Askom Mine, Dalen Molybdenum and Copper Mines, Dalen, Tokke, Telemark, Norwayi
Regional Level Types | |
---|---|
Askom Mine | Mine |
Dalen Molybdenum and Copper Mines | Group of Mines |
Dalen | Town |
Tokke | Municipality |
Telemark | County |
Norway | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Mindat Locality ID:
51052
Long-form identifier:
mindat:1:2:51052:8
GUID (UUID V4):
2dc3e84c-1975-4bab-8723-97cf52c5c538
Other Languages:
Norwegian:
Askom gruve, Dalen molybdengruver, Dalen, Tokke, Telemark, Norge
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded at this locality.Mineral List
21 valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
ⓘ Albite Formula: Na(AlSi3O8) |
ⓘ 'Annite-Phlogopite Series' |
ⓘ Baryte Formula: BaSO4 |
ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
ⓘ Bornite Formula: Cu5FeS4 |
ⓘ Calcite Formula: CaCO3 |
ⓘ Chalcocite Formula: Cu2S |
ⓘ Chalcopyrite Formula: CuFeS2 |
ⓘ 'Chlorite Group' |
ⓘ Clausthalite Formula: PbSe |
ⓘ Covellite Formula: CuS |
ⓘ Dravite Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
ⓘ Galena Formula: PbS |
ⓘ Hematite Formula: Fe2O3 |
ⓘ 'K Feldspar' |
ⓘ Malachite Formula: Cu2(CO3)(OH)2 |
ⓘ Molybdenite Formula: MoS2 |
ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
ⓘ Powellite Formula: Ca(MoO4) |
ⓘ Pyrite Formula: FeS2 |
ⓘ Quartz Formula: SiO2 |
ⓘ Scheelite Formula: Ca(WO4) |
ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
ⓘ 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
Group 2 - Sulphides and Sulfosalts | |||
---|---|---|---|
ⓘ | Chalcocite | 2.BA.05 | Cu2S |
ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
ⓘ | Covellite | 2.CA.05a | CuS |
ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
ⓘ | Galena | 2.CD.10 | PbS |
ⓘ | Clausthalite | 2.CD.10 | PbSe |
ⓘ | Molybdenite | 2.EA.30 | MoS2 |
ⓘ | Pyrite | 2.EB.05a | FeS2 |
Group 4 - Oxides and Hydroxides | |||
ⓘ | Hematite | 4.CB.05 | Fe2O3 |
ⓘ | Quartz | 4.DA.05 | SiO2 |
Group 5 - Nitrates and Carbonates | |||
ⓘ | Calcite | 5.AB.05 | CaCO3 |
ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
ⓘ | Baryte | 7.AD.35 | BaSO4 |
ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
ⓘ | Powellite | 7.GA.05 | Ca(MoO4) |
Group 9 - Silicates | |||
ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
Unclassified | |||
ⓘ | 'Chlorite Group' | - | |
ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
ⓘ | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
ⓘ | 'K Feldspar' | - | |
ⓘ | 'Annite-Phlogopite Series' | - |
List of minerals for each chemical element
H | Hydrogen | |
---|---|---|
H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
H | ⓘ Malachite | Cu2(CO3)(OH)2 |
H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
B | Boron | |
B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
B | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
C | Carbon | |
C | ⓘ Calcite | CaCO3 |
C | ⓘ Malachite | Cu2(CO3)(OH)2 |
O | Oxygen | |
O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
O | ⓘ Albite | Na(AlSi3O8) |
O | ⓘ Baryte | BaSO4 |
O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
O | ⓘ Calcite | CaCO3 |
O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
O | ⓘ Hematite | Fe2O3 |
O | ⓘ Malachite | Cu2(CO3)(OH)2 |
O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
O | ⓘ Powellite | Ca(MoO4) |
O | ⓘ Quartz | SiO2 |
O | ⓘ Scheelite | Ca(WO4) |
O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
O | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
F | Fluorine | |
F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
Na | Sodium | |
Na | ⓘ Albite | Na(AlSi3O8) |
Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
Mg | Magnesium | |
Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
Al | Aluminium | |
Al | ⓘ Albite | Na(AlSi3O8) |
Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
Si | Silicon | |
Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
Si | ⓘ Albite | Na(AlSi3O8) |
Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
Si | ⓘ Quartz | SiO2 |
Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
S | Sulfur | |
S | ⓘ Baryte | BaSO4 |
S | ⓘ Bornite | Cu5FeS4 |
S | ⓘ Chalcopyrite | CuFeS2 |
S | ⓘ Chalcocite | Cu2S |
S | ⓘ Covellite | CuS |
S | ⓘ Galena | PbS |
S | ⓘ Molybdenite | MoS2 |
S | ⓘ Pyrite | FeS2 |
K | Potassium | |
K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
Ca | Calcium | |
Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
Ca | ⓘ Calcite | CaCO3 |
Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
Ca | ⓘ Powellite | Ca(MoO4) |
Ca | ⓘ Scheelite | Ca(WO4) |
Ti | Titanium | |
Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
Fe | Iron | |
Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
Fe | ⓘ Bornite | Cu5FeS4 |
Fe | ⓘ Chalcopyrite | CuFeS2 |
Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
Fe | ⓘ Hematite | Fe2O3 |
Fe | ⓘ Pyrite | FeS2 |
Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
Cu | Copper | |
Cu | ⓘ Bornite | Cu5FeS4 |
Cu | ⓘ Chalcopyrite | CuFeS2 |
Cu | ⓘ Chalcocite | Cu2S |
Cu | ⓘ Covellite | CuS |
Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
Se | Selenium | |
Se | ⓘ Clausthalite | PbSe |
Mo | Molybdenum | |
Mo | ⓘ Molybdenite | MoS2 |
Mo | ⓘ Powellite | Ca(MoO4) |
Ba | Barium | |
Ba | ⓘ Baryte | BaSO4 |
W | Tungsten | |
W | ⓘ Scheelite | Ca(WO4) |
Pb | Lead | |
Pb | ⓘ Clausthalite | PbSe |
Pb | ⓘ Galena | PbS |
Other Regions, Features and Areas containing this locality
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.