Tittling, Passau District, Lower Bavaria, Bavaria, Germanyi
| Regional Level Types | |
|---|---|
| Tittling | Municipality |
| Passau District | District |
| Lower Bavaria | Administrative Region |
| Bavaria | State |
| Germany | Country |
This page is currently not sponsored. Click here to sponsor this page.
Neighbouring regions:
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Tittling | 3,800 (2013) |
Mindat Locality ID:
98684
Long-form identifier:
mindat:1:2:98684:6
GUID (UUID V4):
44534e86-f82d-4694-b7c8-148df6b3fa66
Other Languages:
French:
Tittling, arrondissement de Passau, Basse-Bavière, Bavière, Allemagne
German:
Tittling, Landkreis Passau, Niederbayern, Bayern, Deutschland
Italian:
Tittling, circondario di Passavia, Bassa Baviera, Baviera, Germania
Russian:
Титлинг, Пассау, Нижняя Бавария, Бавария, Германия
Simplified Chinese:
蒂特灵, 帕绍县, 下巴伐利亚行政区, 巴伐利亚, 德国
Spanish:
Tittling, Passau, Niederbayern, Baviera, Alemania
Arabic:
تيتلينغ, منطقة باساو, بافاريا السفلى, بافاريا, ألمانيا
Armenian:
Թիթլինգ, Պասաու, Ստորին Բավարիա, Բավարիա, Գերմանիա
Basque:
Tittling, Bavaria Beherea, Bavaria, Alemania
Cebuano:
Tittling , Landkreis Passau, Lower Bavaria, Bavaria, Alemanya
Dutch:
Tittling, Landkreis Passau, Niederbayern, Beieren, Duitsland
Esperanto:
Tittling, Distrikto Passau, Malsupra Bavario, Bavario, Germanio
Farsi/Persian:
تیتلینگ, پاسساو , باواریای سفلی, بایرن, آلمان
Finnish:
Tittling, Passaun piirikunta, Ala-Baijeri, Baijeri, Saksa
Hungarian:
Tittling, Passau járás, Alsó-Bajorország, Bajorország, Németország
Indonesian:
Tittling, Passau, Bayern, Jerman
Japanese:
ティットリング, パッサウ郡, ニーダーバイエルン県, バイエルン州, ドイツ
Kazakh (Cyrillic Script):
Титлинг, Пассау, Бавария, Германия
Kyrgyz:
Титлинг, Бавария, Германия
Lombard:
Tittling, Passau, Basa Baviera, Baviera, Germania
Malay:
Tittling, Passau, Bavaria, Jerman
Minnan / Hokkien-Taiwanese:
Tittling, Bayern, Tek-kok
Norwegian (Nynorsk):
Tittling, Bayern, Tyskland
Polish:
Tittling, Powiat Pasawa, Dolna Bawaria, Bawaria, Niemcy
Romanian:
Tittling, Passau, Niederbayern, Bavaria, Germania
Serbian:
Титлинг, Доња Баварска, Баварска, Њемачка
Serbo-Croatian:
Tittling, Donja Bavarska, Bavarska, Njemačka
Traditional Chinese:
蒂特林格, 拜仁, 德國
Ukrainian:
Тіттлінг, Пассау, Нижня Баварія, Баварія, Німеччина
Uzbek (Latin Script):
Tittling, Passau, Bavariya, Germaniya
Vietnamese:
Tittling, Passau, Hạ Bayern, Bayern, Đức
Volapük:
Tittling, Bayän, Deutän
Waray:
Tittling, Passau, Bayern, Alemanya
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities49 valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Albite Formula: Na(AlSi3O8) Localities: |
| ⓘ 'Allanite Group' Formula: (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) Localities: |
| ⓘ Anatase Formula: TiO2 Localities: |
| ⓘ Babingtonite Formula: Ca2(Fe,Mn)FeSi5O14(OH) |
| ⓘ Baryte Formula: BaSO4 |
| ⓘ Bavenite Formula: Ca4Be2Al2Si9O26(OH)2 Localities: |
| ⓘ Bertrandite Formula: Be4(Si2O7)(OH)2 Localities: |
| ⓘ Beryl Formula: Be3Al2(Si6O18) Localities: Granodiorite quarries (incl. Kusser Quarry), Hötzendorf, Tittling, Passau District, Lower Bavaria, Bavaria, Germany Schloßberg Quarry, Hohenwart, Tittling, Passau District, Lower Bavaria, Bavaria, Germany Kerber Quarry, Matzersdorf, Tittling, Passau District, Lower Bavaria, Bavaria, Germany Krenn Quarry, Matzersdorf, Tittling, Passau District, Lower Bavaria, Bavaria, Germany |
| ⓘ Beryl var. Aquamarine Formula: Be3Al2Si6O18 |
| ⓘ Bityite Formula: CaLiAl2(AlBeSi2O10)(OH)2 Localities: |
| ⓘ Calcite Formula: CaCO3 |
| ⓘ Cerussite Formula: PbCO3 |
| ⓘ 'Chabazite' Localities: |
| ⓘ Chalcopyrite Formula: CuFeS2 |
| ⓘ 'Chlorite Group' |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ Cuprite Formula: Cu2O |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) Localities: |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F |
| ⓘ Fluorapophyllite-(K) Formula: KCa4(Si8O20)(F,OH) · 8H2O |
| ⓘ Fluorite Formula: CaF2 Localities: |
| ⓘ Galena Formula: PbS |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 Localities: |
| ⓘ Goethite Formula: α-Fe3+O(OH) |
| ⓘ Helvine Formula: Be3Mn2+4(SiO4)3S Localities: |
| ⓘ Hematite Formula: Fe2O3 Localities: |
| ⓘ 'Heulandite Subgroup' Formula: (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| ⓘ Ilmenite Formula: Fe2+TiO3 Localities: |
| ⓘ Laumontite Formula: CaAl2Si4O12 · 4H2O |
| ⓘ 'Limonite' |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 Localities: |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 |
| ⓘ Milarite Formula: K(◻H2O)Ca2(Be2Al)[Si12O30] Localities: |
| ⓘ 'Minasgeraisite-(Y)' ? Formula: (Ca2Y2)◻2(Be2B2)[SiO4]4(OH)4 Description: Insufficient evidence: only PXRD and EDS analyses. |
| ⓘ Molybdenite Formula: MoS2 Localities: |
| ⓘ 'Monazite' Formula: REE(PO4) Localities: |
| ⓘ Moraesite Formula: Be2(PO4)(OH) · 4H2O |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Orthoclase Formula: K(AlSi3O8) Localities: |
| ⓘ Piemontite Formula: (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) Localities: |
| ⓘ Pottsite Formula: (Pb3xBi4-2x)(VO4)4 · H2O (0.8 < x < 1.0) Habit: 0,1mm large crystals as powdery crust Colour: brownish yellow |
| ⓘ Powellite Formula: Ca(MoO4) |
| ⓘ Prehnite Formula: Ca2Al2Si3O10(OH)2 |
| ⓘ 'Psilomelane' |
| ⓘ 'Pumpellyite-(Fe)' |
| ⓘ Pumpellyite-(Mg) Formula: Ca2MgAl2(Si2O7)(SiO4)(OH)2 · H2O |
| ⓘ 'Pumpellyite Subgroup' Formula: Ca2XAl2[Si2O6(OH)][SiO4](OH)2A Localities: |
| ⓘ Pyrite Formula: FeS2 Localities: |
| ⓘ 'Pyrochlore Group' Formula: A2Nb2(O,OH)6Z |
| ⓘ 'Pyrochlore Supergroup' ? Formula: A2-mD2X6-wZ1-n |
| ⓘ Pyrrhotite Formula: Fe1-xS |
| ⓘ Quartz Formula: SiO2 Localities: |
| ⓘ Quartz var. Rock Crystal Formula: SiO2 |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 |
| ⓘ Rutile Formula: TiO2 |
| ⓘ Samarskite-(Y) Formula: YFe3+Nb2O8 Localities: |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ 'Smectite Group' Formula: A0.3D2-3[T4O10]Z2 · nH2O |
| ⓘ Sphalerite Formula: ZnS |
| ⓘ 'Stilbite Subgroup' Formula: M6-7[Al8-9Si27-28O72] · nH2O Localities: |
| ⓘ Sulphur Formula: S8 |
| ⓘ Titanite Formula: CaTi(SiO4)O Localities: |
| ⓘ 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z |
| ⓘ Uralolite Formula: Ca2Be4(PO4)3(OH)3 · 5H2O |
| ⓘ Uricite Formula: C5H4N4O3 |
| ⓘ Vesuvianite Formula: Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ 'Yttrobetafite (of Hogarth 1977)' ? Formula: A2-mD2X6-wZ1-n |
| ⓘ Zircon Formula: Zr(SiO4) Localities: |
| ⓘ Zoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Sulphur | 1.CC.05 | S8 |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | 'Yttrobetafite (of Hogarth 1977)' ? | 4.. | A2-mD2X6-wZ1-n |
| ⓘ | Goethite | 4.00. | α-Fe3+O(OH) |
| ⓘ | 'Pyrochlore Group' | 4.00. | A2Nb2(O,OH)6Z |
| ⓘ | Cuprite | 4.AA.10 | Cu2O |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Rock Crystal | 4.DA.05 | SiO2 |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Samarskite-(Y) | 4.DB.25 | YFe3+Nb2O8 |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Powellite | 7.GA.05 | Ca(MoO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Pottsite | 8.CG.25 | (Pb3xBi4-2x)(VO4)4 · H2O (0.8 < x < 1.0) |
| ⓘ | Moraesite | 8.DA.05 | Be2(PO4)(OH) · 4H2O |
| ⓘ | Uralolite | 8.DA.15 | Ca2Be4(PO4)3(OH)3 · 5H2O |
| Group 9 - Silicates | |||
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
| ⓘ | 'Minasgeraisite-(Y)' ? | 9.AJ.20 | (Ca2Y2)◻2(Be2B2)[SiO4]4(OH)4 |
| ⓘ | Bertrandite | 9.BD.05 | Be4(Si2O7)(OH)2 |
| ⓘ | Piemontite | 9.BG.05a | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Zoisite | 9.BG.10 | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Pumpellyite-(Mg) | 9.BG.20 | Ca2MgAl2(Si2O7)(SiO4)(OH)2 · H2O |
| ⓘ | Vesuvianite | 9.BG.35 | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ | Beryl var. Aquamarine | 9.CJ.05 | Be3Al2Si6O18 |
| ⓘ | 9.CJ.05 | Be3Al2(Si6O18) | |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Milarite | 9.CM.05 | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| ⓘ | Bavenite | 9.DF.25 | Ca4Be2Al2Si9O26(OH)2 |
| ⓘ | Babingtonite | 9.DK.05 | Ca2(Fe,Mn)FeSi5O14(OH) |
| ⓘ | Prehnite | 9.DP.20 | Ca2Al2Si3O10(OH)2 |
| ⓘ | Fluorapophyllite-(K) | 9.EA.15 | KCa4(Si8O20)(F,OH) · 8H2O |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Bityite | 9.EC.35 | CaLiAl2(AlBeSi2O10)(OH)2 |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Helvine | 9.FB.10 | Be3Mn2+4(SiO4)3S |
| ⓘ | Laumontite | 9.GB.10 | CaAl2Si4O12 · 4H2O |
| Group 10 - Organic Compounds | |||
| ⓘ | Uricite | 10.CA.40 | C5H4N4O3 |
| Unclassified | |||
| ⓘ | 'Pumpellyite Subgroup' | - | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| ⓘ | 'Pyrochlore Supergroup' ? | - | A2-mD2X6-wZ1-n |
| ⓘ | 'Smectite Group' | - | A0.3D2-3[T4O10]Z2 · nH2O |
| ⓘ | 'Pumpellyite-(Fe)' | - | |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Chabazite' | - | |
| ⓘ | 'Heulandite Subgroup' | - | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Stilbite Subgroup' | - | M6-7[Al8-9Si27-28O72] · nH2O |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
| ⓘ | 'Monazite' | - | REE(PO4) |
| ⓘ | 'Psilomelane' | - | |
| ⓘ | 'Allanite Group' | - | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Babingtonite | Ca2(Fe,Mn)FeSi5O14(OH) |
| H | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| H | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| H | ⓘ Bityite | CaLiAl2(AlBeSi2O10)(OH)2 |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| H | ⓘ Goethite | α-Fe3+O(OH) |
| H | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| H | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| H | ⓘ Minasgeraisite-(Y) | (Ca2Y2)◻2(Be2B2)[SiO4]4(OH)4 |
| H | ⓘ Moraesite | Be2(PO4)(OH) · 4H2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Pottsite | (Pb3xBi4-2x)(VO4)4 · H2O (0.8 < x < 1.0) |
| H | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| H | ⓘ Pumpellyite Subgroup | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| H | ⓘ Pumpellyite-(Mg) | Ca2MgAl2(Si2O7)(SiO4)(OH)2 · H2O |
| H | ⓘ Pyrochlore Group | A2Nb2(O,OH)6Z |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| H | ⓘ Uralolite | Ca2Be4(PO4)3(OH)3 · 5H2O |
| H | ⓘ Uricite | C5H4N4O3 |
| H | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| H | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Smectite Group | A0.3D2-3[T4O10]Z2 · nH2O |
| H | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| Li | Lithium | |
| Li | ⓘ Bityite | CaLiAl2(AlBeSi2O10)(OH)2 |
| Be | Beryllium | |
| Be | ⓘ Beryl var. Aquamarine | Be3Al2Si6O18 |
| Be | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| Be | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| Be | ⓘ Bityite | CaLiAl2(AlBeSi2O10)(OH)2 |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| Be | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| Be | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| Be | ⓘ Minasgeraisite-(Y) | (Ca2Y2)◻2(Be2B2)[SiO4]4(OH)4 |
| Be | ⓘ Moraesite | Be2(PO4)(OH) · 4H2O |
| Be | ⓘ Uralolite | Ca2Be4(PO4)3(OH)3 · 5H2O |
| B | Boron | |
| B | ⓘ Minasgeraisite-(Y) | (Ca2Y2)◻2(Be2B2)[SiO4]4(OH)4 |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Uricite | C5H4N4O3 |
| N | Nitrogen | |
| N | ⓘ Uricite | C5H4N4O3 |
| O | Oxygen | |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Beryl var. Aquamarine | Be3Al2Si6O18 |
| O | ⓘ Babingtonite | Ca2(Fe,Mn)FeSi5O14(OH) |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| O | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| O | ⓘ Bityite | CaLiAl2(AlBeSi2O10)(OH)2 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| O | ⓘ Goethite | α-Fe3+O(OH) |
| O | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| O | ⓘ Minasgeraisite-(Y) | (Ca2Y2)◻2(Be2B2)[SiO4]4(OH)4 |
| O | ⓘ Monazite | REE(PO4) |
| O | ⓘ Moraesite | Be2(PO4)(OH) · 4H2O |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Pottsite | (Pb3xBi4-2x)(VO4)4 · H2O (0.8 < x < 1.0) |
| O | ⓘ Powellite | Ca(MoO4) |
| O | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| O | ⓘ Pumpellyite Subgroup | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| O | ⓘ Pumpellyite-(Mg) | Ca2MgAl2(Si2O7)(SiO4)(OH)2 · H2O |
| O | ⓘ Pyrochlore Group | A2Nb2(O,OH)6Z |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Samarskite-(Y) | YFe3+Nb2O8 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| O | ⓘ Titanite | CaTi(SiO4)O |
| O | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | ⓘ Uralolite | Ca2Be4(PO4)3(OH)3 · 5H2O |
| O | ⓘ Uricite | C5H4N4O3 |
| O | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Quartz var. Rock Crystal | SiO2 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Smectite Group | A0.3D2-3[T4O10]Z2 · nH2O |
| O | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| F | Fluorine | |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| F | ⓘ Fluorite | CaF2 |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Pumpellyite-(Mg) | Ca2MgAl2(Si2O7)(SiO4)(OH)2 · H2O |
| Mg | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Beryl var. Aquamarine | Be3Al2Si6O18 |
| Al | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| Al | ⓘ Bityite | CaLiAl2(AlBeSi2O10)(OH)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Al | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Al | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Al | ⓘ Pumpellyite Subgroup | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| Al | ⓘ Pumpellyite-(Mg) | Ca2MgAl2(Si2O7)(SiO4)(OH)2 · H2O |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Al | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Beryl var. Aquamarine | Be3Al2Si6O18 |
| Si | ⓘ Babingtonite | Ca2(Fe,Mn)FeSi5O14(OH) |
| Si | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| Si | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| Si | ⓘ Bityite | CaLiAl2(AlBeSi2O10)(OH)2 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| Si | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| Si | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Si | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Si | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| Si | ⓘ Minasgeraisite-(Y) | (Ca2Y2)◻2(Be2B2)[SiO4]4(OH)4 |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Si | ⓘ Pumpellyite Subgroup | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| Si | ⓘ Pumpellyite-(Mg) | Ca2MgAl2(Si2O7)(SiO4)(OH)2 · H2O |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Si | ⓘ Titanite | CaTi(SiO4)O |
| Si | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Quartz var. Rock Crystal | SiO2 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| P | Phosphorus | |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Monazite | REE(PO4) |
| P | ⓘ Moraesite | Be2(PO4)(OH) · 4H2O |
| P | ⓘ Uralolite | Ca2Be4(PO4)3(OH)3 · 5H2O |
| S | Sulfur | |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Galena | PbS |
| S | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Sulphur | S8 |
| K | Potassium | |
| K | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| K | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| K | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| Ca | Calcium | |
| Ca | ⓘ Babingtonite | Ca2(Fe,Mn)FeSi5O14(OH) |
| Ca | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| Ca | ⓘ Bityite | CaLiAl2(AlBeSi2O10)(OH)2 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Ca | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Ca | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| Ca | ⓘ Minasgeraisite-(Y) | (Ca2Y2)◻2(Be2B2)[SiO4]4(OH)4 |
| Ca | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Powellite | Ca(MoO4) |
| Ca | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Ca | ⓘ Pumpellyite Subgroup | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| Ca | ⓘ Pumpellyite-(Mg) | Ca2MgAl2(Si2O7)(SiO4)(OH)2 · H2O |
| Ca | ⓘ Titanite | CaTi(SiO4)O |
| Ca | ⓘ Uralolite | Ca2Be4(PO4)3(OH)3 · 5H2O |
| Ca | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Ca | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ti | Titanium | |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTi(SiO4)O |
| V | Vanadium | |
| V | ⓘ Pottsite | (Pb3xBi4-2x)(VO4)4 · H2O (0.8 < x < 1.0) |
| Mn | Manganese | |
| Mn | ⓘ Babingtonite | Ca2(Fe,Mn)FeSi5O14(OH) |
| Mn | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| Mn | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Fe | Iron | |
| Fe | ⓘ Babingtonite | Ca2(Fe,Mn)FeSi5O14(OH) |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Goethite | α-Fe3+O(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Samarskite-(Y) | YFe3+Nb2O8 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Cu | Copper | |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Zn | Zinc | |
| Zn | ⓘ Sphalerite | ZnS |
| Y | Yttrium | |
| Y | ⓘ Minasgeraisite-(Y) | (Ca2Y2)◻2(Be2B2)[SiO4]4(OH)4 |
| Y | ⓘ Samarskite-(Y) | YFe3+Nb2O8 |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | ⓘ Pyrochlore Group | A2Nb2(O,OH)6Z |
| Nb | ⓘ Samarskite-(Y) | YFe3+Nb2O8 |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Mo | ⓘ Powellite | Ca(MoO4) |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Pb | Lead | |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Pottsite | (Pb3xBi4-2x)(VO4)4 · H2O (0.8 < x < 1.0) |
| Bi | Bismuth | |
| Bi | ⓘ Pottsite | (Pb3xBi4-2x)(VO4)4 · H2O (0.8 < x < 1.0) |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Tittling |
|---|---|
| Wikidata ID: | Q517967 |
| GeoNames ID: | 2822076 |
Localities in this Region
- Bavaria
- Lower Bavaria
- Passau District
- Lower Bavaria
Other Regions, Features and Areas that Intersect
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
