E Township, Franklin County, Maine, USAi
| Regional Level Types | |
|---|---|
| E Township | Township |
| Franklin County | Township |
| Maine | State |
| USA | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
44° North , 70° West (est.)
Estimate based on other nearby localities or region boundaries.
Margin of Error:
~78km
Locality type:
Köppen climate type:
A township in Franklin County.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities13 valid minerals.
Detailed Mineral List:
| ⓘ Almandine ? Formula: Fe2+3Al2(SiO4)3 Reference: No reference listed |
| ⓘ Andalusite Formula: Al2(SiO4)O Reference: E.L. Clopton collection #795 |
| ⓘ Andalusite var. Chiastolite Formula: Al2(SiO4)O Reference: E.L. Clopton collection #795 |
| ⓘ Beryl ? Formula: Be3Al2(Si6O18) Reference: No reference listed |
| ⓘ 'Chamosite-Clinochlore Series' Reference: American Mineralogist 61:431-434, 1976 |
| ⓘ Goethite Formula: α-Fe3+O(OH) Reference: Vandall King |
| ⓘ Graphite Formula: C Reference: American Mineralogist 61:431-434, 1976 |
| ⓘ Margarite Formula: CaAl2(Al2Si2O10)(OH)2 Description: Margarite completely replaced chiastolite variety of andalusite in the Smalls Falls area. Reference: American Mineralogist 61:431-434, 1976 |
| ⓘ Microcline Formula: K(AlSi3O8) Reference: No reference listed |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reference: No reference listed |
| ⓘ Pyrrhotite Formula: Fe1-xS Localities: Reference: American Mineralogist 61:431-434, 1976 |
| ⓘ Quartz Formula: SiO2 Localities: Reference: No reference listed |
| ⓘ Rutile Formula: TiO2 Reference: American Mineralogist 61:431-434, 1976 |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Reference: No reference listed |
| ⓘ Spodumene Formula: LiAlSi2O6 Reference: King, V. and Foord, E., 1994, Mineralogy of Maine, v.1. |
| ⓘ 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z Reference: American Mineralogist 61:431-434, 1976 |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Graphite | 1.CB.05a | C |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | α-Fe3+O(OH) |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| Group 9 - Silicates | |||
| ⓘ | Almandine ? | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | var. Chiastolite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | Beryl ? | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Margarite | 9.EC.30 | CaAl2(Al2Si2O10)(OH)2 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Spodumene | 9.DA.30 | LiAlSi2O6 |
| Unclassified Minerals, Rocks, etc. | |||
| ⓘ | 'Chamosite-Clinochlore Series' | - | |
| ⓘ | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| H | ⓘ Goethite | α-Fe3+O(OH) |
| Li | Lithium | |
| Li | ⓘ Spodumene | LiAlSi2O6 |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Graphite | C |
| O | Oxygen | |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | ⓘ Spodumene | LiAlSi2O6 |
| O | ⓘ Andalusite var. Chiastolite | Al2(SiO4)O |
| O | ⓘ Andalusite | Al2(SiO4)O |
| O | ⓘ Goethite | α-Fe3+O(OH) |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| Na | Sodium | |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | Aluminium | |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| Al | ⓘ Spodumene | LiAlSi2O6 |
| Al | ⓘ Andalusite var. Chiastolite | Al2(SiO4)O |
| Al | ⓘ Andalusite | Al2(SiO4)O |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | Silicon | |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| Si | ⓘ Spodumene | LiAlSi2O6 |
| Si | ⓘ Andalusite var. Chiastolite | Al2(SiO4)O |
| Si | ⓘ Andalusite | Al2(SiO4)O |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| S | Sulfur | |
| S | ⓘ Pyrrhotite | Fe1-xS |
| K | Potassium | |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| Ti | Titanium | |
| Ti | ⓘ Rutile | TiO2 |
| Fe | Iron | |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Goethite | α-Fe3+O(OH) |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
Localities in this Region
- Maine
- Franklin County
Other Regions, Features and Areas containing this locality
North America PlateTectonic Plate
- Ganderia DomainDomain
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Smalls Falls, E Township, Franklin County, Maine, USA