Delamar Mining District, Lincoln County, Nevada, USAi
| Regional Level Types | |
|---|---|
| Delamar Mining District | Mining District |
| Lincoln County | County |
| Nevada | State |
| USA | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Mindat Locality ID:
19818
Long-form identifier:
mindat:1:2:19818:6
GUID (UUID V4):
744d0b48-c25e-40ab-9563-e1d1bf4ccae4
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities72 valid minerals. 1 (TL) - type locality of valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Adanite Formula: Pb2(Te4+O3)(SO4) |
| ⓘ Altaite Formula: PbTe |
| ⓘ Bairdite Formula: Pb2Cu2+4Te6+2O10(OH)2(SO4) · H2O Localities: Description: see photo |
| ⓘ Baryte Formula: BaSO4 Localities: Jumbo mine (Horn mine), Delamar Mining District, Lincoln County, Nevada, USA Flagstaff Mine, Delamar Mining District, Lincoln County, Nevada, USA Magnolia mine, Delamar Mining District, Lincoln County, Nevada, USA April Fool Mine, Delamar Mining District, Lincoln County, Nevada, USA NBMG Sample Location 1760, Delamar Mining District, Lincoln County, Nevada, USA |
| ⓘ 'Bindheimite' Formula: Pb2Sb2O6O |
| ⓘ Bornite Formula: Cu5FeS4 |
| ⓘ Braunite Formula: Mn2+Mn3+6(SiO4)O8 |
| ⓘ Burckhardtite Formula: Pb2(Fe3+Te6+)[AlSi3O8]O6 |
| ⓘ Calcite Formula: CaCO3 Localities: Reported from at least 6 localities in this region. References: |
| ⓘ Carlfriesite Formula: CaTe4+2Te6+O8 Localities: |
| ⓘ Cerussite Formula: PbCO3 |
| ⓘ Cervelleite Formula: Ag4TeS |
| ⓘ Chalcocite Formula: Cu2S |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Delamar Mine, Delamar Mining District, Lincoln County, Nevada, USA Jumbo mine (Horn mine), Delamar Mining District, Lincoln County, Nevada, USA Magnolia mine, Delamar Mining District, Lincoln County, Nevada, USA NBMG Sample Location 1741, Delamar Mining District, Lincoln County, Nevada, USA Mine dump, Delamar Mine, Delamar Mining District, Lincoln County, Nevada, USA |
| ⓘ Chlorargyrite Formula: AgCl Localities: |
| ⓘ 'Chlorite Group' |
| ⓘ Choloalite Formula: (Cu,Sb)3(Pb,Ca)3(TeO3)6Cl |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 Localities: |
| ⓘ Cinnabar Formula: HgS |
| ⓘ 'Copper Stain' |
| ⓘ Covellite Formula: CuS |
| ⓘ Cupropavonite Formula: Cu0.9Ag0.5Pb0.6Bi2.5S5 |
| ⓘ Emmonsite Formula: Fe3+2(TeO3)3 · 2H2O |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ Eztlite Formula: Pb2+2Fe3+3(Te4+ O3)3(SO4)O2Cl |
| ⓘ Fairbankite Formula: Pb2+12(Te4+O3)11(SO4) Localities: |
| ⓘ 'Feldspar Group' |
| ⓘ Fluorite Formula: CaF2 |
| ⓘ Frankhawthorneite Formula: Cu2Te6+O4(OH)2 |
| ⓘ Galena Formula: PbS Localities: |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 |
| ⓘ Goethite Formula: α-Fe3+O(OH) |
| ⓘ Gold Formula: Au Localities: Reported from at least 8 localities in this region. |
| ⓘ Hematite Formula: Fe2O3 |
| ⓘ Hessite Formula: Ag2Te |
| ⓘ Ilmenite Formula: Fe2+TiO3 |
| ⓘ 'Iron oxide' |
| ⓘ Jarosite Formula: KFe3+3(SO4)2(OH)6 |
| ⓘ Jensenite Formula: Cu3[TeO6] · 2H2O Localities: |
| ⓘ 'K Feldspar' Localities: |
| ⓘ 'K Feldspar var. Adularia' Formula: KAlSi3O8 |
| ⓘ Khinite Formula: Pb2+Cu2+3[Te6+O6](OH)2 |
| ⓘ Kinichilite Formula: Mg0.5Mn2+Fe3+(Te4+O3)3 · 4.5H2O |
| ⓘ Kuksite Formula: Pb3Zn3(PO4)2(TeO6) Localities: |
| ⓘ Leisingite Formula: Cu2MgTe6+O6 · 6H2O |
| ⓘ 'Limonite' Localities: Reported from at least 7 localities in this region. |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 Localities: |
| ⓘ Matthiasweilite (TL) Formula: PbTe4+O3 Type Locality: |
| ⓘ Mcalpineite Formula: Cu3(Te6+O6) |
| ⓘ Mimetite Formula: Pb5(AsO4)3Cl |
| ⓘ Mohite Formula: Cu2SnS3 Localities: References: |
| ⓘ Mojaveite Formula: Cu6[Te6+O4(OH)2](OH)7Cl |
| ⓘ 'Monimolite' Formula: Pb2Sb5+2O7 |
| ⓘ Montbrayite Formula: (Au,Ag,Sb,Bi,Pb)23(Te,Sb,Bi,Pb)38 Localities: References: |
| ⓘ Müllerite Formula: Pb2Fe3+(Te6+O6)Cl |
| ⓘ Murdochite Formula: PbCu6O8-x(Cl,Br)2x Habit: cleavage in quartz Colour: lustrous black |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: |
| ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 Localities: |
| ⓘ Naumannite Formula: Ag2Se |
| ⓘ Northstarite Formula: Pb6(Te4+O3)5(S6+O3S2-) |
| ⓘ 'Orthopyroxene Subgroup' |
| ⓘ Oxyplumboroméite Formula: Pb2Sb2O6O Localities: |
| ⓘ Paratimroseite Formula: Pb2Cu4(TeO6)2(H2O)2 |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ Plumbotellurite Formula: Pb(TeO3) |
| ⓘ Poughite Formula: Fe3+2(TeO3)2(SO4)(H2O)2 · H2O Localities: |
| ⓘ 'Psilomelane' Localities: |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 13 localities in this region. |
| ⓘ Pyrolusite Formula: Mn4+O2 Localities: |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 19 localities in this region. |
| ⓘ Quetzalcoatlite Formula: Zn6Cu3(TeO6)2(OH)6 · AgxPbyClx+2y |
| ⓘ Rodalquilarite Formula: Fe2(TeO2OH)3(TeO3)Cl |
| ⓘ Rutile Formula: TiO2 |
| ⓘ Scheelite Formula: Ca(WO4) |
| ⓘ Smithsonite Formula: ZnCO3 |
| ⓘ Sphalerite Formula: ZnS |
| ⓘ Spiroffite Formula: Mn2+2Te4+3O8 Localities: |
| ⓘ Teineite Formula: Cu2+(Te4+O3) · 2H2O |
| ⓘ Tellurite Formula: TeO2 |
| ⓘ Tellurium Formula: Te Localities: |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S Localities: Reported from at least 8 localities in this region. |
| ⓘ Tetrahedrite-(Zn) Formula: Cu6(Cu4Zn2)Sb4S12S |
| ⓘ Tlapallite Formula: (Ca,Pb)3CaCu6[Te4+3Te6+O12]2(Te4+O3)2(SO4)2 · 3H2O Localities: |
| ⓘ Utahite Formula: MgCu4Zn2Te6+3O14(OH)4 · 6H2O |
| ⓘ 'Wad' Localities: Magnolia mine, Delamar Mining District, Lincoln County, Nevada, USA Manganese prospects, Delamar Mining District, Lincoln County, Nevada, USA Jumbo mine (Horn mine), Delamar Mining District, Lincoln County, Nevada, USA Flagstaff Mine, Delamar Mining District, Lincoln County, Nevada, USA Culverwell Mine, Delamar Mining District, Lincoln County, Nevada, USA |
| ⓘ Xocolatlite Formula: Ca2Mn4+2(Te6+O6)2 · H2O |
| ⓘ Xocomecatlite Formula: Cu3(TeO4)(OH)4 |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Gold | 1.AA.05 | Au |
| ⓘ | Tellurium | 1.CC.10 | Te |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Naumannite | 2.BA.55 | Ag2Se |
| ⓘ | Cervelleite | 2.BA.60 | Ag4TeS |
| ⓘ | Hessite | 2.BA.60 | Ag2Te |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Mohite | 2.CB.15b | Cu2SnS3 |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Altaite | 2.CD.10 | PbTe |
| ⓘ | Cinnabar | 2.CD.15a | HgS |
| ⓘ | Montbrayite | 2.DB.20 | (Au,Ag,Sb,Bi,Pb)23(Te,Sb,Bi,Pb)38 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | Tetrahedrite-(Zn) | 2.GB.05 | Cu6(Cu4Zn2)Sb4S12S |
| ⓘ | Cupropavonite | 2.JA.05a | Cu0.9Ag0.5Pb0.6Bi2.5S5 |
| Group 3 - Halides | |||
| ⓘ | Chlorargyrite | 3.AA.15 | AgCl |
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| ⓘ | Murdochite | 3.DB.45 | PbCu6O8-x(Cl,Br)2x |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | α-Fe3+O(OH) |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | Tellurite | 4.DE.20 | TeO2 |
| ⓘ | Oxyplumboroméite | 4.DH. | Pb2Sb2O6O |
| ⓘ | 'Monimolite' | 4.DH.20 | Pb2Sb5+2O7 |
| ⓘ | 'Bindheimite' | 4.DH.20 | Pb2Sb2O6O |
| ⓘ | Frankhawthorneite | 4.FD.25 | Cu2Te6+O4(OH)2 |
| ⓘ | Khinite | 4.FD.30 | Pb2+Cu2+3[Te6+O6](OH)2 |
| ⓘ | Quetzalcoatlite | 4.FE.45 | Zn6Cu3(TeO6)2(OH)6 · AgxPbyClx+2y |
| ⓘ | Jensenite | 4.FL.60 | Cu3[TeO6] · 2H2O |
| ⓘ | Leisingite | 4.FL.65 | Cu2MgTe6+O6 · 6H2O |
| ⓘ | Matthiasweilite (TL) | 4.JK. | PbTe4+O3 |
| ⓘ | Spiroffite | 4.JK.10 | Mn2+2Te4+3O8 |
| ⓘ | Carlfriesite | 4.JK.25 | CaTe4+2Te6+O8 |
| ⓘ | Choloalite | 4.JK.45 | (Cu,Sb)3(Pb,Ca)3(TeO3)6Cl |
| ⓘ | Fairbankite | 4.JK.50 | Pb2+12(Te4+O3)11(SO4) |
| ⓘ | Plumbotellurite | 4.JK.55 | Pb(TeO3) |
| ⓘ | Rodalquilarite | 4.JL.05 | Fe2(TeO2OH)3(TeO3)Cl |
| ⓘ | Tlapallite | 4.JL.25 | (Ca,Pb)3CaCu6[Te4+3Te6+O12]2(Te4+O3)2(SO4)2 · 3H2O |
| ⓘ | Kinichilite | 4.JM.05 | Mg0.5Mn2+Fe3+(Te4+O3)3 · 4.5H2O |
| ⓘ | Emmonsite | 4.JM.10 | Fe3+2(TeO3)3 · 2H2O |
| ⓘ | Teineite | 4.JM.20 | Cu2+(Te4+O3) · 2H2O |
| ⓘ | Poughite | 4.JN.10 | Fe3+2(TeO3)2(SO4)(H2O)2 · H2O |
| ⓘ | Eztlite | 4.JN.20 | Pb2+2Fe3+3(Te4+ O3)3(SO4)O2Cl |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Smithsonite | 5.AB.05 | ZnCO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Mcalpineite | 7.AB.55 | Cu3(Te6+O6) |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Xocomecatlite | 7.BB.50 | Cu3(TeO4)(OH)4 |
| ⓘ | Mojaveite | 7.BB.80 | Cu6[Te6+O4(OH)2](OH)7Cl |
| ⓘ | Paratimroseite | 7.BB.85 | Pb2Cu4(TeO6)2(H2O)2 |
| ⓘ | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Müllerite | 7.BC.47 | Pb2Fe3+(Te6+O6)Cl |
| ⓘ | Adanite | 7.BD. | Pb2(Te4+O3)(SO4) |
| ⓘ | Xocolatlite | 7.CC.85 | Ca2Mn4+2(Te6+O6)2 · H2O |
| ⓘ | Utahite | 7.DE.25 | MgCu4Zn2Te6+3O14(OH)4 · 6H2O |
| ⓘ | Bairdite | 7.DF. | Pb2Cu2+4Te6+2O10(OH)2(SO4) · H2O |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| ⓘ | Northstarite | 7.JA.20 | Pb6(Te4+O3)5(S6+O3S2-) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| ⓘ | Mimetite | 8.BN.05 | Pb5(AsO4)3Cl |
| ⓘ | Kuksite | 8.DL.20 | Pb3Zn3(PO4)2(TeO6) |
| Group 9 - Silicates | |||
| ⓘ | Braunite | 9.AG.05 | Mn2+Mn3+6(SiO4)O8 |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Burckhardtite | 9.EC.70 | Pb2(Fe3+Te6+)[AlSi3O8]O6 |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Unclassified | |||
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Orthopyroxene Subgroup' | - | |
| ⓘ | 'Copper Stain' | - | |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'Wad' | - | |
| ⓘ | 'Psilomelane' | - | |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Iron oxide' | - | |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'K Feldspar var. Adularia' | - | KAlSi3O8 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Emmonsite | Fe23+(TeO3)3 · 2H2O |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Goethite | α-Fe3+O(OH) |
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| H | ⓘ Jensenite | Cu3[TeO6] · 2H2O |
| H | ⓘ Khinite | Pb2+Cu32+[Te6+O6](OH)2 |
| H | ⓘ Kinichilite | Mg0.5Mn2+Fe3+(Te4+O3)3 · 4.5H2O |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Poughite | Fe23+(TeO3)2(SO4)(H2O)2 · H2O |
| H | ⓘ Quetzalcoatlite | Zn6Cu3(TeO6)2(OH)6 · AgxPbyClx+2y |
| H | ⓘ Rodalquilarite | Fe2(TeO2OH)3(TeO3)Cl |
| H | ⓘ Teineite | Cu2+(Te4+O3) · 2H2O |
| H | ⓘ Tlapallite | (Ca,Pb)3CaCu6[Te34+Te6+O12]2(Te4+O3)2(SO4)2 · 3H2O |
| H | ⓘ Xocomecatlite | Cu3(TeO4)(OH)4 |
| H | ⓘ Frankhawthorneite | Cu2Te6+O4(OH)2 |
| H | ⓘ Leisingite | Cu2MgTe6+O6 · 6H2O |
| H | ⓘ Utahite | MgCu4Zn2Te36+O14(OH)4 · 6H2O |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Xocolatlite | Ca2Mn24+(Te6+O6)2 · H2O |
| H | ⓘ Paratimroseite | Pb2Cu4(TeO6)2(H2O)2 |
| H | ⓘ Bairdite | Pb2Cu42+Te26+O10(OH)2(SO4) · H2O |
| H | ⓘ Mojaveite | Cu6[Te6+O4(OH)2](OH)7Cl |
| C | Carbon | |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Smithsonite | ZnCO3 |
| O | Oxygen | |
| O | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Bindheimite | Pb2Sb2O6O |
| O | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| O | ⓘ Burckhardtite | Pb2(Fe3+Te6+)[AlSi3O8]O6 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Carlfriesite | CaTe24+Te6+O8 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Choloalite | (Cu,Sb)3(Pb,Ca)3(TeO3)6Cl |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Emmonsite | Fe23+(TeO3)3 · 2H2O |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Eztlite | Pb22+Fe33+(Te4+ O3)3(SO4)O2Cl |
| O | ⓘ Fairbankite | Pb122+(Te4+O3)11(SO4) |
| O | ⓘ Goethite | α-Fe3+O(OH) |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| O | ⓘ Jensenite | Cu3[TeO6] · 2H2O |
| O | ⓘ Khinite | Pb2+Cu32+[Te6+O6](OH)2 |
| O | ⓘ Kinichilite | Mg0.5Mn2+Fe3+(Te4+O3)3 · 4.5H2O |
| O | ⓘ Kuksite | Pb3Zn3(PO4)2(TeO6) |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Mimetite | Pb5(AsO4)3Cl |
| O | ⓘ Monimolite | Pb2Sb25+O7 |
| O | ⓘ Murdochite | PbCu6O8-x(Cl,Br)2x |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Plumbotellurite | Pb(TeO3) |
| O | ⓘ Poughite | Fe23+(TeO3)2(SO4)(H2O)2 · H2O |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Quetzalcoatlite | Zn6Cu3(TeO6)2(OH)6 · AgxPbyClx+2y |
| O | ⓘ Rodalquilarite | Fe2(TeO2OH)3(TeO3)Cl |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Smithsonite | ZnCO3 |
| O | ⓘ Spiroffite | Mn22+Te34+O8 |
| O | ⓘ Teineite | Cu2+(Te4+O3) · 2H2O |
| O | ⓘ Tellurite | TeO2 |
| O | ⓘ Tlapallite | (Ca,Pb)3CaCu6[Te34+Te6+O12]2(Te4+O3)2(SO4)2 · 3H2O |
| O | ⓘ Xocomecatlite | Cu3(TeO4)(OH)4 |
| O | ⓘ Frankhawthorneite | Cu2Te6+O4(OH)2 |
| O | ⓘ Leisingite | Cu2MgTe6+O6 · 6H2O |
| O | ⓘ Mcalpineite | Cu3(Te6+O6) |
| O | ⓘ Utahite | MgCu4Zn2Te36+O14(OH)4 · 6H2O |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Xocolatlite | Ca2Mn24+(Te6+O6)2 · H2O |
| O | ⓘ Paratimroseite | Pb2Cu4(TeO6)2(H2O)2 |
| O | ⓘ Bairdite | Pb2Cu42+Te26+O10(OH)2(SO4) · H2O |
| O | ⓘ Oxyplumboroméite | Pb2Sb2O6O |
| O | ⓘ Mojaveite | Cu6[Te6+O4(OH)2](OH)7Cl |
| O | ⓘ Northstarite | Pb6(Te4+O3)5(S6+O3S2-) |
| O | ⓘ Müllerite | Pb2Fe3+(Te6+O6)Cl |
| O | ⓘ Adanite | Pb2(Te4+O3)(SO4) |
| O | ⓘ Matthiasweilite | PbTe4+O3 |
| F | Fluorine | |
| F | ⓘ Fluorite | CaF2 |
| Na | Sodium | |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Mg | Magnesium | |
| Mg | ⓘ Kinichilite | Mg0.5Mn2+Fe3+(Te4+O3)3 · 4.5H2O |
| Mg | ⓘ Leisingite | Cu2MgTe6+O6 · 6H2O |
| Mg | ⓘ Utahite | MgCu4Zn2Te36+O14(OH)4 · 6H2O |
| Al | Aluminium | |
| Al | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Al | ⓘ Burckhardtite | Pb2(Fe3+Te6+)[AlSi3O8]O6 |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | Silicon | |
| Si | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Si | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| Si | ⓘ Burckhardtite | Pb2(Fe3+Te6+)[AlSi3O8]O6 |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| P | Phosphorus | |
| P | ⓘ Kuksite | Pb3Zn3(PO4)2(TeO6) |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| S | Sulfur | |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Cervelleite | Ag4TeS |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Cinnabar | HgS |
| S | ⓘ Covellite | CuS |
| S | ⓘ Cupropavonite | Cu0.9Ag0.5Pb0.6Bi2.5S5 |
| S | ⓘ Eztlite | Pb22+Fe33+(Te4+ O3)3(SO4)O2Cl |
| S | ⓘ Fairbankite | Pb122+(Te4+O3)11(SO4) |
| S | ⓘ Galena | PbS |
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| S | ⓘ Mohite | Cu2SnS3 |
| S | ⓘ Poughite | Fe23+(TeO3)2(SO4)(H2O)2 · H2O |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Tlapallite | (Ca,Pb)3CaCu6[Te34+Te6+O12]2(Te4+O3)2(SO4)2 · 3H2O |
| S | ⓘ Bairdite | Pb2Cu42+Te26+O10(OH)2(SO4) · H2O |
| S | ⓘ Tetrahedrite-(Zn) | Cu6(Cu4Zn2)Sb4S12S |
| S | ⓘ Northstarite | Pb6(Te4+O3)5(S6+O3S2-) |
| S | ⓘ Adanite | Pb2(Te4+O3)(SO4) |
| Cl | Chlorine | |
| Cl | ⓘ Chlorargyrite | AgCl |
| Cl | ⓘ Choloalite | (Cu,Sb)3(Pb,Ca)3(TeO3)6Cl |
| Cl | ⓘ Eztlite | Pb22+Fe33+(Te4+ O3)3(SO4)O2Cl |
| Cl | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Cl | ⓘ Murdochite | PbCu6O8-x(Cl,Br)2x |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Cl | ⓘ Quetzalcoatlite | Zn6Cu3(TeO6)2(OH)6 · AgxPbyClx+2y |
| Cl | ⓘ Rodalquilarite | Fe2(TeO2OH)3(TeO3)Cl |
| Cl | ⓘ Mojaveite | Cu6[Te6+O4(OH)2](OH)7Cl |
| Cl | ⓘ Müllerite | Pb2Fe3+(Te6+O6)Cl |
| K | Potassium | |
| K | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Carlfriesite | CaTe24+Te6+O8 |
| Ca | ⓘ Choloalite | (Cu,Sb)3(Pb,Ca)3(TeO3)6Cl |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Tlapallite | (Ca,Pb)3CaCu6[Te34+Te6+O12]2(Te4+O3)2(SO4)2 · 3H2O |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Xocolatlite | Ca2Mn24+(Te6+O6)2 · H2O |
| Ti | Titanium | |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Mn | Manganese | |
| Mn | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| Mn | ⓘ Kinichilite | Mg0.5Mn2+Fe3+(Te4+O3)3 · 4.5H2O |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Mn | ⓘ Spiroffite | Mn22+Te34+O8 |
| Mn | ⓘ Xocolatlite | Ca2Mn24+(Te6+O6)2 · H2O |
| Fe | Iron | |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Burckhardtite | Pb2(Fe3+Te6+)[AlSi3O8]O6 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Emmonsite | Fe23+(TeO3)3 · 2H2O |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Eztlite | Pb22+Fe33+(Te4+ O3)3(SO4)O2Cl |
| Fe | ⓘ Goethite | α-Fe3+O(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | ⓘ Kinichilite | Mg0.5Mn2+Fe3+(Te4+O3)3 · 4.5H2O |
| Fe | ⓘ Poughite | Fe23+(TeO3)2(SO4)(H2O)2 · H2O |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Rodalquilarite | Fe2(TeO2OH)3(TeO3)Cl |
| Fe | ⓘ Müllerite | Pb2Fe3+(Te6+O6)Cl |
| Cu | Copper | |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Choloalite | (Cu,Sb)3(Pb,Ca)3(TeO3)6Cl |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cupropavonite | Cu0.9Ag0.5Pb0.6Bi2.5S5 |
| Cu | ⓘ Jensenite | Cu3[TeO6] · 2H2O |
| Cu | ⓘ Khinite | Pb2+Cu32+[Te6+O6](OH)2 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Mohite | Cu2SnS3 |
| Cu | ⓘ Murdochite | PbCu6O8-x(Cl,Br)2x |
| Cu | ⓘ Quetzalcoatlite | Zn6Cu3(TeO6)2(OH)6 · AgxPbyClx+2y |
| Cu | ⓘ Teineite | Cu2+(Te4+O3) · 2H2O |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | ⓘ Tlapallite | (Ca,Pb)3CaCu6[Te34+Te6+O12]2(Te4+O3)2(SO4)2 · 3H2O |
| Cu | ⓘ Xocomecatlite | Cu3(TeO4)(OH)4 |
| Cu | ⓘ Frankhawthorneite | Cu2Te6+O4(OH)2 |
| Cu | ⓘ Leisingite | Cu2MgTe6+O6 · 6H2O |
| Cu | ⓘ Mcalpineite | Cu3(Te6+O6) |
| Cu | ⓘ Utahite | MgCu4Zn2Te36+O14(OH)4 · 6H2O |
| Cu | ⓘ Paratimroseite | Pb2Cu4(TeO6)2(H2O)2 |
| Cu | ⓘ Bairdite | Pb2Cu42+Te26+O10(OH)2(SO4) · H2O |
| Cu | ⓘ Mojaveite | Cu6[Te6+O4(OH)2](OH)7Cl |
| Cu | ⓘ Tetrahedrite-(Zn) | Cu6(Cu4Zn2)Sb4S12S |
| Zn | Zinc | |
| Zn | ⓘ Kuksite | Pb3Zn3(PO4)2(TeO6) |
| Zn | ⓘ Quetzalcoatlite | Zn6Cu3(TeO6)2(OH)6 · AgxPbyClx+2y |
| Zn | ⓘ Smithsonite | ZnCO3 |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Utahite | MgCu4Zn2Te36+O14(OH)4 · 6H2O |
| Zn | ⓘ Tetrahedrite-(Zn) | Cu6(Cu4Zn2)Sb4S12S |
| As | Arsenic | |
| As | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Se | Selenium | |
| Se | ⓘ Naumannite | Ag2Se |
| Br | Bromine | |
| Br | ⓘ Murdochite | PbCu6O8-x(Cl,Br)2x |
| Ag | Silver | |
| Ag | ⓘ Cervelleite | Ag4TeS |
| Ag | ⓘ Chlorargyrite | AgCl |
| Ag | ⓘ Cupropavonite | Cu0.9Ag0.5Pb0.6Bi2.5S5 |
| Ag | ⓘ Hessite | Ag2Te |
| Ag | ⓘ Montbrayite | (Au,Ag,Sb,Bi,Pb)23(Te,Sb,Bi,Pb)38 |
| Ag | ⓘ Naumannite | Ag2Se |
| Ag | ⓘ Quetzalcoatlite | Zn6Cu3(TeO6)2(OH)6 · AgxPbyClx+2y |
| Sn | Tin | |
| Sn | ⓘ Mohite | Cu2SnS3 |
| Sb | Antimony | |
| Sb | ⓘ Bindheimite | Pb2Sb2O6O |
| Sb | ⓘ Choloalite | (Cu,Sb)3(Pb,Ca)3(TeO3)6Cl |
| Sb | ⓘ Monimolite | Pb2Sb25+O7 |
| Sb | ⓘ Montbrayite | (Au,Ag,Sb,Bi,Pb)23(Te,Sb,Bi,Pb)38 |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Sb | ⓘ Oxyplumboroméite | Pb2Sb2O6O |
| Sb | ⓘ Tetrahedrite-(Zn) | Cu6(Cu4Zn2)Sb4S12S |
| Te | Tellurium | |
| Te | ⓘ Altaite | PbTe |
| Te | ⓘ Burckhardtite | Pb2(Fe3+Te6+)[AlSi3O8]O6 |
| Te | ⓘ Carlfriesite | CaTe24+Te6+O8 |
| Te | ⓘ Cervelleite | Ag4TeS |
| Te | ⓘ Choloalite | (Cu,Sb)3(Pb,Ca)3(TeO3)6Cl |
| Te | ⓘ Emmonsite | Fe23+(TeO3)3 · 2H2O |
| Te | ⓘ Eztlite | Pb22+Fe33+(Te4+ O3)3(SO4)O2Cl |
| Te | ⓘ Fairbankite | Pb122+(Te4+O3)11(SO4) |
| Te | ⓘ Hessite | Ag2Te |
| Te | ⓘ Jensenite | Cu3[TeO6] · 2H2O |
| Te | ⓘ Khinite | Pb2+Cu32+[Te6+O6](OH)2 |
| Te | ⓘ Kinichilite | Mg0.5Mn2+Fe3+(Te4+O3)3 · 4.5H2O |
| Te | ⓘ Kuksite | Pb3Zn3(PO4)2(TeO6) |
| Te | ⓘ Montbrayite | (Au,Ag,Sb,Bi,Pb)23(Te,Sb,Bi,Pb)38 |
| Te | ⓘ Plumbotellurite | Pb(TeO3) |
| Te | ⓘ Poughite | Fe23+(TeO3)2(SO4)(H2O)2 · H2O |
| Te | ⓘ Quetzalcoatlite | Zn6Cu3(TeO6)2(OH)6 · AgxPbyClx+2y |
| Te | ⓘ Rodalquilarite | Fe2(TeO2OH)3(TeO3)Cl |
| Te | ⓘ Spiroffite | Mn22+Te34+O8 |
| Te | ⓘ Teineite | Cu2+(Te4+O3) · 2H2O |
| Te | ⓘ Tellurite | TeO2 |
| Te | ⓘ Tellurium | Te |
| Te | ⓘ Tlapallite | (Ca,Pb)3CaCu6[Te34+Te6+O12]2(Te4+O3)2(SO4)2 · 3H2O |
| Te | ⓘ Xocomecatlite | Cu3(TeO4)(OH)4 |
| Te | ⓘ Frankhawthorneite | Cu2Te6+O4(OH)2 |
| Te | ⓘ Leisingite | Cu2MgTe6+O6 · 6H2O |
| Te | ⓘ Mcalpineite | Cu3(Te6+O6) |
| Te | ⓘ Utahite | MgCu4Zn2Te36+O14(OH)4 · 6H2O |
| Te | ⓘ Xocolatlite | Ca2Mn24+(Te6+O6)2 · H2O |
| Te | ⓘ Paratimroseite | Pb2Cu4(TeO6)2(H2O)2 |
| Te | ⓘ Bairdite | Pb2Cu42+Te26+O10(OH)2(SO4) · H2O |
| Te | ⓘ Mojaveite | Cu6[Te6+O4(OH)2](OH)7Cl |
| Te | ⓘ Northstarite | Pb6(Te4+O3)5(S6+O3S2-) |
| Te | ⓘ Müllerite | Pb2Fe3+(Te6+O6)Cl |
| Te | ⓘ Adanite | Pb2(Te4+O3)(SO4) |
| Te | ⓘ Matthiasweilite | PbTe4+O3 |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| W | Tungsten | |
| W | ⓘ Scheelite | Ca(WO4) |
| Au | Gold | |
| Au | ⓘ Gold | Au |
| Au | ⓘ Montbrayite | (Au,Ag,Sb,Bi,Pb)23(Te,Sb,Bi,Pb)38 |
| Hg | Mercury | |
| Hg | ⓘ Cinnabar | HgS |
| Pb | Lead | |
| Pb | ⓘ Altaite | PbTe |
| Pb | ⓘ Bindheimite | Pb2Sb2O6O |
| Pb | ⓘ Burckhardtite | Pb2(Fe3+Te6+)[AlSi3O8]O6 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Choloalite | (Cu,Sb)3(Pb,Ca)3(TeO3)6Cl |
| Pb | ⓘ Cupropavonite | Cu0.9Ag0.5Pb0.6Bi2.5S5 |
| Pb | ⓘ Eztlite | Pb22+Fe33+(Te4+ O3)3(SO4)O2Cl |
| Pb | ⓘ Fairbankite | Pb122+(Te4+O3)11(SO4) |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Khinite | Pb2+Cu32+[Te6+O6](OH)2 |
| Pb | ⓘ Kuksite | Pb3Zn3(PO4)2(TeO6) |
| Pb | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Pb | ⓘ Monimolite | Pb2Sb25+O7 |
| Pb | ⓘ Montbrayite | (Au,Ag,Sb,Bi,Pb)23(Te,Sb,Bi,Pb)38 |
| Pb | ⓘ Murdochite | PbCu6O8-x(Cl,Br)2x |
| Pb | ⓘ Plumbotellurite | Pb(TeO3) |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Pb | ⓘ Quetzalcoatlite | Zn6Cu3(TeO6)2(OH)6 · AgxPbyClx+2y |
| Pb | ⓘ Tlapallite | (Ca,Pb)3CaCu6[Te34+Te6+O12]2(Te4+O3)2(SO4)2 · 3H2O |
| Pb | ⓘ Paratimroseite | Pb2Cu4(TeO6)2(H2O)2 |
| Pb | ⓘ Bairdite | Pb2Cu42+Te26+O10(OH)2(SO4) · H2O |
| Pb | ⓘ Oxyplumboroméite | Pb2Sb2O6O |
| Pb | ⓘ Northstarite | Pb6(Te4+O3)5(S6+O3S2-) |
| Pb | ⓘ Müllerite | Pb2Fe3+(Te6+O6)Cl |
| Pb | ⓘ Adanite | Pb2(Te4+O3)(SO4) |
| Pb | ⓘ Matthiasweilite | PbTe4+O3 |
| Bi | Bismuth | |
| Bi | ⓘ Cupropavonite | Cu0.9Ag0.5Pb0.6Bi2.5S5 |
| Bi | ⓘ Montbrayite | (Au,Ag,Sb,Bi,Pb)23(Te,Sb,Bi,Pb)38 |
Fossils
There are 4 fossil localities from the PaleoBioDB database within this region.BETA TEST - These data are provided on an experimental basis and are taken from external databases. Mindat.org has no control currently over the accuracy of these data.
| Occurrences | 73 | |||||||||
|---|---|---|---|---|---|---|---|---|---|---|
| Youngest Fossil Listed | 501 Ma (Cambrian) | |||||||||
| Oldest Fossil Listed | 513 Ma (Cambrian) | |||||||||
| Stratigraphic Units |
| |||||||||
| Fossils from Region | Click here to show the list. | |||||||||
| Fossil Localities | Click to show 4 fossil localities |
Localities in this Region
- Nevada
- Lincoln County
- Delamar Mining District
- Lincoln County
- Nevada
- Lincoln County
- Delamar Mining District
- Jumbo mine (Horn mine)
- Little Emma mine
- Magnolia mine
- Manganese Occurrence (MRDS10037389)
- Manganese Occurrence (MRDS10246493)
- Manganese prospects
- NBMG Sample Location 1741
- NBMG Sample Location 1746
- NBMG Sample Location 1748
- NBMG Sample Location 1753
- NBMG Sample Location 1759
- NBMG Sample Location 1760
- Nevada Mine
- Oso mine
- Peggy Lee prospect
- Szywala Claims
- Taylor Mine
- Unnamed prospect
- Delamar Mining District
- Lincoln County
Other Regions, Features and Areas that Intersect
North America PlateTectonic Plate
- Antler Foreland BasinBasin
- Basin and Range BasinsBasin
- Mojave DomainDomain
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Delamar Mining District, Lincoln County, Nevada, USA