekite | AgPb4Sb4S10 |
| S | ⓘ Sphalerite var. Marmatite | (Zn,Fe)S |
| S | ⓘ Molybdenite-2H | MoS2 |
| Cl | Chlorine | |
| Cl | ⓘ Abhurite | Sn21Cl16(OH)14O6 |
| Cl | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Cl | ⓘ Chlorapatite | Ca5(PO4)3Cl |
| Cl | ⓘ Cotunnite | PbCl2 |
| Cl | ⓘ Friedelite | Mn82+Si6O15(OH,Cl)10 |
| Cl | ⓘ Hydrohalite | NaCl · 2H2O |
| Cl | ⓘ Marialite | Na4Al3Si9O24Cl |
| Cl | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| Cl | ⓘ Sylvite | KCl |
| Cl | ⓘ Amphibole Supergroup var. Uralite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Cl | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Cl | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| K | ⓘ Microcline var. Amazonite | K(AlSi3O8) |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Carnotite | K2(UO2)2(VO4)2 · 3H2O |
| K | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| K | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| K | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| K | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| K | ⓘ Leucite | K(AlSi2O6) |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| K | ⓘ Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| K | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| K | ⓘ Sylvite | KCl |
| K | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| K | ⓘ Heulandite-K | (K,Ca,Na)5(Si27Al9)O72 · 26H2O |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Lithian Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Phlogopite var. Iron-bearing Phlogopite | K(Mg,Fe2+)3AlSi3O10(F,OH)2 |
| K | ⓘ Chalcodite | K(Fe3+,Mg,Fe2+)8(Si,Al)12(O,OH)27 |
| K | ⓘ Siderophyllite var. Magnesium-bearing Siderophyllite | K(Fe2+,Mg)2Al(Si2Al2)O10(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Aeschynite-(Ce) | (Ce,Ca,Fe,Th)(Ti,Nb)2(O,OH)6 |
| Ca | ⓘ Aeschynite-(Y) | (Y,Ln,Ca,Th)(Ti,Nb)2(O,OH)6 |
| Ca | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Atheriastite | near Ca5MgFeAl6Si8O32 · 5H2O |
| Ca | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Ca | ⓘ Babingtonite | Ca2(Fe,Mn)FeSi5O14(OH) |
| Ca | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| Ca | ⓘ Beidellite | (Na,Ca0.5)0.3Al2((Si,Al)4O10)(OH)2 · nH2O |
| Ca | ⓘ Pyrochlore Supergroup var. Betafite (of Hogarth 1977) | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| Ca | ⓘ Bityite | CaLiAl2(AlBeSi2O10)(OH)2 |
| Ca | ⓘ Britholite-(Y) | (Y,Ca)5(SiO4)3OH |
| Ca | ⓘ Cahnite | Ca2[B(OH)4](AsO4) |
| Ca | ⓘ Calcioancylite-(Ce) | (Ce,Ca,Sr)CO3(OH,H2O) |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Chlorapatite | Ca5(PO4)3Cl |
| Ca | ⓘ Clarkeite | (Na,Ca,Pb)(UO2)O(OH) · 0-1H2O |
| Ca | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Datolite | CaB(SiO4)(OH) |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Ca | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Ca | ⓘ Ferro-actinolite | ◻Ca2Fe52+(Si8O22)(OH)2 |
| Ca | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Ca | ⓘ Fersmite | (Ca,Ce,Na)(Nb,Ta,Ti)2(O,OH,F)6 |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Ca | ⓘ Hellandite-(Y) | (Ca,REE)4Y2Al◻2(B4Si4O22) (OH)2 |
| Ca | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Ca | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| Ca | ⓘ Kainosite-(Y) | Ca2(Y,Ce)2(Si4O12)(CO3) · H2O |
| Ca | ⓘ Kamphaugite-(Y) | Ca(Y,REE)(CO3)2(OH) · H2O |
| Ca | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Ca | ⓘ Axinite-(Mn) | Ca2Mn2+Al2BSi4O15(OH) |
| Ca | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| Ca | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| Ca | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| Ca | ⓘ Mesolite | Na2Ca2Si9Al6O30 · 8H2O |
| Ca | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| Ca | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Ca | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Ca | ⓘ Pectolite | NaCa2Si3O8(OH) |
| Ca | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Powellite | Ca(MoO4) |
| Ca | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Ca | ⓘ Pumpellyite Subgroup | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| Ca | ⓘ Pumpellyite-(Fe2+) | Ca2Fe2+Al2(Si2O7)(SiO4)(OH,O)2 · H2O |
| Ca | ⓘ Ranciéite | (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O |
| Ca | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Ca | ⓘ Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| Ca | ⓘ Scheteligite | (Ca,Fe,Mn,Sb,Bi,Y)2(Ti,Ta,Nb,W)2(O,OH)7 |
| Ca | ⓘ Schröckingerite | NaCa3(UO2)(CO3)3(SO4)F · 10H2O |
| Ca | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
| Ca | ⓘ Stellerite | Ca4(Si28Al8)O72 · 28H2O |
| Ca | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Ca | ⓘ Zoisite var. Thulite | {Ca2}{Al,Mn33+}(Si2O7)(SiO4)O(OH) |
| Ca | ⓘ Titanite | CaTi(SiO4)O |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Tschermakite | ◻(Ca2)(Mg3Al2)(Al2Si6O22)(OH)2 |
| Ca | ⓘ Tveitite-(Y) | (Y, Na)6Ca6Ca6(Ca,Na)F42 |
| Ca | ⓘ Parauranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| Ca | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| Ca | ⓘ Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| Ca | ⓘ Volkonskoite | Ca0.3(Cr,Mg,Fe)2((Si,Al)4O10)(OH)2 · 4H2O |
| Ca | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Ca | ⓘ Fluorite var. Yttrofluorite | (Ca1-xYx)F2+x where 0.05< x |
| Ca | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Ca | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Ca | ⓘ Heulandite-K | (K,Ca,Na)5(Si27Al9)O72 · 26H2O |
| Ca | ⓘ Okayamalite | Ca2B[BSiO7] |
| Ca | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| Ca | ⓘ Titanite var. Yttrium-bearing Titanite | (Ca,Y)TiSiO5 |
| Ca | ⓘ Titanite var. Keilhauite | (Ca,Y3+)(Ti,Al,Fe3+)[SiO4]O |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Andradite var. Colophonite | Ca3Fe23+(SiO4)3 |
| Ca | ⓘ Epidote var. Withamite | {Ca2}{Al2(Fe3+,Mn)}(Si2O7)(SiO4)O(OH) |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ca | ⓘ Britholite Group | (REE,Ca)5[(Si,P)O4]3X |
| Ca | ⓘ Fluorbritholite-(Y) | (Y,Ca)5(SiO4)3F |
| Ca | ⓘ Hydroxycalciomicrolite | Ca1.5Ta2O6(OH) |
| Ca | ⓘ Cyprine | Ca19Cu2+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10](OH)(OH)9 |
| Sc | Scandium | |
| Sc | ⓘ Thortveitite | Sc2Si2O7 |
| Sc | ⓘ UM2000-35-O:FeNbScTaTi | (Sc,Fe2+,Fe3+,Mn)(Ti,Sn,Zr)1.5(Nb,Ta,W)1.33O8 |
| Ti | Titanium | |
| Ti | ⓘ Aeschynite-(Ce) | (Ce,Ca,Fe,Th)(Ti,Nb)2(O,OH)6 |
| Ti | ⓘ Aeschynite-(Y) | (Y,Ln,Ca,Th)(Ti,Nb)2(O,OH)6 |
| Ti | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Pyrochlore Supergroup var. Betafite (of Hogarth 1977) | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Brookite | TiO2 |
| Ti | ⓘ Davidite-(Ce) | Ce(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| Ti | ⓘ Davidite-(La) | La(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| Ti | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Ti | ⓘ Fersmite | (Ca,Ce,Na)(Nb,Ta,Ti)2(O,OH,F)6 |
| Ti | ⓘ Högbomite | (Mg,Fe)2(Al,Ti)5O10 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile var. Ilmenorutile | (Ti,Nb)O2 |
| Ti | ⓘ Perrierite-(Ce) | Ce4MgFe23+Ti2(Si2O7)2O8 |
| Ti | ⓘ Pyrophanite | Mn2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Scheteligite | (Ca,Fe,Mn,Sb,Bi,Y)2(Ti,Ta,Nb,W)2(O,OH)7 |
| Ti | ⓘ Titanite | CaTi(SiO4)O |
| Ti | ⓘ Magnetite var. Titanium-bearing Magnetite | Fe2+(Fe3+,Ti)2O4 |
| Ti | ⓘ Amphibole Supergroup var. Uralite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Ti | ⓘ Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| Ti | ⓘ Titanite var. Yttrium-bearing Titanite | (Ca,Y)TiSiO5 |
| Ti | ⓘ Titanite var. Keilhauite | (Ca,Y3+)(Ti,Al,Fe3+)[SiO4]O |
| Ti | ⓘ Fergusonite-(Y) var. Risörite | (Y,Er)(Nb,Ti,Ta)(O,OH)4 |
| Ti | ⓘ Rutile var. Niobium-bearing Rutile | (Ti,Nb)O2 |
| Ti | ⓘ Rutile var. Nigrine | TiO2 |
| Ti | ⓘ UM2000-35-O:FeNbScTaTi | (Sc,Fe2+,Fe3+,Mn)(Ti,Sn,Zr)1.5(Nb,Ta,W)1.33O8 |
| V | Vanadium | |
| V | ⓘ Carnotite | K2(UO2)2(VO4)2 · 3H2O |
| V | ⓘ Davidite-(Ce) | Ce(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| V | ⓘ Davidite-(La) | La(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| V | ⓘ Pyrobelonite | PbMn2+(VO4)(OH) |
| V | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Cr | Chromium | |
| Cr | ⓘ Davidite-(Ce) | Ce(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| Cr | ⓘ Davidite-(La) | La(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| Cr | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Cr | ⓘ Volkonskoite | Ca0.3(Cr,Mg,Fe)2((Si,Al)4O10)(OH)2 · 4H2O |
| Cr | ⓘ Hercynite var. Picotite | (Fe,Mg)(Al,Cr)2O4 |
| Mn | Manganese | |
| Mn | ⓘ Babingtonite | Ca2(Fe,Mn)FeSi5O14(OH) |
| Mn | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| Mn | ⓘ Friedelite | Mn82+Si6O15(OH,Cl)10 |
| Mn | ⓘ Groutite | Mn3+O(OH) |
| Mn | ⓘ Axinite-(Mn) | Ca2Mn2+Al2BSi4O15(OH) |
| Mn | ⓘ Manganite | Mn3+O(OH) |
| Mn | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| Mn | ⓘ Tantalite-(Mn) | Mn2+Ta2O6 |
| Mn | ⓘ Neotocite | (Mn,Fe,Mg)SiO3 · H2O |
| Mn | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Mn | ⓘ Pyrobelonite | PbMn2+(VO4)(OH) |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Mn | ⓘ Pyrophanite | Mn2+TiO3 |
| Mn | ⓘ Ramsdellite | Mn4+O2 |
| Mn | ⓘ Ranciéite | (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O |
| Mn | ⓘ Rhodochrosite | MnCO3 |
| Mn | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Mn | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| Mn | ⓘ Scheteligite | (Ca,Fe,Mn,Sb,Bi,Y)2(Ti,Ta,Nb,W)2(O,OH)7 |
| Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Mn | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Mn | ⓘ Tapiolite | (Fe,Mn)(Ta,Nb)2O6 |
| Mn | ⓘ Zoisite var. Thulite | {Ca2}{Al,Mn33+}(Si2O7)(SiO4)O(OH) |
| Mn | ⓘ Triplite | Mn22+(PO4)F |
| Mn | ⓘ Epidote var. Withamite | {Ca2}{Al2(Fe3+,Mn)}(Si2O7)(SiO4)O(OH) |
| Mn | ⓘ UM2000-35-O:FeNbScTaTi | (Sc,Fe2+,Fe3+,Mn)(Ti,Sn,Zr)1.5(Nb,Ta,W)1.33O8 |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Aeschynite-(Ce) | (Ce,Ca,Fe,Th)(Ti,Nb)2(O,OH)6 |
| Fe | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Atheriastite | near Ca5MgFeAl6Si8O32 · 5H2O |
| Fe | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Babingtonite | Ca2(Fe,Mn)FeSi5O14(OH) |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| Fe | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| Fe | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Fe | ⓘ Davidite-(Ce) | Ce(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| Fe | ⓘ Davidite-(La) | La(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| Fe | ⓘ Delessite | (Mg,Fe,Fe,Al)(Si,Al)4O10(O,OH)8 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Fe | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| Fe | ⓘ Ferro-actinolite | ◻Ca2Fe52+(Si8O22)(OH)2 |
| Fe | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| Fe | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Fe | ⓘ Ferrosilite | Fe22+Si2O6 |
| Fe | ⓘ Tantalite-(Fe) | Fe2+Ta2O6 |
| Fe | ⓘ Gadolinite-(Y) | Y2Fe2+Be2Si2O10 |
| Fe | ⓘ Goethite | α-Fe3+O(OH) |
| Fe | ⓘ Grandidierite | (Mg,Fe2+)(Al,Fe3+)3(SiO4)(BO3)O2 |
| Fe | ⓘ Gudmundite | FeSbS |
| Fe | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Hercynite | Fe2+Al2O4 |
| Fe | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| Fe | ⓘ Högbomite | (Mg,Fe)2(Al,Ti)5O10 |
| Fe | ⓘ Hypersthene | (Mg,Fe)SiO3 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| Fe | ⓘ Löllingite | FeAs2 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
| Fe | ⓘ Neotocite | (Mn,Fe,Mg)SiO3 · H2O |
| Fe | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Fe | ⓘ Perrierite-(Ce) | Ce4MgFe23+Ti2(Si2O7)2O8 |
| Fe | ⓘ Pumpellyite-(Fe2+) | Ca2Fe2+Al2(Si2O7)(SiO4)(OH,O)2 · H2O |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Rozenite | FeSO4 · 4H2O |
| Fe | ⓘ Samarskite-(Y) | YFe3+Nb2O8 |
| Fe | ⓘ Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| Fe | ⓘ Scheteligite | (Ca,Fe,Mn,Sb,Bi,Y)2(Ti,Ta,Nb,W)2(O,OH)7 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| Fe | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Fe | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Fe | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Fe | ⓘ Tapiolite | (Fe,Mn)(Ta,Nb)2O6 |
| Fe | ⓘ Magnetite var. Titanium-bearing Magnetite | Fe2+(Fe3+,Ti)2O4 |
| Fe | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Fe | ⓘ Violarite | Fe2+Ni23+S4 |
| Fe | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| Fe | ⓘ Volkonskoite | Ca0.3(Cr,Mg,Fe)2((Si,Al)4O10)(OH)2 · 4H2O |
| Fe | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Fe | ⓘ Yttrotantalite-(Y) | (Y,U,Fe2+)(Ta,Nb)(O,OH)4 |
| Fe | ⓘ Cordierite var. Iolite | (Mg,Fe)2Al3(AlSi5O18) |
| Fe | ⓘ Magnetite var. Lodestone | Fe2+Fe23+O4 |
| Fe | ⓘ Sphalerite var. Marmatite | (Zn,Fe)S |
| Fe | ⓘ Spinel var. Pleonaste | (Mg,Fe)Al2O4 |
| Fe | ⓘ Iddingsite | MgO · Fe2O3 · 3SiO2 · 4H2O |
| Fe | ⓘ Titanite var. Keilhauite | (Ca,Y3+)(Ti,Al,Fe3+)[SiO4]O |
| Fe | ⓘ Hercynite var. Picotite | (Fe,Mg)(Al,Cr)2O4 |
| Fe | ⓘ Andradite var. Colophonite | Ca3Fe23+(SiO4)3 |
| Fe | ⓘ Phlogopite var. Iron-bearing Phlogopite | K(Mg,Fe2+)3AlSi3O10(F,OH)2 |
| Fe | ⓘ Epidote var. Withamite | {Ca2}{Al2(Fe3+,Mn)}(Si2O7)(SiO4)O(OH) |
| Fe | ⓘ Chalcodite | K(Fe3+,Mg,Fe2+)8(Si,Al)12(O,OH)27 |
| Fe | ⓘ Siderophyllite var. Magnesium-bearing Siderophyllite | K(Fe2+,Mg)2Al(Si2Al2)O10(OH)2 |
| Fe | ⓘ UM2000-35-O:FeNbScTaTi | (Sc,Fe2+,Fe3+,Mn)(Ti,Sn,Zr)1.5(Nb,Ta,W)1.33O8 |
| Co | Cobalt | |
| Co | ⓘ Cobaltite | CoAsS |
| Co | ⓘ Linnaeite | Co2+Co23+S4 |
| Co | ⓘ Siegenite | CoNi2S4 |
| Co | ⓘ Skutterudite | CoAs3 |
| Co | ⓘ Willyamite | CoSbS |
| Ni | Nickel | |
| Ni | ⓘ Breithauptite | NiSb |
| Ni | ⓘ Millerite | NiS |
| Ni | ⓘ Nickelhexahydrite | Ni(SO4) · 6H2O |
| Ni | ⓘ Nickeline | NiAs |
| Ni | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Ni | ⓘ Siegenite | CoNi2S4 |
| Ni | ⓘ Ullmannite | NiSbS |
| Ni | ⓘ Violarite | Fe2+Ni23+S4 |
| Cu | Copper | |
| Cu | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Boothite | CuSO4 · 7H2O |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcanthite | CuSO4 · 5H2O |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Cuprite var. Chalcotrichite | Cu2O |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Copper | Cu |
| Cu | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Cu | ⓘ Digenite | Cu9S5 |
| Cu | ⓘ Djurleite | Cu31S16 |
| Cu | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Cu | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Cu | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| Cu | ⓘ Wittichenite | Cu3BiS3 |
| Cu | ⓘ Woodwardite | Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| Cu | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| Cu | ⓘ Cyprine | Ca19Cu2+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10](OH)(OH)9 |
| Zn | Zinc | |
| Zn | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Zn | ⓘ Gahnite | ZnAl2O4 |
| Zn | ⓘ Glaucocerinite | (Zn1-xAlx)(OH)2(SO4)x/2 · nH2O |
| Zn | ⓘ Smithsonite | ZnCO3 |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Sphalerite var. Marmatite | (Zn,Fe)S |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Cahnite | Ca2[B(OH)4](AsO4) |
| As | ⓘ Chernovite-(Y) | Y(AsO4) |
| As | ⓘ Cobaltite | CoAsS |
| As | ⓘ Löllingite | FeAs2 |
| As | ⓘ Nickeline | NiAs |
| As | ⓘ Skutterudite | CoAs3 |
| As | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Sr | Strontium | |
| Sr | ⓘ Ancylite-(Ce) | CeSr(CO3)2(OH) · H2O |
| Sr | ⓘ Calcioancylite-(Ce) | (Ce,Ca,Sr)CO3(OH,H2O) |
| Y | Yttrium | |
| Y | ⓘ Aeschynite-(Y) | (Y,Ln,Ca,Th)(Ti,Nb)2(O,OH)6 |
| Y | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| Y | ⓘ Britholite-(Y) | (Y,Ca)5(SiO4)3OH |
| Y | ⓘ Chernovite-(Y) | Y(AsO4) |
| Y | ⓘ Churchite-(Y) | Y(PO4) · 2H2O |
| Y | ⓘ Davidite-(Ce) | Ce(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| Y | ⓘ Davidite-(La) | La(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| Y | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Y | ⓘ Clinofergusonite-(Y) | YNbO4 |
| Y | ⓘ Fergusonite-(Y) | YNbO4 |
| Y | ⓘ Gadolinite-(Y) | Y2Fe2+Be2Si2O10 |
| Y | ⓘ Hellandite-(Y) | (Ca,REE)4Y2Al◻2(B4Si4O22) (OH)2 |
| Y | ⓘ Kainosite-(Y) | Ca2(Y,Ce)2(Si4O12)(CO3) · H2O |
| Y | ⓘ Kamphaugite-(Y) | Ca(Y,REE)(CO3)2(OH) · H2O |
| Y | ⓘ Keiviite-(Y) | Y2Si2O7 |
| Y | ⓘ Samarskite-(Y) | YFe3+Nb2O8 |
| Y | ⓘ Scheteligite | (Ca,Fe,Mn,Sb,Bi,Y)2(Ti,Ta,Nb,W)2(O,OH)7 |
| Y | ⓘ Tengerite-(Y) | Y2(CO3)3 · 2-3H2O |
| Y | ⓘ Thalénite-(Y) | Y3Si3O10F |
| Y | ⓘ Tombarthite-(Y) | Y4(Si,H4)4O12-x(OH)4+2x |
| Y | ⓘ Tveitite-(Y) | (Y, Na)6Ca6Ca6(Ca,Na)F42 |
| Y | ⓘ Xenotime-(Y) | Y(PO4) |
| Y | ⓘ Yttrialite-(Y) | (Y,Th)2Si2O7 |
| Y | ⓘ Fluorite var. Yttrofluorite | (Ca1-xYx)F2+x where 0.05< x |
| Y | ⓘ Yttrotantalite-(Y) | (Y,U,Fe2+)(Ta,Nb)(O,OH)4 |
| Y | ⓘ Titanite var. Yttrium-bearing Titanite | (Ca,Y)TiSiO5 |
| Y | ⓘ Titanite var. Keilhauite | (Ca,Y3+)(Ti,Al,Fe3+)[SiO4]O |
| Y | ⓘ Fergusonite-(Y) var. Risörite | (Y,Er)(Nb,Ti,Ta)(O,OH)4 |
| Y | ⓘ Fluorbritholite-(Y) | (Y,Ca)5(SiO4)3F |
| Zr | Zirconium | |
| Zr | ⓘ Zircon var. Alvite | Zr(SiO4) |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Zr | ⓘ Zircon var. Oerstedtite | Zr(SiO4) |
| Zr | ⓘ Zircon var. Hafnian Zircon | (Zr,Hf)SiO4 |
| Zr | ⓘ Zircon var. Malacon | Zr(SiO4) |
| Zr | ⓘ UM2000-35-O:FeNbScTaTi | (Sc,Fe2+,Fe3+,Mn)(Ti,Sn,Zr)1.5(Nb,Ta,W)1.33O8 |
| Nb | Niobium | |
| Nb | ⓘ Aeschynite-(Ce) | (Ce,Ca,Fe,Th)(Ti,Nb)2(O,OH)6 |
| Nb | ⓘ Aeschynite-(Y) | (Y,Ln,Ca,Th)(Ti,Nb)2(O,OH)6 |
| Nb | ⓘ Pyrochlore Supergroup var. Betafite (of Hogarth 1977) | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| Nb | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Nb | ⓘ Clinofergusonite-(Y) | YNbO4 |
| Nb | ⓘ Fergusonite-(Y) | YNbO4 |
| Nb | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| Nb | ⓘ Fersmite | (Ca,Ce,Na)(Nb,Ta,Ti)2(O,OH,F)6 |
| Nb | ⓘ Rutile var. Ilmenorutile | (Ti,Nb)O2 |
| Nb | ⓘ Liandratite | U(Nb,Ta)2O8 |
| Nb | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| Nb | ⓘ Pyrochlore Group | A2Nb2(O,OH)6Z |
| Nb | ⓘ Samarskite-(Y) | YFe3+Nb2O8 |
| Nb | ⓘ Scheteligite | (Ca,Fe,Mn,Sb,Bi,Y)2(Ti,Ta,Nb,W)2(O,OH)7 |
| Nb | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Nb | ⓘ Tapiolite | (Fe,Mn)(Ta,Nb)2O6 |
| Nb | ⓘ Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| Nb | ⓘ Pyrochlore Group var. Yttropyrochlore (of Hogarth 1977) | A2Nb2(O,OH)6Z |
| Nb | ⓘ Yttrotantalite-(Y) | (Y,U,Fe2+)(Ta,Nb)(O,OH)4 |
| Nb | ⓘ Fergusonite-(Y) var. Risörite | (Y,Er)(Nb,Ti,Ta)(O,OH)4 |
| Nb | ⓘ Rutile var. Niobium-bearing Rutile | (Ti,Nb)O2 |
| Nb | ⓘ Carlosbarbosaite | (UO2)2Nb2O6(OH)2 · 2H2O |
| Nb | ⓘ UM2000-35-O:FeNbScTaTi | (Sc,Fe2+,Fe3+,Mn)(Ti,Sn,Zr)1.5(Nb,Ta,W)1.33O8 |
| Mo | Molybdenum | |
| Mo | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| Mo | ⓘ Molybdenite | MoS2 |
| Mo | ⓘ Molybdite | MoO3 |
| Mo | ⓘ Powellite | Ca(MoO4) |
| Mo | ⓘ Molybdenite-2H | MoS2 |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
| Ag | ⓘ Gold var. Electrum | (Au,Ag) |
| Ag | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Ag | ⓘ Hessite | Ag2Te |
| Ag | ⓘ Matildite | AgBiS2 |
| Ag | ⓘ Pyrargyrite | Ag3SbS3 |
| Ag | ⓘ Schapbachite | Ag0.4Pb0.2Bi0.4S |
| Ag | ⓘ Silver | Ag |
| Ag | ⓘ Stephanite | Ag5SbS4 |
| Ag | ⓘ Zoubekite | AgPb4Sb4S10 |
| Sn | Tin | |
| Sn | ⓘ Abhurite | Sn21Cl16(OH)14O6 |
| Sn | ⓘ UM2000-35-O:FeNbScTaTi | (Sc,Fe2+,Fe3+,Mn)(Ti,Sn,Zr)1.5(Nb,Ta,W)1.33O8 |
| Sb | Antimony | |
| Sb | ⓘ Boulangerite | Pb5Sb4S11 |
| Sb | ⓘ Breithauptite | NiSb |
| Sb | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Sb | ⓘ Gudmundite | FeSbS |
| Sb | ⓘ Pyrargyrite | Ag3SbS3 |
| Sb | ⓘ Scheteligite | (Ca,Fe,Mn,Sb,Bi,Y)2(Ti,Ta,Nb,W)2(O,OH)7 |
| Sb | ⓘ Stephanite | Ag5SbS4 |
| Sb | ⓘ Stibnite | Sb2S3 |
| Sb | ⓘ Ullmannite | NiSbS |
| Sb | ⓘ Willyamite | CoSbS |
| Sb | ⓘ Zoubekite | AgPb4Sb4S10 |
| Te | Tellurium | |
| Te | ⓘ Hessite | Ag2Te |
| Te | ⓘ Tellurobismuthite | Bi2Te3 |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| La | Lanthanum | |
| La | ⓘ Davidite-(La) | La(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| La | ⓘ Hydroxylbastnäsite-(La) | (La,Nd,Ce)(CO3)(OH,F) |
| La | ⓘ Lanthanite-(Nd) | (Nd,La)2(CO3)3 · 8H2O |
| Ce | Cerium | |
| Ce | ⓘ Aeschynite-(Ce) | (Ce,Ca,Fe,Th)(Ti,Nb)2(O,OH)6 |
| Ce | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ce | ⓘ Ancylite-(Ce) | CeSr(CO3)2(OH) · H2O |
| Ce | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| Ce | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| Ce | ⓘ Calcioancylite-(Ce) | (Ce,Ca,Sr)CO3(OH,H2O) |
| Ce | ⓘ Cerianite-(Ce) | (Ce4+,Th)O2 |
| Ce | ⓘ Davidite-(Ce) | Ce(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| Ce | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Ce | ⓘ Fersmite | (Ca,Ce,Na)(Nb,Ta,Ti)2(O,OH,F)6 |
| Ce | ⓘ Fluocerite-(Ce) | CeF3 |
| Ce | ⓘ Hydroxylbastnäsite-(La) | (La,Nd,Ce)(CO3)(OH,F) |
| Ce | ⓘ Kainosite-(Y) | Ca2(Y,Ce)2(Si4O12)(CO3) · H2O |
| Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
| Ce | ⓘ Perrierite-(Ce) | Ce4MgFe23+Ti2(Si2O7)2O8 |
| Ce | ⓘ Rhabdophane-(Ce) | Ce(PO4) · 0.6H2O |
| Ce | ⓘ Törnebohmite-(Ce) | Ce2Al(SiO4)2(OH) |
| Ce | ⓘ Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| Nd | Neodymium | |
| Nd | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| Nd | ⓘ Hydroxylbastnäsite-(La) | (La,Nd,Ce)(CO3)(OH,F) |
| Nd | ⓘ Lanthanite-(Nd) | (Nd,La)2(CO3)3 · 8H2O |
| Nd | ⓘ Monazite-(Nd) | Nd(PO4) |
| Er | Erbium | |
| Er | ⓘ Fergusonite-(Y) var. Risörite | (Y,Er)(Nb,Ti,Ta)(O,OH)4 |
| Hf | Hafnium | |
| Hf | ⓘ Zircon var. Hafnian Zircon | (Zr,Hf)SiO4 |
| Ta | Tantalum | |
| Ta | ⓘ Pyrochlore Supergroup var. Betafite (of Hogarth 1977) | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| Ta | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Ta | ⓘ Tantalite-(Fe) | Fe2+Ta2O6 |
| Ta | ⓘ Fersmite | (Ca,Ce,Na)(Nb,Ta,Ti)2(O,OH,F)6 |
| Ta | ⓘ Liandratite | U(Nb,Ta)2O8 |
| Ta | ⓘ Tantalite-(Mn) | Mn2+Ta2O6 |
| Ta | ⓘ Microlite Group | A2-mTa2X6-wZ-n |
| Ta | ⓘ Scheteligite | (Ca,Fe,Mn,Sb,Bi,Y)2(Ti,Ta,Nb,W)2(O,OH)7 |
| Ta | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Ta | ⓘ Tapiolite | (Fe,Mn)(Ta,Nb)2O6 |
| Ta | ⓘ Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| Ta | ⓘ Yttrotantalite-(Y) | (Y,U,Fe2+)(Ta,Nb)(O,OH)4 |
| Ta | ⓘ Fergusonite-(Y) var. Risörite | (Y,Er)(Nb,Ti,Ta)(O,OH)4 |
| Ta | ⓘ Hydroxycalciomicrolite | Ca1.5Ta2O6(OH) |
| Ta | ⓘ UM2000-35-O:FeNbScTaTi | (Sc,Fe2+,Fe3+,Mn)(Ti,Sn,Zr)1.5(Nb,Ta,W)1.33O8 |
| W | Tungsten | |
| W | ⓘ Scheteligite | (Ca,Fe,Mn,Sb,Bi,Y)2(Ti,Ta,Nb,W)2(O,OH)7 |
| W | ⓘ UM2000-35-O:FeNbScTaTi | (Sc,Fe2+,Fe3+,Mn)(Ti,Sn,Zr)1.5(Nb,Ta,W)1.33O8 |
| Au | Gold | |
| Au | ⓘ Gold var. Electrum | (Au,Ag) |
| Au | ⓘ Gold | Au |
| Pb | Lead | |
| Pb | ⓘ Boulangerite | Pb5Sb4S11 |
| Pb | ⓘ Clarkeite | (Na,Ca,Pb)(UO2)O(OH) · 0-1H2O |
| Pb | ⓘ Cotunnite | PbCl2 |
| Pb | ⓘ Curite | Pb3(H2O)2[(UO2)4O4(OH)3]2 |
| Pb | ⓘ Fourmarierite | Pb(UO2)4O3(OH)4 · 4H2O |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Kasolite | Pb(UO2)(SiO4) · H2O |
| Pb | ⓘ Lead | Pb |
| Pb | ⓘ Minium | Pb3O4 |
| Pb | ⓘ Pyrobelonite | PbMn2+(VO4)(OH) |
| Pb | ⓘ Schapbachite | Ag0.4Pb0.2Bi0.4S |
| Pb | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Pb | ⓘ Vandendriesscheite | PbU7O22 · 12H2O |
| Pb | ⓘ Zoubekite | AgPb4Sb4S10 |
| Bi | Bismuth | |
| Bi | ⓘ Bismite | Bi2O3 |
| Bi | ⓘ Bismuth | Bi |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Bismutite | (BiO)2CO3 |
| Bi | ⓘ Matildite | AgBiS2 |
| Bi | ⓘ Schapbachite | Ag0.4Pb0.2Bi0.4S |
| Bi | ⓘ Scheteligite | (Ca,Fe,Mn,Sb,Bi,Y)2(Ti,Ta,Nb,W)2(O,OH)7 |
| Bi | ⓘ Tellurobismuthite | Bi2Te3 |
| Bi | ⓘ Wittichenite | Cu3BiS3 |
| Th | Thorium | |
| Th | ⓘ Aeschynite-(Ce) | (Ce,Ca,Fe,Th)(Ti,Nb)2(O,OH)6 |
| Th | ⓘ Aeschynite-(Y) | (Y,Ln,Ca,Th)(Ti,Nb)2(O,OH)6 |
| Th | ⓘ Uraninite var. Thorian Uraninite | (U,Th)O2 |
| Th | ⓘ Cerianite-(Ce) | (Ce4+,Th)O2 |
| Th | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Th | ⓘ Thorite var. Orangite | Th(SiO4) |
| Th | ⓘ Thorianite | ThO2 |
| Th | ⓘ Thorite | Th(SiO4) |
| Th | ⓘ Thorite var. Thorogummite | (Th,U)(SiO4)1-x(OH)4x |
| Th | ⓘ Yttrialite-(Y) | (Y,Th)2Si2O7 |
| Th | ⓘ Thorite var. Uranothorite | (Th,U)SiO4 |
| U | Uranium | |
| U | ⓘ Pyrochlore Supergroup var. Betafite (of Hogarth 1977) | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| U | ⓘ Uraninite var. Thorian Uraninite | (U,Th)O2 |
| U | ⓘ Carnotite | K2(UO2)2(VO4)2 · 3H2O |
| U | ⓘ Clarkeite | (Na,Ca,Pb)(UO2)O(OH) · 0-1H2O |
| U | ⓘ Coffinite | U(SiO4) · nH2O |
| U | ⓘ Curite | Pb3(H2O)2[(UO2)4O4(OH)3]2 |
| U | ⓘ Davidite-(Ce) | Ce(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| U | ⓘ Davidite-(La) | La(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| U | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| U | ⓘ Fourmarierite | Pb(UO2)4O3(OH)4 · 4H2O |
| U | ⓘ Kasolite | Pb(UO2)(SiO4) · H2O |
| U | ⓘ Liandratite | U(Nb,Ta)2O8 |
| U | ⓘ Schoepite | (UO2)8O2(OH)12 · 12H2O |
| U | ⓘ Schröckingerite | NaCa3(UO2)(CO3)3(SO4)F · 10H2O |
| U | ⓘ Thorite var. Thorogummite | (Th,U)(SiO4)1-x(OH)4x |
| U | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| U | ⓘ Uraninite | UO2 |
| U | ⓘ Parauranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| U | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| U | ⓘ Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| U | ⓘ Vandendriesscheite | PbU7O22 · 12H2O |
| U | ⓘ Yttrotantalite-(Y) | (Y,U,Fe2+)(Ta,Nb)(O,OH)4 |
| U | ⓘ Thorite var. Uranothorite | (Th,U)SiO4 |
| U | ⓘ Uraninite var. Cleveite | UO2 |
| U | ⓘ Carlosbarbosaite | (UO2)2Nb2O6(OH)2 · 2H2O |
Geochronology
Mineralization age: Proterozoic : 1750 Ma to 904.2 ± 0.3 MaImportant note: This table is based only on rock and mineral ages recorded on mindat.org for this locality and is not necessarily a complete representation of the geochronology, but does give an indication of possible mineralization events relevant to this locality. As more age information is added this table may expand in the future. A break in the table simply indicates a lack of data entered here, not necessarily a break in the geologic sequence. Grey background entries are from different, related, localities.
| Geologic Time | Rocks, Minerals and Events | |||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Precambrian | ||||||||||||||||
| Proterozoic | ||||||||||||||||
| Neoproterozoic | ||||||||||||||||
| Tonian |
| |||||||||||||||
| Mesoproterozoic | ||||||||||||||||
| Stenian |
| |||||||||||||||
| Ectasian |
| |||||||||||||||
| Calymmian |
| |||||||||||||||
| Paleoproterozoic | ||||||||||||||||
| Statherian |
| |||||||||||||||
Fossils
There are 1 fossil localities from the PaleoBioDB database within this region.BETA TEST - These data are provided on an experimental basis and are taken from external databases. Mindat.org has no control currently over the accuracy of these data.
| Occurrences | 58 | ||||||
|---|---|---|---|---|---|---|---|
| Youngest Fossil Listed | 439 Ma (Silurian) | ||||||
| Oldest Fossil Listed | 443 Ma (Silurian) | ||||||
| Stratigraphic Units |
| ||||||
| Fossils from Region | Click here to show the list. | ||||||
| Fossil Localities | Click to show 1 fossil locality |
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Agder |
|---|---|
| Wikidata ID: | Q2729021 |
| GeoNames ID: | 12110596 |
Localities in this Region
Other Regions, Features and Areas that Intersect
Eurasian PlateTectonic Plate
North SeaSea
Norway
- Agder
- Arendal
- Arendal Iron MinesGroup of Mines
- EptevatnetLake
- Kristiansand
- Skråstadheia Nature ReserveNature Reserve
- SetesdalValley
- Arendal
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Quick NavTopCommoditiesMineral ListRock TypesGeochronologyFossilsOther DatabasesLocalities in RegionOther Regions
Katterås 5 Pegmatite, Katterås, Vegusdal, Birkenes, Agder, Norway