Leipojärvi, Gällivare, Norrbotten County, Swedeni
| Regional Level Types | |
|---|---|
| Leipojärvi | - not defined - |
| Gällivare | Municipality |
| Norrbotten County | County |
| Sweden | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
67° 4' 21'' North , 20° 57' 26'' East (est.)
Estimate based on other nearby localities or region boundaries.
Margin of Error:
~0km
Köppen climate type:
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities12 valid minerals.
Detailed Mineral List:
| ⓘ Albite Formula: Na(AlSi3O8) Reference: Augsten, R. (2008): Pegmatite in Lappland: Rubellit aus Suorravaara. Lapis, 33 (3), 29-32. |
| ⓘ Albite var. Cleavelandite Formula: Na(AlSi3O8) Reference: Augsten, R. (2008): Pegmatite in Lappland: Rubellit aus Suorravaara. Lapis, 33 (3), 29-32. |
| ⓘ Beryl Formula: Be3Al2(Si6O18) Reference: No reference listed |
| ✪ Bismutotantalite Formula: Bi(Ta,Nb)O4 Description: Black elongated well developed crystals up to 1 cm size associated to colored tourmaline, albite, trilithionite et.c. Reference: Analysis by the Swedish Museum of Natural History 2018-2021 on the following specimen at the museum: bismutotantalite specimen no 20210380
|
| ⓘ Elbaite Formula: Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) Reference: Augsten, R. (2008): Pegmatite in Lappland: Rubellit aus Suorravaara. Lapis, 33 (3), 29-32. |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F Reference: Confirmed by the Swedish Museum of Natural History |
| ⓘ Fluor-elbaite Formula: Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F Description: The pink coloured tourmalines found at the locality has been found being fluor-elbaite. Analyzed by Andreas Karlsson, Swedish Museum of Natural History, specimen no. 20180261 and more specimens. Reference: Analysis by the Swedish Museum of Natural History 2018-2021 on the following specimen at the museum: fluor-elbaite specimen no 20180261 |
| ⓘ Hydrokenomicrolite Formula: (◻,H2O)2Ta2(O,OH)6(H2O) Reference: Analysis by the Swedish Museum of Natural History 2018-2021 on the following specimen at the museum: hydrokenomicrolite specimen no 20180263
|
| ⓘ 'Lepidolite' Reference: Augsten, R. (2008): Pegmatite in Lappland: Rubellit aus Suorravaara. Lapis, 33 (3), 29-32. |
| ⓘ Quartz Formula: SiO2 Reference: Augsten, R. (2008): Pegmatite in Lappland: Rubellit aus Suorravaara. Lapis, 33 (3), 29-32. |
| ⓘ Quartz var. Rose Quartz Formula: SiO2 Reference: Augsten, R. (2008): Pegmatite in Lappland: Rubellit aus Suorravaara. Lapis, 33 (3), 29-32. |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Reference: Augsten, R. (2008): Pegmatite in Lappland: Rubellit aus Suorravaara. Lapis, 33 (3), 29-32. |
| ⓘ Spessartine Formula: Mn2+3Al2(SiO4)3 Reference: Augsten, R. (2008): Pegmatite in Lappland: Rubellit aus Suorravaara. Lapis, 33 (3), 29-32. |
| ⓘ 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z Reference: Augsten, R. (2008): Pegmatite in Lappland: Rubellit aus Suorravaara. Lapis, 33 (3), 29-32. |
| ⓘ 'Tourmaline var. Rubellite' Formula: A(D3)G6(T6O18)(BO3)3X3Z Reference: Augsten, R. (2008): Pegmatite in Lappland: Rubellit aus Suorravaara. Lapis, 33 (3), 29-32. |
| ⓘ Trilithionite Formula: K(Li1.5Al1.5)(AlSi3O10)(F,OH)2 Description: Purple coloured flakes up to around 5 cm in size. Reference: Analysis by the Swedish Museum of Natural History 2018-2021 on the following specimen at the museum: trilitionite specimen no 20180265 |
| ⓘ Zircon Formula: Zr(SiO4) Description: Light brown small aggregates to 7 mm. Reference: Nysten, P., Lorin, T (2019): Suorravaara - en färgrik juvel i det inre av Lappland, Geologiskt Forum, 102 |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 4 - Oxides and Hydroxides | |||
|---|---|---|---|
| ⓘ | Bismutotantalite | 4.DE.30 | Bi(Ta,Nb)O4 |
| ⓘ | Hydrokenomicrolite | 4.DH.15 | (◻,H2O)2Ta2(O,OH)6(H2O) |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Rose Quartz | 4.DA.05 | SiO2 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| Group 9 - Silicates | |||
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Cleavelandite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Elbaite | 9.CK.05 | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Fluor-elbaite | 9.CK.05 | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| ⓘ | Trilithionite | 9.EC.20 | K(Li1.5Al1.5)(AlSi3O10)(F,OH)2 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| Unclassified Minerals, Rocks, etc. | |||
| ⓘ | 'Lepidolite' | - | |
| ⓘ | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
| ⓘ | 'var. Rubellite' | - | A(D3)G6(T6O18)(BO3)3X3Z |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| H | ⓘ Hydrokenomicrolite | (◻,H2O)2Ta2(O,OH)6(H2O) |
| H | ⓘ Trilithionite | K(Li1.5Al1.5)(AlSi3O10)(F,OH)2 |
| Li | Lithium | |
| Li | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Li | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| Li | ⓘ Trilithionite | K(Li1.5Al1.5)(AlSi3O10)(F,OH)2 |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline var. Rubellite | A(D3)G6(T6O18)(BO3)3X3Z |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| B | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| O | Oxygen | |
| O | ⓘ Bismutotantalite | Bi(Ta,Nb)O4 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| O | ⓘ Tourmaline var. Rubellite | A(D3)G6(T6O18)(BO3)3X3Z |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| O | ⓘ Quartz var. Rose Quartz | SiO2 |
| O | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| O | ⓘ Hydrokenomicrolite | (◻,H2O)2Ta2(O,OH)6(H2O) |
| O | ⓘ Trilithionite | K(Li1.5Al1.5)(AlSi3O10)(F,OH)2 |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | Fluorine | |
| F | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| F | ⓘ Trilithionite | K(Li1.5Al1.5)(AlSi3O10)(F,OH)2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| Na | Sodium | |
| Na | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| Al | Aluminium | |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| Al | ⓘ Trilithionite | K(Li1.5Al1.5)(AlSi3O10)(F,OH)2 |
| Si | Silicon | |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Si | ⓘ Quartz var. Rose Quartz | SiO2 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| Si | ⓘ Trilithionite | K(Li1.5Al1.5)(AlSi3O10)(F,OH)2 |
| Si | ⓘ Zircon | Zr(SiO4) |
| P | Phosphorus | |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| K | Potassium | |
| K | ⓘ Trilithionite | K(Li1.5Al1.5)(AlSi3O10)(F,OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Mn | Manganese | |
| Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Fe | Iron | |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | ⓘ Bismutotantalite | Bi(Ta,Nb)O4 |
| Ta | Tantalum | |
| Ta | ⓘ Bismutotantalite | Bi(Ta,Nb)O4 |
| Ta | ⓘ Hydrokenomicrolite | (◻,H2O)2Ta2(O,OH)6(H2O) |
| Bi | Bismuth | |
| Bi | ⓘ Bismutotantalite | Bi(Ta,Nb)O4 |
Localities in this Region
- Norrbotten County
- Gällivare
- Leipojärvi
- Gällivare
Other Regions, Features and Areas containing this locality
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Suorravaara, Leipojärvi, Gällivare, Norrbotten County, Sweden