Kjenner Bismuth Mine, Lierskogen, Lier, Buskerud, Norwayi
| Regional Level Types | |
|---|---|
| Kjenner Bismuth Mine | Mine (Backfilled) |
| Lierskogen | Village |
| Lier | Municipality |
| Buskerud | County (Former) |
| Norway | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
59° 48' 41'' North , 10° 19' 1'' East
Latitude & Longitude (decimal):
Type:
Mine (Backfilled) - last checked 2019
Köppen climate type:
Nearest Clubs:
Local clubs are the best way to get access to collecting localities
Local clubs are the best way to get access to collecting localities
| Club | Location | Distance |
|---|---|---|
| Buskerud Geologiforening | Solbergelva | 14km |
| Follo Geologiforening | Ås | 31km |
| Vestfold Geologiforening | Holmestrand | 39km |
| Steinklubben | Skjetten | 42km |
Mindat Locality ID:
32918
Long-form identifier:
mindat:1:2:32918:4
GUID (UUID V4):
23953038-1e58-4bca-97c8-b00dfbf471d4
Other Languages:
Norwegian:
Kjenner vismutgruve, Lierskogen, Lier, Buskerud, Norge
Old Fe/Bi mine, now backfilled, located in a residental area.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded at this locality.Mineral List
15 valid minerals. 1 erroneous literature entry.
Detailed Mineral List:
| ⓘ 'Amphibole Supergroup' Formula: AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ 'Amphibole Supergroup var. Uralite' Formula: AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ Andradite Formula: Ca3Fe3+2(SiO4)3 |
| ⓘ Baryte Formula: BaSO4 References: |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ Bismuth Formula: Bi Description: Possibly a secondary product of bismuthinite. References: |
| ⓘ Bismuthinite Formula: Bi2S3 Description: Goldschmidt describe bismuthinite xls in garnetfels up to 10 cm from this mine. Also freestanding needles in cavities. |
| ⓘ Brianyoungite Formula: Zn3(CO3,SO4)(OH)4 References: |
| ⓘ Carrollite Formula: CuCo2S4 |
| ⓘ Chalcopyrite Formula: CuFeS2 |
| ⓘ Fluorite Formula: CaF2 |
| ⓘ Galena Formula: PbS References: |
| ⓘ Helvine Formula: Be3Mn2+4(SiO4)3S |
| ⓘ Hydrozincite Formula: Zn5(CO3)2(OH)6 References: |
| ⓘ 'K Feldspar' |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) References: |
| ⓘ Smithsonite Formula: ZnCO3 References: |
| ⓘ Sphalerite Formula: ZnS |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Bismuth | 1.CA.05 | Bi |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Carrollite | 2.DA.05 | CuCo2S4 |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Smithsonite | 5.AB.05 | ZnCO3 |
| ⓘ | Hydrozincite | 5.BA.15 | Zn5(CO3)2(OH)6 |
| ⓘ | Brianyoungite | 5.BF.30 | Zn3(CO3,SO4)(OH)4 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| Group 9 - Silicates | |||
| ⓘ | Andradite | 9.AD.25 | Ca3Fe3+2(SiO4)3 |
| ⓘ | Schorl ? | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Helvine | 9.FB.10 | Be3Mn2+4(SiO4)3S |
| Unclassified | |||
| ⓘ | 'Amphibole Supergroup var. Uralite' | - | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ | '' | - | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'K Feldspar' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| H | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Amphibole Supergroup var. Uralite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Be | Beryllium | |
| Be | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| C | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| C | ⓘ Smithsonite | ZnCO3 |
| O | Oxygen | |
| O | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| O | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| O | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| O | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Smithsonite | ZnCO3 |
| O | ⓘ Amphibole Supergroup var. Uralite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| F | Fluorine | |
| F | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Amphibole Supergroup var. Uralite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Na | Sodium | |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | Aluminium | |
| Al | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Amphibole Supergroup var. Uralite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Si | Silicon | |
| Si | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Si | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Amphibole Supergroup var. Uralite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| S | Sulfur | |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| S | ⓘ Carrollite | CuCo2S4 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Galena | PbS |
| S | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| S | ⓘ Sphalerite | ZnS |
| Cl | Chlorine | |
| Cl | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Cl | ⓘ Amphibole Supergroup var. Uralite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ca | Calcium | |
| Ca | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Ca | ⓘ Fluorite | CaF2 |
| Ti | Titanium | |
| Ti | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Amphibole Supergroup var. Uralite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Mn | Manganese | |
| Mn | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| Fe | Iron | |
| Fe | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Co | Cobalt | |
| Co | ⓘ Carrollite | CuCo2S4 |
| Cu | Copper | |
| Cu | ⓘ Carrollite | CuCo2S4 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Zn | Zinc | |
| Zn | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| Zn | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| Zn | ⓘ Smithsonite | ZnCO3 |
| Zn | ⓘ Sphalerite | ZnS |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Pb | Lead | |
| Pb | ⓘ Galena | PbS |
| Bi | Bismuth | |
| Bi | ⓘ Bismuth | Bi |
| Bi | ⓘ Bismuthinite | Bi2S3 |
Other Regions, Features and Areas containing this locality
Eurasian PlateTectonic Plate
EuropeContinent
Norway
- Oslo Volcanic ProvinceVolcanic Province
ScandinaviaRegion
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
