Výsluní, Chomutov District, Ústí nad Labem Region, Czech Republici
| Regional Level Types | |
|---|---|
| Výsluní | Municipality |
| Chomutov District | District |
| Ústí nad Labem Region | Region |
| Czech Republic | Country |
This page is currently not sponsored. Click here to sponsor this page.
Neighbouring regions:
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Výsluní | 219 (2018) |
Mindat Locality ID:
409453
Long-form identifier:
mindat:1:2:409453:4
GUID (UUID V4):
0eac4579-ee9b-4b15-9a01-8988ee605a33
Other Languages:
French:
Výsluní, District de Chomutov, Région d'Ústí nad Labem, République tchèque
German:
Výsluní, Okres Chomutov, Ústecký kraj, Tschechien
Italian:
Výsluní, Distretto di Chomutov, Regione di Ústí nad Labem, Repubblica Ceca
Russian:
Вислуни, Хомутов, Устецкий край, Чехия
Spanish:
Výsluní, Distrito de Chomutov, Región de Ústí nad Labem, República Checa
Basque:
Výsluní, Ústí nad Labem eskualdea, Txekia
Cebuano:
Výsluní, Okres Chomutov, Ústecký kraj, Nasod nga Czech
Czech:
Výsluní, Okres Chomutov, Ústecký kraj, Česko
Dutch:
Výsluní, Okres Chomutov, Ústí nad Labem, Tsjechië
Farsi/Persian:
ویسلونی, شهرستان خوموتوف, منطقه اوستی ناد لابم, جمهوری چک
Hungarian:
Výsluní, Chomutovi járás, Ústí nad Labem-i kerület, Csehország
Malay:
Výsluní, Daerah Chomutov, Wilayah Ústí nad Labem, Republik Czech
Minnan / Hokkien-Taiwanese:
Výsluní
Polish:
Výsluní, Powiat Chomutov, Kraj ustecki, Czechy
Portuguese:
Výsluní, Chomutov, Ústí nad Labem, República Checa
Serbian:
Вислуњи, Округ Хомутов, Устечки крај, Чешка
Slovak:
Výsluní, Okres Chomutov, Úsťanský kraj, Česko
South Azerbaijani:
ویسلونی, خوموتوف بؤلگهسی, اوستی ناد لابم اوستانی, چک جومهوریتی
Swedish:
Výsluní, Chomutov, Ústí nad Labem, Tjeckien
Tatar:
Вислуни, Чехия
Vietnamese:
Výsluní, Chomutov, Ústí nad Labem, Cộng hòa Séc
Výsluní, earlier also Suniperk (German: Sonnenberg) is a small town and municipality in the Ústí nad Labem Region of the Czech Republic.
The town is located in northern Bohemia, nine kilometers south of the Reitzenhain border crossing on the ridge of the Ore Mountains. The town is known for the largest church in the Upper Ore Mountains, popularly known as the Ore Mountains Cathedral, which dominates the town and is visible on the southern slope of the mountains far into the North Bohemian Basin.
The Brandbächel flows through the town to the east and then turns to Kadaň (Kaaden) to fall into the Eger.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities14 valid minerals.
Detailed Mineral List:
| ⓘ Arsenopyrite Formula: FeAsS |
| ⓘ Baryte Formula: BaSO4 |
| ⓘ Chalcopyrite Formula: CuFeS2 |
| ⓘ Dolomite Formula: CaMg(CO3)2 |
| ⓘ Fluorite Formula: CaF2 Localities: References: |
| ⓘ Galena Formula: PbS |
| ⓘ Hematite Formula: Fe2O3 |
| ⓘ 'Hornblende Root Name Group' Formula: ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| ⓘ Kaersutite Formula: NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| ⓘ Microcline Formula: K(AlSi3O8) |
| ⓘ Orthoclase Formula: K(AlSi3O8) |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Quartz Formula: SiO2 Localities: References: |
| ⓘ Scheelite Formula: Ca(WO4) |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| Group 9 - Silicates | |||
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Kaersutite | 9.DE.15 | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| Unclassified | |||
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| O | Oxygen | |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| F | Fluorine | |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Na | Sodium | |
| Na | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| Al | Aluminium | |
| Al | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Si | Silicon | |
| Si | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| S | Sulfur | |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Galena | PbS |
| S | ⓘ Pyrite | FeS2 |
| Cl | Chlorine | |
| Cl | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| K | Potassium | |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| Ca | Calcium | |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Ti | Titanium | |
| Ti | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| Fe | Iron | |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Cu | Copper | |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| W | Tungsten | |
| W | ⓘ Scheelite | Ca(WO4) |
| Pb | Lead | |
| Pb | ⓘ Galena | PbS |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/V%C3%BDslun%C3%AD |
|---|---|
| Wikidata ID: | Q1406706 |
| GeoNames ID: | 3062271 |
Localities in this Region
- Ústí nad Labem Region
- Chomutov District
- Výsluní
- Chomutov District
Other Regions, Features and Areas that Intersect
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Výsluní deposit, Výsluní, Chomutov District, Ústí nad Labem Region, Czech Republic