Hausach, Hausach, Ortenaukreis, Freiburg Region, Baden-Württemberg, Germanyi
| Regional Level Types | |
|---|---|
| Hausach | Municipality |
| Hausach | Administrative Community |
| Ortenaukreis | District |
| Freiburg Region | Region |
| Baden-Württemberg | State |
| Germany | Country |
This page is currently not sponsored. Click here to sponsor this page.
Neighbouring regions:
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Hausach | 5,748 (2013) |
Mindat Locality ID:
403925
Long-form identifier:
mindat:1:2:403925:2
GUID (UUID V4):
6e354257-7a03-48f9-90ec-2d8fdf89c02b
Other Languages:
French:
Hausach, Hausach, Arrondissement de l'Ortenau, Fribourg-en-Brisgau, Bade-Wurtemberg, Allemagne
German:
Hausach, Hausach, Ortenaukreis, Regierungsbezirk Freiburg, Baden-Württemberg, Deutschland
Italian:
Hausach, Hausach, Circondario dell'Ortenau, Distretto governativo di Friburgo, Baden-Württemberg, Germania
Russian:
Хаузах, Хаузах, Ортенау, Фрайбург, Баден-Вюртемберг, Германия
Simplified Chinese:
豪萨, 豪萨, 奥特瑙县, 弗赖堡行政区, 巴登-符腾堡, 德国
Spanish:
Hausach, Hausach, Distrito de Ortenau, Región de Friburgo, Baden-Wurtemberg, Alemania
Alemannic:
Hausach, Hausach, Ortenaukreis, Regierungsbezirk Freiburg, Baden-Württemberg, Deutschland
Arabic:
هاوزاخ, هاوزاخ, مقاطعة فرايبورغ, بادن-فورتمبيرغ, ألمانيا
Belarusian:
Гаўзах, Гаўзах, адміністрацыйная акруга Фрайбург, Бадэн-Вюртэмберг, Германія
Cebuano:
Hausach, Hausach, Ortenaukreis, Baden-Württemberg Region, Alemanya
Dutch:
Hausach, Hausach, Ortenaukreis, Regierungsbezirk Freiburg, Baden-Württemberg, Duitsland
Esperanto:
Hausach, Hausach, Distrikto Ortenau, Distriktaro Freiburg, Baden-Virtembergo, Germanio
Farsi/Persian:
هاوزاخ, هاوزاخ, ارتناوکرایس, فرایبورگ, بادن-وورتمبرگ, آلمان
Hungarian:
Hausach, Hausach, Ortenau járás, Baden-Württemberg, Németország
Japanese:
ハウザッハ, ハウザッハ, オルテナウクライス, フライブルク県, バーデン＝ヴュルテンベルク州, ドイツ
Kazakh (Cyrillic Script):
Хаузах, Хаузах, Ортенау, Баден-Вюртемберг, Германия
Kyrgyz:
Хаузах, Хаузах, Германия
Latin:
Hausach, Hausach, Provincia Friburgum, Badenia-Virtembergia, Germania
Lombard:
Hausach, Hausach, Ortenaukreis, Friburgh, Baden-Württemberg, Germania
Macedonian:
Хаузах, Хаузах, Фрајбург, Баден-Виртемберг, Германија
Malay:
Hausach, Hausach, Ortenaukreis, Freiburg, Baden-Württemberg, Jerman
Polish:
Hausach, Hausach, Powiat Ortenau, Rejencja Fryburg, Badenia-Wirtembergia, Niemcy
Portuguese:
Hausach, Hausach, Ortenaukreis, Freiburg, Baden-Württemberg, Alemanha
Romanian:
Hausach, Hausach, Ortenaukreis, Freiburg , Baden-Württemberg, Germania
Serbian:
Хаузах, Хаузах, Баден-Виртемберг, Њемачка
Serbo-Croatian:
Hausach, Hausach, Baden-Württemberg, Njemačka
South Azerbaijani:
هاوزاخ, هاوزاخ, بادن-وورتمبرق, آلمان
Tatar:
Хаузах, Хаузах, Баден-Вюртемберг, Алмания
Traditional Chinese:
豪薩, 豪薩, 巴登－烏騰堡, 德國
Turkish:
Hausach, Hausach, Ortenaukreis, Regierungsbezirk Freiburg, Baden-Württemberg, Almanya
Ukrainian:
Гаузах, Гаузах, Ортенау, Фрайбург, Баден-Вюртемберг, Німеччина
Uzbek (Latin Script):
Hausach, Hausach, Ortenaukreis, Baden-Vyurtemberg, Germaniya
Volapük:
Hausach, Hausach, Badän-Vürtän, Deutän
Waray:
Hausach, Hausach, Ortenaukreis, Baden-Württemberg, Alemanya
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities79 valid minerals. 1 (TL) - type locality of valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Acanthite Formula: Ag2S Localities: |
| ⓘ 'Allanite Group' Formula: (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 |
| ⓘ Anatase Formula: TiO2 Localities: |
| ⓘ Andradite Formula: Ca3Fe3+2(SiO4)3 |
| ⓘ Anglesite Formula: PbSO4 |
| ⓘ Annabergite Formula: Ni3(AsO4)2 · 8H2O |
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) Localities: References: |
| ⓘ Aragonite Formula: CaCO3 |
| ⓘ Arsenopyrite Formula: FeAsS Localities: |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 |
| ⓘ Bariopharmacosiderite Formula: Ba0.5Fe3+4(AsO4)3(OH)4 · 5H2O |
| ⓘ Baryte Formula: BaSO4 Localities: |
| ⓘ Beyerite Formula: Ca(BiO)2(CO3)2 |
| ⓘ 'Bindheimite' Formula: Pb2Sb2O6O |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ Bismutite Formula: (BiO)2CO3 |
| ⓘ Bornite Formula: Cu5FeS4 |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 |
| ⓘ Brookite Formula: TiO2 |
| ⓘ Calcite Formula: CaCO3 Localities: References: |
| ⓘ Cerussite Formula: PbCO3 |
| ⓘ Chalcocite Formula: Cu2S |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ Clinozoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ Conichalcite Formula: CaCu(AsO4)(OH) |
| ⓘ Corkite ? Formula: PbFe3(PO4)(SO4)(OH)6 Description: might be kintoreite ('sulphate-deficient corkite') |
| ⓘ Covellite Formula: CuS |
| ⓘ Dolomite Formula: CaMg(CO3)2 Localities: |
| ⓘ Duftite Formula: PbCu(AsO4)(OH) |
| ⓘ Elyite Formula: Pb4Cu(SO4)O2(OH)4 · H2O |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ Erythrite Formula: Co3(AsO4)2 · 8H2O |
| ⓘ Eulytine Formula: Bi4(SiO4)3 |
| ⓘ Ferberite Formula: FeWO4 |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F |
| ⓘ Fluorite Formula: CaF2 Localities: |
| ⓘ Galena Formula: PbS Localities: |
| ⓘ Glaucodot Formula: (Co0.50Fe0.50)AsS |
| ⓘ Goethite Formula: α-Fe3+O(OH) |
| ⓘ Halotrichite ? Formula: FeAl2(SO4)4 · 22H2O Description: may form on cabinet specimens from decomposing marcasite, yet has not been found in situ |
| ⓘ Hechtsbergite (TL) Formula: Bi2(VO4)O(OH) Type Locality: |
| ⓘ Hematite Formula: Fe2O3 |
| ⓘ Heterogenite Formula: Co3+O(OH) |
| ⓘ Heterogenite var. Heubachite Formula: (Co,Ni)O(OH) |
| ⓘ Hydrocerussite Formula: Pb3(CO3)2(OH)2 |
| ⓘ Jarosite ? Formula: KFe3+3(SO4)2(OH)6 |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 |
| ⓘ Kintoreite ? Formula: PbFe3(PO4)(PO3OH)(OH)6 Description: might be corkite |
| ⓘ Lautite Formula: CuAsS |
| ⓘ Leadhillite Formula: Pb4(CO3)2(SO4)(OH)2 |
| ⓘ 'Limonite' |
| ⓘ Litharge Formula: PbO |
| ⓘ Löllingite Formula: FeAs2 |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 Localities: References: |
| ⓘ 'Manganogel' Formula: ~MnO2 · nH2O |
| ⓘ Marcasite Formula: FeS2 |
| ⓘ Microcline Formula: K(AlSi3O8) |
| ⓘ Minium Formula: Pb3O4 |
| ⓘ Mixite Formula: BiCu6(AsO4)3(OH)6 · 3H2O |
| ⓘ 'Monazite' Formula: REE(PO4) |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Muscovite var. Illite Formula: K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ Namibite Formula: Cu(BiO)2(VO4)(OH) |
| ⓘ Prehnite Formula: Ca2Al2Si3O10(OH)2 |
| ⓘ Pyrargyrite Formula: Ag3SbS3 |
| ⓘ Pyrite Formula: FeS2 Localities: Erzengel Gabriel Mine (Gabriel Mine), Hausach, Hausach, Ortenaukreis, Freiburg Region, Baden-Württemberg, Germany Hechtsberg quarry, Hausach, Hausach, Ortenaukreis, Freiburg Region, Baden-Württemberg, Germany Maria Josepha Mine, Hausach, Hausach, Ortenaukreis, Freiburg Region, Baden-Württemberg, Germany |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl |
| ⓘ Pyrrhotite Formula: Fe1-xS |
| ⓘ Quartz Formula: SiO2 Localities: Erzengel Gabriel Mine (Gabriel Mine), Hausach, Hausach, Ortenaukreis, Freiburg Region, Baden-Württemberg, Germany Hechtsberg quarry, Hausach, Hausach, Ortenaukreis, Freiburg Region, Baden-Württemberg, Germany Maria Josepha Mine, Hausach, Hausach, Ortenaukreis, Freiburg Region, Baden-Württemberg, Germany B 33 Road tunnel, Hausach, Hausach, Ortenaukreis, Freiburg Region, Baden-Württemberg, Germany |
| ⓘ Rammelsbergite Formula: NiAs2 |
| ⓘ Rhodochrosite Formula: MnCO3 |
| ⓘ Safflorite Formula: (Co,Ni,Fe)As2 |
| ⓘ Scheelite Formula: Ca(WO4) |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Localities: |
| ⓘ Scorodite Formula: Fe3+AsO4 · 2H2O |
| ⓘ Segnitite Formula: PbFe3+3AsO4(AsO3OH)(OH)6 |
| ⓘ Silver Formula: Ag Localities: Erzengel Gabriel Mine (Gabriel Mine), Hausach, Hausach, Ortenaukreis, Freiburg Region, Baden-Württemberg, Germany Hechtsberg quarry, Hausach, Hausach, Ortenaukreis, Freiburg Region, Baden-Württemberg, Germany Maria Josepha Mine, Hausach, Hausach, Ortenaukreis, Freiburg Region, Baden-Württemberg, Germany Neu Sophia Mine, Hausach, Hausach, Ortenaukreis, Freiburg Region, Baden-Württemberg, Germany |
| ⓘ Sphalerite Formula: ZnS Localities: References: |
| ⓘ Stolzite Formula: Pb(WO4) |
| ⓘ Stromeyerite Formula: AgCuS |
| ⓘ Sulphur Formula: S8 |
| ⓘ Susannite Formula: Pb4(CO3)2(SO4)(OH)2 |
| ⓘ 'Synchysite Group' |
| ⓘ 'Tennantite Subgroup' Formula: Cu6(Cu4C2+2)As4S12S |
| ⓘ 'Tennantite-Tetrahedrite Series' |
| ⓘ Tyrolite Formula: Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| ⓘ Uricite Formula: C5H4N4O3 Description: Analysed (EDX + Raman spectroscopy) |
| ⓘ Wittichenite Formula: Cu3BiS3 |
| ⓘ Wulfenite Formula: Pb(MoO4) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Silver | 1.AA.05 | Ag |
| ⓘ | Sulphur | 1.CC.05 | S8 |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Acanthite | 2.BA.35 | Ag2S |
| ⓘ | Stromeyerite | 2.BA.40 | AgCuS |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Lautite | 2.CB.40 | CuAsS |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Glaucodot | 2.EB.10c | (Co0.50Fe0.50)AsS |
| ⓘ | Safflorite | 2.EB.15a | (Co,Ni,Fe)As2 |
| ⓘ | Rammelsbergite | 2.EB.15a | NiAs2 |
| ⓘ | Löllingite | 2.EB.15a | FeAs2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Pyrargyrite | 2.GA.05 | Ag3SbS3 |
| ⓘ | Wittichenite | 2.GA.20 | Cu3BiS3 |
| ⓘ | 'Tennantite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)As4S12S |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | α-Fe3+O(OH) |
| ⓘ | Litharge | 4.AC.20 | PbO |
| ⓘ | Minium | 4.BD.05 | Pb3O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Ferberite | 4.DB.30 | FeWO4 |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Brookite | 4.DD.10 | TiO2 |
| ⓘ | 'Bindheimite' | 4.DH.20 | Pb2Sb2O6O |
| ⓘ | Heterogenite var. Heubachite | 4.FE.20 | (Co,Ni)O(OH) |
| ⓘ | 4.FE.20 | Co3+O(OH) | |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Rhodochrosite | 5.AB.05 | MnCO3 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Hydrocerussite | 5.BE.10 | Pb3(CO3)2(OH)2 |
| ⓘ | Bismutite | 5.BE.25 | (BiO)2CO3 |
| ⓘ | Beyerite | 5.BE.35 | Ca(BiO)2(CO3)2 |
| ⓘ | Susannite | 5.BF.40 | Pb4(CO3)2(SO4)(OH)2 |
| ⓘ | Leadhillite | 5.BF.40 | Pb4(CO3)2(SO4)(OH)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Jarosite ? | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Halotrichite ? | 7.CB.85 | FeAl2(SO4)4 · 22H2O |
| ⓘ | Elyite | 7.DF.65 | Pb4Cu(SO4)O2(OH)4 · H2O |
| ⓘ | Stolzite | 7.GA.05 | Pb(WO4) |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Namibite | 8.BB.50 | Cu(BiO)2(VO4)(OH) |
| ⓘ | Duftite | 8.BH.35 | PbCu(AsO4)(OH) |
| ⓘ | Conichalcite | 8.BH.35 | CaCu(AsO4)(OH) |
| ⓘ | Corkite ? | 8.BL.05 | PbFe3(PO4)(SO4)(OH)6 |
| ⓘ | Segnitite | 8.BL.10 | PbFe3+3AsO4(AsO3OH)(OH)6 |
| ⓘ | Kintoreite ? | 8.BL.10 | PbFe3(PO4)(PO3OH)(OH)6 |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| ⓘ | Hechtsbergite (TL) | 8.BO.15 | Bi2(VO4)O(OH) |
| ⓘ | Scorodite | 8.CD.10 | Fe3+AsO4 · 2H2O |
| ⓘ | Erythrite | 8.CE.40 | Co3(AsO4)2 · 8H2O |
| ⓘ | Annabergite | 8.CE.40 | Ni3(AsO4)2 · 8H2O |
| ⓘ | Bariopharmacosiderite | 8.DK.10 | Ba0.5Fe3+4(AsO4)3(OH)4 · 5H2O |
| ⓘ | Mixite | 8.DL.15 | BiCu6(AsO4)3(OH)6 · 3H2O |
| ⓘ | Tyrolite | 8.DM.10 | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| Group 9 - Silicates | |||
| ⓘ | Andradite | 9.AD.25 | Ca3Fe3+2(SiO4)3 |
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Eulytine | 9.AD.40 | Bi4(SiO4)3 |
| ⓘ | Clinozoisite | 9.BG.05a | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Prehnite | 9.DP.20 | Ca2Al2Si3O10(OH)2 |
| ⓘ | Muscovite var. Illite | 9.EC.15 | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| Group 10 - Organic Compounds | |||
| ⓘ | Uricite | 10.CA.40 | C5H4N4O3 |
| Unclassified | |||
| ⓘ | 'Monazite' | - | REE(PO4) |
| ⓘ | 'Manganogel' | - | ~MnO2 · nH2O |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Tennantite-Tetrahedrite Series' | - | |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| ⓘ | 'Synchysite Group' | - | |
| ⓘ | 'Allanite Group' | - | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Bariopharmacosiderite | Ba0.5Fe43+(AsO4)3(OH)4 · 5H2O |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| H | ⓘ Corkite | PbFe3(PO4)(SO4)(OH)6 |
| H | ⓘ Duftite | PbCu(AsO4)(OH) |
| H | ⓘ Elyite | Pb4Cu(SO4)O2(OH)4 · H2O |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| H | ⓘ Goethite | α-Fe3+O(OH) |
| H | ⓘ Halotrichite | FeAl2(SO4)4 · 22H2O |
| H | ⓘ Heterogenite | Co3+O(OH) |
| H | ⓘ Heterogenite var. Heubachite | (Co,Ni)O(OH) |
| H | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| H | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Kintoreite | PbFe3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| H | ⓘ Manganogel | ~MnO2 · nH2O |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Namibite | Cu(BiO)2(VO4)(OH) |
| H | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| H | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
| H | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| H | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| H | ⓘ Uricite | C5H4N4O3 |
| H | ⓘ Hechtsbergite | Bi2(VO4)O(OH) |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| H | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Beyerite | Ca(BiO)2(CO3)2 |
| C | ⓘ Bismutite | (BiO)2CO3 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| C | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Rhodochrosite | MnCO3 |
| C | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| C | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| C | ⓘ Uricite | C5H4N4O3 |
| N | Nitrogen | |
| N | ⓘ Uricite | C5H4N4O3 |
| O | Oxygen | |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Bariopharmacosiderite | Ba0.5Fe43+(AsO4)3(OH)4 · 5H2O |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Beyerite | Ca(BiO)2(CO3)2 |
| O | ⓘ Bindheimite | Pb2Sb2O6O |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Bismutite | (BiO)2CO3 |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Brookite | TiO2 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| O | ⓘ Corkite | PbFe3(PO4)(SO4)(OH)6 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Duftite | PbCu(AsO4)(OH) |
| O | ⓘ Elyite | Pb4Cu(SO4)O2(OH)4 · H2O |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| O | ⓘ Eulytine | Bi4(SiO4)3 |
| O | ⓘ Ferberite | FeWO4 |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Goethite | α-Fe3+O(OH) |
| O | ⓘ Halotrichite | FeAl2(SO4)4 · 22H2O |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Heterogenite | Co3+O(OH) |
| O | ⓘ Heterogenite var. Heubachite | (Co,Ni)O(OH) |
| O | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| O | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Kintoreite | PbFe3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| O | ⓘ Litharge | PbO |
| O | ⓘ Manganogel | ~MnO2 · nH2O |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Minium | Pb3O4 |
| O | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| O | ⓘ Monazite | REE(PO4) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Namibite | Cu(BiO)2(VO4)(OH) |
| O | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rhodochrosite | MnCO3 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| O | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
| O | ⓘ Stolzite | Pb(WO4) |
| O | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| O | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| O | ⓘ Uricite | C5H4N4O3 |
| O | ⓘ Wulfenite | Pb(MoO4) |
| O | ⓘ Hechtsbergite | Bi2(VO4)O(OH) |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| O | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Al | Aluminium | |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Halotrichite | FeAl2(SO4)4 · 22H2O |
| Al | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | Silicon | |
| Si | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Eulytine | Bi4(SiO4)3 |
| Si | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| P | Phosphorus | |
| P | ⓘ Corkite | PbFe3(PO4)(SO4)(OH)6 |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Kintoreite | PbFe3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Monazite | REE(PO4) |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Corkite | PbFe3(PO4)(SO4)(OH)6 |
| S | ⓘ Covellite | CuS |
| S | ⓘ Elyite | Pb4Cu(SO4)O2(OH)4 · H2O |
| S | ⓘ Galena | PbS |
| S | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| S | ⓘ Halotrichite | FeAl2(SO4)4 · 22H2O |
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| S | ⓘ Lautite | CuAsS |
| S | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Pyrargyrite | Ag3SbS3 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stromeyerite | AgCuS |
| S | ⓘ Sulphur | S8 |
| S | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| S | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| S | ⓘ Wittichenite | Cu3BiS3 |
| Cl | Chlorine | |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Beyerite | Ca(BiO)2(CO3)2 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ti | Titanium | |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Brookite | TiO2 |
| V | Vanadium | |
| V | ⓘ Namibite | Cu(BiO)2(VO4)(OH) |
| V | ⓘ Hechtsbergite | Bi2(VO4)O(OH) |
| Mn | Manganese | |
| Mn | ⓘ Manganogel | ~MnO2 · nH2O |
| Mn | ⓘ Rhodochrosite | MnCO3 |
| Fe | Iron | |
| Fe | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Bariopharmacosiderite | Ba0.5Fe43+(AsO4)3(OH)4 · 5H2O |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Corkite | PbFe3(PO4)(SO4)(OH)6 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Ferberite | FeWO4 |
| Fe | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| Fe | ⓘ Goethite | α-Fe3+O(OH) |
| Fe | ⓘ Halotrichite | FeAl2(SO4)4 · 22H2O |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | ⓘ Kintoreite | PbFe3(PO4)(PO3OH)(OH)6 |
| Fe | ⓘ Löllingite | FeAs2 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| Fe | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
| Co | Cobalt | |
| Co | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| Co | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| Co | ⓘ Heterogenite | Co3+O(OH) |
| Co | ⓘ Heterogenite var. Heubachite | (Co,Ni)O(OH) |
| Co | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| Ni | Nickel | |
| Ni | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| Ni | ⓘ Heterogenite var. Heubachite | (Co,Ni)O(OH) |
| Ni | ⓘ Rammelsbergite | NiAs2 |
| Ni | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| Cu | Copper | |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Duftite | PbCu(AsO4)(OH) |
| Cu | ⓘ Elyite | Pb4Cu(SO4)O2(OH)4 · H2O |
| Cu | ⓘ Lautite | CuAsS |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| Cu | ⓘ Namibite | Cu(BiO)2(VO4)(OH) |
| Cu | ⓘ Stromeyerite | AgCuS |
| Cu | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Cu | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| Cu | ⓘ Wittichenite | Cu3BiS3 |
| Zn | Zinc | |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Bariopharmacosiderite | Ba0.5Fe43+(AsO4)3(OH)4 · 5H2O |
| As | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| As | ⓘ Duftite | PbCu(AsO4)(OH) |
| As | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| As | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| As | ⓘ Lautite | CuAsS |
| As | ⓘ Löllingite | FeAs2 |
| As | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| As | ⓘ Rammelsbergite | NiAs2 |
| As | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| As | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| As | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
| As | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| As | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| Mo | Molybdenum | |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
| Ag | ⓘ Pyrargyrite | Ag3SbS3 |
| Ag | ⓘ Silver | Ag |
| Ag | ⓘ Stromeyerite | AgCuS |
| Sb | Antimony | |
| Sb | ⓘ Bindheimite | Pb2Sb2O6O |
| Sb | ⓘ Pyrargyrite | Ag3SbS3 |
| Ba | Barium | |
| Ba | ⓘ Bariopharmacosiderite | Ba0.5Fe43+(AsO4)3(OH)4 · 5H2O |
| Ba | ⓘ Baryte | BaSO4 |
| W | Tungsten | |
| W | ⓘ Ferberite | FeWO4 |
| W | ⓘ Scheelite | Ca(WO4) |
| W | ⓘ Stolzite | Pb(WO4) |
| Pb | Lead | |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Bindheimite | Pb2Sb2O6O |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Corkite | PbFe3(PO4)(SO4)(OH)6 |
| Pb | ⓘ Duftite | PbCu(AsO4)(OH) |
| Pb | ⓘ Elyite | Pb4Cu(SO4)O2(OH)4 · H2O |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| Pb | ⓘ Kintoreite | PbFe3(PO4)(PO3OH)(OH)6 |
| Pb | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| Pb | ⓘ Litharge | PbO |
| Pb | ⓘ Minium | Pb3O4 |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Pb | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
| Pb | ⓘ Stolzite | Pb(WO4) |
| Pb | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
| Bi | Bismuth | |
| Bi | ⓘ Beyerite | Ca(BiO)2(CO3)2 |
| Bi | ⓘ Bismutite | (BiO)2CO3 |
| Bi | ⓘ Eulytine | Bi4(SiO4)3 |
| Bi | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| Bi | ⓘ Namibite | Cu(BiO)2(VO4)(OH) |
| Bi | ⓘ Wittichenite | Cu3BiS3 |
| Bi | ⓘ Hechtsbergite | Bi2(VO4)O(OH) |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Hausach |
|---|---|
| Wikidata ID: | Q506856 |
| GeoNames ID: | 2908974 |
Localities in this Region
- Baden-Württemberg
- Freiburg Region
Other Regions, Features and Areas that Intersect
Eurasian PlateTectonic Plate
Germany
- Baden-Württemberg
- Black ForestMountain Range
- Freiburg Region
- Ortenaukreis
- Hausach
- Adlersbach valleyValley
- Einbach valleyValley
- Hausach
- Ortenaukreis
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther Regions
