Gondomar, Porto, Portugali
| Regional Level Types | |
|---|---|
| Gondomar | Municipality |
| Porto | District |
| Portugal | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Rio Tinto | 49,966 (2018) |
| Gondomar | 27,691 (2018) |
| Fânzeres | 23,916 (2018) |
| São Pedro da Cova | 17,011 (2018) |
| Baguim do Monte | 15,850 (2018) |
| Valbom | 14,443 (2018) |
Museums in region:
Mindat Locality ID:
47079
Long-form identifier:
mindat:1:2:47079:8
GUID (UUID V4):
4d930c90-ec58-42ec-bcaa-613ae8893b46
Other Languages:
French:
Gondomar, Porto, Portugal
German:
Gondomar, Distrikt Porto, Portugal
Italian:
Gondomar, distretto di Porto, Portogallo
Portuguese:
Gondomar, Porto, Portugal
Russian:
Гондомар, Порту, Португалия
Simplified Chinese:
贡多马尔, 波爾圖區, 葡萄牙
Spanish:
Gondomar, Distrito de Oporto, Portugal
Arabic:
جوندومار, بورتو, البرتغال
Armenian:
Գոնդոմար
Asturian:
Gondomar, Distritu de Porto
Basque:
Gondomar, Porto
Belarusian (Tarashkevitsa):
Гандумар
Breton:
Gondomar, Distrig Porto
Catalan:
Gondomar, districte de Porto, Portugal
Cebuano:
Gondomar, Distrito do Porto
Danish:
Gondomar, Portugal
Dutch:
Gondomar, Porto, Portugal
Esperanto:
Gondomar, distrikto Porto
Farsi/Persian:
گوندومار, پرتغال
Finnish:
Gondomar, Porton piiri, Portugali
Galician:
Gondomar, Distrito do Porto, Portugal
Georgian:
გონდომარი
Greek:
Γκοντομάρ, Πορτογαλία
Korean:
곤도마르, 포르투, 포르투갈
Latin:
Gundemarus, Portus Cale
Mazanderani:
گوندومار
Minnan / Hokkien-Taiwanese:
Gondomar, Porto Koān
Polish:
Gondomar, Portugalia
Romanian:
Gondomar, Districtul Porto, Portugalia
Swedish:
Gondomar, Porto, Portugal
Turkish:
Gondomar, Portekiz
Ukrainian:
Гондомар, Порту, Португалія
Vietnamese:
Gondomar, Porto, Bồ Đào Nha
Volapük:
Gondomar
Waray:
Gondomar, Porto
Municipality of Porto district.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities29 valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Antimony Formula: Sb |
| ⓘ Arsenopyrite Formula: FeAsS |
| ⓘ Berthierite Formula: FeSb2S4 |
| ⓘ Cervantite Formula: Sb3+Sb5+O4 |
| ⓘ Coquandite Formula: Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) |
| ⓘ Dolomite Formula: CaMg(CO3)2 |
| ⓘ Fülöppite Formula: Pb3Sb8S15 |
| ⓘ Galena Formula: PbS |
| ⓘ Goethite Formula: α-Fe3+O(OH) |
| ⓘ Gold Formula: Au Localities: Reported from at least 7 localities in this region. Description: Minerais de Portugal Continental, Elementos Nativos, Amílcar Mário de Jesus, Lisboa 1928. |
| ⓘ Gold var. Electrum Formula: (Au,Ag) |
| ⓘ Heteromorphite Formula: Pb7Sb8S19 |
| ⓘ Jamesonite Formula: Pb4FeSb6S14 |
| ⓘ Kermesite Formula: Sb2S2O |
| ⓘ Klebelsbergite Formula: Sb4O4(SO4)(OH)2 |
| ⓘ Kyanite Formula: Al2(SiO4)O |
| ⓘ Metastibnite Formula: Sb2S3 |
| ⓘ 'Psilomelane' |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 7 localities in this region. |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 10 localities in this region. |
| ⓘ Salammoniac Formula: NH4Cl |
| ⓘ Senarmontite Formula: Sb2O3 |
| ⓘ Siderite Formula: FeCO3 |
| ⓘ Silver Formula: Ag |
| ⓘ Sphalerite Formula: ZnS |
| ⓘ Staurolite Formula: Fe2+2Al9Si4O23(OH) Locality: Fânzeres, Gondomar, Porto, Portugal |
| ⓘ 'Stibiconite' Formula: Sb3+Sb5+2O6(OH) |
| ⓘ Stibnite Formula: Sb2S3 Localities: Reported from at least 10 localities in this region. |
| ⓘ Sulphur Formula: S8 Localities: References: |
| ⓘ Tetrahedrite-(Fe) Formula: Cu6(Cu4Fe2+2)Sb4S12S |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S |
| ⓘ Tripuhyite Formula: Fe3+Sb5+O4 |
| ⓘ Valentinite Formula: Sb2O3 |
| ⓘ 'Wolframite Group' |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Antimony | 1.CA.05 | Sb |
| ⓘ | Gold | 1.AA.05 | Au |
| ⓘ | var. Electrum | 1.AA.05 | (Au,Ag) |
| ⓘ | Silver | 1.AA.05 | Ag |
| ⓘ | Sulphur | 1.CC.05 | S8 |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Berthierite | 2.HA.20 | FeSb2S4 |
| ⓘ | Fülöppite | 2.HC.10a | Pb3Sb8S15 |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Heteromorphite | 2.HC.10c | Pb7Sb8S19 |
| ⓘ | Jamesonite | 2.HB.15 | Pb4FeSb6S14 |
| ⓘ | Kermesite | 2.FD.05 | Sb2S2O |
| ⓘ | Metastibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Stibnite | 2.DB.05 | Sb2S3 |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | Tetrahedrite-(Fe) | 2.GB.05 | Cu6(Cu4Fe2+2)Sb4S12S |
| Group 3 - Halides | |||
| ⓘ | Salammoniac | 3.AA.25 | NH4Cl |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Cervantite | 4.DE.30 | Sb3+Sb5+O4 |
| ⓘ | Goethite | 4.00. | α-Fe3+O(OH) |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Senarmontite | 4.CB.50 | Sb2O3 |
| ⓘ | 'Stibiconite' | 4.DH.20 | Sb3+Sb5+2O6(OH) |
| ⓘ | Tripuhyite | 4.DB.05 | Fe3+Sb5+O4 |
| ⓘ | Valentinite | 4.CB.55 | Sb2O3 |
| ⓘ | 'Wolframite Group' | 4.DB.30 va | |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Coquandite | 7.DE.35 | Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) |
| ⓘ | Klebelsbergite | 7.BB.35 | Sb4O4(SO4)(OH)2 |
| Group 9 - Silicates | |||
| ⓘ | Kyanite | 9.AF.15 | Al2(SiO4)O |
| ⓘ | Staurolite | 9.AF.30 | Fe2+2Al9Si4O23(OH) |
| Unclassified Minerals, Rocks, etc. | |||
| ⓘ | 'Psilomelane' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Coquandite | Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) |
| H | ⓘ Klebelsbergite | Sb4O4(SO4)(OH)2 |
| H | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| H | ⓘ Salammoniac | NH4Cl |
| H | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| H | ⓘ Goethite | α-Fe3+O(OH) |
| C | Carbon | |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Siderite | FeCO3 |
| N | Nitrogen | |
| N | ⓘ Salammoniac | NH4Cl |
| O | Oxygen | |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Kermesite | Sb2S2O |
| O | ⓘ Cervantite | Sb3+Sb5+O4 |
| O | ⓘ Coquandite | Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) |
| O | ⓘ Klebelsbergite | Sb4O4(SO4)(OH)2 |
| O | ⓘ Senarmontite | Sb2O3 |
| O | ⓘ Valentinite | Sb2O3 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| O | ⓘ Kyanite | Al2(SiO4)O |
| O | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| O | ⓘ Tripuhyite | Fe3+Sb5+O4 |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Goethite | α-Fe3+O(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Al | Aluminium | |
| Al | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Al | ⓘ Kyanite | Al2(SiO4)O |
| Si | Silicon | |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Si | ⓘ Kyanite | Al2(SiO4)O |
| S | Sulfur | |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Kermesite | Sb2S2O |
| S | ⓘ Jamesonite | Pb4FeSb6S14 |
| S | ⓘ Berthierite | FeSb2S4 |
| S | ⓘ Coquandite | Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) |
| S | ⓘ Klebelsbergite | Sb4O4(SO4)(OH)2 |
| S | ⓘ Metastibnite | Sb2S3 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Sulphur | S8 |
| S | ⓘ Heteromorphite | Pb7Sb8S19 |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Galena | PbS |
| S | ⓘ Fülöppite | Pb3Sb8S15 |
| S | ⓘ Tetrahedrite-(Fe) | Cu6(Cu4Fe22+)Sb4S12S |
| Cl | Chlorine | |
| Cl | ⓘ Salammoniac | NH4Cl |
| Ca | Calcium | |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Fe | Iron | |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Jamesonite | Pb4FeSb6S14 |
| Fe | ⓘ Berthierite | FeSb2S4 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Fe | ⓘ Tetrahedrite-(Fe) | Cu6(Cu4Fe22+)Sb4S12S |
| Fe | ⓘ Tripuhyite | Fe3+Sb5+O4 |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Goethite | α-Fe3+O(OH) |
| Cu | Copper | |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | ⓘ Tetrahedrite-(Fe) | Cu6(Cu4Fe22+)Sb4S12S |
| Zn | Zinc | |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| Ag | Silver | |
| Ag | ⓘ Silver | Ag |
| Ag | ⓘ Gold var. Electrum | (Au,Ag) |
| Sb | Antimony | |
| Sb | ⓘ Stibnite | Sb2S3 |
| Sb | ⓘ Kermesite | Sb2S2O |
| Sb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Sb | ⓘ Berthierite | FeSb2S4 |
| Sb | ⓘ Cervantite | Sb3+Sb5+O4 |
| Sb | ⓘ Coquandite | Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) |
| Sb | ⓘ Klebelsbergite | Sb4O4(SO4)(OH)2 |
| Sb | ⓘ Metastibnite | Sb2S3 |
| Sb | ⓘ Senarmontite | Sb2O3 |
| Sb | ⓘ Valentinite | Sb2O3 |
| Sb | ⓘ Antimony | Sb |
| Sb | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| Sb | ⓘ Heteromorphite | Pb7Sb8S19 |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Sb | ⓘ Fülöppite | Pb3Sb8S15 |
| Sb | ⓘ Tetrahedrite-(Fe) | Cu6(Cu4Fe22+)Sb4S12S |
| Sb | ⓘ Tripuhyite | Fe3+Sb5+O4 |
| Au | Gold | |
| Au | ⓘ Gold | Au |
| Au | ⓘ Gold var. Electrum | (Au,Ag) |
| Pb | Lead | |
| Pb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Pb | ⓘ Heteromorphite | Pb7Sb8S19 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Fülöppite | Pb3Sb8S15 |
Fossils
There are 1 fossil localities from the PaleoBioDB database within this region.BETA TEST - These data are provided on an experimental basis and are taken from external databases. Mindat.org has no control currently over the accuracy of these data.
| Occurrences | 4 |
|---|---|
| Youngest Fossil Listed | 301 Ma (Carboniferous) |
| Oldest Fossil Listed | 303 Ma (Carboniferous) |
| Fossils from Region | Click here to show the list. |
| Fossil Localities | Click to show 1 fossil locality |
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Gondomar,_Portugal |
|---|---|
| Wikidata ID: | Q983483 |
| GeoNames ID: | 8010580 |
Localities in this Region
Other Regions, Features and Areas that Intersect
Eurasian PlateTectonic Plate
Iberian PeninsulaPeninsula
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
São Pedro da Cova Mine, São Pedro da Cova, Gondomar, Porto, Portugal