Hastings Highlands Municipality, Hastings County, Ontario, Canadai
| Regional Level Types | |
|---|---|
| Hastings Highlands Municipality | Municipality |
| Hastings County | County |
| Ontario | Province |
| Canada | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
44° North , 77° West (est.)
Estimate based on other nearby localities or region boundaries.
Margin of Error:
~83km
Type:
Köppen climate type:
Mindat Locality ID:
272971
Long-form identifier:
mindat:1:2:272971:1
GUID (UUID V4):
b81fc91c-8664-4e9d-840e-8bea0a68e3ee
The Municipality of Hastings Highlands was incorporated by amalgamating the townships of Bangor, Wicklow & McClure, Herschel and Monteagle on 1 January 2001.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities58 valid minerals. 1 (TL) - type locality of valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 Localities: Graphite Road roadcut, Monteagle Township, Hastings Highlands Municipality, Hastings County, Ontario, Canada Highway 62 north roadcut, Monteagle Township, Hastings Highlands Municipality, Hastings County, Ontario, Canada Baptiste Lake North occurrences, Herschel Township, Hastings Highlands Municipality, Hastings County, Ontario, Canada Near Graphite Road, Musclow Greenview Road roadcuts, Monteagle Township, Hastings Highlands Municipality, Hastings County, Ontario, Canada |
| ⓘ 'Actinolite-Tremolite Series' |
| ⓘ Aeschynite-(Y) Formula: (Y,Ln,Ca,Th)(Ti,Nb)2(O,OH)6 |
| ⓘ Albite Formula: Na(AlSi3O8) Localities: Reported from at least 11 localities in this region. |
| ⓘ Albite var. Oligoclase Formula: (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ Albite var. Peristerite Formula: Na(AlSi3O8) Localities: Watson Mine, Monteagle Township, Hastings Highlands Municipality, Hastings County, Ontario, Canada MacDonald Mine, Monteagle Township, Hastings Highlands Municipality, Hastings County, Ontario, Canada Cairns Mine, Monteagle Township, Hastings Highlands Municipality, Hastings County, Ontario, Canada Plunkett Mine, Monteagle Township, Hastings Highlands Municipality, Hastings County, Ontario, Canada McCormack Mine (North and South), Monteagle Township, Hastings Highlands Municipality, Hastings County, Ontario, Canada References: |
| ⓘ Allanite-(Ce) Formula: (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) Localities: Highway 62 north roadcut, Monteagle Township, Hastings Highlands Municipality, Hastings County, Ontario, Canada MacDonald Mine, Monteagle Township, Hastings Highlands Municipality, Hastings County, Ontario, Canada Highway 62 Road cut, Maynooth, Hastings Highlands Municipality, Hastings County, Ontario, Canada References: |
| ⓘ 'Allanite Group' Formula: (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) Localities: Reported from at least 14 localities in this region. Description: Masses to several hundred pounds/
2 feet long |
| ⓘ 'Amphibole Supergroup' Formula: AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 Localities: Baptiste Lake area, Herschel Township, Hastings Highlands Municipality, Hastings County, Ontario, Canada Hybla Road roadcut, Monteagle Township, Hastings Highlands Municipality, Hastings County, Ontario, Canada Maple Leaf, Monteagle Township, Hastings Highlands Municipality, Hastings County, Ontario, Canada |
| ⓘ Anatase Formula: TiO2 Habit: gray to brownish gray Description: alteration of warwicite |
| ⓘ Andradite Formula: Ca3Fe3+2(SiO4)3 Localities: Description: according to ontariominerals.com a resource by H.V Ellsworth says the andradite is radioactive and has a 1.14% REE content. |
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) Localities: Reported from at least 11 localities in this region. References: |
| ⓘ Augite Formula: (CaxMgyFez)(Mgy1Fez1)Si2O6 Localities: Musclow Greenview Road roadcuts, Monteagle Township, Hastings Highlands Municipality, Hastings County, Ontario, Canada Baptiste Lake North occurrences, Herschel Township, Hastings Highlands Municipality, Hastings County, Ontario, Canada Highway 62 north roadcut, Monteagle Township, Hastings Highlands Municipality, Hastings County, Ontario, Canada Diamond Lake, Herschel Township, Hastings Highlands Municipality, Hastings County, Ontario, Canada ? (more information) References: |
| ⓘ 'Bastnäsite' Formula: (Ce/Nd/Y/REE)(CO3)F |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 Localities: Reported from at least 14 localities in this region. |
| ⓘ Calciosamarskite (TL) Formula: (Ca,U4+)Fe3+(Nb,Ta,Ti)2O8 Type Locality: |
| ⓘ Calcite Formula: CaCO3 Localities: Reported from at least 16 localities in this region. References: |
| ⓘ 'Chabazite' Localities: Highway 62 north roadcut, Monteagle Township, Hastings Highlands Municipality, Hastings County, Ontario, Canada Monteagle Township, Hastings Highlands Municipality, Hastings County, Ontario, Canada Max Miller workings, Monteagle Township, Hastings Highlands Municipality, Hastings County, Ontario, Canada References: |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: |
| ⓘ Chamosite Formula: (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| ⓘ 'Chlorite Group' Localities: Watson Mine, Monteagle Township, Hastings Highlands Municipality, Hastings County, Ontario, Canada MacDonald Mine, Monteagle Township, Hastings Highlands Municipality, Hastings County, Ontario, Canada McCormack Mine (North and South), Monteagle Township, Hastings Highlands Municipality, Hastings County, Ontario, Canada Thompson Mine, Monteagle Township, Hastings Highlands Municipality, Hastings County, Ontario, Canada Hickey Mine, Monteagle Township, Hastings Highlands Municipality, Hastings County, Ontario, Canada Description: peristerite hear has pleasing blue schiller. Small nicely formed titanites can be found. Amazonite is scarce. Jarosite occurs as a pestering coating on feldspar. most plag requires cleaving to see if it has schiller. References: |
| ⓘ Chondrodite Formula: Mg5(SiO4)2F2 Localities: |
| ⓘ Chrysotile Formula: Mg3(Si2O5)(OH)4 |
| ⓘ 'Clinopyroxene Subgroup' Colour: colorless, light yellow and grey |
| ⓘ 'Columbite-(Fe)-Columbite-(Mn) Series' Localities: |
| ⓘ Corundum Formula: Al2O3 Localities: References: |
| ⓘ Diopside Formula: CaMgSi2O6 Localities: Reported from at least 11 localities in this region. References: |
| ⓘ 'Diopside-Hedenbergite Series' |
| ⓘ Edenite Formula: NaCa2Mg5(Si7Al)O22(OH)2 |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) Localities: Reported from at least 6 localities in this region. References: |
| ⓘ Euxenite-(Y) Formula: (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 Localities: Plunkett Mine, Monteagle Township, Hastings Highlands Municipality, Hastings County, Ontario, Canada Genesee No. 2 Mine, Monteagle Township, Hastings Highlands Municipality, Hastings County, Ontario, Canada Patterson occurrence, Herschel Township, Hastings Highlands Municipality, Hastings County, Ontario, Canada Cairns Mine, Monteagle Township, Hastings Highlands Municipality, Hastings County, Ontario, Canada Reeves Mine, Monteagle Township, Hastings Highlands Municipality, Hastings County, Ontario, Canada |
| ⓘ 'Feldspar Group' Localities: Reported from at least 19 localities in this region. |
| ⓘ 'Feldspar Group var. Perthite' Localities: Reported from at least 6 localities in this region. |
| ⓘ 'Feldspar Group var. Sunstone' Localities: Hickey Mine, Monteagle Township, Hastings Highlands Municipality, Hastings County, Ontario, Canada Selby Hill, Herschel Township, Hastings Highlands Municipality, Hastings County, Ontario, Canada National Graphite Mine, Monteagle Township, Hastings Highlands Municipality, Hastings County, Ontario, Canada |
| ⓘ Fergusonite-(Y) Formula: YNbO4 |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F |
| ⓘ Fluorite Formula: CaF2 Localities: Reported from at least 7 localities in this region. |
| ⓘ Fluorite var. Stink-Fluss Formula: CaF2 |
| ⓘ Galena Formula: PbS Localities: |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 Localities: Reported from at least 8 localities in this region. Description: The garnet found is rare-earth bearing |
| ⓘ Goethite Formula: α-Fe3+O(OH) Localities: References: |
| ⓘ Graphite Formula: C Localities: |
| ⓘ Gypsum Formula: CaSO4 · 2H2O |
| ⓘ Hematite Formula: Fe2O3 Localities: Reported from at least 7 localities in this region. References: |
| ⓘ Hematite var. Martite Formula: Fe2O3 Habit: octohedrons Colour: gray Description: hematite psuedomorphs after magnetite found on hematite-stained books of mica in the main dyke |
| ⓘ Hollandite ? Formula: Ba(Mn4+6Mn3+2)O16 Description: Hollandite was closest PXRD diffraction pattern match, but other closely related Mn oxides possible. Mn also confirmed by wet chemistry. In a fine-grained mixture with hematite and quartz, possibly representing pseudomorph after garnet. |
| ⓘ 'Hornblende Root Name Group' Formula: ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 Localities: Reported from at least 18 localities in this region. |
| ⓘ Hydroxycalciopyrochlore Formula: (Ca,Na,U,◻)2(Nb,Ti)2O6(OH) Description: Masson and Gordon say: Associated with cyrtolite is the radioactive mineral ellsworthite. This mineral is waxy yellow-brown to shiny black in colour and commonly occurs in calcite or feldspar. |
| ⓘ Ilmenite Formula: Fe2+TiO3 Localities: |
| ⓘ Jarosite Formula: KFe3+3(SO4)2(OH)6 Localities: Description: peristerite hear has pleasing blue schiller. Small nicely formed titanites can be found. Amazonite is scarce. Jarosite occurs as a pestering coating on feldspar. most plag requires cleaving to see if it has schiller. References: |
| ⓘ 'K Feldspar' Localities: |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 Localities: Reported from at least 11 localities in this region. |
| ⓘ Marcasite Formula: FeS2 |
| ⓘ Marialite Formula: Na4Al3Si9O24Cl |
| ⓘ Meionite Formula: Ca4Al6Si6O24CO3 Localities: References: |
| ⓘ 'Mica Group' Localities: Reported from at least 7 localities in this region. |
| ⓘ Microcline Formula: K(AlSi3O8) Localities: Reported from at least 12 localities in this region. |
| ⓘ Microcline var. Amazonite Formula: K(AlSi3O8) Localities: Reported from at least 7 localities in this region. |
| ⓘ 'Microperthite' |
| ⓘ Molybdenite Formula: MoS2 Localities: Reported from at least 10 localities in this region. |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: MacDonald Mine, Monteagle Township, Hastings Highlands Municipality, Hastings County, Ontario, Canada Genesee No. 2 Mine, Monteagle Township, Hastings Highlands Municipality, Hastings County, Ontario, Canada Thompson Mine, Monteagle Township, Hastings Highlands Municipality, Hastings County, Ontario, Canada References: |
| ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 Localities: |
| ⓘ Nepheline Formula: Na3K(Al4Si4O16) |
| ⓘ Phlogopite Formula: KMg3(AlSi3O10)(OH)2 Localities: Reported from at least 7 localities in this region. References: |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 Localities: Reported from at least 11 localities in this region. Description: peristerite hear has pleasing blue schiller. Small nicely formed titanites can be found. Amazonite is scarce. Jarosite occurs as a pestering coating on feldspar. most plag requires cleaving to see if it has schiller. References: |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 16 localities in this region. Description: peristerite hear has pleasing blue schiller. Small nicely formed titanites can be found. Amazonite is scarce. Jarosite occurs as a pestering coating on feldspar. most plag requires cleaving to see if it has schiller. References: |
| ⓘ 'Pyrochlore Group' Formula: A2Nb2(O,OH)6Z Localities: Reported from at least 7 localities in this region. |
| ⓘ 'Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977)' Formula: (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) Localities: Reported from at least 6 localities in this region. Description: described as ellsworthite References: |
| ⓘ 'Pyrochlore Supergroup' Formula: A2-mD2X6-wZ1-n Localities: Reported from at least 6 localities in this region. Description: peristerite hear has pleasing blue schiller. Small nicely formed titanites can be found. Amazonite is scarce. Jarosite occurs as a pestering coating on feldspar. most plag requires cleaving to see if it has schiller. References: |
| ⓘ 'Pyrochlore Supergroup var. Betafite (of Hogarth 1977)' Formula: (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) Localities: Reported from at least 6 localities in this region. Description: peristerite hear has pleasing blue schiller. Small nicely formed titanites can be found. Amazonite is scarce. Jarosite occurs as a pestering coating on feldspar. most plag requires cleaving to see if it has schiller. References: |
| ⓘ 'Pyroxene Group' Formula: ADSi2O6 Localities: Reported from at least 15 localities in this region. |
| ⓘ Pyrrhotite Formula: Fe1-xS Localities: MacDonald Mine, Monteagle Township, Hastings Highlands Municipality, Hastings County, Ontario, Canada Warwickite occurrence, Herschel Township, Hastings Highlands Municipality, Hastings County, Ontario, Canada National Graphite Mine, Monteagle Township, Hastings Highlands Municipality, Hastings County, Ontario, Canada Taylor Mine, Monteagle Township, Hastings Highlands Municipality, Hastings County, Ontario, Canada |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 25 localities in this region. |
| ⓘ Quartz var. Amethyst Formula: SiO2 Localities: References: |
| ⓘ Quartz var. Rose Quartz Formula: SiO2 |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 Localities: Reported from at least 9 localities in this region. References: |
| ⓘ Rozenite Formula: FeSO4 · 4H2O |
| ⓘ Samarskite-(Y) Formula: YFe3+Nb2O8 |
| ⓘ 'Scapolite' Localities: Reported from at least 19 localities in this region. |
| ⓘ Scheelite Formula: Ca(WO4) |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ 'Serpentine Subgroup' Formula: D3[Si2O5](OH)4 Localities: Habit: as alteration of diopside |
| ⓘ Sinhalite Formula: MgAl(BO4) Habit: irregular masses 2mm in diameter & microcrystalline crust around spinel Colour: colorless to light yellow |
| ⓘ Spinel Formula: MgAl2O4 |
| ⓘ 'Stilbite Subgroup' Formula: M6-7[Al8-9Si27-28O72] · nH2O |
| ⓘ Szaibélyite Formula: MgBO2(OH) |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 Habit: as alteration of k-spar |
| ⓘ Thorianite Formula: ThO2 |
| ⓘ Thorite Formula: Th(SiO4) Localities: Reported from at least 7 localities in this region. |
| ⓘ Thorite var. Thorogummite Formula: (Th,U)(SiO4)1-x(OH)4x |
| ⓘ Thorite var. Uranothorite Formula: (Th,U)SiO4 Localities: Reported from at least 6 localities in this region. References: |
| ⓘ Titanite Formula: CaTi(SiO4)O Localities: Reported from at least 17 localities in this region. |
| ⓘ Tochilinite Formula: Fe2+5-6(Mg,Fe2+)5S6(OH)10 |
| ⓘ 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z Localities: Reported from at least 6 localities in this region. |
| ⓘ Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 Localities: Maple Leaf, Monteagle Township, Hastings Highlands Municipality, Hastings County, Ontario, Canada Graphite Road roadcut, Monteagle Township, Hastings Highlands Municipality, Hastings County, Ontario, Canada National Graphite Mine, Monteagle Township, Hastings Highlands Municipality, Hastings County, Ontario, Canada References: |
| ⓘ Uraninite Formula: UO2 Localities: |
| ⓘ Warwickite Formula: (Mg,Ti,Fe,Al)2O(BO3) |
| ⓘ Zircon Formula: Zr(SiO4) Localities: Reported from at least 8 localities in this region. Colour: pink |
| ⓘ Zircon var. Cyrtolite Formula: Zr[(SiO4),(OH)4] Localities: MacDonald Mine, Monteagle Township, Hastings Highlands Municipality, Hastings County, Ontario, Canada Woodcox Mine, Monteagle Township, Hastings Highlands Municipality, Hastings County, Ontario, Canada Cairns Mine, Monteagle Township, Hastings Highlands Municipality, Hastings County, Ontario, Canada Bartlett Mine, Monteagle Township, Hastings Highlands Municipality, Hastings County, Ontario, Canada References: |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Graphite | 1.CB.05a | C |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Tochilinite | 2.FD.35 | Fe2+5-6(Mg,Fe2+)5S6(OH)10 |
| Group 3 - Halides | |||
| ⓘ | Fluorite var. Stink-Fluss | 3.AB.25 | CaF2 |
| ⓘ | 3.AB.25 | CaF2 | |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | α-Fe3+O(OH) |
| ⓘ | 'Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977)' | 4.00. | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| ⓘ | '' | 4.00. | A2Nb2(O,OH)6Z |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Spinel | 4.BB.05 | MgAl2O4 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Corundum | 4.CB.05 | Al2O3 |
| ⓘ | Hematite var. Martite | 4.CB.05 | Fe2O3 |
| ⓘ | 4.CB.05 | Fe2O3 | |
| ⓘ | Quartz var. Amethyst | 4.DA.05 | SiO2 |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Rose Quartz | 4.DA.05 | SiO2 |
| ⓘ | Calciosamarskite (TL) | 4.DB.25 | (Ca,U4+)Fe3+(Nb,Ta,Ti)2O8 |
| ⓘ | Samarskite-(Y) | 4.DB.25 | YFe3+Nb2O8 |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Aeschynite-(Y) | 4.DF.05 | (Y,Ln,Ca,Th)(Ti,Nb)2(O,OH)6 |
| ⓘ | Euxenite-(Y) | 4.DG.05 | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| ⓘ | Hydroxycalciopyrochlore | 4.DH.15 | (Ca,Na,U,◻)2(Nb,Ti)2O6(OH) |
| ⓘ | Hollandite ? | 4.DK.05a | Ba(Mn4+6Mn3+2)O16 |
| ⓘ | Uraninite | 4.DL.05 | UO2 |
| ⓘ | Thorianite | 4.DL.05 | ThO2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| Group 6 - Borates | |||
| ⓘ | Warwickite | 6.AB.20 | (Mg,Ti,Fe,Al)2O(BO3) |
| ⓘ | Sinhalite | 6.AC.05 | MgAl(BO4) |
| ⓘ | Szaibélyite | 6.BA.15 | MgBO2(OH) |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Rozenite | 7.CB.15 | FeSO4 · 4H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| ⓘ | Fergusonite-(Y) | 7.GA.05 | YNbO4 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| Group 9 - Silicates | |||
| ⓘ | Chrysotile | 9.. | Mg3(Si2O5)(OH)4 |
| ⓘ | Andradite | 9.AD.25 | Ca3Fe3+2(SiO4)3 |
| ⓘ | Zircon var. Cyrtolite | 9.AD.30 | Zr[(SiO4),(OH)4] |
| ⓘ | Thorite var. Thorogummite | 9.AD.30 | (Th,U)(SiO4)1-x(OH)4x |
| ⓘ | 9.AD.30 | Th(SiO4) | |
| ⓘ | var. Uranothorite | 9.AD.30 | (Th,U)SiO4 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Chondrodite | 9.AF.45 | Mg5(SiO4)2F2 |
| ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Allanite-(Ce) | 9.BG.05b | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Augite | 9.DA.15 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Edenite | 9.DE.15 | NaCa2Mg5(Si7Al)O22(OH)2 |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Muscovite var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Chamosite | 9.EC.55 | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| ⓘ | Nepheline | 9.FA.05 | Na3K(Al4Si4O16) |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | var. Amazonite | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite var. Oligoclase | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ | var. Peristerite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | 9.FA.35 | Na(AlSi3O8) | |
| ⓘ | Meionite | 9.FB.15 | Ca4Al6Si6O24CO3 |
| ⓘ | Marialite | 9.FB.15 | Na4Al3Si9O24Cl |
| Unclassified | |||
| ⓘ | 'Pyroxene Group' | - | ADSi2O6 |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Pyrochlore Supergroup' | - | A2-mD2X6-wZ1-n |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Feldspar Group var. Sunstone' | - | |
| ⓘ | 'Serpentine Subgroup' | - | D3[Si2O5](OH)4 |
| ⓘ | 'Microperthite' | - | |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| ⓘ | 'Diopside-Hedenbergite Series' | - | |
| ⓘ | 'Clinopyroxene Subgroup' | - | |
| ⓘ | 'Scapolite' | - | |
| ⓘ | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
| ⓘ | 'Actinolite-Tremolite Series' | - | |
| ⓘ | 'Amphibole Supergroup' | - | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ | 'Bastnäsite' | - | (Ce/Nd/Y/REE)(CO3)F |
| ⓘ | 'Pyrochlore Supergroup var. Betafite (of Hogarth 1977)' | - | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| ⓘ | 'Mica Group' | - | |
| ⓘ | 'Feldspar Group var. Perthite' | - | |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chabazite' | - | |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Stilbite Subgroup' | - | M6-7[Al8-9Si27-28O72] · nH2O |
| ⓘ | 'Allanite Group' | - | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Aeschynite-(Y) | (Y,Ln,Ca,Th)(Ti,Nb)2(O,OH)6 |
| H | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| H | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| H | ⓘ Pyrochlore Supergroup var. Betafite (of Hogarth 1977) | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| H | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| H | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Goethite | α-Fe3+O(OH) |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Pyrochlore Group | A2Nb2(O,OH)6Z |
| H | ⓘ Rozenite | FeSO4 · 4H2O |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| H | ⓘ Szaibélyite | MgBO2(OH) |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Thorite var. Thorogummite | (Th,U)(SiO4)1-x(OH)4x |
| H | ⓘ Tochilinite | Fe2+5-6(Mg,Fe2+)5S6(OH)10 |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| H | ⓘ Zircon var. Cyrtolite | Zr[(SiO4),(OH)4] |
| H | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| H | ⓘ Hydroxycalciopyrochlore | (Ca,Na,U,◻)2(Nb,Ti)2O6(OH) |
| H | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Sinhalite | MgAl(BO4) |
| B | ⓘ Szaibélyite | MgBO2(OH) |
| B | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| B | ⓘ Warwickite | (Mg,Ti,Fe,Al)2O(BO3) |
| C | Carbon | |
| C | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Graphite | C |
| C | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ Aeschynite-(Y) | (Y,Ln,Ca,Th)(Ti,Nb)2(O,OH)6 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| O | ⓘ Microcline var. Amazonite | K(AlSi3O8) |
| O | ⓘ Quartz var. Amethyst | SiO2 |
| O | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| O | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| O | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| O | ⓘ Pyrochlore Supergroup var. Betafite (of Hogarth 1977) | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| O | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| O | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| O | ⓘ Corundum | Al2O3 |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| O | ⓘ Fergusonite-(Y) | YNbO4 |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Goethite | α-Fe3+O(OH) |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hollandite | Ba(Mn64+Mn23+)O16 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Marialite | Na4Al3Si9O24Cl |
| O | ⓘ Hematite var. Martite | Fe2O3 |
| O | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Nepheline | Na3K(Al4Si4O16) |
| O | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Pyrochlore Group | A2Nb2(O,OH)6Z |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Quartz var. Rose Quartz | SiO2 |
| O | ⓘ Rozenite | FeSO4 · 4H2O |
| O | ⓘ Samarskite-(Y) | YFe3+Nb2O8 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Sinhalite | MgAl(BO4) |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Spinel | MgAl2O4 |
| O | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| O | ⓘ Szaibélyite | MgBO2(OH) |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Thorianite | ThO2 |
| O | ⓘ Thorite | Th(SiO4) |
| O | ⓘ Thorite var. Thorogummite | (Th,U)(SiO4)1-x(OH)4x |
| O | ⓘ Titanite | CaTi(SiO4)O |
| O | ⓘ Tochilinite | Fe2+5-6(Mg,Fe2+)5S6(OH)10 |
| O | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| O | ⓘ Warwickite | (Mg,Ti,Fe,Al)2O(BO3) |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Albite var. Peristerite | Na(AlSi3O8) |
| O | ⓘ Zircon var. Cyrtolite | Zr[(SiO4),(OH)4] |
| O | ⓘ Calciosamarskite | (Ca,U4+)Fe3+(Nb,Ta,Ti)2O8 |
| O | ⓘ Thorite var. Uranothorite | (Th,U)SiO4 |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Pyroxene Group | ADSi2O6 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| O | ⓘ Hydroxycalciopyrochlore | (Ca,Na,U,◻)2(Nb,Ti)2O6(OH) |
| O | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| F | Fluorine | |
| F | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| F | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| F | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | ⓘ Fluorite var. Stink-Fluss | CaF2 |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Pyrochlore Supergroup var. Betafite (of Hogarth 1977) | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| Na | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Na | ⓘ Marialite | Na4Al3Si9O24Cl |
| Na | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| Na | ⓘ Nepheline | Na3K(Al4Si4O16) |
| Na | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Albite var. Peristerite | Na(AlSi3O8) |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Na | ⓘ Hydroxycalciopyrochlore | (Ca,Na,U,◻)2(Nb,Ti)2O6(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | ⓘ Sinhalite | MgAl(BO4) |
| Mg | ⓘ Spinel | MgAl2O4 |
| Mg | ⓘ Szaibélyite | MgBO2(OH) |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Tochilinite | Fe2+5-6(Mg,Fe2+)5S6(OH)10 |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Warwickite | (Mg,Ti,Fe,Al)2O(BO3) |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Microcline var. Amazonite | K(AlSi3O8) |
| Al | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| Al | ⓘ Corundum | Al2O3 |
| Al | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Marialite | Na4Al3Si9O24Cl |
| Al | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Nepheline | Na3K(Al4Si4O16) |
| Al | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Sinhalite | MgAl(BO4) |
| Al | ⓘ Spinel | MgAl2O4 |
| Al | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Al | ⓘ Warwickite | (Mg,Ti,Fe,Al)2O(BO3) |
| Al | ⓘ Albite var. Peristerite | Na(AlSi3O8) |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Microcline var. Amazonite | K(AlSi3O8) |
| Si | ⓘ Quartz var. Amethyst | SiO2 |
| Si | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Si | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Si | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| Si | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Marialite | Na4Al3Si9O24Cl |
| Si | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Nepheline | Na3K(Al4Si4O16) |
| Si | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Quartz var. Rose Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Thorite | Th(SiO4) |
| Si | ⓘ Thorite var. Thorogummite | (Th,U)(SiO4)1-x(OH)4x |
| Si | ⓘ Titanite | CaTi(SiO4)O |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Albite var. Peristerite | Na(AlSi3O8) |
| Si | ⓘ Zircon var. Cyrtolite | Zr[(SiO4),(OH)4] |
| Si | ⓘ Thorite var. Uranothorite | (Th,U)SiO4 |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Pyroxene Group | ADSi2O6 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| Si | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| P | Phosphorus | |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Galena | PbS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Rozenite | FeSO4 · 4H2O |
| S | ⓘ Tochilinite | Fe2+5-6(Mg,Fe2+)5S6(OH)10 |
| Cl | Chlorine | |
| Cl | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Cl | ⓘ Marialite | Na4Al3Si9O24Cl |
| Cl | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| Cl | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ Microcline var. Amazonite | K(AlSi3O8) |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Nepheline | Na3K(Al4Si4O16) |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Aeschynite-(Y) | (Y,Ln,Ca,Th)(Ti,Nb)2(O,OH)6 |
| Ca | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Ca | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Ca | ⓘ Pyrochlore Supergroup var. Betafite (of Hogarth 1977) | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| Ca | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Titanite | CaTi(SiO4)O |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| Ca | ⓘ Calciosamarskite | (Ca,U4+)Fe3+(Nb,Ta,Ti)2O8 |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ca | ⓘ Fluorite var. Stink-Fluss | CaF2 |
| Ca | ⓘ Hydroxycalciopyrochlore | (Ca,Na,U,◻)2(Nb,Ti)2O6(OH) |
| Ti | Titanium | |
| Ti | ⓘ Aeschynite-(Y) | (Y,Ln,Ca,Th)(Ti,Nb)2(O,OH)6 |
| Ti | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Pyrochlore Supergroup var. Betafite (of Hogarth 1977) | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Titanite | CaTi(SiO4)O |
| Ti | ⓘ Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| Ti | ⓘ Warwickite | (Mg,Ti,Fe,Al)2O(BO3) |
| Ti | ⓘ Calciosamarskite | (Ca,U4+)Fe3+(Nb,Ta,Ti)2O8 |
| Ti | ⓘ Hydroxycalciopyrochlore | (Ca,Na,U,◻)2(Nb,Ti)2O6(OH) |
| Mn | Manganese | |
| Mn | ⓘ Hollandite | Ba(Mn64+Mn23+)O16 |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Fe | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Goethite | α-Fe3+O(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Hematite var. Martite | Fe2O3 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Rozenite | FeSO4 · 4H2O |
| Fe | ⓘ Samarskite-(Y) | YFe3+Nb2O8 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Tochilinite | Fe2+5-6(Mg,Fe2+)5S6(OH)10 |
| Fe | ⓘ Warwickite | (Mg,Ti,Fe,Al)2O(BO3) |
| Fe | ⓘ Calciosamarskite | (Ca,U4+)Fe3+(Nb,Ta,Ti)2O8 |
| Cu | Copper | |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Y | Yttrium | |
| Y | ⓘ Aeschynite-(Y) | (Y,Ln,Ca,Th)(Ti,Nb)2(O,OH)6 |
| Y | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| Y | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Y | ⓘ Fergusonite-(Y) | YNbO4 |
| Y | ⓘ Samarskite-(Y) | YFe3+Nb2O8 |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Zr | ⓘ Zircon var. Cyrtolite | Zr[(SiO4),(OH)4] |
| Nb | Niobium | |
| Nb | ⓘ Aeschynite-(Y) | (Y,Ln,Ca,Th)(Ti,Nb)2(O,OH)6 |
| Nb | ⓘ Pyrochlore Supergroup var. Betafite (of Hogarth 1977) | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| Nb | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Nb | ⓘ Fergusonite-(Y) | YNbO4 |
| Nb | ⓘ Pyrochlore Group | A2Nb2(O,OH)6Z |
| Nb | ⓘ Samarskite-(Y) | YFe3+Nb2O8 |
| Nb | ⓘ Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| Nb | ⓘ Calciosamarskite | (Ca,U4+)Fe3+(Nb,Ta,Ti)2O8 |
| Nb | ⓘ Hydroxycalciopyrochlore | (Ca,Na,U,◻)2(Nb,Ti)2O6(OH) |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Ba | Barium | |
| Ba | ⓘ Hollandite | Ba(Mn64+Mn23+)O16 |
| Ce | Cerium | |
| Ce | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ce | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| Ce | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Ce | ⓘ Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| Nd | Neodymium | |
| Nd | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| Ta | Tantalum | |
| Ta | ⓘ Pyrochlore Supergroup var. Betafite (of Hogarth 1977) | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| Ta | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Ta | ⓘ Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| Ta | ⓘ Calciosamarskite | (Ca,U4+)Fe3+(Nb,Ta,Ti)2O8 |
| W | Tungsten | |
| W | ⓘ Scheelite | Ca(WO4) |
| Pb | Lead | |
| Pb | ⓘ Galena | PbS |
| Th | Thorium | |
| Th | ⓘ Aeschynite-(Y) | (Y,Ln,Ca,Th)(Ti,Nb)2(O,OH)6 |
| Th | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Th | ⓘ Thorianite | ThO2 |
| Th | ⓘ Thorite | Th(SiO4) |
| Th | ⓘ Thorite var. Thorogummite | (Th,U)(SiO4)1-x(OH)4x |
| Th | ⓘ Thorite var. Uranothorite | (Th,U)SiO4 |
| U | Uranium | |
| U | ⓘ Pyrochlore Supergroup var. Betafite (of Hogarth 1977) | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| U | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| U | ⓘ Thorite var. Thorogummite | (Th,U)(SiO4)1-x(OH)4x |
| U | ⓘ Uraninite | UO2 |
| U | ⓘ Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| U | ⓘ Calciosamarskite | (Ca,U4+)Fe3+(Nb,Ta,Ti)2O8 |
| U | ⓘ Thorite var. Uranothorite | (Th,U)SiO4 |
| U | ⓘ Hydroxycalciopyrochlore | (Ca,Na,U,◻)2(Nb,Ti)2O6(OH) |
Localities in this Region
- Ontario
- Hastings County
- Hastings Highlands Municipality
- Hastings County
- Ontario
- Hastings County
- Hastings Highlands Municipality
- Monteagle Township
- Hybla Road roadcut
- John Hawley farm
- MacDonald Mine
- Maple Leaf
- Max Miller workings
- McCormack Mine (North and South)
- Monteagle Valley occurrence
- Musclow Greenview Road roadcuts
- National Graphite Mine
- Normingo deposit
- Plunkett Mine
- Quirk showing
- Reeves Mine
- S.J. Carr occurrence
- Taylor Mine
- Thompson Mine
- Watson Mine
- Welsh Corundum mine
- Welsh Farm
- Woodcox Mine
- Monteagle Township
- Hastings Highlands Municipality
- Hastings County
Other Regions, Features and Areas containing this locality
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
MacDonald Mine, Monteagle Township, Hastings Highlands Municipality, Hastings County, Ontario, Canada