Norrköping, Östergötland County, Swedeni
| Regional Level Types | |
|---|---|
| Norrköping | Municipality |
| Östergötland County | County |
| Sweden | Country |
This page is currently not sponsored. Click here to sponsor this page.
Locality type:
Largest Settlements:
| Place | Population |
|---|---|
| Norrköping | 93,765 (2017) |
| Åby | 6,917 (2017) |
| Krokek | 5,053 (2017) |
| Lindö | 4,763 (2017) |
| Skärblacka | 4,023 (2017) |
| Svärtinge | 3,326 (2017) |
Other Languages:
French:
Norrköping, Comté d'Östergötland, Suède
German:
Norrköping, Östergötlands län, Schweden
Italian:
Norrköping, Contea di Östergötland, Svezia
Russian:
Норрчёпинг, Эстергётланд, Швеция
Simplified Chinese:
诺尔雪平市, 东约特兰省, 瑞典
Spanish:
Municipio de Norrköping, Provincia de Östergötland, Suecia
Swedish:
Norrköping kommune, Östergötlands län, Sverige
Asturian:
Norrköpings, Provincia d'Östergötland, Suecia
Basque:
Norrköping udalerria, Östergötlandeko konderria, Suedia
Belarusian:
Норчэпінг, Эстэргётланд, Швецыя
Belarusian (Tarashkevitsa):
Нарчэпінг, Эстэр’ётлянд, Швэцыя
Bulgarian:
Норшьопинг, Йостерйотланд, Швеция
Cebuano:
Norrköpings Kommun, Östergötlands län, Suwesya
Danish:
Norrköpings kommun, Östergötlands län, Sverige
Dutch:
Norrköping, Östergötlands län, Zweden
Faroese:
Norrköpings kommuna, Östergötlands län, Svøríki
Farsi/Persian:
بخش نورشوپینگ, شهرستان اوستریوتلاند, سوئد
Finnish:
Norrköpingin kunta, Itä-Götanmaan lääni, Ruotsi
Hungarian:
Norrköping község, Östergötland megye, Svédország
Korean:
노르셰핑 시, 외스테르예틀란드주, 스웨덴
Limburgian:
Norrköping, Östergötlands län, Zwede
Low Saxon/Low German:
Kommun Norrköping, Lehn Oostgötland, Sweden
Minnan / Hokkien-Taiwanese:
Norrköping Chū-tī-chhī, Sūi-tián
Northern Sami:
Norrköpinga gielda, Nuortagötlándda leatna, Ruoŧŧa
Norwegian:
Norrköping kommune, Östergötlands län, Sverige
Norwegian (Nynorsk):
Norrköpings kommun, Östergötlands län, Sverige
Polish:
Gmina Norrköping, Östergötland, Szwecja
Portuguese:
Norrköping, Gotalândia Oriental, Suécia
Romanian:
Comuna Norrköping, Östergötlands län, Suedia
Tatar:
Норчөпиң, Швеция
Traditional Chinese:
諾爾雪平市, 瑞典
Ukrainian:
Норрчепінг, Естерйотланд, Швеція
Vietnamese:
Norrköping, Östergötland, Thụy Điển
Welsh:
Bwrdeistref Norrköping, Sweden
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities16 valid minerals.
Detailed Mineral List:
| ⓘ Albite Formula: Na(AlSi3O8) Localities: Reference: Swedish Museum of Natural History (NRM) catalogue |
| ⓘ Albite var. Oligoclase Formula: (Na,Ca)[Al(Si,Al)Si2O8] Reference: Perge, A. Unpublished communication 1971 |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 Localities: Reference: Swedish Museum of Natural History (NRM) catalogue |
| ⓘ Beryl Formula: Be3Al2(Si6O18) |
| ⓘ Beryllonite Formula: NaBePO4 Reference: Nysten,P. & Gustafsson, L.(2006): I jakt på sällsynta mineral. Geologiskt forum nr 49, 22-25 |
| ⓘ Bismuth Formula: Bi Reference: Swedish Museum of Natural History (NRM) catalogue |
| ⓘ Chrysoberyl Formula: BeAl2O4 Reference: Knut Edvard Larsen collection # 2023 (Ex Jörgen Langhof collection) |
| ⓘ Columbite-(Fe) Formula: Fe2+Nb2O6 Reference: Swedish Museum of Natural History (NRM) catalogue |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F Localities: Reference: Swedish Museum of Natural History (NRM) catalogue |
| ⓘ Microcline Formula: K(AlSi3O8) Localities: Reference: Swedish Museum of Natural History (NRM) catalogue |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reference: Knut Edvard Larsen collection ( # 628) |
| ⓘ Quartz Formula: SiO2 Reference: Swedish Museum of Natural History (NRM) catalogue |
| ⓘ 'Scapolite' Reference: www.runeberg.org |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Reference: Swedish Museum of Natural History (NRM) catalogue |
| ⓘ Titanite Formula: CaTi(SiO4)O Reference: www.runeberg.org |
| ⓘ Topaz Formula: Al2(SiO4)(F,OH)2 |
| ⓘ Triplite Formula: Mn2+2(PO4)F Reference: Palache, C., Berman, H., & Frondel, C. (1951), The System of Mineralogy of James Dwight Dana and Edward Salisbury Dana, Yale University 1837-1892, Volume II: 851. |
| ⓘ Zircon Formula: Zr(SiO4) Reference: Swedish Museum of Natural History (NRM) catalogue |
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Bismuth | 1.CA.05 | Bi |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Chrysoberyl | 4.BA.05 | BeAl2O4 |
| ⓘ | Columbite-(Fe) | 4.DB.35 | Fe2+Nb2O6 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Beryllonite | 8.AA.10 | NaBePO4 |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Triplite | 8.BB.10 | Mn2+2(PO4)F |
| Group 9 - Silicates | |||
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Oligoclase | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
| ⓘ | Topaz | 9.AF.35 | Al2(SiO4)(F,OH)2 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| Unclassified Minerals, Rocks, etc. | |||
| ⓘ | 'Scapolite' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| Be | ⓘ Beryllonite | NaBePO4 |
| Be | ⓘ Chrysoberyl | BeAl2O4 |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | Oxygen | |
| O | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| O | ⓘ Triplite | Mn22+(PO4)F |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Beryllonite | NaBePO4 |
| O | ⓘ Chrysoberyl | BeAl2O4 |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Titanite | CaTi(SiO4)O |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| F | Fluorine | |
| F | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| F | ⓘ Triplite | Mn22+(PO4)F |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| Na | Sodium | |
| Na | ⓘ Beryllonite | NaBePO4 |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | Aluminium | |
| Al | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Chrysoberyl | BeAl2O4 |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | Silicon | |
| Si | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Titanite | CaTi(SiO4)O |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| P | Phosphorus | |
| P | ⓘ Triplite | Mn22+(PO4)F |
| P | ⓘ Beryllonite | NaBePO4 |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| K | Potassium | |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Microcline | K(AlSi3O8) |
| Ca | Calcium | |
| Ca | ⓘ Titanite | CaTi(SiO4)O |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ti | Titanium | |
| Ti | ⓘ Titanite | CaTi(SiO4)O |
| Mn | Manganese | |
| Mn | ⓘ Triplite | Mn22+(PO4)F |
| Fe | Iron | |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| Bi | Bismuth | |
| Bi | ⓘ Bismuth | Bi |
Fossils
This region is too big to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Norrk%C3%B6ping_Municipality |
|---|---|
| Wikidata ID: | Q504676 |
| GeoNames ID: | 2688367 |
Localities in this Region
- Östergötland County
Other Regions, Features and Areas that Intersect
Eurasian PlateTectonic Plate
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Lilla Älgsjö Quarry, Kolmården, Norrköping, Östergötland County, Sweden