Fountain, Pitt County, North Carolina, USAi
| Regional Level Types | |
|---|---|
| Fountain | Town |
| Pitt County | County |
| North Carolina | State |
| USA | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Fountain | 435 (2017) |
Mindat Locality ID:
245551
Long-form identifier:
mindat:1:2:245551:1
GUID (UUID V4):
c4e9b4f5-9a8e-4f43-bbc1-8b957340b425
Other Languages:
French:
Fountain, comté de Pitt, Caroline du Nord, États-Unis
German:
Fountain, Pitt County, North Carolina, Vereinigte Staaten
Italian:
Fountain, contea di Pitt, Carolina del Nord, Stati Uniti d'America
Spanish:
Fountain, Condado de Pitt, Carolina del Norte, Estados Unidos
Arabic:
فونتاين, مقاطعة بيت, كارولاينا الشمالية, الولايات المتحدة
Basque:
Fountain , Pitt konderria, Ipar Carolina
Catalan:
Fountain, Carolina del Nord, Estats Units d’Amèrica
Cebuano:
Fountain, Pitt County, North Carolina
Chechen:
Фаунтен , Къилбаседа Каролина, Америкин Цхьаьнатоьхна Штаташ
Dutch:
Fountain, Pitt County, North Carolina, Verenigde Staten
Farsi/Persian:
فاونتن، کارولینای شمالی, شهرستان پیت، کارولینای شمالی, کارولینای شمالی, ایالات متحده آمریکا
Haitian:
Fountain, Karolin dinò, Etazini
Hungarian:
Fountain, Pitt megye, Észak-Karolina, Amerikai Egyesült Államok
Ladin:
Fountain
Minnan / Hokkien-Taiwanese:
Fountain, Pitt Kūn
Polish:
Fountain, Hrabstwo Pitt, Karolina Północna, Stany Zjednoczone
Portuguese:
Fountain, Condado de Pitt, Carolina do Norte, Estados Unidos
Serbian:
Фаунтин , Округ Пит, Северна Каролина, Сједињене Америчке Државе
Serbo-Croatian:
Fountain, Pitt County, Sjeverna Karolina, Sjedinjene Američke Države
Tatar:
Фаунтен , Төньяк Каролина, Америка Кушма Штатлары
Ukrainian:
Фаунтен, Пітт, Північна Кароліна, Сполучені Штати Америки
Uzbek (Latin Script):
Fountain, Shimoliy Karolina, Amerika Qoʻshma Shtatlari
Volapük:
Fountain, North Carolina, Lamerikän
Fountain is a town in Pitt County, North Carolina, United States. The town is a part of the Greenville Metropolitan Area, located in North Carolina's Inner Banks region.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities13 valid minerals.
Detailed Mineral List:
| ⓘ Aegirine Formula: NaFe3+Si2O6 |
| ⓘ Albite Formula: Na(AlSi3O8) |
| ⓘ Arfvedsonite Formula: [Na][Na2][Fe2+4Fe3+]Si8O22(OH)2 |
| ⓘ Bafertisite Formula: Ba2Fe2+4Ti2(Si2O7)2O2(OH)2F2 |
| ⓘ Baryte Formula: BaSO4 |
| ⓘ Calcite Formula: CaCO3 |
| ⓘ 'Ferro-eckermannite' Formula: NaNa2(Fe2+4Al)Si8O22(OH)2 |
| ⓘ Ferro-pargasite Formula: NaCa2(Fe2+4Al)(Si6Al2)O22(OH)2 |
| ⓘ Ferro-richterite Formula: {Na}{CaNa}{Fe2+5}(Si8O22)(OH)2 |
| ⓘ Fluorite Formula: CaF2 |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
| ⓘ Microcline Formula: K(AlSi3O8) |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Riebeckite Formula: ◻[Na2][Fe2+3Fe3+2]Si8O22(OH)2 |
| ⓘ 'UM1983-23-SiO:BaFeHMnTi' Formula: (Ba,Ca,K,Na)3(Fe2+,Mn)7Ti2Si8O24(O,OH)7 Colour: Browish-Gray with Silvery-Pink hue. Darkens to a Dark Brown Description: Material is fibrous. Associated with Bafertisite and Acmite |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 3 - Halides | |||
|---|---|---|---|
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| Group 9 - Silicates | |||
| ⓘ | Bafertisite | 9.BE.55 | Ba2Fe2+4Ti2(Si2O7)2O2(OH)2F2 |
| ⓘ | Aegirine | 9.DA.25 | NaFe3+Si2O6 |
| ⓘ | Ferro-pargasite | 9.DE.15 | NaCa2(Fe2+4Al)(Si6Al2)O22(OH)2 |
| ⓘ | Ferro-richterite | 9.DE.20 | {Na}{CaNa}{Fe2+5}(Si8O22)(OH)2 |
| ⓘ | Arfvedsonite | 9.DE.25 | [Na][Na2][Fe2+4Fe3+]Si8O22(OH)2 |
| ⓘ | 'Ferro-eckermannite' | 9.DE.25 | NaNa2(Fe2+4Al)Si8O22(OH)2 |
| ⓘ | Riebeckite | 9.DE.25 | ◻[Na2][Fe2+3Fe3+2]Si8O22(OH)2 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| Unclassified | |||
| ⓘ | 'UM1983-23-SiO:BaFeHMnTi' | - | (Ba,Ca,K,Na)3(Fe2+,Mn)7Ti2Si8O24(O,OH)7 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Arfvedsonite | [Na][Na2][Fe42+Fe3+]Si8O22(OH)2 |
| H | ⓘ Bafertisite | Ba2Fe42+Ti2(Si2O7)2O2(OH)2F2 |
| H | ⓘ Ferro-eckermannite | NaNa2(Fe42+Al)Si8O22(OH)2 |
| H | ⓘ Ferro-pargasite | NaCa2(Fe42+Al)(Si6Al2)O22(OH)2 |
| H | ⓘ Ferro-richterite | {Na}{CaNa}{Fe52+}(Si8O22)(OH)2 |
| H | ⓘ Riebeckite | ◻[Na2][Fe32+Fe23+]Si8O22(OH)2 |
| H | ⓘ UM1983-23-SiO:BaFeHMnTi | (Ba,Ca,K,Na)3(Fe2+,Mn)7Ti2Si8O24(O,OH)7 |
| C | Carbon | |
| C | ⓘ Calcite | CaCO3 |
| O | Oxygen | |
| O | ⓘ Aegirine | NaFe3+Si2O6 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Arfvedsonite | [Na][Na2][Fe42+Fe3+]Si8O22(OH)2 |
| O | ⓘ Bafertisite | Ba2Fe42+Ti2(Si2O7)2O2(OH)2F2 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Ferro-eckermannite | NaNa2(Fe42+Al)Si8O22(OH)2 |
| O | ⓘ Ferro-pargasite | NaCa2(Fe42+Al)(Si6Al2)O22(OH)2 |
| O | ⓘ Ferro-richterite | {Na}{CaNa}{Fe52+}(Si8O22)(OH)2 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Riebeckite | ◻[Na2][Fe32+Fe23+]Si8O22(OH)2 |
| O | ⓘ UM1983-23-SiO:BaFeHMnTi | (Ba,Ca,K,Na)3(Fe2+,Mn)7Ti2Si8O24(O,OH)7 |
| F | Fluorine | |
| F | ⓘ Bafertisite | Ba2Fe42+Ti2(Si2O7)2O2(OH)2F2 |
| F | ⓘ Fluorite | CaF2 |
| Na | Sodium | |
| Na | ⓘ Aegirine | NaFe3+Si2O6 |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Arfvedsonite | [Na][Na2][Fe42+Fe3+]Si8O22(OH)2 |
| Na | ⓘ Ferro-eckermannite | NaNa2(Fe42+Al)Si8O22(OH)2 |
| Na | ⓘ Ferro-pargasite | NaCa2(Fe42+Al)(Si6Al2)O22(OH)2 |
| Na | ⓘ Ferro-richterite | {Na}{CaNa}{Fe52+}(Si8O22)(OH)2 |
| Na | ⓘ Riebeckite | ◻[Na2][Fe32+Fe23+]Si8O22(OH)2 |
| Na | ⓘ UM1983-23-SiO:BaFeHMnTi | (Ba,Ca,K,Na)3(Fe2+,Mn)7Ti2Si8O24(O,OH)7 |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Ferro-eckermannite | NaNa2(Fe42+Al)Si8O22(OH)2 |
| Al | ⓘ Ferro-pargasite | NaCa2(Fe42+Al)(Si6Al2)O22(OH)2 |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Si | Silicon | |
| Si | ⓘ Aegirine | NaFe3+Si2O6 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Arfvedsonite | [Na][Na2][Fe42+Fe3+]Si8O22(OH)2 |
| Si | ⓘ Bafertisite | Ba2Fe42+Ti2(Si2O7)2O2(OH)2F2 |
| Si | ⓘ Ferro-eckermannite | NaNa2(Fe42+Al)Si8O22(OH)2 |
| Si | ⓘ Ferro-pargasite | NaCa2(Fe42+Al)(Si6Al2)O22(OH)2 |
| Si | ⓘ Ferro-richterite | {Na}{CaNa}{Fe52+}(Si8O22)(OH)2 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Riebeckite | ◻[Na2][Fe32+Fe23+]Si8O22(OH)2 |
| Si | ⓘ UM1983-23-SiO:BaFeHMnTi | (Ba,Ca,K,Na)3(Fe2+,Mn)7Ti2Si8O24(O,OH)7 |
| S | Sulfur | |
| S | ⓘ Baryte | BaSO4 |
| K | Potassium | |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ UM1983-23-SiO:BaFeHMnTi | (Ba,Ca,K,Na)3(Fe2+,Mn)7Ti2Si8O24(O,OH)7 |
| Ca | Calcium | |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Ferro-pargasite | NaCa2(Fe42+Al)(Si6Al2)O22(OH)2 |
| Ca | ⓘ Ferro-richterite | {Na}{CaNa}{Fe52+}(Si8O22)(OH)2 |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ UM1983-23-SiO:BaFeHMnTi | (Ba,Ca,K,Na)3(Fe2+,Mn)7Ti2Si8O24(O,OH)7 |
| Ti | Titanium | |
| Ti | ⓘ Bafertisite | Ba2Fe42+Ti2(Si2O7)2O2(OH)2F2 |
| Ti | ⓘ UM1983-23-SiO:BaFeHMnTi | (Ba,Ca,K,Na)3(Fe2+,Mn)7Ti2Si8O24(O,OH)7 |
| Mn | Manganese | |
| Mn | ⓘ UM1983-23-SiO:BaFeHMnTi | (Ba,Ca,K,Na)3(Fe2+,Mn)7Ti2Si8O24(O,OH)7 |
| Fe | Iron | |
| Fe | ⓘ Aegirine | NaFe3+Si2O6 |
| Fe | ⓘ Arfvedsonite | [Na][Na2][Fe42+Fe3+]Si8O22(OH)2 |
| Fe | ⓘ Bafertisite | Ba2Fe42+Ti2(Si2O7)2O2(OH)2F2 |
| Fe | ⓘ Ferro-eckermannite | NaNa2(Fe42+Al)Si8O22(OH)2 |
| Fe | ⓘ Ferro-pargasite | NaCa2(Fe42+Al)(Si6Al2)O22(OH)2 |
| Fe | ⓘ Ferro-richterite | {Na}{CaNa}{Fe52+}(Si8O22)(OH)2 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Riebeckite | ◻[Na2][Fe32+Fe23+]Si8O22(OH)2 |
| Fe | ⓘ UM1983-23-SiO:BaFeHMnTi | (Ba,Ca,K,Na)3(Fe2+,Mn)7Ti2Si8O24(O,OH)7 |
| Ba | Barium | |
| Ba | ⓘ Bafertisite | Ba2Fe42+Ti2(Si2O7)2O2(OH)2F2 |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ UM1983-23-SiO:BaFeHMnTi | (Ba,Ca,K,Na)3(Fe2+,Mn)7Ti2Si8O24(O,OH)7 |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Fountain,_North_Carolina |
|---|---|
| Wikidata ID: | Q2030880 |
| GeoNames ID: | 4466972 |
Localities in this Region
- North Carolina
- Pitt County
- Fountain
- Pitt County
Other Regions, Features and Areas that Intersect
North America PlateTectonic Plate
- Carolinia DomainDomain
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Fountain Quarry, Fountain, Pitt County, North Carolina, USA