Wanlockhead, Dumfries and Galloway, Scotland, UKi
| Regional Level Types | |
|---|---|
| Wanlockhead | Village |
| Dumfries and Galloway | Council Area |
| Scotland | Country |
| UK | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
55° 23' 50'' North , 3° 47' 1'' West
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Sanquhar | 1,980 (2017) | 9.4km |
| Kirkconnel | 2,070 (2017) | 13.6km |
| Douglas | 1,560 (2017) | 17.5km |
| Thornhill | 1,610 (2017) | 18.3km |
| Rigside | 770 (2017) | 22.2km |
Mindat Locality ID:
2894
Long-form identifier:
mindat:1:2:2894:6
GUID (UUID V4):
95a92360-de71-40a1-a896-04fc3593ee89
Other/historical names associated with this locality:
Winlocke; Dumfriesshire
Other Languages:
French:
Wanlockhead, Dumfries and Galloway, Écosse, Royaume-Uni
German:
Wanlockhead, Dumfries and Galloway, Schottland, Vereinigtes Königreich
Scottish Gaelic:
Cuingealach, Comhairle Dhùn Phris is Ghall-Ghàidhealaibh, Alba, An Rìoghachd Aonaichte
Irish Gaelic:
Cuingealach, Comhairle Dhún Phrís is Gall-Ghaidhealaibh, Albain, An Ríocht Aontaithe
Old lead-zinc mining area, part of the Leadhills-Wanlockhead Mining District (see Leadhills, http://www.mindat.org/loc-3032.html).
Mining activities stopped in the 1930, a short period of revival in the 1950s and some dump treat continued up to the 1960s, with dumps used for road fill to around the 1980s-'90s.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities101 valid minerals. 1 (TL) - type locality of valid minerals. 1 erroneous literature entry.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Acanthite Formula: Ag2S Habit: very thin metallic inconspicuous sooty coatings on tiny wires of Silver/argentiferous lead, appearing within minutes of being exposed to the atmosphere Colour: black |
| ⓘ Anglesite Formula: PbSO4 Localities: Reported from at least 12 localities in this region. Habit: tabular, prismatic, blocky, bladed, platy, spiky, acicular... Colour: colourless, white, yellow, very rarely tinted blue by internal reflection from underlying blue minerals such as caledonite/langite References: |
| ⓘ Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 Localities: Lees Vein, Stake Moss, Wanlockhead, Dumfries and Galloway, Scotland, UK Straitstep Vein (Margaret's Vein), Wanlock Dod-Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK New Glencrieff Mine (Wanlockhead Mine; East and West branch of New Glencrieff Vein), Wanlockhead, Dumfries and Galloway, Scotland, UK Meadowfoot Mine, Wanlockhead, Dumfries and Galloway, Scotland, UK |
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) Localities: Description: May refer to plumbian apatite or mattheddleite. References: |
| ⓘ Aragonite Formula: CaCO3 Localities: Meadowfoot Smelter slag locality, Wanlockhead, Dumfries and Galloway, Scotland, UK Straitstep Vein (Margaret's Vein), Wanlock Dod-Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK Pates Knowes Smelter slag locality, Wanlockhead, Dumfries and Galloway, Scotland, UK Wanlockhead, Dumfries and Galloway, Scotland, UK Meadowfoot Mine, Wanlockhead, Dumfries and Galloway, Scotland, UK Colour: light blue References: |
| ⓘ Aragonite var. Lead-bearing Aragonite Formula: (Ca,Pb)CO3 References: |
| ⓘ Aurichalcite Formula: (Zn,Cu)5(CO3)2(OH)6 Localities: |
| ⓘ Baryte Formula: BaSO4 Localities: Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK New Cove Vein, Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK Cove Vein, Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK Straitstep Vein (Margaret's Vein), Wanlock Dod-Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK New Glencrieff Mine (Wanlockhead Mine; East and West branch of New Glencrieff Vein), Wanlockhead, Dumfries and Galloway, Scotland, UK References: |
| ⓘ Beudantite Formula: PbFe3(AsO4)(SO4)(OH)6 |
| ⓘ Blixite Formula: Pb8O5(OH)2Cl4 |
| ⓘ Boleite Formula: KPb26Ag9Cu24(OH)48Cl62 |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 Localities: Reported from at least 7 localities in this region. Colour: light to dark emerald green References: |
| ⓘ Calcite Formula: CaCO3 Localities: Reported from at least 13 localities in this region. |
| ⓘ Calcite var. Lead-bearing Calcite Formula: (Ca,Pb)CO3 Description: Recorded as "Plumbocalcite"
"Some Wanlockhead specimens have been recorded as containing up to 9.47% of lead carbonate." |
| ⓘ Caledonite Formula: Pb5Cu2(SO4)3(CO3)(OH)6 Localities: Reported from at least 7 localities in this region. Habit: acicular, prismatic Colour: blue(-green) References: |
| ⓘ Cassiterite Formula: SnO2 |
| ⓘ Cerussite Formula: PbCO3 Localities: Reported from at least 15 localities in this region. Habit: tabular, platy Colour: blue(-grey) References: |
| ⓘ Chalcocite Formula: Cu2S |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Reported from at least 9 localities in this region. |
| ⓘ Chenite Formula: Pb4Cu(SO4)2(OH)6 Localities: Meadowfoot Smelter slag locality, Wanlockhead, Dumfries and Galloway, Scotland, UK Cove Vein, Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK Pates Knowes Smelter slag locality, Wanlockhead, Dumfries and Galloway, Scotland, UK References: |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 Localities: Reported from at least 12 localities in this region. |
| ⓘ 'Clay minerals' |
| ⓘ Copiapite Formula: Fe2+Fe3+4(SO4)6(OH)2 · 20H2O Description: As a powdery yellow efflorescence on altered pyrite 'from 160 level, Wanlockhead, Dumfriesshire'. IGS specimen collected by J. Brown in 1916. ID confirmed by X-ray diffraction in 1979. |
| ⓘ Copper Formula: Cu Colour: copper-red Description: Also found as a Zinc-bearing variety. |
| ⓘ Corkite Formula: PbFe3(PO4)(SO4)(OH)6 Localities: Habit: Micro crystals Colour: Yellow to dark brown References: |
| ⓘ Cotunnite Formula: PbCl2 |
| ⓘ Covellite Formula: CuS Localities: Description: Occurs as a Zinc-bearing variety. |
| ⓘ Creaseyite Formula: Pb2Cu2Fe3+2(Si4.67Al0.33)O15.33(OH)3 · H2O Localities: Colour: Pale Green to mint green |
| ⓘ Crocoite Formula: PbCr6+O4 Habit: Primatic Colour: Dull orange |
| ⓘ Cuprite Formula: Cu2O Colour: red |
| ⓘ Cuprite var. Chalcotrichite Formula: Cu2O |
| ⓘ Cuprostibite Formula: Cu2(Sb,Tl) |
| ⓘ Descloizite Formula: PbZn(VO4)(OH) Localities: New Glencrieff Mine (Wanlockhead Mine; East and West branch of New Glencrieff Vein), Wanlockhead, Dumfries and Galloway, Scotland, UK New Vein, Wanlock Dod-Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK Cove Vein, Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK Belton Grain vein, Wanlock Dod-Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK |
| ⓘ 'Descloizite-Mottramite Series' Localities: References: |
| ⓘ Devilline Formula: CaCu4(SO4)2(OH)6 · 3H2O Localities: Habit: Lath-like Colour: Pale Blue to light blue References: |
| ⓘ Dolomite Formula: CaMg(CO3)2 |
| ⓘ Duftite Formula: PbCu(AsO4)(OH) Habit: Thin crusts Colour: Black Description: Recordede on a specimen from Taits Level, Whytes Cleugh. |
| ⓘ Elyite Formula: Pb4Cu(SO4)O2(OH)4 · H2O Localities: Meadowfoot Smelter slag locality, Wanlockhead, Dumfries and Galloway, Scotland, UK Cove Vein, Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK Pates Knowes Smelter slag locality, Wanlockhead, Dumfries and Galloway, Scotland, UK References: |
| ⓘ Erythrite Formula: Co3(AsO4)2 · 8H2O |
| ⓘ 'Fayalite-Forsterite Series' |
| ⓘ Ferrisurite Formula: (Pb,Ca)2.4Fe3+2(Si4O10)(CO3)1.7(OH)3 · nH2O Localities: |
| ⓘ Galena Formula: PbS Localities: Reported from at least 16 localities in this region. Colour: grey References: |
| ⓘ Goethite Formula: α-Fe3+O(OH) Localities: Reported from at least 12 localities in this region. |
| ⓘ Greenockite Formula: CdS Localities: |
| ⓘ Gypsum Formula: CaSO4 · 2H2O Colour: colourless |
| ⓘ Hematite Formula: Fe2O3 Localities: Reported from at least 9 localities in this region. |
| ⓘ Hemimorphite Formula: Zn4Si2O7(OH)2 · H2O Localities: Reported from at least 10 localities in this region. |
| ⓘ Hydrocerussite Formula: Pb3(CO3)2(OH)2 Localities: Belton Grain vein, Wanlock Dod-Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK Cove Vein, Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK New Cove Vein, Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK Meadowfoot Smelter slag locality, Wanlockhead, Dumfries and Galloway, Scotland, UK |
| ⓘ Hydrozincite Formula: Zn5(CO3)2(OH)6 Localities: References: |
| ⓘ Jarosite Formula: KFe3+3(SO4)2(OH)6 Localities: References: |
| ⓘ Kegelite Formula: Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 |
| ⓘ Lanarkite Formula: Pb2(SO4)O Localities: Reported from at least 10 localities in this region. Habit: bladed Colour: white, yellowish References: |
| ⓘ Langite Formula: Cu4(SO4)(OH)6 · 2H2O Localities: Reported from at least 6 localities in this region. Colour: blue References: |
| ⓘ Lautenthalite Formula: PbCu4(SO4)2(OH)6 · 3H2O |
| ⓘ Lead Formula: Pb Description: argentiferous in some cases |
| ⓘ Leadhillite Formula: Pb4(CO3)2(SO4)(OH)2 Localities: Reported from at least 11 localities in this region. Habit: botryoidal Colour: (creamy) white References: |
| ⓘ 'Limonite' Description: Mostly as crusts commonly coats other species and intermixed with clay minerals. |
| ⓘ Linarite Formula: PbCu(SO4)(OH)2 Localities: Reported from at least 9 localities in this region. References: |
| ⓘ Litharge Formula: PbO Localities: References: |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 Localities: |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 Localities: Reported from at least 11 localities in this region. Habit: botryoidal Colour: (yellowish) green, light brown (altered) References: |
| ⓘ Marcasite Formula: FeS2 |
| ⓘ Massicot Formula: PbO |
| ⓘ Mattheddleite Formula: Pb5(SiO4)1.5(SO4)1.5(Cl,OH) Localities: Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK Belton Grain vein, Wanlock Dod-Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK Cove Vein, Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK Wilsons Vein, Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK References: |
| ⓘ Melanterite Formula: Fe2+(H2O)6SO4 · H2O |
| ⓘ 'Melilite Group' Formula: Ca2M(XSiO7) |
| ⓘ Mimetite ? Formula: Pb5(AsO4)3Cl |
| ⓘ Monohydrocalcite Formula: CaCO3 · H2O Description: Natural History Museum London x-ray file number 4068F |
| ⓘ Mottramite Formula: PbCu(VO4)(OH) Localities: Reported from at least 7 localities in this region. |
| ⓘ Nickeline Formula: NiAs |
| ⓘ Oxyplumboroméite Formula: Pb2Sb2O6O |
| ⓘ Paralaurionite Formula: PbCl(OH) Localities: References: |
| ⓘ Pentlandite Formula: (NixFey)Σ9S8 |
| ⓘ Phosphohedyphane Formula: Ca2Pb3(PO4)3Cl Localities: Belton Grain vein, Wanlock Dod-Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK Cove Vein, Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK Wilsons Vein, Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK New Glencrieff Mine (Wanlockhead Mine; East and West branch of New Glencrieff Vein), Wanlockhead, Dumfries and Galloway, Scotland, UK References: |
| ⓘ Plattnerite Formula: PbO2 Localities: New Vein, Wanlock Dod-Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK Belton Grain vein, Wanlock Dod-Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK High Pirn Mine (Belton Grain Vein and New Vein), Wanlock Dod-Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK Meadowfoot Smelter slag locality, Wanlockhead, Dumfries and Galloway, Scotland, UK ? (more information) |
| ⓘ Plumbogummite Formula: PbAl3(PO4)(PO3OH)(OH)6 |
| ⓘ Plumbonacrite (TL) Formula: Pb5O(OH)2(CO3)3 Type Locality: Description: Work is continuing to confirm the occurance of plumbonacrite in the Leadhills-Wanlockhead Orefield. |
| ⓘ Posnjakite Formula: Cu4(SO4)(OH)6 · H2O |
| ⓘ Pseudoboleite Formula: Pb31Cu24Cl62(OH)48 |
| ⓘ 'Psilomelane' |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 9 localities in this region. |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl Localities: Reported from at least 13 localities in this region. |
| ⓘ Pyromorphite var. Calcium-bearing Pyromorphite Formula: (Pb,Ca)5(PO4)3Cl Localities: New Glencrieff Mine (Wanlockhead Mine; East and West branch of New Glencrieff Vein), Wanlockhead, Dumfries and Galloway, Scotland, UK High Pirn Mine (Belton Grain Vein and New Vein), Wanlock Dod-Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK Old Glencrieff Vein, Wanlockhead, Dumfries and Galloway, Scotland, UK Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK |
| ⓘ 'Pyroxene Group' Formula: ADSi2O6 |
| ⓘ Pyrrhotite Formula: Fe1-xS |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 16 localities in this region. References: |
| ⓘ Rammelsbergite Formula: NiAs2 |
| ⓘ Redgillite Formula: Cu6(SO4)(OH)10 · H2O Localities: |
| ⓘ 'Roméite Group' Formula: A2(Sb5+)2O6Z |
| ⓘ Rosiaite Formula: PbSb5+2O6 |
| ⓘ Schmiederite Formula: Pb2Cu2(Se6+O4)(Se4+O3)(OH)4 Description: NAM London X-Ray File 4377F (near Schmiederite) |
| ⓘ Schulenbergite Formula: (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| ⓘ Scotlandite Formula: PbSO3 |
| ⓘ Serpierite Formula: Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O Colour: blue-green |
| ⓘ Shattuckite Formula: Cu5(Si2O6)2(OH)2 |
| ⓘ Siderite Formula: FeCO3 |
| ⓘ Silver Formula: Ag Habit: tiny sprigs or wires coated by black sooty acanthite |
| ⓘ Smithsonite Formula: ZnCO3 Description: Listed as "calamine (zinc carbonate)". |
| ⓘ Sphalerite Formula: ZnS Localities: Reported from at least 7 localities in this region. |
| ⓘ Steverustite Formula: Pb2+5(OH)5[Cu+(S6+O3S2-)3](H2O)2 Description: Steverustite was visually identified by comparison with confirmed specimens from several Welsh and Scottish locations. |
| ⓘ Stolzite Formula: Pb(WO4) |
| ⓘ Sulphur Formula: S8 Localities: References: |
| ✪ Sundiusite Formula: Pb10(SO4)O8Cl2 Description: Natural History Museum London X-ray File number 6939F shows the mineral to be near Sundiusite but not100%. |
| ⓘ Susannite Formula: Pb4(CO3)2(SO4)(OH)2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Tenorite Formula: CuO Description: Well-formed typically black lustrous micro-crystals, with coverings on slag to several centimeters. |
| ⓘ 'Unnamed (Pb-Cu-Al-Si-O)' Formula: Pb-Cu-Al-Si-O |
| ⓘ Valentinite Formula: Sb2O3 |
| ⓘ Vanadinite Formula: Pb5(VO4)3Cl Localities: Reported from at least 8 localities in this region. Colour: Pale brown to Orange-red |
| ⓘ Formula: Pb2Cu(CrO4)(PO4)(OH) Description: Davies' Vauquelinite = Mottramite. See Bannister, F.A. (1933) The identity of mottramite and psittacinite with cupriferous descloizite. Mineralogical Magazine, vol. 23, n° 141, 376-386. References: Davies, Thos. (1877) VI.—Notes on Vauquelinite from Scotland, and Cantonite from Cornwall. Mineralogical Magazine and Journal of the Mineralogical Society, 1 (4) 112-114 doi:10.1180/minmag.1877.001.4.07 |
| ⓘ Veszelyite Formula: (Cu,Zn)2Zn(PO4)(OH)3 · 2H2O Localities: |
| ⓘ 'Wad' |
| ⓘ Willemite Formula: Zn2SiO4 |
| ⓘ Witherite Formula: BaCO3 |
| ⓘ Wroewolfeite Formula: Cu4(SO4)(OH)6 · 2H2O Localities: Colour: blue References: |
| ⓘ Wulfenite Formula: Pb(MoO4) Localities: |
| ⓘ Wüstite Formula: FeO |
| ⓘ Zincite Formula: ZnO |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Silver | 1.AA.05 | Ag |
| ⓘ | Lead | 1.AA.05 | Pb |
| ⓘ | Copper | 1.AA.05 | Cu |
| ⓘ | Sulphur | 1.CC.05 | S8 |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Cuprostibite | 2.AA.20 | Cu2(Sb,Tl) |
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Acanthite | 2.BA.35 | Ag2S |
| ⓘ | Pentlandite | 2.BB.15 | (NixFey)Σ9S8 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Greenockite | 2.CB.45 | CdS |
| ⓘ | Nickeline | 2.CC.05 | NiAs |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Rammelsbergite | 2.EB.15a | NiAs2 |
| Group 3 - Halides | |||
| ⓘ | Cotunnite | 3.AB.85 | PbCl2 |
| ⓘ | Pseudoboleite | 3.DB.10 | Pb31Cu24Cl62(OH)48 |
| ⓘ | Boleite | 3.DB.15 | KPb26Ag9Cu24(OH)48Cl62 |
| ⓘ | Paralaurionite | 3.DC.05 | PbCl(OH) |
| ⓘ | Blixite | 3.DC.50 | Pb8O5(OH)2Cl4 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | α-Fe3+O(OH) |
| ⓘ | Cuprite | 4.AA.10 | Cu2O |
| ⓘ | var. Chalcotrichite | 4.AA.10 | Cu2O |
| ⓘ | Tenorite | 4.AB.10 | CuO |
| ⓘ | Zincite | 4.AB.20 | ZnO |
| ⓘ | Wüstite | 4.AB.25 | FeO |
| ⓘ | Litharge | 4.AC.20 | PbO |
| ⓘ | Massicot | 4.AC.25 | PbO |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Valentinite | 4.CB.55 | Sb2O3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Plattnerite | 4.DB.05 | PbO2 |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Oxyplumboroméite | 4.DH. | Pb2Sb2O6O |
| ⓘ | 'Roméite Group' | 4.DH. | A2(Sb5+)2O6Z |
| ⓘ | Rosiaite | 4.DH.25 | PbSb5+2O6 |
| ⓘ | Scotlandite | 4.JE.20 | PbSO3 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite var. Lead-bearing Calcite | 5.AB.05 | (Ca,Pb)CO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Smithsonite | 5.AB.05 | ZnCO3 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Aragonite var. Lead-bearing Aragonite | 5.AB.15 | (Ca,Pb)CO3 |
| ⓘ | Witherite | 5.AB.15 | BaCO3 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Aurichalcite | 5.BA.15 | (Zn,Cu)5(CO3)2(OH)6 |
| ⓘ | Hydrozincite | 5.BA.15 | Zn5(CO3)2(OH)6 |
| ⓘ | Hydrocerussite | 5.BE.10 | Pb3(CO3)2(OH)2 |
| ⓘ | Plumbonacrite (TL) | 5.BE.15 | Pb5O(OH)2(CO3)3 |
| ⓘ | Leadhillite | 5.BF.40 | Pb4(CO3)2(SO4)(OH)2 |
| ⓘ | Susannite | 5.BF.40 | Pb4(CO3)2(SO4)(OH)2 |
| ⓘ | Monohydrocalcite | 5.CB.20 | CaCO3 · H2O |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Caledonite | 7.BC.50 | Pb5Cu2(SO4)3(CO3)(OH)6 |
| ⓘ | Linarite | 7.BC.65 | PbCu(SO4)(OH)2 |
| ⓘ | Schmiederite | 7.BC.65 | Pb2Cu2(Se6+O4)(Se4+O3)(OH)4 |
| ⓘ | Chenite | 7.BC.70 | Pb4Cu(SO4)2(OH)6 |
| ⓘ | Lanarkite | 7.BD.40 | Pb2(SO4)O |
| ⓘ | Sundiusite | 7.BD.70 | Pb10(SO4)O8Cl2 |
| ⓘ | Melanterite | 7.CB.35 | Fe2+(H2O)6SO4 · H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Copiapite | 7.DB.35 | Fe2+Fe3+4(SO4)6(OH)2 · 20H2O |
| ⓘ | Langite | 7.DD.10 | Cu4(SO4)(OH)6 · 2H2O |
| ⓘ | Posnjakite | 7.DD.10 | Cu4(SO4)(OH)6 · H2O |
| ⓘ | Wroewolfeite | 7.DD.10 | Cu4(SO4)(OH)6 · 2H2O |
| ⓘ | Devilline | 7.DD.30 | CaCu4(SO4)2(OH)6 · 3H2O |
| ⓘ | Serpierite | 7.DD.30 | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| ⓘ | Redgillite | 7.DD.70 | Cu6(SO4)(OH)10 · H2O |
| ⓘ | Schulenbergite | 7.DD.80 | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| ⓘ | Elyite | 7.DF.65 | Pb4Cu(SO4)O2(OH)4 · H2O |
| ⓘ | Lautenthalite | 7.DF.70 | PbCu4(SO4)2(OH)6 · 3H2O |
| ⓘ | Crocoite | 7.FA.20 | PbCr6+O4 |
| ⓘ | Vauquelinite ? | 7.FC.05 | Pb2Cu(CrO4)(PO4)(OH) |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| ⓘ | Stolzite | 7.GA.05 | Pb(WO4) |
| ⓘ | Steverustite | 7.JA.10 | Pb2+5(OH)5[Cu+(S6+O3S2-)3](H2O)2 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Duftite | 8.BH.35 | PbCu(AsO4)(OH) |
| ⓘ | Descloizite | 8.BH.40 | PbZn(VO4)(OH) |
| ⓘ | Mottramite | 8.BH.40 | PbCu(VO4)(OH) |
| ⓘ | Beudantite | 8.BL.05 | PbFe3(AsO4)(SO4)(OH)6 |
| ⓘ | Corkite | 8.BL.05 | PbFe3(PO4)(SO4)(OH)6 |
| ⓘ | Plumbogummite | 8.BL.10 | PbAl3(PO4)(PO3OH)(OH)6 |
| ⓘ | Pyromorphite var. Calcium-bearing Pyromorphite | 8.BN.05 | (Pb,Ca)5(PO4)3Cl |
| ⓘ | 8.BN.05 | Pb5(PO4)3Cl | |
| ⓘ | Vanadinite | 8.BN.05 | Pb5(VO4)3Cl |
| ⓘ | Phosphohedyphane | 8.BN.05 | Ca2Pb3(PO4)3Cl |
| ⓘ | Mimetite ? | 8.BN.05 | Pb5(AsO4)3Cl |
| ⓘ | Erythrite | 8.CE.40 | Co3(AsO4)2 · 8H2O |
| ⓘ | Veszelyite | 8.DE.30 | (Cu,Zn)2Zn(PO4)(OH)3 · 2H2O |
| Group 9 - Silicates | |||
| ⓘ | Willemite | 9.AA.05 | Zn2SiO4 |
| ⓘ | Mattheddleite | 9.AH.25 | Pb5(SiO4)1.5(SO4)1.5(Cl,OH) |
| ⓘ | Hemimorphite | 9.BD.10 | Zn4Si2O7(OH)2 · H2O |
| ⓘ | Shattuckite | 9.DB.40 | Cu5(Si2O6)2(OH)2 |
| ⓘ | Ferrisurite | 9.EC.75 | (Pb,Ca)2.4Fe3+2(Si4O10)(CO3)1.7(OH)3 · nH2O |
| ⓘ | Kegelite | 9.EC.80 | Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Creaseyite | 9.HH.15 | Pb2Cu2Fe3+2(Si4.67Al0.33)O15.33(OH)3 · H2O |
| Unclassified | |||
| ⓘ | 'Wad' | - | |
| ⓘ | 'Psilomelane' | - | |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Fayalite-Forsterite Series' | - | |
| ⓘ | 'Descloizite-Mottramite Series' | - | |
| ⓘ | 'Pyroxene Group' | - | ADSi2O6 |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| ⓘ | 'Melilite Group' | - | Ca2M(XSiO7) |
| ⓘ | 'Clay minerals' | - | |
| ⓘ | 'Unnamed (Pb-Cu-Al-Si-O)' | - | Pb-Cu-Al-Si-O |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| H | ⓘ Beudantite | PbFe3(AsO4)(SO4)(OH)6 |
| H | ⓘ Blixite | Pb8O5(OH)2Cl4 |
| H | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| H | ⓘ Chenite | Pb4Cu(SO4)2(OH)6 |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| H | ⓘ Corkite | PbFe3(PO4)(SO4)(OH)6 |
| H | ⓘ Creaseyite | Pb2Cu2Fe23+(Si4.67Al0.33)O15.33(OH)3 · H2O |
| H | ⓘ Descloizite | PbZn(VO4)(OH) |
| H | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| H | ⓘ Duftite | PbCu(AsO4)(OH) |
| H | ⓘ Elyite | Pb4Cu(SO4)O2(OH)4 · H2O |
| H | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| H | ⓘ Ferrisurite | (Pb,Ca)2.4Fe23+(Si4O10)(CO3)1.7(OH)3 · nH2O |
| H | ⓘ Goethite | α-Fe3+O(OH) |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| H | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| H | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| H | ⓘ Kegelite | Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 |
| H | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| H | ⓘ Lautenthalite | PbCu4(SO4)2(OH)6 · 3H2O |
| H | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| H | ⓘ Linarite | PbCu(SO4)(OH)2 |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Mattheddleite | Pb5(SiO4)1.5(SO4)1.5(Cl,OH) |
| H | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
| H | ⓘ Monohydrocalcite | CaCO3 · H2O |
| H | ⓘ Mottramite | PbCu(VO4)(OH) |
| H | ⓘ Paralaurionite | PbCl(OH) |
| H | ⓘ Plumbonacrite | Pb5O(OH)2(CO3)3 |
| H | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| H | ⓘ Pseudoboleite | Pb31Cu24Cl62(OH)48 |
| H | ⓘ Schmiederite | Pb2Cu2(Se6+O4)(Se4+O3)(OH)4 |
| H | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| H | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| H | ⓘ Shattuckite | Cu5(Si2O6)2(OH)2 |
| H | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| H | ⓘ Vauquelinite | Pb2Cu(CrO4)(PO4)(OH) |
| H | ⓘ Veszelyite | (Cu,Zn)2Zn(PO4)(OH)3 · 2H2O |
| H | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| H | ⓘ Redgillite | Cu6(SO4)(OH)10 · H2O |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| H | ⓘ Steverustite | Pb52+(OH)5[Cu+(S6+O3S2-)3](H2O)2 |
| C | Carbon | |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Ferrisurite | (Pb,Ca)2.4Fe23+(Si4O10)(CO3)1.7(OH)3 · nH2O |
| C | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| C | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| C | ⓘ Kegelite | Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 |
| C | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Monohydrocalcite | CaCO3 · H2O |
| C | ⓘ Plumbonacrite | Pb5O(OH)2(CO3)3 |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Smithsonite | ZnCO3 |
| C | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| C | ⓘ Aragonite var. Lead-bearing Aragonite | (Ca,Pb)CO3 |
| C | ⓘ Witherite | BaCO3 |
| C | ⓘ Calcite var. Lead-bearing Calcite | (Ca,Pb)CO3 |
| O | Oxygen | |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Beudantite | PbFe3(AsO4)(SO4)(OH)6 |
| O | ⓘ Blixite | Pb8O5(OH)2Cl4 |
| O | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Cuprite var. Chalcotrichite | Cu2O |
| O | ⓘ Chenite | Pb4Cu(SO4)2(OH)6 |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| O | ⓘ Corkite | PbFe3(PO4)(SO4)(OH)6 |
| O | ⓘ Creaseyite | Pb2Cu2Fe23+(Si4.67Al0.33)O15.33(OH)3 · H2O |
| O | ⓘ Crocoite | PbCr6+O4 |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Descloizite | PbZn(VO4)(OH) |
| O | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Duftite | PbCu(AsO4)(OH) |
| O | ⓘ Elyite | Pb4Cu(SO4)O2(OH)4 · H2O |
| O | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| O | ⓘ Ferrisurite | (Pb,Ca)2.4Fe23+(Si4O10)(CO3)1.7(OH)3 · nH2O |
| O | ⓘ Goethite | α-Fe3+O(OH) |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| O | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| O | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| O | ⓘ Kegelite | Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 |
| O | ⓘ Lanarkite | Pb2(SO4)O |
| O | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| O | ⓘ Lautenthalite | PbCu4(SO4)2(OH)6 · 3H2O |
| O | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| O | ⓘ Linarite | PbCu(SO4)(OH)2 |
| O | ⓘ Litharge | PbO |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Massicot | PbO |
| O | ⓘ Mattheddleite | Pb5(SiO4)1.5(SO4)1.5(Cl,OH) |
| O | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
| O | ⓘ Mimetite | Pb5(AsO4)3Cl |
| O | ⓘ Monohydrocalcite | CaCO3 · H2O |
| O | ⓘ Mottramite | PbCu(VO4)(OH) |
| O | ⓘ Paralaurionite | PbCl(OH) |
| O | ⓘ Plumbonacrite | Pb5O(OH)2(CO3)3 |
| O | ⓘ Plattnerite | PbO2 |
| O | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| O | ⓘ Pseudoboleite | Pb31Cu24Cl62(OH)48 |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Roméite Group | A2(Sb5+)2O6Z |
| O | ⓘ Schmiederite | Pb2Cu2(Se6+O4)(Se4+O3)(OH)4 |
| O | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| O | ⓘ Scotlandite | PbSO3 |
| O | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| O | ⓘ Shattuckite | Cu5(Si2O6)2(OH)2 |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Smithsonite | ZnCO3 |
| O | ⓘ Stolzite | Pb(WO4) |
| O | ⓘ Sundiusite | Pb10(SO4)O8Cl2 |
| O | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| O | ⓘ Aragonite var. Lead-bearing Aragonite | (Ca,Pb)CO3 |
| O | ⓘ Tenorite | CuO |
| O | ⓘ Valentinite | Sb2O3 |
| O | ⓘ Vanadinite | Pb5(VO4)3Cl |
| O | ⓘ Vauquelinite | Pb2Cu(CrO4)(PO4)(OH) |
| O | ⓘ Veszelyite | (Cu,Zn)2Zn(PO4)(OH)3 · 2H2O |
| O | ⓘ Willemite | Zn2SiO4 |
| O | ⓘ Witherite | BaCO3 |
| O | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| O | ⓘ Wüstite | FeO |
| O | ⓘ Wulfenite | Pb(MoO4) |
| O | ⓘ Zincite | ZnO |
| O | ⓘ Rosiaite | PbSb25+O6 |
| O | ⓘ Pyroxene Group | ADSi2O6 |
| O | ⓘ Redgillite | Cu6(SO4)(OH)10 · H2O |
| O | ⓘ Pyromorphite var. Calcium-bearing Pyromorphite | (Pb,Ca)5(PO4)3Cl |
| O | ⓘ Calcite var. Lead-bearing Calcite | (Ca,Pb)CO3 |
| O | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| O | ⓘ Melilite Group | Ca2M(XSiO7) |
| O | ⓘ Steverustite | Pb52+(OH)5[Cu+(S6+O3S2-)3](H2O)2 |
| O | ⓘ Oxyplumboroméite | Pb2Sb2O6O |
| O | ⓘ Unnamed (Pb-Cu-Al-Si-O) | Pb-Cu-Al-Si-O |
| F | Fluorine | |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Mg | Magnesium | |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Al | Aluminium | |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Creaseyite | Pb2Cu2Fe23+(Si4.67Al0.33)O15.33(OH)3 · H2O |
| Al | ⓘ Kegelite | Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 |
| Al | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Unnamed (Pb-Cu-Al-Si-O) | Pb-Cu-Al-Si-O |
| Si | Silicon | |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Creaseyite | Pb2Cu2Fe23+(Si4.67Al0.33)O15.33(OH)3 · H2O |
| Si | ⓘ Ferrisurite | (Pb,Ca)2.4Fe23+(Si4O10)(CO3)1.7(OH)3 · nH2O |
| Si | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Si | ⓘ Kegelite | Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 |
| Si | ⓘ Mattheddleite | Pb5(SiO4)1.5(SO4)1.5(Cl,OH) |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Shattuckite | Cu5(Si2O6)2(OH)2 |
| Si | ⓘ Willemite | Zn2SiO4 |
| Si | ⓘ Pyroxene Group | ADSi2O6 |
| Si | ⓘ Melilite Group | Ca2M(XSiO7) |
| Si | ⓘ Unnamed (Pb-Cu-Al-Si-O) | Pb-Cu-Al-Si-O |
| P | Phosphorus | |
| P | ⓘ Corkite | PbFe3(PO4)(SO4)(OH)6 |
| P | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| P | ⓘ Vauquelinite | Pb2Cu(CrO4)(PO4)(OH) |
| P | ⓘ Veszelyite | (Cu,Zn)2Zn(PO4)(OH)3 · 2H2O |
| P | ⓘ Pyromorphite var. Calcium-bearing Pyromorphite | (Pb,Ca)5(PO4)3Cl |
| P | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Beudantite | PbFe3(AsO4)(SO4)(OH)6 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Chenite | Pb4Cu(SO4)2(OH)6 |
| S | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| S | ⓘ Corkite | PbFe3(PO4)(SO4)(OH)6 |
| S | ⓘ Covellite | CuS |
| S | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| S | ⓘ Elyite | Pb4Cu(SO4)O2(OH)4 · H2O |
| S | ⓘ Galena | PbS |
| S | ⓘ Greenockite | CdS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| S | ⓘ Kegelite | Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 |
| S | ⓘ Lanarkite | Pb2(SO4)O |
| S | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| S | ⓘ Lautenthalite | PbCu4(SO4)2(OH)6 · 3H2O |
| S | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| S | ⓘ Linarite | PbCu(SO4)(OH)2 |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Mattheddleite | Pb5(SiO4)1.5(SO4)1.5(Cl,OH) |
| S | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
| S | ⓘ Pentlandite | (NixFey)Σ9S8 |
| S | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| S | ⓘ Scotlandite | PbSO3 |
| S | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Sulphur | S8 |
| S | ⓘ Sundiusite | Pb10(SO4)O8Cl2 |
| S | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| S | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| S | ⓘ Redgillite | Cu6(SO4)(OH)10 · H2O |
| S | ⓘ Steverustite | Pb52+(OH)5[Cu+(S6+O3S2-)3](H2O)2 |
| Cl | Chlorine | |
| Cl | ⓘ Blixite | Pb8O5(OH)2Cl4 |
| Cl | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| Cl | ⓘ Cotunnite | PbCl2 |
| Cl | ⓘ Mattheddleite | Pb5(SiO4)1.5(SO4)1.5(Cl,OH) |
| Cl | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Cl | ⓘ Paralaurionite | PbCl(OH) |
| Cl | ⓘ Pseudoboleite | Pb31Cu24Cl62(OH)48 |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Cl | ⓘ Sundiusite | Pb10(SO4)O8Cl2 |
| Cl | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Cl | ⓘ Pyromorphite var. Calcium-bearing Pyromorphite | (Pb,Ca)5(PO4)3Cl |
| Cl | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Ca | Calcium | |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Ferrisurite | (Pb,Ca)2.4Fe23+(Si4O10)(CO3)1.7(OH)3 · nH2O |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Monohydrocalcite | CaCO3 · H2O |
| Ca | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| Ca | ⓘ Aragonite var. Lead-bearing Aragonite | (Ca,Pb)CO3 |
| Ca | ⓘ Pyromorphite var. Calcium-bearing Pyromorphite | (Pb,Ca)5(PO4)3Cl |
| Ca | ⓘ Calcite var. Lead-bearing Calcite | (Ca,Pb)CO3 |
| Ca | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ca | ⓘ Melilite Group | Ca2M(XSiO7) |
| V | Vanadium | |
| V | ⓘ Descloizite | PbZn(VO4)(OH) |
| V | ⓘ Mottramite | PbCu(VO4)(OH) |
| V | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Cr | Chromium | |
| Cr | ⓘ Crocoite | PbCr6+O4 |
| Cr | ⓘ Vauquelinite | Pb2Cu(CrO4)(PO4)(OH) |
| Fe | Iron | |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Beudantite | PbFe3(AsO4)(SO4)(OH)6 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| Fe | ⓘ Corkite | PbFe3(PO4)(SO4)(OH)6 |
| Fe | ⓘ Creaseyite | Pb2Cu2Fe23+(Si4.67Al0.33)O15.33(OH)3 · H2O |
| Fe | ⓘ Ferrisurite | (Pb,Ca)2.4Fe23+(Si4O10)(CO3)1.7(OH)3 · nH2O |
| Fe | ⓘ Goethite | α-Fe3+O(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
| Fe | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Wüstite | FeO |
| Co | Cobalt | |
| Co | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| Ni | Nickel | |
| Ni | ⓘ Nickeline | NiAs |
| Ni | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Ni | ⓘ Rammelsbergite | NiAs2 |
| Cu | Copper | |
| Cu | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Cu | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Cuprite var. Chalcotrichite | Cu2O |
| Cu | ⓘ Chenite | Pb4Cu(SO4)2(OH)6 |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Creaseyite | Pb2Cu2Fe23+(Si4.67Al0.33)O15.33(OH)3 · H2O |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Cuprostibite | Cu2(Sb,Tl) |
| Cu | ⓘ Copper | Cu |
| Cu | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Cu | ⓘ Duftite | PbCu(AsO4)(OH) |
| Cu | ⓘ Elyite | Pb4Cu(SO4)O2(OH)4 · H2O |
| Cu | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| Cu | ⓘ Lautenthalite | PbCu4(SO4)2(OH)6 · 3H2O |
| Cu | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Mottramite | PbCu(VO4)(OH) |
| Cu | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| Cu | ⓘ Pseudoboleite | Pb31Cu24Cl62(OH)48 |
| Cu | ⓘ Schmiederite | Pb2Cu2(Se6+O4)(Se4+O3)(OH)4 |
| Cu | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| Cu | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| Cu | ⓘ Shattuckite | Cu5(Si2O6)2(OH)2 |
| Cu | ⓘ Tenorite | CuO |
| Cu | ⓘ Vauquelinite | Pb2Cu(CrO4)(PO4)(OH) |
| Cu | ⓘ Veszelyite | (Cu,Zn)2Zn(PO4)(OH)3 · 2H2O |
| Cu | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| Cu | ⓘ Redgillite | Cu6(SO4)(OH)10 · H2O |
| Cu | ⓘ Steverustite | Pb52+(OH)5[Cu+(S6+O3S2-)3](H2O)2 |
| Cu | ⓘ Unnamed (Pb-Cu-Al-Si-O) | Pb-Cu-Al-Si-O |
| Zn | Zinc | |
| Zn | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Zn | ⓘ Descloizite | PbZn(VO4)(OH) |
| Zn | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Zn | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| Zn | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| Zn | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| Zn | ⓘ Smithsonite | ZnCO3 |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Veszelyite | (Cu,Zn)2Zn(PO4)(OH)3 · 2H2O |
| Zn | ⓘ Willemite | Zn2SiO4 |
| Zn | ⓘ Zincite | ZnO |
| As | Arsenic | |
| As | ⓘ Beudantite | PbFe3(AsO4)(SO4)(OH)6 |
| As | ⓘ Duftite | PbCu(AsO4)(OH) |
| As | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| As | ⓘ Mimetite | Pb5(AsO4)3Cl |
| As | ⓘ Nickeline | NiAs |
| As | ⓘ Rammelsbergite | NiAs2 |
| Se | Selenium | |
| Se | ⓘ Schmiederite | Pb2Cu2(Se6+O4)(Se4+O3)(OH)4 |
| Mo | Molybdenum | |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
| Ag | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| Ag | ⓘ Silver | Ag |
| Cd | Cadmium | |
| Cd | ⓘ Greenockite | CdS |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sb | Antimony | |
| Sb | ⓘ Cuprostibite | Cu2(Sb,Tl) |
| Sb | ⓘ Roméite Group | A2(Sb5+)2O6Z |
| Sb | ⓘ Valentinite | Sb2O3 |
| Sb | ⓘ Rosiaite | PbSb25+O6 |
| Sb | ⓘ Oxyplumboroméite | Pb2Sb2O6O |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Witherite | BaCO3 |
| W | Tungsten | |
| W | ⓘ Stolzite | Pb(WO4) |
| Tl | Thallium | |
| Tl | ⓘ Cuprostibite | Cu2(Sb,Tl) |
| Pb | Lead | |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Beudantite | PbFe3(AsO4)(SO4)(OH)6 |
| Pb | ⓘ Blixite | Pb8O5(OH)2Cl4 |
| Pb | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| Pb | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Chenite | Pb4Cu(SO4)2(OH)6 |
| Pb | ⓘ Corkite | PbFe3(PO4)(SO4)(OH)6 |
| Pb | ⓘ Cotunnite | PbCl2 |
| Pb | ⓘ Creaseyite | Pb2Cu2Fe23+(Si4.67Al0.33)O15.33(OH)3 · H2O |
| Pb | ⓘ Crocoite | PbCr6+O4 |
| Pb | ⓘ Descloizite | PbZn(VO4)(OH) |
| Pb | ⓘ Duftite | PbCu(AsO4)(OH) |
| Pb | ⓘ Elyite | Pb4Cu(SO4)O2(OH)4 · H2O |
| Pb | ⓘ Ferrisurite | (Pb,Ca)2.4Fe23+(Si4O10)(CO3)1.7(OH)3 · nH2O |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| Pb | ⓘ Kegelite | Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 |
| Pb | ⓘ Lanarkite | Pb2(SO4)O |
| Pb | ⓘ Lautenthalite | PbCu4(SO4)2(OH)6 · 3H2O |
| Pb | ⓘ Lead | Pb |
| Pb | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| Pb | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Pb | ⓘ Litharge | PbO |
| Pb | ⓘ Massicot | PbO |
| Pb | ⓘ Mattheddleite | Pb5(SiO4)1.5(SO4)1.5(Cl,OH) |
| Pb | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Pb | ⓘ Mottramite | PbCu(VO4)(OH) |
| Pb | ⓘ Paralaurionite | PbCl(OH) |
| Pb | ⓘ Plumbonacrite | Pb5O(OH)2(CO3)3 |
| Pb | ⓘ Plattnerite | PbO2 |
| Pb | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| Pb | ⓘ Pseudoboleite | Pb31Cu24Cl62(OH)48 |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Pb | ⓘ Schmiederite | Pb2Cu2(Se6+O4)(Se4+O3)(OH)4 |
| Pb | ⓘ Scotlandite | PbSO3 |
| Pb | ⓘ Stolzite | Pb(WO4) |
| Pb | ⓘ Sundiusite | Pb10(SO4)O8Cl2 |
| Pb | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| Pb | ⓘ Aragonite var. Lead-bearing Aragonite | (Ca,Pb)CO3 |
| Pb | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Pb | ⓘ Vauquelinite | Pb2Cu(CrO4)(PO4)(OH) |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
| Pb | ⓘ Rosiaite | PbSb25+O6 |
| Pb | ⓘ Pyromorphite var. Calcium-bearing Pyromorphite | (Pb,Ca)5(PO4)3Cl |
| Pb | ⓘ Calcite var. Lead-bearing Calcite | (Ca,Pb)CO3 |
| Pb | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| Pb | ⓘ Steverustite | Pb52+(OH)5[Cu+(S6+O3S2-)3](H2O)2 |
| Pb | ⓘ Oxyplumboroméite | Pb2Sb2O6O |
| Pb | ⓘ Unnamed (Pb-Cu-Al-Si-O) | Pb-Cu-Al-Si-O |
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Wanlockhead |
|---|---|
| Wikidata ID: | Q1670511 |
Localities in this Region
- Scotland
- Dumfries and Galloway
- Wanlockhead
- Dumfries and Galloway
- Scotland
- Dumfries and Galloway
- Wanlockhead
- Wanlock Dod-Whytes Cleuch
- Waygate Shaft (Straitstep Vein)
- Whytes Cleuch
- Wanlockhead
- Dumfries and Galloway
Other Regions, Features and Areas containing this locality
British and Irish IslesGroup of Islands
Eurasian PlateTectonic Plate
EuropeContinent
UK
- Scotland
- Leadhills-Wanlockhead Mining DistrictMining District
- ⭔StrathclydeRegion
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Davies, Thos. (1877) VI.—Notes on Vauquelinite from Scotland, and Cantonite from Cornwall. Mineralogical Magazine and Journal of the Mineralogical Society, 1 (4) 112-114 doi:10.1180/minmag.1877.001.4.07
Bannister, F. A. (1933) The identity of mottramite and psittacinite with cupriferous descloizite. Mineralogical Magazine and Journal of the Mineralogical Society, 23 (141) 376-386 doi:10.1180/minmag.1933.023.141.04 (claims that Davies' (1877) identification of vauquelinite from Wanlockhead is incorrect and that the mineral in question is in fact mottramite)
Kingsbury, Arthur W. G., Hartley, J. (1956) New occurrences of vanadium minerals (mottramite, descloizite, and vanadinite) in the Caldbeck area of Cumberland. Mineralogical Magazine and Journal of the Mineralogical Society, 31 (235) 289-295 doi:10.1180/minmag.1956.031.235.02 (referring to Davies (1877) and Bannister (1933))
Quick NavTopCommoditiesMineral ListRock TypesOther DatabasesLocalities in RegionOther RegionsReferences
Wanlockhead, Dumfries and Galloway, Scotland, UK