Centre Hastings Municipality, Hastings County, Ontario, Canadai
| Regional Level Types | |
|---|---|
| Centre Hastings Municipality | Municipality |
| Hastings County | County |
| Ontario | Province |
| Canada | Country |
This page is currently not sponsored. Click here to sponsor this page.
Neighbouring regions:
Type:
Mindat Locality ID:
232968
Long-form identifier:
mindat:1:2:232968:3
GUID (UUID V4):
e3bd0435-d61c-47f1-b649-a95ff617d447
Other Languages:
French:
Centre Hastings, comté de Hastings, Ontario, Canada
German:
Centre Hastings, Hastings County, Ontario, Kanada
Spanish:
Centre Hastings, Ontario, Canadá
Polish:
Centre Hastings, Hrabstwo Hastings, Ontario, Kanada
Serbian:
Сентер Хејстингс, Онтарио, Канада
Serbo-Croatian:
Centre Hastings, Ontario, Kanada
Turkish:
Centre Hastings, Ontario, Kanada
The Municipality of Centre Hastings was formed by the amalgamation of the Village of Madoc with Huntingdon Township on 1 January 1998.
If you do not know exactly where in the area your sample comes from, then place it here rather than guessing. The list of minerals for this area is incomplete.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities79 valid minerals. 10 (TL) - type locality of valid minerals. 7 erroneous literature entries.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Gold | 1.AA.05 | Au |
| ⓘ | Antimony | 1.CA.05 | Sb |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Wurtzite ? | 2.CB.45 | (Zn,Fe)S |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Stibnite ? | 2.DB.05 | Sb2S3 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Skutterudite | 2.EC.05 | CoAs3 |
| ⓘ | Realgar ? | 2.FA.15a | As4S4 |
| ⓘ | Orpiment ? | 2.FA.30 | As2S3 |
| ⓘ | Bournonite | 2.GA.50 | PbCuSbS3 |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | Jamesonite | 2.HB.15 | Pb4FeSb6S14 |
| ⓘ | Twinnite (TL) | 2.HC.05a | Pb0.8Tl0.1Sb1.3As0.8S4 |
| ⓘ | Guettardite (TL) | 2.HC.05a | Pb8(Sb0.56As0.44)16S32 |
| ⓘ | Baumhauerite | 2.HC.05b | Pb12As16S36 |
| ⓘ | Veenite (TL) | 2.HC.05d | Pb16Sb9-xAs7+xS40, x ~ 0-0.5 |
| ⓘ | Semseyite | 2.HC.10d | Pb9Sb8S21 |
| ⓘ | Boulangerite | 2.HC.15 | Pb5Sb4S11 |
| ⓘ | Robinsonite | 2.HC.20 | Pb4Sb6S13 |
| ⓘ | Dadsonite (TL) | 2.HC.30 | Pb23Sb25S60Cl |
| ⓘ | Lopatkaite (TL) | 2.HC.50 | Pb5Sb3AsS11 |
| ⓘ | Jordanite ? | 2.JB.30a | Pb14As6S23 |
| ⓘ | Geocronite | 2.JB.30a | Pb14Sb6S23 |
| ⓘ | Zinkenite | 2.JB.35a | Pb9Sb22S42 |
| ⓘ | Gratonite ? | 2.JB.55 | Pb9As4S15 |
| ⓘ | Enargite ? | 2.KA.05 | Cu3AsS4 |
| ⓘ | Playfairite (TL) | 2.LB.30 | Pb16(Sb,As)19S44Cl |
| ⓘ | Launayite (TL) | 2.LB.30 | CuPb10(Sb,As)12S20 |
| ⓘ | Sorbyite (TL) | 2.LB.30 | CuPb9(Sb,As)11S26 |
| ⓘ | Sterryite (TL) | 2.LB.30 | Cu(Ag,Cu)3Pb19(Sb,As)22(As-As)S56 |
| ⓘ | Madocite (TL) | 2.LB.30 | Pb19(Sb,As)16S43 |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | α-Fe3+O(OH) |
| ⓘ | Gahnite | 4.BB.05 | ZnAl2O4 |
| ⓘ | Franklinite | 4.BB.05 | Zn2+Fe3+2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Maghemite | 4.BB.15 | (Fe3+0.67◻0.33)Fe3+2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | var. Martite | 4.CB.05 | Fe2O3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Ordoñezite | 4.DB.10 | ZnSb2O6 |
| ⓘ | Brannerite | 4.DH.05 | UTi2O6 |
| ⓘ | 'Bindheimite' | 4.DH.20 | Pb2Sb2O6O |
| ⓘ | Uraninite | 4.DL.05 | UO2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Magnesite | 5.AB.05 | MgCO3 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Aurichalcite | 5.BA.15 | (Zn,Cu)5(CO3)2(OH)6 |
| ⓘ | Hydromagnesite | 5.DA.05 | Mg5(CO3)4(OH)2 · 4H2O |
| ⓘ | Pyroaurite | 5.DA.50 | Mg6Fe3+2(OH)16[CO3] · 4H2O |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Celestine | 7.AD.35 | SrSO4 |
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Linarite | 7.BC.65 | PbCu(SO4)(OH)2 |
| ⓘ | Melanterite | 7.CB.35 | Fe2+(H2O)6SO4 · H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Ferrimolybdite | 7.GB.30 | Fe2(MoO4)3 · nH2O |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Erythrite | 8.CE.40 | Co3(AsO4)2 · 8H2O |
| ⓘ | Dufrénite | 8.DK.15 | Ca0.5Fe2+Fe3+5(PO4)4(OH)6 · 2H2O |
| Group 9 - Silicates | |||
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Staurolite | 9.AF.30 | Fe2+2Al9Si4O23(OH) |
| ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
| ⓘ | Hemimorphite | 9.BD.10 | Zn4Si2O7(OH)2 · H2O |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Vesuvianite | 9.BG.35 | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Stilpnomelane | 9.EG.40 | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| ⓘ | 'Chalcodite' | 9.EG.40 | K(Fe3+,Mg,Fe2+)8(Si,Al)12(O,OH)27 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| Unclassified | |||
| ⓘ | 'Pyrobitumen var. Thucholite' | - | |
| ⓘ | 'Petroleum var. Bitumen' | - | |
| ⓘ | 'Pyrobitumen' | - | |
| ⓘ | 'Serpentine Subgroup' | - | D3[Si2O5](OH)4 |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'Mica Group' | - | |
| ⓘ | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chlorite Group' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Dufrénite | Ca0.5Fe2+Fe53+(PO4)4(OH)6 · 2H2O |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| H | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| H | ⓘ Goethite | α-Fe3+O(OH) |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| H | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| H | ⓘ Linarite | PbCu(SO4)(OH)2 |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Pyroaurite | Mg6Fe23+(OH)16[CO3] · 4H2O |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| H | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| H | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| H | ⓘ Chalcodite | K(Fe3+,Mg,Fe2+)8(Si,Al)12(O,OH)27 |
| B | Boron | |
| B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| C | ⓘ Magnesite | MgCO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Pyroaurite | Mg6Fe23+(OH)16[CO3] · 4H2O |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Bindheimite | Pb2Sb2O6O |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Brannerite | UTi2O6 |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Celestine | SrSO4 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Dufrénite | Ca0.5Fe2+Fe53+(PO4)4(OH)6 · 2H2O |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| O | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| O | ⓘ Franklinite | Zn2+Fe23+O4 |
| O | ⓘ Gahnite | ZnAl2O4 |
| O | ⓘ Goethite | α-Fe3+O(OH) |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| O | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| O | ⓘ Linarite | PbCu(SO4)(OH)2 |
| O | ⓘ Magnesite | MgCO3 |
| O | ⓘ Maghemite | (Fe3+0.67◻0.33)Fe23+O4 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Hematite var. Martite | Fe2O3 |
| O | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Ordoñezite | ZnSb2O6 |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Pyroaurite | Mg6Fe23+(OH)16[CO3] · 4H2O |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| O | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Titanite | CaTi(SiO4)O |
| O | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| O | ⓘ Chalcodite | K(Fe3+,Mg,Fe2+)8(Si,Al)12(O,OH)27 |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorite | CaF2 |
| Na | Sodium | |
| Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| Mg | ⓘ Magnesite | MgCO3 |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | ⓘ Pyroaurite | Mg6Fe23+(OH)16[CO3] · 4H2O |
| Mg | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Mg | ⓘ Chalcodite | K(Fe3+,Mg,Fe2+)8(Si,Al)12(O,OH)27 |
| Al | Aluminium | |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Gahnite | ZnAl2O4 |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Al | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Al | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Al | ⓘ Chalcodite | K(Fe3+,Mg,Fe2+)8(Si,Al)12(O,OH)27 |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Si | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Titanite | CaTi(SiO4)O |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| Si | ⓘ Chalcodite | K(Fe3+,Mg,Fe2+)8(Si,Al)12(O,OH)27 |
| P | Phosphorus | |
| P | ⓘ Dufrénite | Ca0.5Fe2+Fe53+(PO4)4(OH)6 · 2H2O |
| S | Sulfur | |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Baumhauerite | Pb12As16S36 |
| S | ⓘ Boulangerite | Pb5Sb4S11 |
| S | ⓘ Bournonite | PbCuSbS3 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Celestine | SrSO4 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Dadsonite | Pb23Sb25S60Cl |
| S | ⓘ Enargite | Cu3AsS4 |
| S | ⓘ Galena | PbS |
| S | ⓘ Geocronite | Pb14Sb6S23 |
| S | ⓘ Gratonite | Pb9As4S15 |
| S | ⓘ Guettardite | Pb8(Sb0.56As0.44)16S32 |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Jamesonite | Pb4FeSb6S14 |
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| S | ⓘ Jordanite | Pb14As6S23 |
| S | ⓘ Launayite | CuPb10(Sb,As)12S20 |
| S | ⓘ Linarite | PbCu(SO4)(OH)2 |
| S | ⓘ Madocite | Pb19(Sb,As)16S43 |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Orpiment | As2S3 |
| S | ⓘ Playfairite | Pb16(Sb,As)19S44Cl |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Realgar | As4S4 |
| S | ⓘ Robinsonite | Pb4Sb6S13 |
| S | ⓘ Semseyite | Pb9Sb8S21 |
| S | ⓘ Sorbyite | CuPb9(Sb,As)11S26 |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Sterryite | Cu(Ag,Cu)3Pb19(Sb,As)22(As-As)S56 |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Twinnite | Pb0.8Tl0.1Sb1.3As0.8S4 |
| S | ⓘ Veenite | Pb16Sb9-xAs7+xS40, x ~ 0-0.5 |
| S | ⓘ Wurtzite | (Zn,Fe)S |
| S | ⓘ Zinkenite | Pb9Sb22S42 |
| S | ⓘ Lopatkaite | Pb5Sb3AsS11 |
| Cl | Chlorine | |
| Cl | ⓘ Dadsonite | Pb23Sb25S60Cl |
| Cl | ⓘ Playfairite | Pb16(Sb,As)19S44Cl |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| K | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| K | ⓘ Chalcodite | K(Fe3+,Mg,Fe2+)8(Si,Al)12(O,OH)27 |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Dufrénite | Ca0.5Fe2+Fe53+(PO4)4(OH)6 · 2H2O |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Ca | ⓘ Titanite | CaTi(SiO4)O |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Brannerite | UTi2O6 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTi(SiO4)O |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Dufrénite | Ca0.5Fe2+Fe53+(PO4)4(OH)6 · 2H2O |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| Fe | ⓘ Franklinite | Zn2+Fe23+O4 |
| Fe | ⓘ Goethite | α-Fe3+O(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Jamesonite | Pb4FeSb6S14 |
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | ⓘ Maghemite | (Fe3+0.67◻0.33)Fe23+O4 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Hematite var. Martite | Fe2O3 |
| Fe | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Pyroaurite | Mg6Fe23+(OH)16[CO3] · 4H2O |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Fe | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Fe | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Fe | ⓘ Wurtzite | (Zn,Fe)S |
| Fe | ⓘ Chalcodite | K(Fe3+,Mg,Fe2+)8(Si,Al)12(O,OH)27 |
| Co | Cobalt | |
| Co | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| Co | ⓘ Skutterudite | CoAs3 |
| Cu | Copper | |
| Cu | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Bournonite | PbCuSbS3 |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Enargite | Cu3AsS4 |
| Cu | ⓘ Launayite | CuPb10(Sb,As)12S20 |
| Cu | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Sorbyite | CuPb9(Sb,As)11S26 |
| Cu | ⓘ Sterryite | Cu(Ag,Cu)3Pb19(Sb,As)22(As-As)S56 |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Zn | Zinc | |
| Zn | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Zn | ⓘ Franklinite | Zn2+Fe23+O4 |
| Zn | ⓘ Gahnite | ZnAl2O4 |
| Zn | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Zn | ⓘ Ordoñezite | ZnSb2O6 |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Wurtzite | (Zn,Fe)S |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Baumhauerite | Pb12As16S36 |
| As | ⓘ Enargite | Cu3AsS4 |
| As | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| As | ⓘ Gratonite | Pb9As4S15 |
| As | ⓘ Guettardite | Pb8(Sb0.56As0.44)16S32 |
| As | ⓘ Jordanite | Pb14As6S23 |
| As | ⓘ Launayite | CuPb10(Sb,As)12S20 |
| As | ⓘ Madocite | Pb19(Sb,As)16S43 |
| As | ⓘ Orpiment | As2S3 |
| As | ⓘ Playfairite | Pb16(Sb,As)19S44Cl |
| As | ⓘ Realgar | As4S4 |
| As | ⓘ Skutterudite | CoAs3 |
| As | ⓘ Sorbyite | CuPb9(Sb,As)11S26 |
| As | ⓘ Sterryite | Cu(Ag,Cu)3Pb19(Sb,As)22(As-As)S56 |
| As | ⓘ Twinnite | Pb0.8Tl0.1Sb1.3As0.8S4 |
| As | ⓘ Veenite | Pb16Sb9-xAs7+xS40, x ~ 0-0.5 |
| As | ⓘ Lopatkaite | Pb5Sb3AsS11 |
| Sr | Strontium | |
| Sr | ⓘ Celestine | SrSO4 |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Mo | Molybdenum | |
| Mo | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| Mo | ⓘ Molybdenite | MoS2 |
| Ag | Silver | |
| Ag | ⓘ Sterryite | Cu(Ag,Cu)3Pb19(Sb,As)22(As-As)S56 |
| Sb | Antimony | |
| Sb | ⓘ Antimony | Sb |
| Sb | ⓘ Bindheimite | Pb2Sb2O6O |
| Sb | ⓘ Boulangerite | Pb5Sb4S11 |
| Sb | ⓘ Bournonite | PbCuSbS3 |
| Sb | ⓘ Dadsonite | Pb23Sb25S60Cl |
| Sb | ⓘ Geocronite | Pb14Sb6S23 |
| Sb | ⓘ Guettardite | Pb8(Sb0.56As0.44)16S32 |
| Sb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Sb | ⓘ Launayite | CuPb10(Sb,As)12S20 |
| Sb | ⓘ Madocite | Pb19(Sb,As)16S43 |
| Sb | ⓘ Ordoñezite | ZnSb2O6 |
| Sb | ⓘ Playfairite | Pb16(Sb,As)19S44Cl |
| Sb | ⓘ Robinsonite | Pb4Sb6S13 |
| Sb | ⓘ Semseyite | Pb9Sb8S21 |
| Sb | ⓘ Sorbyite | CuPb9(Sb,As)11S26 |
| Sb | ⓘ Sterryite | Cu(Ag,Cu)3Pb19(Sb,As)22(As-As)S56 |
| Sb | ⓘ Stibnite | Sb2S3 |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Sb | ⓘ Twinnite | Pb0.8Tl0.1Sb1.3As0.8S4 |
| Sb | ⓘ Veenite | Pb16Sb9-xAs7+xS40, x ~ 0-0.5 |
| Sb | ⓘ Zinkenite | Pb9Sb22S42 |
| Sb | ⓘ Lopatkaite | Pb5Sb3AsS11 |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Au | Gold | |
| Au | ⓘ Gold | Au |
| Tl | Thallium | |
| Tl | ⓘ Twinnite | Pb0.8Tl0.1Sb1.3As0.8S4 |
| Pb | Lead | |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Baumhauerite | Pb12As16S36 |
| Pb | ⓘ Bindheimite | Pb2Sb2O6O |
| Pb | ⓘ Boulangerite | Pb5Sb4S11 |
| Pb | ⓘ Bournonite | PbCuSbS3 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Dadsonite | Pb23Sb25S60Cl |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Geocronite | Pb14Sb6S23 |
| Pb | ⓘ Gratonite | Pb9As4S15 |
| Pb | ⓘ Guettardite | Pb8(Sb0.56As0.44)16S32 |
| Pb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Pb | ⓘ Jordanite | Pb14As6S23 |
| Pb | ⓘ Launayite | CuPb10(Sb,As)12S20 |
| Pb | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Pb | ⓘ Madocite | Pb19(Sb,As)16S43 |
| Pb | ⓘ Playfairite | Pb16(Sb,As)19S44Cl |
| Pb | ⓘ Robinsonite | Pb4Sb6S13 |
| Pb | ⓘ Semseyite | Pb9Sb8S21 |
| Pb | ⓘ Sorbyite | CuPb9(Sb,As)11S26 |
| Pb | ⓘ Sterryite | Cu(Ag,Cu)3Pb19(Sb,As)22(As-As)S56 |
| Pb | ⓘ Twinnite | Pb0.8Tl0.1Sb1.3As0.8S4 |
| Pb | ⓘ Veenite | Pb16Sb9-xAs7+xS40, x ~ 0-0.5 |
| Pb | ⓘ Zinkenite | Pb9Sb22S42 |
| Pb | ⓘ Lopatkaite | Pb5Sb3AsS11 |
| U | Uranium | |
| U | ⓘ Brannerite | UTi2O6 |
| U | ⓘ Uraninite | UO2 |
Fossils
There are 1 fossil localities from the PaleoBioDB database within this region.BETA TEST - These data are provided on an experimental basis and are taken from external databases. Mindat.org has no control currently over the accuracy of these data.
| Occurrences | 1 |
|---|---|
| Youngest Fossil Listed | 0.01 Ma (Pleistocene) |
| Oldest Fossil Listed | 0.13 Ma (Pleistocene) |
| Fossils from Region | Click here to show the list. |
| Fossil Localities | Click to show 1 fossil locality |
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Centre_Hastings |
|---|---|
| Wikidata ID: | Q4859999 |
| GeoNames ID: | 5919180 |
Localities in this Region
- Ontario
- Hastings County
- Centre Hastings Municipality
- ⭔Huntingdon Township
- Blakely Mine
- Canada Talc Mine (Madoc Talc mine; Conley mine; Henderson mine)
- Coe Mine
- Crookston Quarry South
- Howard-Hill Mine
- Johnston Mine
- Keene Mine (Keen; Kane; Bradley)
- Kilpatrick Mine
- Noyes Mine
- Perry Lake Mine
- Perry Mine
- Rogers Mine property
- Stoklosar quarries (Marmora Road quarries)
- Taylor Pit
- Unnamed Ti occurrence
- ⭔Huntingdon Township
- Centre Hastings Municipality
- Hastings County
- Ontario
- Hastings County
- Centre Hastings Municipality
- Huntingdon Township
- ⭔Madoc Township
- Bailey Mine
- Blakely Pyrite Mine (Queensboro)
- Canadian Sulphur Mine (Wellington)
- Curtis Quarry
- Dominion Mine
- Dufferin Iron Mine
- Eldorado Copper Mine (Coe Iron mine; Moore Iron mine)
- Gateford Prospect (Vankleek Prospect)
- Hobson Mine
- Hollandia Mine
- Lee Senior Mine
- McIlroy Mine
- Richardson Mine
- Seymour Mine
- Sophia Mine (Diamond Mine)
- Stoklosar II Pink Marble Quarries
- Wallbridge and Herrington Mine
- Wallbridge Iron Mine
- William Reynolds Mine
- Centre Hastings Municipality
- Hastings County
Other Regions, Features and Areas that Intersect
North America PlateTectonic Plate
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther Regions
Rogers Mine, Rogers mine property, Huntingdon Township, Centre Hastings Municipality, Hastings County, Ontario, Canada