Midlands, Zimbabwei
| Regional Level Types | |
|---|---|
| Midlands | Province |
| Zimbabwe | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Mindat Locality ID:
26322
Long-form identifier:
mindat:1:2:26322:2
GUID (UUID V4):
7e01f350-066e-4c94-946f-58d916a80d16
Other Languages:
French:
Province des Midlands, Zimbabwe
German:
Provinz Midlands, Simbabwe
Italian:
Provincia delle Midland, Zimbabwe
Russian:
Мидлендс, Зимбабве
Simplified Chinese:
中部省, 津巴布韦
Spanish:
Provincia de Midlands, Zimbabue
Afrikaans:
Midlands, Zimbabwe
Arabic:
إقليم ميدلاندس, زيمبابوي
Asturian:
Midlands
Basque:
Midlands
Belarusian (Tarashkevitsa):
Мідлэндс
Bulgarian:
Мидлендс, Зимбабве
Catalan:
Midlands, Zimbabwe
Cebuano:
Midlands Province
Danish:
Midlands, Zimbabwe
Dutch:
Midlands, Zimbabwe
Estonian:
Midlandsi provints, Zimbabwe
Farsi/Persian:
استان میدلندز, زیمبابوه
Finnish:
Midlands, Zimbabwe
Georgian:
მიდლენდსი
Hill Mari:
Мидлендс
Indonesian:
Provinsi Midlands, Zimbabwe
Japanese:
ミッドランズ州, ジンバブエ
Korean:
미들랜즈 주, 짐바브웨
Lithuanian:
Midlandsas, Zimbabvė
Northern Frisian:
Midlands
Norwegian:
Midlands, Zimbabwe
Polish:
Midlands, Zimbabwe
Portuguese:
Midlands, Zimbabwe
Romanian:
Provincia Midlands, Zimbabwe
Serbian:
Мидлендс, Зимбабве
Shona:
Midlands Province
Swedish:
Midlands, Zimbabwe
Turkish:
Midlands, Zimbabve
Ukrainian:
Мідлендс, Зімбабве
Urdu:
مڈلینڈز صوبہ
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities188 valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 Localities: |
| ⓘ Adamite Formula: Zn2(AsO4)(OH) |
| ⓘ Adamite var. Cobalt-bearing Adamite |
| ⓘ Adamite var. Copper-bearing Adamite Formula: (Zn,Cu)2AsO4OH |
| ⓘ Aegirine-augite Formula: (NaaCabFe2+cMgd)(Fe3+eAlfFe2+gMgh)Si2O6 |
| ⓘ Albite Formula: Na(AlSi3O8) Localities: Reported from at least 6 localities in this region. |
| ⓘ Albite var. Andesine Formula: (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ Albite var. Oligoclase Formula: (Na,Ca)[Al(Si,Al)Si2O8] Localities: References: |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 |
| ⓘ Altaite Formula: PbTe |
| ⓘ Alunite Formula: KAl3(SO4)2(OH)6 |
| ⓘ Andalusite Formula: Al2(SiO4)O |
| ⓘ Anglesite Formula: PbSO4 Description: From the Copper King anglesite is associated with pyromorphite and mimetite. |
| ⓘ Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 Localities: |
| ⓘ Anorthite Formula: Ca(Al2Si2O8) |
| ⓘ Anorthite var. Labradorite Formula: (Ca,Na)[Al(Al,Si)Si2O8] |
| ⓘ Anthophyllite Formula: ◻{Mg2}{Mg5}(Si8O22)(OH)2 Localities: |
| ⓘ Antigorite Formula: Mg3(Si2O5)(OH)4 Localities: |
| ⓘ Antimony Formula: Sb |
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) Localities: |
| ⓘ Arfvedsonite Formula: [Na][Na2][Fe2+4Fe3+]Si8O22(OH)2 |
| ⓘ Arsenopyrite Formula: FeAsS Localities: Reported from at least 11 localities in this region. |
| ⓘ Augite Formula: (CaxMgyFez)(Mgy1Fez1)Si2O6 Localities: |
| ⓘ Aurostibite Formula: AuSb2 |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 Localities: |
| ⓘ Baryte Formula: BaSO4 Locality: Gweru District, Midlands, Zimbabwe |
| ⓘ Bayldonite Formula: PbCu3(AsO4)2(OH)2 |
| ⓘ Beaverite-(Cu) Formula: Pb(Fe3+2Cu)(SO4)2(OH)6 |
| ⓘ Berthierite Formula: FeSb2S4 Localities: |
| ⓘ Beryl Formula: Be3Al2(Si6O18) Localities: References: |
| ⓘ Beryl var. Emerald Formula: Be3Al2(Si6O18) Localities: |
| ⓘ Beudantite Formula: PbFe3(AsO4)(SO4)(OH)6 |
| ⓘ Bieberite Formula: CoSO4 · 7H2O |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 Localities: References: |
| ⓘ Bismuth Formula: Bi |
| ⓘ Bismuthinite Formula: Bi2S3 |
| ⓘ Bismutite Formula: (BiO)2CO3 |
| ⓘ Bornite Formula: Cu5FeS4 Localities: |
| ⓘ Bournonite Formula: PbCuSbS3 Localities: |
| ⓘ Bowieite Formula: Rh2S3 |
| ⓘ Braggite Formula: PdPt3S4 Localities: References: |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 |
| ⓘ Brucite Formula: Mg(OH)2 Localities: Description: Found east of Kwekwe. |
| ⓘ 'Calcic plagioclase' |
| ⓘ Calcite Formula: CaCO3 Localities: |
| ⓘ Calcite var. Manganese-bearing Calcite Formula: (Ca,Mn)CO3 |
| ⓘ 'Calcite Group' Formula: AXO3 |
| ⓘ Cassiterite Formula: SnO2 Localities: References: |
| ⓘ Cerussite Formula: PbCO3 Localities: References: |
| ⓘ Chalcanthite Formula: CuSO4 · 5H2O |
| ⓘ Chalcocite Formula: Cu2S Localities: References: |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Reported from at least 12 localities in this region. References: |
| ⓘ Chalcostibite Formula: CuSbS2 |
| ⓘ 'Chlorite Group' Localities: Reported from at least 9 localities in this region. |
| ⓘ Chromite Formula: Fe2+Cr3+2O4 Localities: Reported from at least 6 localities in this region. |
| ⓘ Chrysoberyl Formula: BeAl2O4 Localities: References: |
| ⓘ Chrysoberyl var. Alexandrite Formula: BeAl2O4 |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 Localities: References: |
| ⓘ Chrysotile Formula: Mg3(Si2O5)(OH)4 Localities: |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 Localities: |
| ⓘ Clinochlore var. Diabantite Formula: (Mg,Fe,Al)6((Si,Al)4O10)(OH)8 |
| ⓘ Clinochlore var. Pennine Formula: Mg5Al(AlSi3O10)(OH)8 Localities: |
| ⓘ Clinochlore var. Pycnochlorite Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ Clinochlore var. Ripidolite Formula: (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| ⓘ 'Clinochrysotile' Localities: |
| ⓘ Clinoclase Formula: Cu3(AsO4)(OH)3 |
| ⓘ Clinohumite Formula: Mg9(SiO4)4F2 |
| ⓘ Clinozoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ Cobaltite Formula: CoAsS |
| ⓘ Coloradoite Formula: HgTe |
| ⓘ 'Columbite-Tantalite' |
| ⓘ Cooperite Formula: PtS Localities: References: |
| ⓘ Copper Formula: Cu Localities: |
| ⓘ Cornwallite Formula: Cu5(AsO4)2(OH)4 |
| ⓘ Coronadite Formula: Pb(Mn4+6Mn3+2)O16 |
| ⓘ Corundum Formula: Al2O3 Localities: Description: red corundum found in alluvial gravels close to Gwelo. |
| ⓘ Corundum var. Ruby Formula: Al2O3 Localities: References: |
| ⓘ Corundum var. Sapphire Formula: Al2O3 Localities: Description: Rubies and sapphires were found as early as 1903 when some small stones where faceted from this material. |
| ⓘ Covellite Formula: CuS Localities: References: |
| ⓘ Cubanite Formula: CuFe2S3 |
| ⓘ Cummingtonite Formula: ◻{Mg2}{Mg5}(Si8O22)(OH)2 Localities: |
| ⓘ Cuprite Formula: Cu2O Localities: References: |
| ⓘ Diamond Formula: C Localities: |
| ⓘ Diaspore Formula: AlO(OH) Description: Green chrome-diaspore is found here. |
| ⓘ Digenite Formula: Cu9S5 Localities: |
| ⓘ Diopside Formula: CaMgSi2O6 |
| ⓘ Dioptase Formula: CuSiO3 · H2O |
| ⓘ Dolomite Formula: CaMg(CO3)2 Localities: References: |
| ⓘ Duftite Formula: PbCu(AsO4)(OH) |
| ⓘ Enstatite Formula: Mg2Si2O6 |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) Localities: |
| ⓘ Erlichmanite Formula: OsS2 |
| ⓘ 'Fayalite-Forsterite Series' Localities: References: |
| ⓘ 'Feldspar Group' |
| ⓘ 'Feldspar Group var. Perthite' |
| ⓘ 'Ferro-actinolite-Tremolite Series' |
| ⓘ Ferronickelplatinum Formula: Pt2FeNi |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F |
| ⓘ Forsterite Formula: Mg2SiO4 |
| ⓘ Galena Formula: PbS Localities: Reported from at least 7 localities in this region. References: |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 Localities: References: |
| ⓘ Gedrite Formula: ◻{Mg2}{Mg3Al2}(Al2Si6O22)(OH)2 |
| ⓘ Gersdorffite Formula: NiAsS Localities: References: |
| ⓘ Goethite Formula: α-Fe3+O(OH) |
| ⓘ Gold Formula: Au Localities: Reported from at least 24 localities in this region. References: |
| ⓘ Gold var. Electrum Formula: (Au,Ag) Localities: |
| ⓘ Gorceixite Formula: BaAl3(PO4)(PO3OH)(OH)6 Description: Occurs in Triassic diamantiferous gravels. |
| ⓘ Goslarite Formula: ZnSO4 · 7H2O |
| ⓘ Graphite Formula: C |
| ⓘ Gudmundite Formula: FeSbS |
| ⓘ Gypsum Formula: CaSO4 · 2H2O |
| ⓘ Gypsum var. Selenite Formula: CaSO4 · 2H2O |
| ⓘ Halloysite Formula: Al2(Si2O5)(OH)4 |
| ⓘ Hematite Formula: Fe2O3 Localities: Reported from at least 7 localities in this region. References: |
| ⓘ Hemimorphite Formula: Zn4Si2O7(OH)2 · H2O |
| ⓘ Hessite Formula: Ag2Te |
| ⓘ Hetaerolite Formula: ZnMn2O4 |
| ⓘ Hidalgoite Formula: PbAl3(AsO4)(SO4)(OH)6 |
| ⓘ Hollingworthite Formula: (Rh,Pt,Pd)AsS Localities: References: |
| ⓘ Holmquistite Formula: ◻{Li2}{Mg3Al2}(Si8O22)(OH)2 |
| ⓘ 'Hornblende' Localities: |
| ⓘ Hydromagnesite Formula: Mg5(CO3)4(OH)2 · 4H2O |
| ⓘ Ilmenite Formula: Fe2+TiO3 Localities: Reported from at least 6 localities in this region. References: |
| ⓘ Irarsite Formula: (Ir,Ru,Rh,Pt)AsS |
| ⓘ Iridium Formula: (Ir,Os,Ru) |
| ⓘ Iridium var. Osmiridium Formula: (Ir,Os,Ru) |
| ⓘ 'Iron-Platinum alloy' Formula: (Pt,Fe) Localities: |
| ⓘ Isomertieite Formula: Pd11Sb2As2 |
| ⓘ Jamesonite Formula: Pb4FeSb6S14 Localities: |
| ⓘ Jarosite Formula: KFe3+3(SO4)2(OH)6 |
| ⓘ Kermesite Formula: Sb2S2O Localities: Description: Crystal cluster, 4.5 inches |
| ⓘ 'K Feldspar' Localities: References: |
| ⓘ 'K Feldspar var. Adularia' Formula: KAlSi3O8 |
| ⓘ Kostovite Formula: CuAuTe4 |
| ⓘ Kotulskite Formula: Pd(Te,Bi)2-x (x ≈ 0.4) |
| ⓘ Kyanite Formula: Al2(SiO4)O Localities: References: |
| ⓘ Laurite Formula: RuS2 Localities: |
| ⓘ Lavendulan Formula: NaCaCu5(AsO4)4Cl · 5H2O |
| ⓘ Legrandite Formula: Zn2(AsO4)(OH) · H2O |
| ⓘ Lepidocrocite Formula: γ-Fe3+O(OH) |
| ⓘ 'Leucoxene' Localities: |
| ⓘ 'Limonite' Localities: |
| ⓘ Linnaeite Formula: Co2+Co3+2S4 Localities: |
| ⓘ Litharge Formula: PbO |
| ⓘ Mackinawite Formula: FeS |
| ⓘ Magnesite Formula: MgCO3 |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 Localities: Reported from at least 10 localities in this region. References: |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 Localities: |
| ⓘ Marcasite Formula: FeS2 |
| ⓘ Maslovite Formula: PtBiTe Localities: |
| ⓘ Matlockite Formula: PbFCl |
| ⓘ Melanterite Formula: Fe2+(H2O)6SO4 · H2O |
| ⓘ Melonite Formula: NiTe2 |
| ⓘ Merenskyite Formula: PdTe2 |
| ⓘ Michenerite Formula: PdBiTe Localities: |
| ⓘ Microcline Formula: K(AlSi3O8) Localities: |
| ⓘ Milarite Formula: K(◻H2O)Ca2(Be2Al)[Si12O30] |
| ⓘ Millerite Formula: NiS |
| ⓘ Mimetite Formula: Pb5(AsO4)3Cl Description: From the Copper King mimetite is associated with pyromorphite and anglesite. |
| ⓘ 'Monazite' Formula: REE(PO4) Localities: |
| ⓘ Moncheite Formula: Pt(Te,Bi)2 Localities: References: |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 7 localities in this region. References: |
| ⓘ Muscovite var. Fuchsite Formula: K(Al,Cr)3Si3O10(OH)2 |
| ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 Localities: Indarama Mine, Kwekwe District, Midlands, Zimbabwe Sanyati Mine, Gokwe North District, Midlands, Zimbabwe Ford Mine, Kwekwe District, Midlands, Zimbabwe Connemara gold deposit, Connemara, Gweru District, Midlands, Zimbabwe Globe and Phoenix Mine, Kwekwe (Que Que; QueQue), Kwekwe District, Midlands, Zimbabwe |
| ⓘ Olivenite Formula: Cu2(AsO4)(OH) |
| ⓘ 'Olivine Group' Formula: M2SiO4 |
| ⓘ 'Orthopyroxene Subgroup' |
| ⓘ Osarizawaite Formula: Pb(Al2Cu2+)(SO4)2(OH)6 |
| ⓘ Osmium Formula: (Os,Ir,Ru) |
| ⓘ 'Parachrysotile' |
| ⓘ Pentahydrite Formula: MgSO4 · 5H2O |
| ⓘ Pentlandite Formula: (NixFey)Σ9S8 Localities: Mimosa Mine, Zvishavane (Shabani; Shabanie; Shavani), Zvishavane District, Midlands, Zimbabwe Unki Mine, Shurugwi District, Midlands, Zimbabwe Epoch Mine, Insiza District, Matabeleland South, Zimbabwe Empress Mine, Kwekwe District, Midlands, Zimbabwe Hunters Road deposit, Kwekwe District, Midlands, Zimbabwe References: |
| ⓘ Petzite Formula: Ag3AuTe2 |
| ⓘ Pharmacosiderite Formula: KFe3+4(AsO4)3(OH)4 · 6-7H2O |
| ⓘ Phenakite Formula: Be2SiO4 |
| ⓘ Philipsbornite Formula: PbAl3(AsO4)(AsO3OH)(OH)6 |
| ⓘ Phlogopite Formula: KMg3(AlSi3O10)(OH)2 Localities: |
| ⓘ Pigeonite Formula: (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 Localities: References: |
| ⓘ Platinum Formula: Pt Localities: References: |
| ⓘ Plumbojarosite Formula: Pb0.5Fe3+3(SO4)2(OH)6 |
| ⓘ Polarite Formula: Pd(Bi,Pb) |
| ⓘ Potarite Formula: PdHg Localities: |
| ⓘ Prehnite Formula: Ca2Al2Si3O10(OH)2 |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 20 localities in this region. |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl Localities: Description: From the Copper King pyromorphite is associated with anglesite and mimetite. References: |
| ⓘ 'Pyroxene Group' Formula: ADSi2O6 Localities: |
| ⓘ Pyrrhotite Formula: Fe1-xS Localities: Reported from at least 9 localities in this region. References: |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 20 localities in this region. References: |
| ⓘ Quartz var. Chalcedony Formula: SiO2 |
| ⓘ Quartz var. Jasper |
| ⓘ Renierite ? Formula: (Cu1+,Zn)11Fe4(Ge4+,As5+)2S16 |
| ⓘ Rhodium Formula: (Rh,Pt) |
| ⓘ Rickardite Formula: Cu7Te5 |
| ⓘ Riebeckite Formula: ◻[Na2][Fe2+3Fe3+2]Si8O22(OH)2 |
| ⓘ Rosasite Formula: (Cu,Zn)2(CO3)(OH)2 |
| ⓘ Rouaite Formula: Cu2(NO3)(OH)3 Description: Originally described as an unknown Cu nitrate by Vetter et al. (1999). |
| ⓘ Ruarsite Formula: (Ru,Os)AsS |
| ⓘ Rustenburgite Formula: (Pt,Pd)3Sn Localities: |
| ⓘ Rutile Formula: TiO2 Localities: Reported from at least 7 localities in this region. References: |
| ⓘ 'Saussurite' |
| ⓘ Scheelite Formula: Ca(WO4) |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Scorodite Formula: Fe3+AsO4 · 2H2O |
| ⓘ 'Serpentine Subgroup' Formula: D3[Si2O5](OH)4 Localities: |
| ⓘ Siderite Formula: FeCO3 Localities: |
| ⓘ Siderite var. Mg-rich Siderite Formula: (Fe,Mg)CO3 |
| ⓘ Siderophyllite Formula: KFe2+2Al(Al2Si2O10)(OH)2 |
| ⓘ 'Smectite Group' Formula: A0.3D2-3[T4O10]Z2 · nH2O |
| ⓘ Smithsonite Formula: ZnCO3 |
| ⓘ Sobolevskite Formula: PdBi |
| ⓘ Sperrylite Formula: PtAs2 Localities: Mimosa Mine, Zvishavane (Shabani; Shabanie; Shavani), Zvishavane District, Midlands, Zimbabwe Unki Mine, Shurugwi District, Midlands, Zimbabwe Wedza Mine, Zvishavane (Shabani; Shabanie; Shavani), Zvishavane District, Midlands, Zimbabwe Umtebekwe River, Shurugwi District, Midlands, Zimbabwe Umtshingwe River, Zvishavane District, Midlands, Zimbabwe References: |
| ⓘ Sperrylite var. Platarsite Formula: PtAsS |
| ⓘ Sphalerite Formula: ZnS Localities: Reported from at least 10 localities in this region. |
| ⓘ Starkeyite Formula: MgSO4 · 4H2O |
| ⓘ Staurolite Formula: Fe2+2Al9Si4O23(OH) Localities: |
| ⓘ Stibiopalladinite Formula: Pd5Sb2 |
| ⓘ Stibnite Formula: Sb2S3 Localities: Reported from at least 6 localities in this region. |
| ⓘ Stichtite Formula: Mg6Cr3+2(OH)16[CO3] · 4H2O |
| ⓘ Stützite Formula: Ag5-xTe3, x = 0.24-0.36 |
| ⓘ Sylvanite Formula: AgAuTe4 |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 Localities: Reported from at least 9 localities in this region. References: |
| ⓘ Tellurium Formula: Te |
| ⓘ Tenorite Formula: CuO |
| ⓘ Tetraferroplatinum Formula: PtFe |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S Localities: |
| ⓘ Titanite Formula: CaTi(SiO4)O Localities: |
| ⓘ Topaz Formula: Al2(SiO4)(F,OH)2 Localities: Colour: White and blue |
| ⓘ 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z Localities: References: |
| ⓘ Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 Localities: |
| ⓘ Tschermakite Formula: ◻(Ca2)(Mg3Al2)(Al2Si6O22)(OH)2 |
| ⓘ Tulameenite Formula: Pt2CuFe |
| ⓘ 'UM2002-27-S:Rh' Formula: RhS |
| ⓘ 'UM2002-50-Te:PdPtRhS' Formula: (Rh,Pd,Pt)3(Te,S)2 |
| ⓘ Vaesite Formula: NiS2 |
| ⓘ Valleriite Formula: (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 Localities: |
| ⓘ Veszelyite Formula: (Cu,Zn)2Zn(PO4)(OH)3 · 2H2O |
| ⓘ 'Wad' Localities: |
| ⓘ Weissite Formula: Cu2-xTe |
| ⓘ Winchite Formula: ◻{CaNa}{Mg4Al}(Si8O22)(OH)2 |
| ⓘ Xenotime-(Y) Formula: Y(PO4) |
| ⓘ Zircon Formula: Zr(SiO4) Localities: Reported from at least 6 localities in this region. References: |
| ⓘ Zoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) Localities: |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Antimony | 1.CA.05 | Sb |
| ⓘ | Bismuth | 1.CA.05 | Bi |
| ⓘ | Copper | 1.AA.05 | Cu |
| ⓘ | Diamond | 1.CB.10a | C |
| ⓘ | Ferronickelplatinum | 1.AG.40 | Pt2FeNi |
| ⓘ | Gold | 1.AA.05 | Au |
| ⓘ | var. Electrum | 1.AA.05 | (Au,Ag) |
| ⓘ | Graphite | 1.CB.05a | C |
| ⓘ | Iridium | 1.AF.10 | (Ir,Os,Ru) |
| ⓘ | var. Osmiridium | 1.AF.10 | (Ir,Os,Ru) |
| ⓘ | Osmium | 1.AF.05 | (Os,Ir,Ru) |
| ⓘ | Platinum | 1.AF.10 | Pt |
| ⓘ | Potarite | 1.AD.25 | PdHg |
| ⓘ | Rhodium | 1.AF.10 | (Rh,Pt) |
| ⓘ | Rustenburgite | 1.AG.10 | (Pt,Pd)3Sn |
| ⓘ | Tellurium | 1.CC.10 | Te |
| ⓘ | Tetraferroplatinum | 1.AG.40 | PtFe |
| ⓘ | Tulameenite | 1.AG.40 | Pt2CuFe |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Altaite | 2.CD.10 | PbTe |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Aurostibite | 2.EB.05a | AuSb2 |
| ⓘ | Berthierite | 2.HA.20 | FeSb2S4 |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Bournonite | 2.GA.50 | PbCuSbS3 |
| ⓘ | Bowieite | 2.DB.15 | Rh2S3 |
| ⓘ | Braggite | 2.CC.35a | PdPt3S4 |
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Chalcostibite | 2.HA.05 | CuSbS2 |
| ⓘ | Cobaltite | 2.EB.25 | CoAsS |
| ⓘ | Coloradoite | 2.CB.05a | HgTe |
| ⓘ | Cooperite | 2.CC.35b | PtS |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Cubanite | 2.CB.55a | CuFe2S3 |
| ⓘ | Digenite | 2.BA.10 | Cu9S5 |
| ⓘ | Erlichmanite | 2.EB.05a | OsS2 |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Gersdorffite | 2.EB.25 | NiAsS |
| ⓘ | Gudmundite | 2.EB.20 | FeSbS |
| ⓘ | Hessite | 2.BA.60 | Ag2Te |
| ⓘ | Hollingworthite | 2.EB.25 | (Rh,Pt,Pd)AsS |
| ⓘ | Irarsite | 2.EB.25 | (Ir,Ru,Rh,Pt)AsS |
| ⓘ | Isomertieite | 2.AC.15a | Pd11Sb2As2 |
| ⓘ | Jamesonite | 2.HB.15 | Pb4FeSb6S14 |
| ⓘ | Kermesite | 2.FD.05 | Sb2S2O |
| ⓘ | Kostovite | 2.EA.15 | CuAuTe4 |
| ⓘ | Kotulskite | 2.CC.05 | Pd(Te,Bi)2-x (x ≈ 0.4) |
| ⓘ | Laurite | 2.EB.05a | RuS2 |
| ⓘ | Linnaeite | 2.DA.05 | Co2+Co3+2S4 |
| ⓘ | Mackinawite | 2.CC.25 | FeS |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Maslovite | 2.EB.25 | PtBiTe |
| ⓘ | Melonite | 2.EA.20 | NiTe2 |
| ⓘ | Merenskyite | 2.EA.20 | PdTe2 |
| ⓘ | Michenerite | 2.EB.25 | PdBiTe |
| ⓘ | Millerite | 2.CC.20 | NiS |
| ⓘ | Moncheite | 2.EA.20 | Pt(Te,Bi)2 |
| ⓘ | Pentlandite | 2.BB.15 | (NixFey)Σ9S8 |
| ⓘ | Petzite | 2.BA.75 | Ag3AuTe2 |
| ⓘ | Polarite | 2.AC.40 | Pd(Bi,Pb) |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Renierite ? | 2.CB.35a | (Cu1+,Zn)11Fe4(Ge4+,As5+)2S16 |
| ⓘ | Rickardite | 2.BA.30 | Cu7Te5 |
| ⓘ | Ruarsite | 2.EB.20 | (Ru,Os)AsS |
| ⓘ | Sobolevskite | 2.CC.05 | PdBi |
| ⓘ | Sperrylite | 2.EB.05a | PtAs2 |
| ⓘ | var. Platarsite | 2.EB.05a | PtAsS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Stibiopalladinite | 2.AC.20a | Pd5Sb2 |
| ⓘ | Stibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Stützite | 2.BA.65 | Ag5-xTe3, x = 0.24-0.36 |
| ⓘ | Sylvanite | 2.EA.05 | AgAuTe4 |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | Vaesite | 2.EB.05a | NiS2 |
| ⓘ | Valleriite | 2.FD.30 | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| ⓘ | Weissite | 2.BA.30 | Cu2-xTe |
| Group 3 - Halides | |||
| ⓘ | Matlockite | 3.DC.25 | PbFCl |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Brucite | 4.FE.05 | Mg(OH)2 |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Chromite | 4.BB.05 | Fe2+Cr3+2O4 |
| ⓘ | Chrysoberyl | 4.BA.05 | BeAl2O4 |
| ⓘ | var. Alexandrite | 4.BA.05 | BeAl2O4 |
| ⓘ | Coronadite | 4.DK.05a | Pb(Mn4+6Mn3+2)O16 |
| ⓘ | Corundum | 4.CB.05 | Al2O3 |
| ⓘ | var. Ruby | 4.CB.05 | Al2O3 |
| ⓘ | var. Sapphire | 4.CB.05 | Al2O3 |
| ⓘ | Cuprite | 4.AA.10 | Cu2O |
| ⓘ | Diaspore | 4.FD.10 | AlO(OH) |
| ⓘ | Goethite | 4.00. | α-Fe3+O(OH) |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Hetaerolite | 4.BB.10 | ZnMn2O4 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Lepidocrocite | 4.FE.15 | γ-Fe3+O(OH) |
| ⓘ | Litharge | 4.AC.20 | PbO |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | var. Jasper | 4.DA.05 | SiO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Tenorite | 4.AB.10 | CuO |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Bismutite | 5.BE.25 | (BiO)2CO3 |
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | var. Manganese-bearing Calcite | 5.AB.05 | (Ca,Mn)CO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Hydromagnesite | 5.DA.05 | Mg5(CO3)4(OH)2 · 4H2O |
| ⓘ | Magnesite | 5.AB.05 | MgCO3 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Rosasite | 5.BA.10 | (Cu,Zn)2(CO3)(OH)2 |
| ⓘ | Rouaite | 5.NB.05 | Cu2(NO3)(OH)3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | var. Mg-rich Siderite | 5.AB.05 | (Fe,Mg)CO3 |
| ⓘ | Smithsonite | 5.AB.05 | ZnCO3 |
| ⓘ | Stichtite | 5.DA.50 | Mg6Cr3+2(OH)16[CO3] · 4H2O |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Alunite | 7.BC.10 | KAl3(SO4)2(OH)6 |
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Beaverite-(Cu) | 7.BC.10 | Pb(Fe3+2Cu)(SO4)2(OH)6 |
| ⓘ | Bieberite | 7.CB.35 | CoSO4 · 7H2O |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Chalcanthite | 7.CB.20 | CuSO4 · 5H2O |
| ⓘ | Goslarite | 7.CB.40 | ZnSO4 · 7H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | var. Selenite | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Melanterite | 7.CB.35 | Fe2+(H2O)6SO4 · H2O |
| ⓘ | Osarizawaite | 7.BC.10 | Pb(Al2Cu2+)(SO4)2(OH)6 |
| ⓘ | Pentahydrite | 7.CB.20 | MgSO4 · 5H2O |
| ⓘ | Plumbojarosite | 7.BC.10 | Pb0.5Fe3+3(SO4)2(OH)6 |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| ⓘ | Starkeyite | 7.CB.15 | MgSO4 · 4H2O |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Adamite | 8.BB.30 | Zn2(AsO4)(OH) |
| ⓘ | var. Cobalt-bearing Adamite | 8.BB.30 | Zn2(AsO4)(OH) |
| ⓘ | var. Copper-bearing Adamite | 8.BB.30 | (Zn,Cu)2AsO4OH |
| ⓘ | Bayldonite | 8.BH.45 | PbCu3(AsO4)2(OH)2 |
| ⓘ | Beudantite | 8.BL.05 | PbFe3(AsO4)(SO4)(OH)6 |
| ⓘ | Clinoclase | 8.BE.20 | Cu3(AsO4)(OH)3 |
| ⓘ | Cornwallite | 8.BD.05 | Cu5(AsO4)2(OH)4 |
| ⓘ | Duftite | 8.BH.35 | PbCu(AsO4)(OH) |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Gorceixite | 8.BL.10 | BaAl3(PO4)(PO3OH)(OH)6 |
| ⓘ | Hidalgoite | 8.BL.05 | PbAl3(AsO4)(SO4)(OH)6 |
| ⓘ | Lavendulan | 8.DG.05 | NaCaCu5(AsO4)4Cl · 5H2O |
| ⓘ | Legrandite | 8.DC.10 | Zn2(AsO4)(OH) · H2O |
| ⓘ | Mimetite | 8.BN.05 | Pb5(AsO4)3Cl |
| ⓘ | Olivenite | 8.BB.30 | Cu2(AsO4)(OH) |
| ⓘ | Pharmacosiderite | 8.DK.10 | KFe3+4(AsO4)3(OH)4 · 6-7H2O |
| ⓘ | Philipsbornite | 8.BL.10 | PbAl3(AsO4)(AsO3OH)(OH)6 |
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| ⓘ | Scorodite | 8.CD.10 | Fe3+AsO4 · 2H2O |
| ⓘ | Veszelyite | 8.DE.30 | (Cu,Zn)2Zn(PO4)(OH)3 · 2H2O |
| ⓘ | Xenotime-(Y) | 8.AD.35 | Y(PO4) |
| Group 9 - Silicates | |||
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Aegirine-augite | 9.DA.20 | (NaaCabFe2+cMgd)(Fe3+eAlfFe2+gMgh)Si2O6 |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Andesine | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ | var. Oligoclase | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | Anorthite | 9.FA.35 | Ca(Al2Si2O8) |
| ⓘ | var. Labradorite | 9.FA.35 | (Ca,Na)[Al(Al,Si)Si2O8] |
| ⓘ | Anthophyllite | 9.DD.05 | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| ⓘ | Antigorite | 9.ED.15 | Mg3(Si2O5)(OH)4 |
| ⓘ | Arfvedsonite | 9.DE.25 | [Na][Na2][Fe2+4Fe3+]Si8O22(OH)2 |
| ⓘ | Augite | 9.DA.15 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | var. Emerald | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Chrysotile | 9.. | Mg3(Si2O5)(OH)4 |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | var. Diabantite | 9.EC.55 | (Mg,Fe,Al)6((Si,Al)4O10)(OH)8 |
| ⓘ | var. Pennine | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | var. Pycnochlorite | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | var. Ripidolite | 9.EC.55 | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| ⓘ | 'Clinochrysotile' | 9.ED. | |
| ⓘ | Clinohumite | 9.AF.55 | Mg9(SiO4)4F2 |
| ⓘ | Clinozoisite | 9.BG.05a | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Cummingtonite | 9.DE.05 | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Dioptase | 9.CJ.30 | CuSiO3 · H2O |
| ⓘ | Enstatite | 9.DA.05 | Mg2Si2O6 |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Forsterite | 9.AC.05 | Mg2SiO4 |
| ⓘ | Gedrite | 9.DD.05 | ◻{Mg2}{Mg3Al2}(Al2Si6O22)(OH)2 |
| ⓘ | Halloysite | 9.ED.10 | Al2(Si2O5)(OH)4 |
| ⓘ | Hemimorphite | 9.BD.10 | Zn4Si2O7(OH)2 · H2O |
| ⓘ | Holmquistite | 9.DD.05 | ◻{Li2}{Mg3Al2}(Si8O22)(OH)2 |
| ⓘ | Kyanite | 9.AF.15 | Al2(SiO4)O |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Milarite | 9.CM.05 | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | var. Fuchsite | 9.EC.15 | K(Al,Cr)3Si3O10(OH)2 |
| ⓘ | var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Phenakite | 9.AA.05 | Be2SiO4 |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Pigeonite | 9.DA.10 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ | Prehnite | 9.DP.20 | Ca2Al2Si3O10(OH)2 |
| ⓘ | Riebeckite | 9.DE.25 | ◻[Na2][Fe2+3Fe3+2]Si8O22(OH)2 |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Siderophyllite | 9.EC.20 | KFe2+2Al(Al2Si2O10)(OH)2 |
| ⓘ | Staurolite | 9.AF.30 | Fe2+2Al9Si4O23(OH) |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
| ⓘ | Topaz | 9.AF.35 | Al2(SiO4)(F,OH)2 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Tschermakite | 9.DE.10 | ◻(Ca2)(Mg3Al2)(Al2Si6O22)(OH)2 |
| ⓘ | Winchite | 9.DE.20 | ◻{CaNa}{Mg4Al}(Si8O22)(OH)2 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Zoisite | 9.BG.10 | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Unclassified Minerals, Rocks, etc. | |||
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| ⓘ | 'Calcic plagioclase' | - | |
| ⓘ | 'Calcite Group' | - | AXO3 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Columbite-Tantalite' | - | |
| ⓘ | 'Fayalite-Forsterite Series' | - | |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'var. Perthite' | - | |
| ⓘ | 'Ferro-actinolite-Tremolite Series' | - | |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Hornblende' | - | |
| ⓘ | 'Iron-Platinum alloy' | - | (Pt,Fe) |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'var. Adularia' | - | KAlSi3O8 |
| ⓘ | 'Leucoxene' | - | |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Monazite' | - | REE(PO4) |
| ⓘ | 'Olivine Group' | - | M2SiO4 |
| ⓘ | 'Orthopyroxene Subgroup' | - | |
| ⓘ | 'Parachrysotile' | - | |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'Pyroxene Group' | - | ADSi2O6 |
| ⓘ | 'Saussurite' | - | |
| ⓘ | 'Serpentine Subgroup' | - | D3[Si2O5](OH)4 |
| ⓘ | 'Smectite Group' | - | A0.3D2-3[T4O10]Z2 · nH2O |
| ⓘ | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
| ⓘ | 'UM2002-27-S:Rh' | - | RhS |
| ⓘ | 'UM2002-50-Te:PdPtRhS' | - | (Rh,Pd,Pt)3(Te,S)2 |
| ⓘ | 'Wad' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| H | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Winchite | ◻{CaNa}{Mg4Al}(Si8O22)(OH)2 |
| H | ⓘ Riebeckite | ◻[Na2][Fe32+Fe23+]Si8O22(OH)2 |
| H | ⓘ Arfvedsonite | [Na][Na2][Fe42+Fe3+]Si8O22(OH)2 |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Rouaite | Cu2(NO3)(OH)3 |
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Anthophyllite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| H | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| H | ⓘ Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Goethite | α-Fe3+O(OH) |
| H | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Osarizawaite | Pb(Al2Cu2+)(SO4)2(OH)6 |
| H | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| H | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
| H | ⓘ Bieberite | CoSO4 · 7H2O |
| H | ⓘ Goslarite | ZnSO4 · 7H2O |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Veszelyite | (Cu,Zn)2Zn(PO4)(OH)3 · 2H2O |
| H | ⓘ Olivenite | Cu2(AsO4)(OH) |
| H | ⓘ Adamite | Zn2(AsO4)(OH) |
| H | ⓘ Cornwallite | Cu5(AsO4)2(OH)4 |
| H | ⓘ Clinoclase | Cu3(AsO4)(OH)3 |
| H | ⓘ Duftite | PbCu(AsO4)(OH) |
| H | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| H | ⓘ Philipsbornite | PbAl3(AsO4)(AsO3OH)(OH)6 |
| H | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| H | ⓘ Legrandite | Zn2(AsO4)(OH) · H2O |
| H | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| H | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| H | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Halloysite | Al2(Si2O5)(OH)4 |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Cummingtonite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| H | ⓘ Holmquistite | ◻{Li2}{Mg3Al2}(Si8O22)(OH)2 |
| H | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| H | ⓘ Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Stichtite | Mg6Cr23+(OH)16[CO3] · 4H2O |
| H | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| H | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| H | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| H | ⓘ Brucite | Mg(OH)2 |
| H | ⓘ Diaspore | AlO(OH) |
| H | ⓘ Dioptase | CuSiO3 · H2O |
| H | ⓘ Adamite var. Copper-bearing Adamite | (Zn,Cu)2AsO4OH |
| H | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| H | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| H | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| H | ⓘ Smectite Group | A0.3D2-3[T4O10]Z2 · nH2O |
| H | ⓘ Lepidocrocite | γ-Fe3+O(OH) |
| H | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| H | ⓘ Hidalgoite | PbAl3(AsO4)(SO4)(OH)6 |
| H | ⓘ Beudantite | PbFe3(AsO4)(SO4)(OH)6 |
| H | ⓘ Pentahydrite | MgSO4 · 5H2O |
| H | ⓘ Chalcanthite | CuSO4 · 5H2O |
| H | ⓘ Starkeyite | MgSO4 · 4H2O |
| H | ⓘ Clinochlore var. Pycnochlorite | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Clinochlore var. Diabantite | (Mg,Fe,Al)6((Si,Al)4O10)(OH)8 |
| H | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Gedrite | ◻{Mg2}{Mg3Al2}(Al2Si6O22)(OH)2 |
| H | ⓘ Tschermakite | ◻(Ca2)(Mg3Al2)(Al2Si6O22)(OH)2 |
| H | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| H | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| H | ⓘ Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| Li | Lithium | |
| Li | ⓘ Holmquistite | ◻{Li2}{Mg3Al2}(Si8O22)(OH)2 |
| Be | Beryllium | |
| Be | ⓘ Chrysoberyl | BeAl2O4 |
| Be | ⓘ Beryl var. Emerald | Be3Al2(Si6O18) |
| Be | ⓘ Phenakite | Be2SiO4 |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| Be | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| Be | ⓘ Chrysoberyl var. Alexandrite | BeAl2O4 |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Diamond | C |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Graphite | C |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Smithsonite | ZnCO3 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| C | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| C | ⓘ Stichtite | Mg6Cr23+(OH)16[CO3] · 4H2O |
| C | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| C | ⓘ Magnesite | MgCO3 |
| C | ⓘ Bismutite | (BiO)2CO3 |
| C | ⓘ Siderite var. Mg-rich Siderite | (Fe,Mg)CO3 |
| N | Nitrogen | |
| N | ⓘ Rouaite | Cu2(NO3)(OH)3 |
| O | Oxygen | |
| O | ⓘ Kermesite | Sb2S2O |
| O | ⓘ Chrysoberyl | BeAl2O4 |
| O | ⓘ Beryl var. Emerald | Be3Al2(Si6O18) |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Winchite | ◻{CaNa}{Mg4Al}(Si8O22)(OH)2 |
| O | ⓘ Riebeckite | ◻[Na2][Fe32+Fe23+]Si8O22(OH)2 |
| O | ⓘ Arfvedsonite | [Na][Na2][Fe42+Fe3+]Si8O22(OH)2 |
| O | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Chromite | Fe2+Cr23+O4 |
| O | ⓘ Rouaite | Cu2(NO3)(OH)3 |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ Anthophyllite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| O | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| O | ⓘ Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Titanite | CaTi(SiO4)O |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Tenorite | CuO |
| O | ⓘ Litharge | PbO |
| O | ⓘ Hetaerolite | ZnMn2O4 |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Goethite | α-Fe3+O(OH) |
| O | ⓘ Smithsonite | ZnCO3 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Osarizawaite | Pb(Al2Cu2+)(SO4)2(OH)6 |
| O | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| O | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
| O | ⓘ Bieberite | CoSO4 · 7H2O |
| O | ⓘ Goslarite | ZnSO4 · 7H2O |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Veszelyite | (Cu,Zn)2Zn(PO4)(OH)3 · 2H2O |
| O | ⓘ Olivenite | Cu2(AsO4)(OH) |
| O | ⓘ Adamite | Zn2(AsO4)(OH) |
| O | ⓘ Cornwallite | Cu5(AsO4)2(OH)4 |
| O | ⓘ Clinoclase | Cu3(AsO4)(OH)3 |
| O | ⓘ Duftite | PbCu(AsO4)(OH) |
| O | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| O | ⓘ Philipsbornite | PbAl3(AsO4)(AsO3OH)(OH)6 |
| O | ⓘ Mimetite | Pb5(AsO4)3Cl |
| O | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| O | ⓘ Legrandite | Zn2(AsO4)(OH) · H2O |
| O | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| O | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| O | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Halloysite | Al2(Si2O5)(OH)4 |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Cummingtonite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Holmquistite | ◻{Li2}{Mg3Al2}(Si8O22)(OH)2 |
| O | ⓘ Phenakite | Be2SiO4 |
| O | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Forsterite | Mg2SiO4 |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| O | ⓘ Monazite | REE(PO4) |
| O | ⓘ Xenotime-(Y) | Y(PO4) |
| O | ⓘ Corundum var. Sapphire | Al2O3 |
| O | ⓘ Andalusite | Al2(SiO4)O |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| O | ⓘ Kyanite | Al2(SiO4)O |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Stichtite | Mg6Cr23+(OH)16[CO3] · 4H2O |
| O | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| O | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| O | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | ⓘ Corundum var. Ruby | Al2O3 |
| O | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| O | ⓘ Brucite | Mg(OH)2 |
| O | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| O | ⓘ Chrysoberyl var. Alexandrite | BeAl2O4 |
| O | ⓘ Corundum | Al2O3 |
| O | ⓘ Diaspore | AlO(OH) |
| O | ⓘ Dioptase | CuSiO3 · H2O |
| O | ⓘ Calcite Group | AXO3 |
| O | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| O | ⓘ Magnesite | MgCO3 |
| O | ⓘ Adamite var. Copper-bearing Adamite | (Zn,Cu)2AsO4OH |
| O | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Clinohumite | Mg9(SiO4)4F2 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| O | ⓘ Bismutite | (BiO)2CO3 |
| O | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| O | ⓘ Smectite Group | A0.3D2-3[T4O10]Z2 · nH2O |
| O | ⓘ Lepidocrocite | γ-Fe3+O(OH) |
| O | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| O | ⓘ Coronadite | Pb(Mn64+Mn23+)O16 |
| O | ⓘ Hidalgoite | PbAl3(AsO4)(SO4)(OH)6 |
| O | ⓘ Beudantite | PbFe3(AsO4)(SO4)(OH)6 |
| O | ⓘ Pentahydrite | MgSO4 · 5H2O |
| O | ⓘ Chalcanthite | CuSO4 · 5H2O |
| O | ⓘ Starkeyite | MgSO4 · 4H2O |
| O | ⓘ Siderite var. Mg-rich Siderite | (Fe,Mg)CO3 |
| O | ⓘ Pyroxene Group | ADSi2O6 |
| O | ⓘ Enstatite | Mg2Si2O6 |
| O | ⓘ Pigeonite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Clinochlore var. Pycnochlorite | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Clinochlore var. Diabantite | (Mg,Fe,Al)6((Si,Al)4O10)(OH)8 |
| O | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Gedrite | ◻{Mg2}{Mg3Al2}(Al2Si6O22)(OH)2 |
| O | ⓘ Tschermakite | ◻(Ca2)(Mg3Al2)(Al2Si6O22)(OH)2 |
| O | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| O | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| O | ⓘ Olivine Group | M2SiO4 |
| O | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| O | ⓘ Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| O | ⓘ Anorthite | Ca(Al2Si2O8) |
| O | ⓘ Scheelite | Ca(WO4) |
| F | Fluorine | |
| F | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| F | ⓘ Matlockite | PbFCl |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | ⓘ Clinohumite | Mg9(SiO4)4F2 |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | ⓘ Winchite | ◻{CaNa}{Mg4Al}(Si8O22)(OH)2 |
| Na | ⓘ Riebeckite | ◻[Na2][Fe32+Fe23+]Si8O22(OH)2 |
| Na | ⓘ Arfvedsonite | [Na][Na2][Fe42+Fe3+]Si8O22(OH)2 |
| Na | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Na | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Mg | Magnesium | |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| Mg | ⓘ Winchite | ◻{CaNa}{Mg4Al}(Si8O22)(OH)2 |
| Mg | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Anthophyllite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | ⓘ Cummingtonite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| Mg | ⓘ Holmquistite | ◻{Li2}{Mg3Al2}(Si8O22)(OH)2 |
| Mg | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| Mg | ⓘ Forsterite | Mg2SiO4 |
| Mg | ⓘ Stichtite | Mg6Cr23+(OH)16[CO3] · 4H2O |
| Mg | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Brucite | Mg(OH)2 |
| Mg | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Mg | ⓘ Magnesite | MgCO3 |
| Mg | ⓘ Clinohumite | Mg9(SiO4)4F2 |
| Mg | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| Mg | ⓘ Pentahydrite | MgSO4 · 5H2O |
| Mg | ⓘ Starkeyite | MgSO4 · 4H2O |
| Mg | ⓘ Siderite var. Mg-rich Siderite | (Fe,Mg)CO3 |
| Mg | ⓘ Enstatite | Mg2Si2O6 |
| Mg | ⓘ Pigeonite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Clinochlore var. Pycnochlorite | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Clinochlore var. Diabantite | (Mg,Fe,Al)6((Si,Al)4O10)(OH)8 |
| Mg | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Gedrite | ◻{Mg2}{Mg3Al2}(Al2Si6O22)(OH)2 |
| Mg | ⓘ Tschermakite | ◻(Ca2)(Mg3Al2)(Al2Si6O22)(OH)2 |
| Mg | ⓘ Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| Al | Aluminium | |
| Al | ⓘ Chrysoberyl | BeAl2O4 |
| Al | ⓘ Beryl var. Emerald | Be3Al2(Si6O18) |
| Al | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Al | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Winchite | ◻{CaNa}{Mg4Al}(Si8O22)(OH)2 |
| Al | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Al | ⓘ Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Osarizawaite | Pb(Al2Cu2+)(SO4)2(OH)6 |
| Al | ⓘ Philipsbornite | PbAl3(AsO4)(AsO3OH)(OH)6 |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Halloysite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Holmquistite | ◻{Li2}{Mg3Al2}(Si8O22)(OH)2 |
| Al | ⓘ Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Corundum var. Sapphire | Al2O3 |
| Al | ⓘ Andalusite | Al2(SiO4)O |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Al | ⓘ Kyanite | Al2(SiO4)O |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Corundum var. Ruby | Al2O3 |
| Al | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| Al | ⓘ Chrysoberyl var. Alexandrite | BeAl2O4 |
| Al | ⓘ Corundum | Al2O3 |
| Al | ⓘ Diaspore | AlO(OH) |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| Al | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| Al | ⓘ Hidalgoite | PbAl3(AsO4)(SO4)(OH)6 |
| Al | ⓘ Clinochlore var. Pycnochlorite | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Clinochlore var. Diabantite | (Mg,Fe,Al)6((Si,Al)4O10)(OH)8 |
| Al | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Gedrite | ◻{Mg2}{Mg3Al2}(Al2Si6O22)(OH)2 |
| Al | ⓘ Tschermakite | ◻(Ca2)(Mg3Al2)(Al2Si6O22)(OH)2 |
| Al | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Al | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Al | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Al | ⓘ Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| Al | ⓘ Anorthite | Ca(Al2Si2O8) |
| Si | Silicon | |
| Si | ⓘ Beryl var. Emerald | Be3Al2(Si6O18) |
| Si | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Winchite | ◻{CaNa}{Mg4Al}(Si8O22)(OH)2 |
| Si | ⓘ Riebeckite | ◻[Na2][Fe32+Fe23+]Si8O22(OH)2 |
| Si | ⓘ Arfvedsonite | [Na][Na2][Fe42+Fe3+]Si8O22(OH)2 |
| Si | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ Anthophyllite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| Si | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| Si | ⓘ Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Titanite | CaTi(SiO4)O |
| Si | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Halloysite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Cummingtonite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Holmquistite | ◻{Li2}{Mg3Al2}(Si8O22)(OH)2 |
| Si | ⓘ Phenakite | Be2SiO4 |
| Si | ⓘ Forsterite | Mg2SiO4 |
| Si | ⓘ Andalusite | Al2(SiO4)O |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Si | ⓘ Kyanite | Al2(SiO4)O |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| Si | ⓘ Dioptase | CuSiO3 · H2O |
| Si | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Clinohumite | Mg9(SiO4)4F2 |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Pyroxene Group | ADSi2O6 |
| Si | ⓘ Enstatite | Mg2Si2O6 |
| Si | ⓘ Pigeonite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Clinochlore var. Pycnochlorite | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Clinochlore var. Diabantite | (Mg,Fe,Al)6((Si,Al)4O10)(OH)8 |
| Si | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Gedrite | ◻{Mg2}{Mg3Al2}(Al2Si6O22)(OH)2 |
| Si | ⓘ Tschermakite | ◻(Ca2)(Mg3Al2)(Al2Si6O22)(OH)2 |
| Si | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Si | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Si | ⓘ Olivine Group | M2SiO4 |
| Si | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Si | ⓘ Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| Si | ⓘ Anorthite | Ca(Al2Si2O8) |
| P | Phosphorus | |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| P | ⓘ Veszelyite | (Cu,Zn)2Zn(PO4)(OH)3 · 2H2O |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| P | ⓘ Monazite | REE(PO4) |
| P | ⓘ Xenotime-(Y) | Y(PO4) |
| S | Sulfur | |
| S | ⓘ Kermesite | Sb2S2O |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Gersdorffite | NiAsS |
| S | ⓘ Pentlandite | (NixFey)Σ9S8 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Berthierite | FeSb2S4 |
| S | ⓘ Gudmundite | FeSbS |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Covellite | CuS |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Osarizawaite | Pb(Al2Cu2+)(SO4)2(OH)6 |
| S | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| S | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
| S | ⓘ Bieberite | CoSO4 · 7H2O |
| S | ⓘ Goslarite | ZnSO4 · 7H2O |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Jamesonite | Pb4FeSb6S14 |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Galena | PbS |
| S | ⓘ Hollingworthite | (Rh,Pt,Pd)AsS |
| S | ⓘ Cooperite | PtS |
| S | ⓘ Braggite | PdPt3S4 |
| S | ⓘ Laurite | RuS2 |
| S | ⓘ Millerite | NiS |
| S | ⓘ Chalcostibite | CuSbS2 |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Irarsite | (Ir,Ru,Rh,Pt)AsS |
| S | ⓘ Ruarsite | (Ru,Os)AsS |
| S | ⓘ Sperrylite var. Platarsite | PtAsS |
| S | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| S | ⓘ Vaesite | NiS2 |
| S | ⓘ Linnaeite | Co2+Co23+S4 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Digenite | Cu9S5 |
| S | ⓘ Mackinawite | FeS |
| S | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| S | ⓘ Cobaltite | CoAsS |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Cubanite | CuFe2S3 |
| S | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| S | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| S | ⓘ Hidalgoite | PbAl3(AsO4)(SO4)(OH)6 |
| S | ⓘ Beudantite | PbFe3(AsO4)(SO4)(OH)6 |
| S | ⓘ Pentahydrite | MgSO4 · 5H2O |
| S | ⓘ Chalcanthite | CuSO4 · 5H2O |
| S | ⓘ Starkeyite | MgSO4 · 4H2O |
| S | ⓘ Bournonite | PbCuSbS3 |
| S | ⓘ UM2002-27-S:Rh | RhS |
| S | ⓘ UM2002-50-Te:PdPtRhS | (Rh,Pd,Pt)3(Te,S)2 |
| S | ⓘ Erlichmanite | OsS2 |
| S | ⓘ Bowieite | Rh2S3 |
| S | ⓘ Renierite | (Cu1+,Zn)11Fe4(Ge4+,As5+)2S16 |
| Cl | Chlorine | |
| Cl | ⓘ Matlockite | PbFCl |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Cl | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Cl | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| K | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| K | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| K | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| K | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Winchite | ◻{CaNa}{Mg4Al}(Si8O22)(OH)2 |
| Ca | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Titanite | CaTi(SiO4)O |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ca | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| Ca | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| Ca | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Ca | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| Ca | ⓘ Pigeonite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Tschermakite | ◻(Ca2)(Mg3Al2)(Al2Si6O22)(OH)2 |
| Ca | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Ca | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Ca | ⓘ Anorthite | Ca(Al2Si2O8) |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ti | Titanium | |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| Ti | ⓘ Titanite | CaTi(SiO4)O |
| Cr | Chromium | |
| Cr | ⓘ Chromite | Fe2+Cr23+O4 |
| Cr | ⓘ Stichtite | Mg6Cr23+(OH)16[CO3] · 4H2O |
| Cr | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Mn | Manganese | |
| Mn | ⓘ Hetaerolite | ZnMn2O4 |
| Mn | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| Mn | ⓘ Coronadite | Pb(Mn64+Mn23+)O16 |
| Fe | Iron | |
| Fe | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Berthierite | FeSb2S4 |
| Fe | ⓘ Gudmundite | FeSbS |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| Fe | ⓘ Riebeckite | ◻[Na2][Fe32+Fe23+]Si8O22(OH)2 |
| Fe | ⓘ Arfvedsonite | [Na][Na2][Fe42+Fe3+]Si8O22(OH)2 |
| Fe | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Chromite | Fe2+Cr23+O4 |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Goethite | α-Fe3+O(OH) |
| Fe | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| Fe | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
| Fe | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| Fe | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| Fe | ⓘ Jamesonite | Pb4FeSb6S14 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Mackinawite | FeS |
| Fe | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Cubanite | CuFe2S3 |
| Fe | ⓘ Lepidocrocite | γ-Fe3+O(OH) |
| Fe | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | ⓘ Beudantite | PbFe3(AsO4)(SO4)(OH)6 |
| Fe | ⓘ Siderite var. Mg-rich Siderite | (Fe,Mg)CO3 |
| Fe | ⓘ Pigeonite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Fe | ⓘ Clinochlore var. Diabantite | (Mg,Fe,Al)6((Si,Al)4O10)(OH)8 |
| Fe | ⓘ Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| Fe | ⓘ Ferronickelplatinum | Pt2FeNi |
| Fe | ⓘ Iron-Platinum alloy | (Pt,Fe) |
| Fe | ⓘ Tetraferroplatinum | PtFe |
| Fe | ⓘ Tulameenite | Pt2CuFe |
| Fe | ⓘ Renierite | (Cu1+,Zn)11Fe4(Ge4+,As5+)2S16 |
| Co | Cobalt | |
| Co | ⓘ Bieberite | CoSO4 · 7H2O |
| Co | ⓘ Linnaeite | Co2+Co23+S4 |
| Co | ⓘ Cobaltite | CoAsS |
| Ni | Nickel | |
| Ni | ⓘ Gersdorffite | NiAsS |
| Ni | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Ni | ⓘ Melonite | NiTe2 |
| Ni | ⓘ Millerite | NiS |
| Ni | ⓘ Vaesite | NiS2 |
| Ni | ⓘ Ferronickelplatinum | Pt2FeNi |
| Cu | Copper | |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Rouaite | Cu2(NO3)(OH)3 |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Tenorite | CuO |
| Cu | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Osarizawaite | Pb(Al2Cu2+)(SO4)2(OH)6 |
| Cu | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| Cu | ⓘ Veszelyite | (Cu,Zn)2Zn(PO4)(OH)3 · 2H2O |
| Cu | ⓘ Olivenite | Cu2(AsO4)(OH) |
| Cu | ⓘ Cornwallite | Cu5(AsO4)2(OH)4 |
| Cu | ⓘ Clinoclase | Cu3(AsO4)(OH)3 |
| Cu | ⓘ Duftite | PbCu(AsO4)(OH) |
| Cu | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| Cu | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Rickardite | Cu7Te5 |
| Cu | ⓘ Weissite | Cu2-xTe |
| Cu | ⓘ Kostovite | CuAuTe4 |
| Cu | ⓘ Copper | Cu |
| Cu | ⓘ Dioptase | CuSiO3 · H2O |
| Cu | ⓘ Chalcostibite | CuSbS2 |
| Cu | ⓘ Adamite var. Copper-bearing Adamite | (Zn,Cu)2AsO4OH |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Digenite | Cu9S5 |
| Cu | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| Cu | ⓘ Cubanite | CuFe2S3 |
| Cu | ⓘ Chalcanthite | CuSO4 · 5H2O |
| Cu | ⓘ Bournonite | PbCuSbS3 |
| Cu | ⓘ Tulameenite | Pt2CuFe |
| Cu | ⓘ Renierite | (Cu1+,Zn)11Fe4(Ge4+,As5+)2S16 |
| Zn | Zinc | |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Hetaerolite | ZnMn2O4 |
| Zn | ⓘ Smithsonite | ZnCO3 |
| Zn | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Zn | ⓘ Goslarite | ZnSO4 · 7H2O |
| Zn | ⓘ Veszelyite | (Cu,Zn)2Zn(PO4)(OH)3 · 2H2O |
| Zn | ⓘ Adamite | Zn2(AsO4)(OH) |
| Zn | ⓘ Legrandite | Zn2(AsO4)(OH) · H2O |
| Zn | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Zn | ⓘ Adamite var. Copper-bearing Adamite | (Zn,Cu)2AsO4OH |
| Zn | ⓘ Renierite | (Cu1+,Zn)11Fe4(Ge4+,As5+)2S16 |
| Ge | Germanium | |
| Ge | ⓘ Renierite | (Cu1+,Zn)11Fe4(Ge4+,As5+)2S16 |
| As | Arsenic | |
| As | ⓘ Gersdorffite | NiAsS |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Olivenite | Cu2(AsO4)(OH) |
| As | ⓘ Adamite | Zn2(AsO4)(OH) |
| As | ⓘ Cornwallite | Cu5(AsO4)2(OH)4 |
| As | ⓘ Clinoclase | Cu3(AsO4)(OH)3 |
| As | ⓘ Duftite | PbCu(AsO4)(OH) |
| As | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| As | ⓘ Philipsbornite | PbAl3(AsO4)(AsO3OH)(OH)6 |
| As | ⓘ Mimetite | Pb5(AsO4)3Cl |
| As | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| As | ⓘ Legrandite | Zn2(AsO4)(OH) · H2O |
| As | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| As | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| As | ⓘ Sperrylite | PtAs2 |
| As | ⓘ Hollingworthite | (Rh,Pt,Pd)AsS |
| As | ⓘ Irarsite | (Ir,Ru,Rh,Pt)AsS |
| As | ⓘ Ruarsite | (Ru,Os)AsS |
| As | ⓘ Sperrylite var. Platarsite | PtAsS |
| As | ⓘ Adamite var. Copper-bearing Adamite | (Zn,Cu)2AsO4OH |
| As | ⓘ Cobaltite | CoAsS |
| As | ⓘ Hidalgoite | PbAl3(AsO4)(SO4)(OH)6 |
| As | ⓘ Beudantite | PbFe3(AsO4)(SO4)(OH)6 |
| As | ⓘ Isomertieite | Pd11Sb2As2 |
| As | ⓘ Renierite | (Cu1+,Zn)11Fe4(Ge4+,As5+)2S16 |
| Y | Yttrium | |
| Y | ⓘ Xenotime-(Y) | Y(PO4) |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Ru | Ruthenium | |
| Ru | ⓘ Iridium var. Osmiridium | (Ir,Os,Ru) |
| Ru | ⓘ Laurite | RuS2 |
| Ru | ⓘ Irarsite | (Ir,Ru,Rh,Pt)AsS |
| Ru | ⓘ Ruarsite | (Ru,Os)AsS |
| Ru | ⓘ Iridium | (Ir,Os,Ru) |
| Ru | ⓘ Osmium | (Os,Ir,Ru) |
| Rh | Rhodium | |
| Rh | ⓘ Hollingworthite | (Rh,Pt,Pd)AsS |
| Rh | ⓘ Irarsite | (Ir,Ru,Rh,Pt)AsS |
| Rh | ⓘ UM2002-27-S:Rh | RhS |
| Rh | ⓘ UM2002-50-Te:PdPtRhS | (Rh,Pd,Pt)3(Te,S)2 |
| Rh | ⓘ Rhodium | (Rh,Pt) |
| Rh | ⓘ Bowieite | Rh2S3 |
| Pd | Palladium | |
| Pd | ⓘ Merenskyite | PdTe2 |
| Pd | ⓘ Hollingworthite | (Rh,Pt,Pd)AsS |
| Pd | ⓘ Braggite | PdPt3S4 |
| Pd | ⓘ Michenerite | PdBiTe |
| Pd | ⓘ Kotulskite | Pd(Te,Bi)2-x (x ≈ 0.4) |
| Pd | ⓘ Polarite | Pd(Bi,Pb) |
| Pd | ⓘ UM2002-50-Te:PdPtRhS | (Rh,Pd,Pt)3(Te,S)2 |
| Pd | ⓘ Rustenburgite | (Pt,Pd)3Sn |
| Pd | ⓘ Stibiopalladinite | Pd5Sb2 |
| Pd | ⓘ Isomertieite | Pd11Sb2As2 |
| Pd | ⓘ Potarite | PdHg |
| Pd | ⓘ Sobolevskite | PdBi |
| Ag | Silver | |
| Ag | ⓘ Hessite | Ag2Te |
| Ag | ⓘ Petzite | Ag3AuTe2 |
| Ag | ⓘ Sylvanite | AgAuTe4 |
| Ag | ⓘ Stützite | Ag5-xTe3, x = 0.24-0.36 |
| Ag | ⓘ Gold var. Electrum | (Au,Ag) |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sn | ⓘ Rustenburgite | (Pt,Pd)3Sn |
| Sb | Antimony | |
| Sb | ⓘ Kermesite | Sb2S2O |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Sb | ⓘ Stibnite | Sb2S3 |
| Sb | ⓘ Aurostibite | AuSb2 |
| Sb | ⓘ Antimony | Sb |
| Sb | ⓘ Berthierite | FeSb2S4 |
| Sb | ⓘ Gudmundite | FeSbS |
| Sb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Sb | ⓘ Chalcostibite | CuSbS2 |
| Sb | ⓘ Bournonite | PbCuSbS3 |
| Sb | ⓘ Stibiopalladinite | Pd5Sb2 |
| Sb | ⓘ Isomertieite | Pd11Sb2As2 |
| Te | Tellurium | |
| Te | ⓘ Hessite | Ag2Te |
| Te | ⓘ Altaite | PbTe |
| Te | ⓘ Coloradoite | HgTe |
| Te | ⓘ Petzite | Ag3AuTe2 |
| Te | ⓘ Sylvanite | AgAuTe4 |
| Te | ⓘ Melonite | NiTe2 |
| Te | ⓘ Rickardite | Cu7Te5 |
| Te | ⓘ Weissite | Cu2-xTe |
| Te | ⓘ Stützite | Ag5-xTe3, x = 0.24-0.36 |
| Te | ⓘ Tellurium | Te |
| Te | ⓘ Kostovite | CuAuTe4 |
| Te | ⓘ Moncheite | Pt(Te,Bi)2 |
| Te | ⓘ Merenskyite | PdTe2 |
| Te | ⓘ Maslovite | PtBiTe |
| Te | ⓘ Michenerite | PdBiTe |
| Te | ⓘ Kotulskite | Pd(Te,Bi)2-x (x ≈ 0.4) |
| Te | ⓘ UM2002-50-Te:PdPtRhS | (Rh,Pd,Pt)3(Te,S)2 |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
| W | Tungsten | |
| W | ⓘ Scheelite | Ca(WO4) |
| Os | Osmium | |
| Os | ⓘ Iridium var. Osmiridium | (Ir,Os,Ru) |
| Os | ⓘ Ruarsite | (Ru,Os)AsS |
| Os | ⓘ Iridium | (Ir,Os,Ru) |
| Os | ⓘ Osmium | (Os,Ir,Ru) |
| Os | ⓘ Erlichmanite | OsS2 |
| Ir | Iridium | |
| Ir | ⓘ Iridium var. Osmiridium | (Ir,Os,Ru) |
| Ir | ⓘ Irarsite | (Ir,Ru,Rh,Pt)AsS |
| Ir | ⓘ Iridium | (Ir,Os,Ru) |
| Ir | ⓘ Osmium | (Os,Ir,Ru) |
| Pt | Platinum | |
| Pt | ⓘ Platinum | Pt |
| Pt | ⓘ Sperrylite | PtAs2 |
| Pt | ⓘ Moncheite | Pt(Te,Bi)2 |
| Pt | ⓘ Hollingworthite | (Rh,Pt,Pd)AsS |
| Pt | ⓘ Cooperite | PtS |
| Pt | ⓘ Braggite | PdPt3S4 |
| Pt | ⓘ Maslovite | PtBiTe |
| Pt | ⓘ Irarsite | (Ir,Ru,Rh,Pt)AsS |
| Pt | ⓘ Sperrylite var. Platarsite | PtAsS |
| Pt | ⓘ UM2002-50-Te:PdPtRhS | (Rh,Pd,Pt)3(Te,S)2 |
| Pt | ⓘ Rustenburgite | (Pt,Pd)3Sn |
| Pt | ⓘ Rhodium | (Rh,Pt) |
| Pt | ⓘ Ferronickelplatinum | Pt2FeNi |
| Pt | ⓘ Iron-Platinum alloy | (Pt,Fe) |
| Pt | ⓘ Tetraferroplatinum | PtFe |
| Pt | ⓘ Tulameenite | Pt2CuFe |
| Au | Gold | |
| Au | ⓘ Gold | Au |
| Au | ⓘ Aurostibite | AuSb2 |
| Au | ⓘ Petzite | Ag3AuTe2 |
| Au | ⓘ Sylvanite | AgAuTe4 |
| Au | ⓘ Kostovite | CuAuTe4 |
| Au | ⓘ Gold var. Electrum | (Au,Ag) |
| Hg | Mercury | |
| Hg | ⓘ Coloradoite | HgTe |
| Hg | ⓘ Potarite | PdHg |
| Pb | Lead | |
| Pb | ⓘ Matlockite | PbFCl |
| Pb | ⓘ Litharge | PbO |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Osarizawaite | Pb(Al2Cu2+)(SO4)2(OH)6 |
| Pb | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Pb | ⓘ Duftite | PbCu(AsO4)(OH) |
| Pb | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| Pb | ⓘ Philipsbornite | PbAl3(AsO4)(AsO3OH)(OH)6 |
| Pb | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Pb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Pb | ⓘ Altaite | PbTe |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Polarite | Pd(Bi,Pb) |
| Pb | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| Pb | ⓘ Coronadite | Pb(Mn64+Mn23+)O16 |
| Pb | ⓘ Hidalgoite | PbAl3(AsO4)(SO4)(OH)6 |
| Pb | ⓘ Beudantite | PbFe3(AsO4)(SO4)(OH)6 |
| Pb | ⓘ Bournonite | PbCuSbS3 |
| Bi | Bismuth | |
| Bi | ⓘ Moncheite | Pt(Te,Bi)2 |
| Bi | ⓘ Maslovite | PtBiTe |
| Bi | ⓘ Michenerite | PdBiTe |
| Bi | ⓘ Kotulskite | Pd(Te,Bi)2-x (x ≈ 0.4) |
| Bi | ⓘ Polarite | Pd(Bi,Pb) |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Bismutite | (BiO)2CO3 |
| Bi | ⓘ Bismuth | Bi |
| Bi | ⓘ Sobolevskite | PdBi |
Fossils
There are 18 fossil localities from the PaleoBioDB database within this region.BETA TEST - These data are provided on an experimental basis and are taken from external databases. Mindat.org has no control currently over the accuracy of these data.
| Occurrences | 38 |
|---|---|
| Youngest Fossil Listed | 101 Ma (Late/Upper Cretaceous) |
| Oldest Fossil Listed | 296 Ma (Permian) |
| Stratigraphic Units | Click here to view 6 stratigraphic units. |
| Fossils from Region | Click here to show the list. |
| Fossil Localities | Click to show 18 fossil localities |
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Midlands_Province |
|---|---|
| Wikidata ID: | Q456556 |
| GeoNames ID: | 886119 |
Localities in this Region
- Midlands
- Kwekwe District
- ⭔Mberengwa District
- Mweza Range (Wedja)
- ⭔Shurugwi District
- ⭔Zvishavane District
Other Regions, Features and Areas that Intersect
African PlateTectonic Plate
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther Regions
Athens Mine, Mvuma, Chirumhanzu District, Midlands, Zimbabwe