Halifax Co., Nova Scotia, Canadai
| Regional Level Types | |
|---|---|
| Halifax Co. | County |
| Nova Scotia | Province |
| Canada | Country |
This page is currently not sponsored. Click here to sponsor this page.
Area:
5,496 km2
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Halifax | 359,111 (2018) |
| Dartmouth | 101,343 (2010) |
| Lower Sackville | 21,379 (2016) |
| Cole Harbour | 20,000 (2010) |
| Fall River | 11,526 (2017) |
| East Lawrencetown | 251 (2016) |
Museums in region:
Mindat Locality ID:
133566
Long-form identifier:
mindat:1:2:133566:1
GUID (UUID V4):
00f73f9a-0655-4d37-8f22-d3910149b441
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities101 valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Akaganeite Formula: (Fe3+,Ni2+)8(OH,O)16Cl1.25 · nH2O Localities: References: |
| ⓘ Albite Formula: Na(AlSi3O8) Localities: References: |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 Localities: |
| ⓘ 'Amphibole Supergroup' Formula: AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ Anatase Formula: TiO2 Localities: References: |
| ⓘ Andalusite Formula: Al2(SiO4)O |
| ⓘ Anglesite Formula: PbSO4 Habit: Tabular Colour: Transparent white and yellow Description: Only a few specimens known. |
| ⓘ Anhydrite Formula: CaSO4 |
| ⓘ Anilite Formula: Cu7S4 Colour: Black Description: Powdery and intermixed with other copper sulfides |
| ⓘ Ankerite ? Formula: Ca(Fe2+,Mg)(CO3)2 Localities: Reported from at least 6 localities in this region. Description: A note on ankerite: Recent redefinitions of the ankerite-dolomite series mean that many samples that would have been classified as ankerite would now be defined as dolomite (iron-rich dolomite) and true ankerite is quite rare. See a discussion here https://www.mindat.org/mesg-7-430792.html. The listing below reflects the current species definitions. |
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) Localities: References: |
| ⓘ Arseniosiderite Formula: Ca2Fe3+3(AsO4)3O2 · 3H2O |
| ⓘ Arsenopyrite Formula: FeAsS Localities: Reported from at least 18 localities in this region. References: |
| ⓘ Aurichalcite Formula: (Zn,Cu)5(CO3)2(OH)6 Colour: Turquoise |
| ⓘ Autunite Formula: Ca(UO2)2(PO4)2 · 10-12H2O |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 Description: Though widely reported, all of the blue mineral found on the dumps is linarite. An acid test gives the mineral a white coating, whereas azurite would dissolve. Natural Resources indicated that all blue copper showings in the province are listed as azurite for the prospectors. |
| ⓘ Baryte Formula: BaSO4 Localities: References: |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 Localities: References: |
| ⓘ Bornite Formula: Cu5FeS4 |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 Colour: Green Description: XRD performed by Canadian Museum of Nature |
| ⓘ Calcite Formula: CaCO3 Localities: Reported from at least 12 localities in this region. References: |
| ⓘ Caledonite Formula: Pb5Cu2(SO4)3(CO3)(OH)6 |
| ⓘ Cassiterite Formula: SnO2 Localities: |
| ⓘ Cerussite Formula: PbCO3 Localities: Habit: Often twinned Colour: Colorless, creamy white, pale yellowish, brown |
| ⓘ Chalcocite Formula: Cu2S Colour: Black Description: Powdery and intermixed with other copper sulfides |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Reported from at least 14 localities in this region. Habit: Massive Colour: Brassy yellow |
| ⓘ 'Chlorite Group' Localities: Reported from at least 7 localities in this region. References: |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 Habit: Massive Colour: Turquoise |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ Clinozoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ Copper Formula: Cu Localities: |
| ⓘ Cordierite Formula: (Mg,Fe)2Al3(AlSi5O18) |
| ⓘ 'Cordierite-Sekaninaite Series' Localities: References: |
| ⓘ Corundum Formula: Al2O3 |
| ⓘ Covellite Formula: CuS Description: Iridescent black crystals |
| ⓘ Cuprite Formula: Cu2O Localities: Habit: Commonly massive, rarely as tiny octahedrons Colour: Red |
| ⓘ Digenite Formula: Cu9S5 Colour: Black Description: Powdery and intermixed with other copper sulfides |
| ⓘ Djurleite Formula: Cu31S16 Colour: Black Description: Powdery and intermixed with other copper sulfides |
| ⓘ Dolomite Formula: CaMg(CO3)2 Localities: Reported from at least 7 localities in this region. |
| ⓘ Dolomite var. Iron-bearing Dolomite Formula: Ca(Mg,Fe)(CO3)2 Localities: |
| ⓘ Dravite Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) Localities: |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ 'Feldspar Group' Localities: References: |
| ⓘ 'Feldspar Group var. Perthite' |
| ⓘ Ferro-hornblende Formula: ◻Ca2(Fe2+4Al)(Si7Al)O22(OH)2 |
| ⓘ Ferrosilite Formula: Fe2+2Si2O6 |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F Localities: |
| ⓘ Fluorite Formula: CaF2 Localities: |
| ⓘ Galena Formula: PbS Localities: Reported from at least 15 localities in this region. Habit: Commonly massive, rarely at tiny crystals in the form of cubes, sometimes with octahedral modifications Colour: Gray, dark gray |
| ⓘ Galena var. Silver-bearing Galena Formula: PbS with Ag |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 |
| ⓘ Goethite Formula: α-Fe3+O(OH) Localities: Reported from at least 6 localities in this region. Habit: Sprays Colour: Yellow-brown Description: Ball-shaped sprays on drusy quartz. |
| ⓘ Gold Formula: Au Localities: Reported from at least 15 localities in this region. |
| ⓘ Gold var. Electrum Formula: (Au,Ag) |
| ⓘ Graphite Formula: C |
| ⓘ Greenockite Formula: CdS |
| ⓘ Gypsum Formula: CaSO4 · 2H2O Localities: |
| ⓘ Halotrichite Formula: FeAl2(SO4)4 · 22H2O Habit: Radiating fibers Colour: White-brownish |
| ⓘ Hematite Formula: Fe2O3 Localities: |
| ⓘ Ilmenite Formula: Fe2+TiO3 Localities: |
| ⓘ Kaňkite Formula: FeAsO4 · 3.5H2O Localities: References: |
| ⓘ 'K Feldspar' |
| ⓘ Kyanite Formula: Al2(SiO4)O |
| ⓘ Langite Formula: Cu4(SO4)(OH)6 · 2H2O Habit: Hexagonal tablets to elongated. Sometimes twinned in star shapes. Colour: Greenish-blue Description: Difficult to distinguish from wroewolfeite |
| ⓘ Lepidocrocite Formula: γ-Fe3+O(OH) Localities: References: |
| ⓘ Linarite Formula: PbCu(SO4)(OH)2 Colour: Blue |
| ⓘ Löllingite Formula: FeAs2 |
| ⓘ Magnesio-hornblende Formula: ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| ⓘ Magnesite Formula: MgCO3 |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 Localities: Colour: Bright green to deep green |
| ⓘ Marcasite Formula: FeS2 |
| ⓘ Meneghinite Formula: Pb13CuSb7S24 |
| ⓘ Metatorbernite Formula: Cu(UO2)2(PO4)2 · 8H2O Localities: Description: One specimen known, but based on limited collecting. Good, well formed crystals, but tiny.
http://rruff.info/metatorbernite/R120014 References: |
| ⓘ 'Mica Group' |
| ⓘ Microcline Formula: K(AlSi3O8) Localities: References: |
| ⓘ Molybdenite Formula: MoS2 Localities: |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 10 localities in this region. References: |
| ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Natrojarosite Formula: NaFe3(SO4)2(OH)6 Habit: Earthy to somewhat botryoidal. Colour: Bright yellow. Description: A secondary mineral, likely formed from the breakdown of pyrite. |
| ⓘ Orthoclase Formula: K(AlSi3O8) Localities: References: |
| ⓘ 'Orthopyroxene Subgroup' |
| ⓘ Pharmacosiderite Formula: KFe3+4(AsO4)3(OH)4 · 6-7H2O Localities: Description: Museum catalog number 976GM0068.001 References: |
| ⓘ Phosphohedyphane Formula: Ca2Pb3(PO4)3Cl |
| ⓘ 'Pinite' Localities: References: |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 Localities: |
| ⓘ Pseudomalachite Formula: Cu5(PO4)2(OH)4 Habit: Botryoidal Colour: Green Description: XRD performed by Canadian Museum of Nature |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 19 localities in this region. |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl Localities: Colour: Brown, yellow-brown, green, colorless, red Fluorescence: Yellow |
| ⓘ Pyrrhotite Formula: Fe1-xS Localities: Reported from at least 10 localities in this region. |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 23 localities in this region. Habit: Drusy crystals Colour: White, dark brown, colorless |
| ⓘ Quartz var. Chalcedony Formula: SiO2 |
| ⓘ Quartz var. Rose Quartz Formula: SiO2 |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 Localities: |
| ⓘ Realgar Formula: As4S4 |
| ⓘ Rutile Formula: TiO2 Localities: Reported from at least 7 localities in this region. References: |
| ⓘ Sapphirine Formula: Mg4(Mg3Al9)O4[Si3Al9O36] |
| ⓘ Scheelite Formula: Ca(WO4) Localities: Reported from at least 10 localities in this region. References: |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Localities: References: |
| ⓘ Scorodite Formula: Fe3+AsO4 · 2H2O Localities: References: |
| ⓘ Sekaninaite Formula: (Fe,Mg)2Al3(AlSi5O18) |
| ⓘ Siderite Formula: FeCO3 Localities: |
| ⓘ Silver Formula: Ag Habit: Wires Colour: Silver-gray |
| ⓘ Slavíkite Formula: (H3O+)3Mg6Fe15(SO4)21(OH)18 · 98H2O Colour: Green |
| ⓘ Sperrylite Formula: PtAs2 Localities: |
| ⓘ Spessartine Formula: Mn2+3Al2(SiO4)3 |
| ⓘ Sphalerite Formula: ZnS Localities: Reported from at least 13 localities in this region. Colour: Dark reddish-brown to black |
| ⓘ Spinel Formula: MgAl2O4 |
| ⓘ Staurolite Formula: Fe2+2Al9Si4O23(OH) |
| ⓘ Sulphur Formula: S8 |
| ⓘ Thénardite Formula: Na2SO4 |
| ⓘ Titanite Formula: CaTi(SiO4)O Localities: |
| ⓘ Tooeleite Formula: Fe3+6(As3+O3)4(SO4)(OH)4 · 4H2O |
| ⓘ 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z Localities: Reported from at least 6 localities in this region. |
| ⓘ Tridymite Formula: SiO2 Description: Existance doubted; see:
Dickie, J.R., "Geological, mineralogical and fluid inclusion studies at the Dunbrack lead-silver deposit, Musquodoboit Harbour, Halifax County, Nova Scotia", unpublished B.Sc. Thesis, Dalhousie University, Canada, 1978. |
| ⓘ Tungstite Formula: WO3 · H2O |
| ⓘ Ulexite Formula: NaCa[B5O6(OH)6] · 5H2O |
| ⓘ 'Wolframite Group' |
| ⓘ Woodwardite Formula: Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| ⓘ Wroewolfeite Formula: Cu4(SO4)(OH)6 · 2H2O Colour: Greenish-blue Description: XRD performed by Canadian Museum of Nature.
Difficult to distinguish from langite. |
| ⓘ Wulfenite Formula: Pb(MoO4) Habit: Steep bipyramids Colour: Orange Description: Almost always associated with green pyromorphite |
| ⓘ Yukonite Formula: Ca3Fe3+(AsO4)2(OH)3 · 5H2O Localities: References: |
| ⓘ Zircon Formula: Zr(SiO4) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Copper | 1.AA.05 | Cu |
| ⓘ | Gold | 1.AA.05 | Au |
| ⓘ | var. Electrum | 1.AA.05 | (Au,Ag) |
| ⓘ | Graphite | 1.CB.05a | C |
| ⓘ | Silver | 1.AA.05 | Ag |
| ⓘ | Sulphur | 1.CC.05 | S8 |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Anilite | 2.BA.10 | Cu7S4 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Digenite | 2.BA.10 | Cu9S5 |
| ⓘ | Djurleite | 2.BA.05 | Cu31S16 |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | var. Silver-bearing Galena | 2.CD.10 | PbS with Ag |
| ⓘ | Greenockite | 2.CB.45 | CdS |
| ⓘ | Löllingite | 2.EB.15a | FeAs2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Meneghinite | 2.HB.05b | Pb13CuSb7S24 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Realgar | 2.FA.15a | As4S4 |
| ⓘ | Sperrylite | 2.EB.05a | PtAs2 |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Akaganeite | 4.DK.05 | (Fe3+,Ni2+)8(OH,O)16Cl1.25 · nH2O |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Corundum | 4.CB.05 | Al2O3 |
| ⓘ | Cuprite | 4.AA.10 | Cu2O |
| ⓘ | Goethite | 4.00. | α-Fe3+O(OH) |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Lepidocrocite | 4.FE.15 | γ-Fe3+O(OH) |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | var. Rose Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Spinel | 4.BB.05 | MgAl2O4 |
| ⓘ | Tooeleite | 4.JD.15 | Fe3+6(As3+O3)4(SO4)(OH)4 · 4H2O |
| ⓘ | Tridymite | 4.DA.10 | SiO2 |
| ⓘ | Tungstite | 4.FJ.10 | WO3 · H2O |
| ⓘ | 'Wolframite Group' | 4.DB.30 va | |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Ankerite ? | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Aurichalcite | 5.BA.15 | (Zn,Cu)5(CO3)2(OH)6 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | var. Iron-bearing Dolomite | 5.AB.10 | Ca(Mg,Fe)(CO3)2 |
| ⓘ | Magnesite | 5.AB.05 | MgCO3 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| Group 6 - Borates | |||
| ⓘ | Ulexite | 6.EA.25 | NaCa[B5O6(OH)6] · 5H2O |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Anhydrite | 7.AD.30 | CaSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Caledonite | 7.BC.50 | Pb5Cu2(SO4)3(CO3)(OH)6 |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Halotrichite | 7.CB.85 | FeAl2(SO4)4 · 22H2O |
| ⓘ | Langite | 7.DD.10 | Cu4(SO4)(OH)6 · 2H2O |
| ⓘ | Linarite | 7.BC.65 | PbCu(SO4)(OH)2 |
| ⓘ | Natrojarosite | 7.BC.10 | NaFe3(SO4)2(OH)6 |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| ⓘ | Slavíkite | 7.DF.30 | (H3O+)3Mg6Fe15(SO4)21(OH)18 · 98H2O |
| ⓘ | Thénardite | 7.AD.25 | Na2SO4 |
| ⓘ | Woodwardite | 7.DD.35 | Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| ⓘ | Wroewolfeite | 7.DD.10 | Cu4(SO4)(OH)6 · 2H2O |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Arseniosiderite | 8.DH.30 | Ca2Fe3+3(AsO4)3O2 · 3H2O |
| ⓘ | Autunite | 8.EB.05 | Ca(UO2)2(PO4)2 · 10-12H2O |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Kaňkite | 8.CE.60 | FeAsO4 · 3.5H2O |
| ⓘ | Metatorbernite | 8.EB.10 | Cu(UO2)2(PO4)2 · 8H2O |
| ⓘ | Pharmacosiderite | 8.DK.10 | KFe3+4(AsO4)3(OH)4 · 6-7H2O |
| ⓘ | Phosphohedyphane | 8.BN.05 | Ca2Pb3(PO4)3Cl |
| ⓘ | Pseudomalachite | 8.BD.05 | Cu5(PO4)2(OH)4 |
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| ⓘ | Scorodite | 8.CD.10 | Fe3+AsO4 · 2H2O |
| ⓘ | Yukonite | 8.DM.25 | Ca3Fe3+(AsO4)2(OH)3 · 5H2O |
| Group 9 - Silicates | |||
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | Clinozoisite | 9.BG.05a | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Cordierite | 9.CJ.10 | (Mg,Fe)2Al3(AlSi5O18) |
| ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Ferro-hornblende | 9.DE.10 | ◻Ca2(Fe2+4Al)(Si7Al)O22(OH)2 |
| ⓘ | Ferrosilite | 9.DA.05 | Fe2+2Si2O6 |
| ⓘ | Kyanite | 9.AF.15 | Al2(SiO4)O |
| ⓘ | Magnesio-hornblende | 9.DE.10 | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Sapphirine | 9.DH.45 | Mg4(Mg3Al9)O4[Si3Al9O36] |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Sekaninaite | 9.CJ.10 | (Fe,Mg)2Al3(AlSi5O18) |
| ⓘ | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| ⓘ | Staurolite | 9.AF.30 | Fe2+2Al9Si4O23(OH) |
| ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| Unclassified Minerals, Rocks, etc. | |||
| ⓘ | 'Amphibole Supergroup' | - | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Cordierite-Sekaninaite Series' | - | |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'var. Perthite' | - | |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Mica Group' | - | |
| ⓘ | 'Orthopyroxene Subgroup' | - | |
| ⓘ | 'Pinite' | - | |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| H | ⓘ Linarite | PbCu(SO4)(OH)2 |
| H | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| H | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Goethite | α-Fe3+O(OH) |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| H | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| H | ⓘ Woodwardite | Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| H | ⓘ Tungstite | WO3 · H2O |
| H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| H | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| H | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Ulexite | NaCa[B5O6(OH)6] · 5H2O |
| H | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| H | ⓘ Slavíkite | (H3O+)3Mg6Fe15(SO4)21(OH)18 · 98H2O |
| H | ⓘ Halotrichite | FeAl2(SO4)4 · 22H2O |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| H | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| H | ⓘ Kaňkite | FeAsO4 · 3.5H2O |
| H | ⓘ Yukonite | Ca3Fe3+(AsO4)2(OH)3 · 5H2O |
| H | ⓘ Lepidocrocite | γ-Fe3+O(OH) |
| H | ⓘ Akaganeite | (Fe3+,Ni2+)8(OH,O)16Cl1.25 · nH2O |
| H | ⓘ Tooeleite | Fe63+(As3+O3)4(SO4)(OH)4 · 4H2O |
| H | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| H | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| H | ⓘ Natrojarosite | NaFe3(SO4)2(OH)6 |
| B | Boron | |
| B | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Ulexite | NaCa[B5O6(OH)6] · 5H2O |
| C | Carbon | |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| C | ⓘ Graphite | C |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| C | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Magnesite | MgCO3 |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | Oxygen | |
| O | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| O | ⓘ Wulfenite | Pb(MoO4) |
| O | ⓘ Linarite | PbCu(SO4)(OH)2 |
| O | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| O | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Quartz var. Rose Quartz | SiO2 |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Tridymite | SiO2 |
| O | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Goethite | α-Fe3+O(OH) |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Andalusite | Al2(SiO4)O |
| O | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| O | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| O | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Woodwardite | Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Tungstite | WO3 · H2O |
| O | ⓘ Titanite | CaTi(SiO4)O |
| O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| O | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| O | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| O | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Anhydrite | CaSO4 |
| O | ⓘ Ulexite | NaCa[B5O6(OH)6] · 5H2O |
| O | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| O | ⓘ Slavíkite | (H3O+)3Mg6Fe15(SO4)21(OH)18 · 98H2O |
| O | ⓘ Magnesite | MgCO3 |
| O | ⓘ Thénardite | Na2SO4 |
| O | ⓘ Halotrichite | FeAl2(SO4)4 · 22H2O |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| O | ⓘ Sekaninaite | (Fe,Mg)2Al3(AlSi5O18) |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| O | ⓘ Kaňkite | FeAsO4 · 3.5H2O |
| O | ⓘ Yukonite | Ca3Fe3+(AsO4)2(OH)3 · 5H2O |
| O | ⓘ Lepidocrocite | γ-Fe3+O(OH) |
| O | ⓘ Akaganeite | (Fe3+,Ni2+)8(OH,O)16Cl1.25 · nH2O |
| O | ⓘ Tooeleite | Fe63+(As3+O3)4(SO4)(OH)4 · 4H2O |
| O | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| O | ⓘ Kyanite | Al2(SiO4)O |
| O | ⓘ Sapphirine | Mg4(Mg3Al9)O4[Si3Al9O36] |
| O | ⓘ Spinel | MgAl2O4 |
| O | ⓘ Corundum | Al2O3 |
| O | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| O | ⓘ Ferrosilite | Fe22+Si2O6 |
| O | ⓘ Natrojarosite | NaFe3(SO4)2(OH)6 |
| O | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| F | Fluorine | |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Na | Sodium | |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Ulexite | NaCa[B5O6(OH)6] · 5H2O |
| Na | ⓘ Thénardite | Na2SO4 |
| Na | ⓘ Natrojarosite | NaFe3(SO4)2(OH)6 |
| Mg | Magnesium | |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| Mg | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| Mg | ⓘ Slavíkite | (H3O+)3Mg6Fe15(SO4)21(OH)18 · 98H2O |
| Mg | ⓘ Magnesite | MgCO3 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Sekaninaite | (Fe,Mg)2Al3(AlSi5O18) |
| Mg | ⓘ Sapphirine | Mg4(Mg3Al9)O4[Si3Al9O36] |
| Mg | ⓘ Spinel | MgAl2O4 |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Al | Aluminium | |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Andalusite | Al2(SiO4)O |
| Al | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Al | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Woodwardite | Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Al | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Al | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| Al | ⓘ Halotrichite | FeAl2(SO4)4 · 22H2O |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Sekaninaite | (Fe,Mg)2Al3(AlSi5O18) |
| Al | ⓘ Kyanite | Al2(SiO4)O |
| Al | ⓘ Sapphirine | Mg4(Mg3Al9)O4[Si3Al9O36] |
| Al | ⓘ Spinel | MgAl2O4 |
| Al | ⓘ Corundum | Al2O3 |
| Al | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Si | Silicon | |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Quartz var. Rose Quartz | SiO2 |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Tridymite | SiO2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Andalusite | Al2(SiO4)O |
| Si | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Si | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Titanite | CaTi(SiO4)O |
| Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Si | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Si | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Sekaninaite | (Fe,Mg)2Al3(AlSi5O18) |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Kyanite | Al2(SiO4)O |
| Si | ⓘ Sapphirine | Mg4(Mg3Al9)O4[Si3Al9O36] |
| Si | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Si | ⓘ Ferrosilite | Fe22+Si2O6 |
| P | Phosphorus | |
| P | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| P | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| P | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| P | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| S | Sulfur | |
| S | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| S | ⓘ Linarite | PbCu(SO4)(OH)2 |
| S | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| S | ⓘ Anilite | Cu7S4 |
| S | ⓘ Galena | PbS |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Djurleite | Cu31S16 |
| S | ⓘ Digenite | Cu9S5 |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Meneghinite | Pb13CuSb7S24 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Greenockite | CdS |
| S | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Woodwardite | Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Anhydrite | CaSO4 |
| S | ⓘ Slavíkite | (H3O+)3Mg6Fe15(SO4)21(OH)18 · 98H2O |
| S | ⓘ Thénardite | Na2SO4 |
| S | ⓘ Halotrichite | FeAl2(SO4)4 · 22H2O |
| S | ⓘ Sulphur | S8 |
| S | ⓘ Covellite | CuS |
| S | ⓘ Tooeleite | Fe63+(As3+O3)4(SO4)(OH)4 · 4H2O |
| S | ⓘ Realgar | As4S4 |
| S | ⓘ Natrojarosite | NaFe3(SO4)2(OH)6 |
| Cl | Chlorine | |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Cl | ⓘ Akaganeite | (Fe3+,Ni2+)8(OH,O)16Cl1.25 · nH2O |
| Cl | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Cl | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| Ca | Calcium | |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| Ca | ⓘ Titanite | CaTi(SiO4)O |
| Ca | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Ca | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Anhydrite | CaSO4 |
| Ca | ⓘ Ulexite | NaCa[B5O6(OH)6] · 5H2O |
| Ca | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| Ca | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Yukonite | Ca3Fe3+(AsO4)2(OH)3 · 5H2O |
| Ca | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| Ca | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ti | Titanium | |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Titanite | CaTi(SiO4)O |
| Ti | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Mn | Manganese | |
| Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Fe | Iron | |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Goethite | α-Fe3+O(OH) |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Fe | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Löllingite | FeAs2 |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Fe | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Slavíkite | (H3O+)3Mg6Fe15(SO4)21(OH)18 · 98H2O |
| Fe | ⓘ Halotrichite | FeAl2(SO4)4 · 22H2O |
| Fe | ⓘ Sekaninaite | (Fe,Mg)2Al3(AlSi5O18) |
| Fe | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| Fe | ⓘ Kaňkite | FeAsO4 · 3.5H2O |
| Fe | ⓘ Yukonite | Ca3Fe3+(AsO4)2(OH)3 · 5H2O |
| Fe | ⓘ Lepidocrocite | γ-Fe3+O(OH) |
| Fe | ⓘ Akaganeite | (Fe3+,Ni2+)8(OH,O)16Cl1.25 · nH2O |
| Fe | ⓘ Tooeleite | Fe63+(As3+O3)4(SO4)(OH)4 · 4H2O |
| Fe | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| Fe | ⓘ Ferrosilite | Fe22+Si2O6 |
| Fe | ⓘ Natrojarosite | NaFe3(SO4)2(OH)6 |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ni | Nickel | |
| Ni | ⓘ Akaganeite | (Fe3+,Ni2+)8(OH,O)16Cl1.25 · nH2O |
| Cu | Copper | |
| Cu | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| Cu | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Cu | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| Cu | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| Cu | ⓘ Anilite | Cu7S4 |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Djurleite | Cu31S16 |
| Cu | ⓘ Digenite | Cu9S5 |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Meneghinite | Pb13CuSb7S24 |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Cu | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| Cu | ⓘ Woodwardite | Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| Cu | ⓘ Copper | Cu |
| Cu | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| Cu | ⓘ Covellite | CuS |
| Zn | Zinc | |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Sperrylite | PtAs2 |
| As | ⓘ Löllingite | FeAs2 |
| As | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| As | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| As | ⓘ Kaňkite | FeAsO4 · 3.5H2O |
| As | ⓘ Yukonite | Ca3Fe3+(AsO4)2(OH)3 · 5H2O |
| As | ⓘ Tooeleite | Fe63+(As3+O3)4(SO4)(OH)4 · 4H2O |
| As | ⓘ Realgar | As4S4 |
| As | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Mo | Molybdenum | |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Mo | ⓘ Molybdenite | MoS2 |
| Ag | Silver | |
| Ag | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| Ag | ⓘ Gold var. Electrum | (Au,Ag) |
| Ag | ⓘ Silver | Ag |
| Cd | Cadmium | |
| Cd | ⓘ Greenockite | CdS |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sb | Antimony | |
| Sb | ⓘ Meneghinite | Pb13CuSb7S24 |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| W | Tungsten | |
| W | ⓘ Scheelite | Ca(WO4) |
| W | ⓘ Tungstite | WO3 · H2O |
| Pt | Platinum | |
| Pt | ⓘ Sperrylite | PtAs2 |
| Au | Gold | |
| Au | ⓘ Gold | Au |
| Au | ⓘ Gold var. Electrum | (Au,Ag) |
| Pb | Lead | |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
| Pb | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Meneghinite | Pb13CuSb7S24 |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Pb | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| Pb | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| U | Uranium | |
| U | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| U | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
Fossils
There are 1 fossil localities from the PaleoBioDB database within this region.BETA TEST - These data are provided on an experimental basis and are taken from external databases. Mindat.org has no control currently over the accuracy of these data.
| Occurrences | 1 |
|---|---|
| Youngest Fossil Listed | |
| Oldest Fossil Listed | 2.59 Ma (Pleistocene) |
| Fossils from Region | Click here to show the list. |
| Fossil Localities | Click to show 1 fossil locality |
Localities in this Region
- Nova Scotia
- Halifax Co.
- Bayer's Lake pegmatites (north)
- Bayer's Lake pegmatites (south)
- Beaverdam gold mine (Beaver Dam mine)
- ⭔Caribou gold district
- ⭔Cow Bay gold district
- Dufferin mines
- East Milford
- ⭔Ecum Secum gold district
- Fall River
- ⭔Fifteen Mile Stream gold district
- Governor Lake pegmatite
- Halifax slavikite occurrence
- Herring Cove traverse
- ⭔Hubley
- Halifax Co.
- Nova Scotia
- Halifax Co.
- ⭔Lake Catcha gold district
- Lake Charlotte mines
- Lawrencetown gold district
- Lochaber mines
- Montague gold district
- Moose River
- Moosehead gold mines (Shiers Point mines)
- ⭔Mount Uniacke gold district
- Musquodoboit Harbour
- ⭔Oldham gold district
- Pogue Lake
- Popes Harbour
- Sheet Harbour mines
- Ship Harbour occurrences
- Tangier mines
- Waverley
- Halifax Co.
Other Regions, Features and Areas that Intersect
Atlantic OceanOcean
Canada
- Nova Scotia
- South Mountain batholithBatholith
North America PlateTectonic Plate
- Magdalen basinBasin
- Meguma DomainDomain
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Tangier mines, Halifax Co., Nova Scotia, Canada