Midtre Havredal, Havredal, Bamble, Telemark, Norwayi
| Regional Level Types | |
|---|---|
| Midtre Havredal | Farm |
| Havredal | Group of Farms |
| Bamble | Municipality |
| Telemark | County |
| Norway | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
58° 57' 31'' North , 9° 33' 47'' East
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Nearest Clubs:
Local clubs are the best way to get access to collecting localities
Local clubs are the best way to get access to collecting localities
| Club | Location | Distance |
|---|---|---|
| Fensfeltet Geologiforening | Ulefoss | 37km |
Mindat Locality ID:
219816
Long-form identifier:
mindat:1:2:219816:6
GUID (UUID V4):
772c8b52-5c2b-424a-9635-544192785d86
Other/historical names associated with this locality:
Midtre Hafredal
Other Languages:
Norwegian:
Midtre Havredal, Havredal, Bamble, Telemark, Norge
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities12 valid minerals. 1 erroneous literature entry.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Albite Formula: Na(AlSi3O8) Localities: Description: This albite was first descibed by v. Kobell as Tschermakit |
| ⓘ Albite var. Oligoclase Formula: (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 Localities: |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ Clinochlore var. Sheridanite Formula: (Mg,Al,Fe)6(Si,Al)4O10(OH)8 |
| ⓘ Dravite Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ 'Feldspar Group' |
| ⓘ 'Feldspar Group var. Sunstone' |
| ⓘ Hematite Formula: Fe2O3 Localities: |
| ⓘ Ilmenite Formula: Fe2+TiO3 |
| ⓘ Isokite Formula: CaMg(PO4)F |
| ⓘ 'K Feldspar' |
| ⓘ Kyanite Formula: Al2(SiO4)O |
| ⓘ 'Mica Group' |
| ⓘ 'Monazite' Formula: REE(PO4) |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ Formula: Fe2TiO5 Locality: Wagnerite Prospect, Midtre Havredal, Havredal, Bamble, Telemark, Norway - erroneously reported Description: Smith (1969) has showed that the "pseudobrookite" from Havredal in fact consists of an extremely fine-grained mixture of hematite and rutile with a lesser amount of quartz and chlorite |
| ⓘ Quartz Formula: SiO2 Localities: |
| ⓘ Rutile Formula: TiO2 |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Wagnerite Formula: (Mg,Fe2+)2(PO4)F |
List of minerals arranged by Strunz 10th Edition classification
| Group 4 - Oxides and Hydroxides | |||
|---|---|---|---|
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Pseudobrookite ? | 4.CB.15 | Fe2TiO5 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Wagnerite | 8.BB.15 | (Mg,Fe2+)2(PO4)F |
| ⓘ | Isokite | 8.BH.10 | CaMg(PO4)F |
| Group 9 - Silicates | |||
| ⓘ | Kyanite | 9.AF.15 | Al2(SiO4)O |
| ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | var. Sheridanite | 9.EC.55 | (Mg,Al,Fe)6(Si,Al)4O10(OH)8 |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Oligoclase | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| Unclassified | |||
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Monazite' | - | REE(PO4) |
| ⓘ | 'Mica Group' | - | |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Feldspar Group var. Sunstone' | - | |
| ⓘ | '' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Clinochlore var. Sheridanite | (Mg,Al,Fe)6(Si,Al)4O10(OH)8 |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| B | Boron | |
| B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | Oxygen | |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Isokite | CaMg(PO4)F |
| O | ⓘ Kyanite | Al2(SiO4)O |
| O | ⓘ Monazite | REE(PO4) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Pseudobrookite | Fe2TiO5 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Wagnerite | (Mg,Fe2+)2(PO4)F |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Clinochlore var. Sheridanite | (Mg,Al,Fe)6(Si,Al)4O10(OH)8 |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Isokite | CaMg(PO4)F |
| F | ⓘ Wagnerite | (Mg,Fe2+)2(PO4)F |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Mg | Magnesium | |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | ⓘ Isokite | CaMg(PO4)F |
| Mg | ⓘ Wagnerite | (Mg,Fe2+)2(PO4)F |
| Mg | ⓘ Clinochlore var. Sheridanite | (Mg,Al,Fe)6(Si,Al)4O10(OH)8 |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Kyanite | Al2(SiO4)O |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Al | ⓘ Clinochlore var. Sheridanite | (Mg,Al,Fe)6(Si,Al)4O10(OH)8 |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Kyanite | Al2(SiO4)O |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Clinochlore var. Sheridanite | (Mg,Al,Fe)6(Si,Al)4O10(OH)8 |
| P | Phosphorus | |
| P | ⓘ Isokite | CaMg(PO4)F |
| P | ⓘ Monazite | REE(PO4) |
| P | ⓘ Wagnerite | (Mg,Fe2+)2(PO4)F |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Cl | Chlorine | |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Isokite | CaMg(PO4)F |
| Ca | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Pseudobrookite | Fe2TiO5 |
| Ti | ⓘ Rutile | TiO2 |
| Fe | Iron | |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Pseudobrookite | Fe2TiO5 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Wagnerite | (Mg,Fe2+)2(PO4)F |
| Fe | ⓘ Clinochlore var. Sheridanite | (Mg,Al,Fe)6(Si,Al)4O10(OH)8 |
Localities in this Region
- Telemark
- Bamble
- Havredal
- Midtre Havredal
- Havredal
- Bamble
Other Regions, Features and Areas containing this locality
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
