La Fregeneda, Salamanca, Castile and Leon, Spaini
| Regional Level Types | |
|---|---|
| La Fregeneda | Municipality |
| Salamanca | Province |
| Castile and Leon | Autonomous Community |
| Spain | Group of Countries |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Largest Settlements:
| Place | Population |
|---|---|
| La Fregeneda | 457 (2012) |
Mindat Locality ID:
155484
Long-form identifier:
mindat:1:2:155484:0
GUID (UUID V4):
c8384406-d539-45d5-9642-466007d16b9d
Other Languages:
French:
La Fregeneda, Salamanque, Castille-et-León, Espagne
German:
La Fregeneda, Provinz Salamanca, Kastilien und León, Spanien
Italian:
La Fregeneda, provincia di Salamanca, Castiglia e León, Spagna
Russian:
Ла-Фрехенеда, Саламанка, Кастилия-Леон, Испания
Simplified Chinese:
拉夫雷赫内达, 萨拉曼卡省, 卡斯蒂利亚-莱昂, 西班牙
Spanish:
La Fregeneda, Salamanca, Castilla y León, España
Aragonese:
La Fregeneda, Provincia de Salamanca, Castiella y Leyón, Espanya
Asturian:
La Freisneda, Provincia de Salamanca, Castiella y Llión, España
Basque:
La Fregeneda, Salamancako probintzia, Gaztela eta Leon, Espainia
Breton:
La Fregeneda, Proviñs Salamanca, Kastilha ha León, Spagn
Catalan:
La Fregeneda, Salamanca, Castella i Lleó, Espanya
Cebuano:
Fregeneda, Provincia de Salamanca, Castilla y León, Espanya
Chechen:
Ла-Фрехенеда, Испани
Dutch:
La Fregeneda, Salamanca, Castilië en León, Spanje
Esperanto:
La Fregeneda, Provinco Salamanko, Kastilio kaj Leono, Hispanio
Hawaiian:
La Fregeneda, Castille a Leon, Sepania
Hungarian:
La Fregeneda, Salamanca, Kasztília és León, Spanyolország
Interlingua:
La Fregeneda, Provincia Salamanca, Castilia e León, Espania
Interlingue:
La Fregeneda, Hispania
Irish Gaelic:
La Fregeneda, Castilla y León, An Spáinn
Kazakh (Cyrillic Script):
Ла-Фрехенеда, Саламанка, Кастилия және Леон, Испания
Ladin:
La Fregeneda
Lombard:
La Fregeneda, Spagna
Luxembourgish:
La Fregeneda, Provënz Salamanca, Kastilien-León, Spuenien
Malay:
La Fregeneda, Wilayah Salamanca, Castile-León, Sepanyol
Minnan / Hokkien-Taiwanese:
La Fregeneda, Salamanca Séng, Castilla kap León, Se-pan-gâ
Norwegian:
La Fregeneda, Salamanca, Castilla y León, Spania
Occitan:
La Fregeneda, Salamanca, Castelha e Leon, Espanha
Polish:
La Fregeneda, Salamanka, Kastylia i León, Hiszpania
Portuguese:
Fregeneda, Salamanca, Castela e Leão, Espanha
Swedish:
Fregeneda, Salamanca, Kastilien och León, Spanien
Tatar:
Ла-Фрехенеда, Кастилия һәм Леон, Испания
Traditional Chinese:
拉夫雷赫內達, 薩拉曼卡省, 卡斯提亞與利昂, 西班牙
Turkish:
La Fregeneda, Salamanca ili, Kastilya ve Leon, İspanya
Ukrainian:
Ла-Фрехенеда, Саламанка, Кастилія і Леон, Іспанія
Uzbek (Latin Script):
La Fregeneda, Salamanka, Castilla y León, Ispaniya
Venetian:
La Fregeneda, Castilia e León, Spagna
Waray:
La Fregeneda, Provincia de Salamanca, Castilla y León, Espanya
La Fregeneda is a municipality of Spain, located in the province of Salamanca, in Castile and León. There are several hundred pegmatites in the area.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities46 valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Albite Formula: Na(AlSi3O8) Localities: Feli Sn deposit, La Fregeneda, Salamanca, Castile and Leon, Spain La Fregeneda, Salamanca, Castile and Leon, Spain Alberto pit, La Fregeneda, Salamanca, Castile and Leon, Spain Hinojosa-Saucelle road, La Fregeneda, Salamanca, Castile and Leon, Spain Tumbo de la Caldera pegmatite, La Fregeneda, Salamanca, Castile and Leon, Spain Description: Albitized microcline selvages (greisens) in pegmatite dykes.
First generation of pegmatites. References: |
| ⓘ Alluaudite Formula: (Na,Ca)Mn2+(Fe3+,Mn2+,Fe2+,Mg)2(PO4)3 References: |
| ⓘ Andalusite Formula: Al2(SiO4)O References: |
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) Localities: Description: First generation of pegmatites.
Second generation of pegmatites. References: |
| ⓘ Arsenopyrite Formula: FeAsS Description: First generation of pegmatites. |
| ⓘ Beryl Formula: Be3Al2(Si6O18) Localities: Description: Second generation of pegmatites. References: |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 References: |
| ⓘ Bismuth Formula: Bi Description: First generation of pegmatites. |
| ⓘ Bismuthinite Formula: Bi2S3 Description: First generation of pegmatites. |
| ⓘ Cassiterite Formula: SnO2 Localities: Feli Sn deposit, La Fregeneda, Salamanca, Castile and Leon, Spain Alberto pit, La Fregeneda, Salamanca, Castile and Leon, Spain La Fregeneda, Salamanca, Castile and Leon, Spain Hinojosa-Saucelle road, La Fregeneda, Salamanca, Castile and Leon, Spain Tumbo de la Caldera pegmatite, La Fregeneda, Salamanca, Castile and Leon, Spain Description: First generation of pegmatites.
Second generation of pegmatites. References: |
| ⓘ Chalcocite Formula: Cu2S |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Description: First generation of pegmatites. |
| ⓘ Childrenite Formula: Fe2+Al(PO4)(OH)2 · H2O |
| ⓘ 'Chlorite Group' References: |
| ⓘ Columbite-(Fe) Formula: Fe2+Nb2O6 |
| ⓘ 'Columbite-(Fe)-Columbite-(Mn) Series' Description: First generation of pegmatites.
Second generation of pegmatites. |
| ⓘ 'Columbite Group' Localities: |
| ⓘ Columbite-(Mn) Formula: Mn2+Nb2O6 |
| ⓘ Covellite Formula: CuS Description: First generation of pegmatites. |
| ⓘ Crandallite Formula: CaAl3(PO4)(PO3OH)(OH)6 |
| ⓘ Eucryptite Formula: LiAlSiO4 Localities: References: |
| ⓘ Ferberite Formula: FeWO4 Description: First generation of pegmatites. |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F Localities: |
| ⓘ Fluorite Formula: CaF2 Description: Second generation of pegmatites. |
| ⓘ Galena Formula: PbS Localities: Description: First generation of pegmatites. |
| ⓘ Graftonite Formula: Fe2+Fe2+2(PO4)2 References: |
| ⓘ Heterosite Formula: (Fe3+,Mn3+)PO4 References: |
| ⓘ 'Jahnsite Group' Formula: XM1M22M32(H2O)8(OH)2(PO4)4 |
| ⓘ 'K Feldspar' Localities: Description: Second generation of pegmatites. References: |
| ⓘ 'Lepidolite' Localities: Description: Second generation of pegmatites. References: |
| ⓘ Lithiophilite var. Sicklerite Formula: Li1-x(Mn3+xMn2+1-x)PO4 |
| ⓘ Messelite Formula: Ca2Fe2+(PO4)2 · 2H2O |
| ⓘ Microcline Formula: K(AlSi3O8) Localities: Description: Albitized microcline selvages (greisens) in pegmatite dykes.
First generation of pegmatites. References: |
| ⓘ Molybdenite Formula: MoS2 |
| ⓘ Montebrasite Formula: LiAl(PO4)(OH) Localities: Alberto pit, La Fregeneda, Salamanca, Castile and Leon, Spain La Fregeneda, Salamanca, Castile and Leon, Spain Feli Sn deposit, La Fregeneda, Salamanca, Castile and Leon, Spain Hinojosa-Saucelle road, La Fregeneda, Salamanca, Castile and Leon, Spain Tumbo de la Caldera pegmatite, La Fregeneda, Salamanca, Castile and Leon, Spain References: |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: Feli Sn deposit, La Fregeneda, Salamanca, Castile and Leon, Spain Alberto pit, La Fregeneda, Salamanca, Castile and Leon, Spain La Fregeneda, Salamanca, Castile and Leon, Spain Hinojosa-Saucelle road, La Fregeneda, Salamanca, Castile and Leon, Spain Tumbo de la Caldera pegmatite, La Fregeneda, Salamanca, Castile and Leon, Spain Description: First generation of pegmatites. References: |
| ⓘ Orthoclase Formula: K(AlSi3O8) |
| ⓘ Petalite Formula: LiAl(Si4O10) Localities: References: |
| ⓘ Purpurite Formula: Mn3+(PO4) References: |
| ⓘ Pyrite Formula: FeS2 References: |
| ⓘ Quartz Formula: SiO2 Localities: Feli Sn deposit, La Fregeneda, Salamanca, Castile and Leon, Spain Alberto pit, La Fregeneda, Salamanca, Castile and Leon, Spain La Fregeneda, Salamanca, Castile and Leon, Spain Hinojosa-Saucelle road, La Fregeneda, Salamanca, Castile and Leon, Spain Tumbo de la Caldera pegmatite, La Fregeneda, Salamanca, Castile and Leon, Spain References: |
| ⓘ Rockbridgeite Formula: Fe2+Fe3+4(PO4)3(OH)5 |
| ⓘ Rosemaryite Formula: (Na,Ca,Mn)(Mn,Fe2+)(Fe3+,Mg)Al(PO4)3 |
| ⓘ Rutile Formula: TiO2 Description: Second generation of pegmatites. |
| ⓘ Sarcopside Formula: Fe2+3(PO4)2 References: |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Sphalerite Formula: ZnS Localities: Description: First generation of pegmatites. |
| ⓘ Spodumene Formula: LiAlSi2O6 Localities: Description: Second generation of pegmatites. References: |
| ⓘ Stannite Formula: Cu2FeSnS4 Localities: Description: First generation of pegmatites. References: |
| ⓘ 'Tantalite' Formula: (Mn,Fe)(Ta,Nb)2O6 Description: First generation of pegmatites.
Second generation of pegmatites. |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S Description: First generation of pegmatites. |
| ⓘ 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z Localities: Description: Second generation of pegmatites. |
| ⓘ Triphylite var. Ferrisicklerite Formula: Li1-x(Fe3+xFe2+1-x)PO4 References: |
| ⓘ Triplite Formula: Mn2+2(PO4)F References: |
| ⓘ Varulite Formula: NaCaMn2+Mn2+2(PO4)3 |
| ⓘ Väyrynenite Formula: BeMn2+(PO4)(OH) References: |
| ⓘ Wyllieite Formula: (Na,Ca,Mn)(Mn,Fe)(Fe,Mg)Al(PO4)3 References: |
| ⓘ Zircon Formula: Zr(SiO4) Description: First generation of pegmatites. |
| ⓘ Zwieselite Formula: Fe2+2(PO4)F |
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Bismuth | 1.CA.05 | Bi |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Stannite | 2.CB.15a | Cu2FeSnS4 |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Ferberite | 4.DB.30 | FeWO4 |
| ⓘ | Columbite-(Fe) | 4.DB.35 | Fe2+Nb2O6 |
| ⓘ | Columbite-(Mn) | 4.DB.35 | Mn2+Nb2O6 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Purpurite | 8.AB.10 | Mn3+(PO4) |
| ⓘ | Triphylite var. Ferrisicklerite | 8.AB.10 | Li1-x(Fe3+xFe2+1-x)PO4 |
| ⓘ | Lithiophilite var. Sicklerite | 8.AB.10 | Li1-x(Mn3+xMn2+1-x)PO4 |
| ⓘ | Heterosite | 8.AB.10 | (Fe3+,Mn3+)PO4 |
| ⓘ | Sarcopside | 8.AB.15 | Fe2+3(PO4)2 |
| ⓘ | Graftonite | 8.AB.20 | Fe2+Fe2+2(PO4)2 |
| ⓘ | Varulite | 8.AC.10 | NaCaMn2+Mn2+2(PO4)3 |
| ⓘ | Alluaudite | 8.AC.10 | (Na,Ca)Mn2+(Fe3+,Mn2+,Fe2+,Mg)2(PO4)3 |
| ⓘ | Rosemaryite | 8.AC.15 | (Na,Ca,Mn)(Mn,Fe2+)(Fe3+,Mg)Al(PO4)3 |
| ⓘ | Wyllieite | 8.AC.15 | (Na,Ca,Mn)(Mn,Fe)(Fe,Mg)Al(PO4)3 |
| ⓘ | Väyrynenite | 8.BA.05 | BeMn2+(PO4)(OH) |
| ⓘ | Montebrasite | 8.BB.05 | LiAl(PO4)(OH) |
| ⓘ | Triplite | 8.BB.10 | Mn2+2(PO4)F |
| ⓘ | Zwieselite | 8.BB.10 | Fe2+2(PO4)F |
| ⓘ | Rockbridgeite | 8.BC.10 | Fe2+Fe3+4(PO4)3(OH)5 |
| ⓘ | Crandallite | 8.BL.10 | CaAl3(PO4)(PO3OH)(OH)6 |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Messelite | 8.CG.05 | Ca2Fe2+(PO4)2 · 2H2O |
| ⓘ | Childrenite | 8.DD.20 | Fe2+Al(PO4)(OH)2 · H2O |
| Group 9 - Silicates | |||
| ⓘ | Eucryptite | 9.AA.05 | LiAlSiO4 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Spodumene | 9.DA.30 | LiAlSi2O6 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Petalite | 9.EF.05 | LiAl(Si4O10) |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| Unclassified | |||
| ⓘ | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
| ⓘ | 'Tantalite' | - | (Mn,Fe)(Ta,Nb)2O6 |
| ⓘ | 'Lepidolite' | - | |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| ⓘ | 'Jahnsite Group' | - | XM1M22M32(H2O)8(OH)2(PO4)4 |
| ⓘ | 'Columbite Group' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Childrenite | Fe2+Al(PO4)(OH)2 · H2O |
| H | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Messelite | Ca2Fe2+(PO4)2 · 2H2O |
| H | ⓘ Montebrasite | LiAl(PO4)(OH) |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Rockbridgeite | Fe2+Fe43+(PO4)3(OH)5 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Väyrynenite | BeMn2+(PO4)(OH) |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| H | ⓘ Jahnsite Group | XM1M22M32(H2O)8(OH)2(PO4)4 |
| Li | Lithium | |
| Li | ⓘ Eucryptite | LiAlSiO4 |
| Li | ⓘ Triphylite var. Ferrisicklerite | Li1-x(Fex3+Fe2+1-x)PO4 |
| Li | ⓘ Montebrasite | LiAl(PO4)(OH) |
| Li | ⓘ Petalite | LiAl(Si4O10) |
| Li | ⓘ Lithiophilite var. Sicklerite | Li1-x(Mnx3+Mn2+1-x)PO4 |
| Li | ⓘ Spodumene | LiAlSi2O6 |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| Be | ⓘ Väyrynenite | BeMn2+(PO4)(OH) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | Oxygen | |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Alluaudite | (Na,Ca)Mn2+(Fe3+,Mn2+,Fe2+,Mg)2(PO4)3 |
| O | ⓘ Andalusite | Al2(SiO4)O |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Childrenite | Fe2+Al(PO4)(OH)2 · H2O |
| O | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Eucryptite | LiAlSiO4 |
| O | ⓘ Ferberite | FeWO4 |
| O | ⓘ Triphylite var. Ferrisicklerite | Li1-x(Fex3+Fe2+1-x)PO4 |
| O | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Graftonite | Fe2+Fe22+(PO4)2 |
| O | ⓘ Heterosite | (Fe3+,Mn3+)PO4 |
| O | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| O | ⓘ Messelite | Ca2Fe2+(PO4)2 · 2H2O |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Montebrasite | LiAl(PO4)(OH) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Petalite | LiAl(Si4O10) |
| O | ⓘ Purpurite | Mn3+(PO4) |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rockbridgeite | Fe2+Fe43+(PO4)3(OH)5 |
| O | ⓘ Rosemaryite | (Na,Ca,Mn)(Mn,Fe2+)(Fe3+,Mg)Al(PO4)3 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Sarcopside | Fe32+(PO4)2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Lithiophilite var. Sicklerite | Li1-x(Mnx3+Mn2+1-x)PO4 |
| O | ⓘ Spodumene | LiAlSi2O6 |
| O | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| O | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | ⓘ Triplite | Mn22+(PO4)F |
| O | ⓘ Varulite | NaCaMn2+Mn22+(PO4)3 |
| O | ⓘ Väyrynenite | BeMn2+(PO4)(OH) |
| O | ⓘ Wyllieite | (Na,Ca,Mn)(Mn,Fe)(Fe,Mg)Al(PO4)3 |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Zwieselite | Fe22+(PO4)F |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| O | ⓘ Jahnsite Group | XM1M22M32(H2O)8(OH)2(PO4)4 |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Triplite | Mn22+(PO4)F |
| F | ⓘ Zwieselite | Fe22+(PO4)F |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Alluaudite | (Na,Ca)Mn2+(Fe3+,Mn2+,Fe2+,Mg)2(PO4)3 |
| Na | ⓘ Rosemaryite | (Na,Ca,Mn)(Mn,Fe2+)(Fe3+,Mg)Al(PO4)3 |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Varulite | NaCaMn2+Mn22+(PO4)3 |
| Na | ⓘ Wyllieite | (Na,Ca,Mn)(Mn,Fe)(Fe,Mg)Al(PO4)3 |
| Mg | Magnesium | |
| Mg | ⓘ Alluaudite | (Na,Ca)Mn2+(Fe3+,Mn2+,Fe2+,Mg)2(PO4)3 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Rosemaryite | (Na,Ca,Mn)(Mn,Fe2+)(Fe3+,Mg)Al(PO4)3 |
| Mg | ⓘ Wyllieite | (Na,Ca,Mn)(Mn,Fe)(Fe,Mg)Al(PO4)3 |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Andalusite | Al2(SiO4)O |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Childrenite | Fe2+Al(PO4)(OH)2 · H2O |
| Al | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Eucryptite | LiAlSiO4 |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Montebrasite | LiAl(PO4)(OH) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Petalite | LiAl(Si4O10) |
| Al | ⓘ Rosemaryite | (Na,Ca,Mn)(Mn,Fe2+)(Fe3+,Mg)Al(PO4)3 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Spodumene | LiAlSi2O6 |
| Al | ⓘ Wyllieite | (Na,Ca,Mn)(Mn,Fe)(Fe,Mg)Al(PO4)3 |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Andalusite | Al2(SiO4)O |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Eucryptite | LiAlSiO4 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Petalite | LiAl(Si4O10) |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Spodumene | LiAlSi2O6 |
| Si | ⓘ Zircon | Zr(SiO4) |
| P | Phosphorus | |
| P | ⓘ Alluaudite | (Na,Ca)Mn2+(Fe3+,Mn2+,Fe2+,Mg)2(PO4)3 |
| P | ⓘ Childrenite | Fe2+Al(PO4)(OH)2 · H2O |
| P | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Triphylite var. Ferrisicklerite | Li1-x(Fex3+Fe2+1-x)PO4 |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Graftonite | Fe2+Fe22+(PO4)2 |
| P | ⓘ Heterosite | (Fe3+,Mn3+)PO4 |
| P | ⓘ Messelite | Ca2Fe2+(PO4)2 · 2H2O |
| P | ⓘ Montebrasite | LiAl(PO4)(OH) |
| P | ⓘ Purpurite | Mn3+(PO4) |
| P | ⓘ Rockbridgeite | Fe2+Fe43+(PO4)3(OH)5 |
| P | ⓘ Rosemaryite | (Na,Ca,Mn)(Mn,Fe2+)(Fe3+,Mg)Al(PO4)3 |
| P | ⓘ Sarcopside | Fe32+(PO4)2 |
| P | ⓘ Lithiophilite var. Sicklerite | Li1-x(Mnx3+Mn2+1-x)PO4 |
| P | ⓘ Triplite | Mn22+(PO4)F |
| P | ⓘ Varulite | NaCaMn2+Mn22+(PO4)3 |
| P | ⓘ Väyrynenite | BeMn2+(PO4)(OH) |
| P | ⓘ Wyllieite | (Na,Ca,Mn)(Mn,Fe)(Fe,Mg)Al(PO4)3 |
| P | ⓘ Zwieselite | Fe22+(PO4)F |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| P | ⓘ Jahnsite Group | XM1M22M32(H2O)8(OH)2(PO4)4 |
| S | Sulfur | |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Covellite | CuS |
| S | ⓘ Galena | PbS |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stannite | Cu2FeSnS4 |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cl | Chlorine | |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| Ca | Calcium | |
| Ca | ⓘ Alluaudite | (Na,Ca)Mn2+(Fe3+,Mn2+,Fe2+,Mg)2(PO4)3 |
| Ca | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Messelite | Ca2Fe2+(PO4)2 · 2H2O |
| Ca | ⓘ Rosemaryite | (Na,Ca,Mn)(Mn,Fe2+)(Fe3+,Mg)Al(PO4)3 |
| Ca | ⓘ Varulite | NaCaMn2+Mn22+(PO4)3 |
| Ca | ⓘ Wyllieite | (Na,Ca,Mn)(Mn,Fe)(Fe,Mg)Al(PO4)3 |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Rutile | TiO2 |
| Mn | Manganese | |
| Mn | ⓘ Alluaudite | (Na,Ca)Mn2+(Fe3+,Mn2+,Fe2+,Mg)2(PO4)3 |
| Mn | ⓘ Heterosite | (Fe3+,Mn3+)PO4 |
| Mn | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| Mn | ⓘ Purpurite | Mn3+(PO4) |
| Mn | ⓘ Rosemaryite | (Na,Ca,Mn)(Mn,Fe2+)(Fe3+,Mg)Al(PO4)3 |
| Mn | ⓘ Lithiophilite var. Sicklerite | Li1-x(Mnx3+Mn2+1-x)PO4 |
| Mn | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Mn | ⓘ Triplite | Mn22+(PO4)F |
| Mn | ⓘ Varulite | NaCaMn2+Mn22+(PO4)3 |
| Mn | ⓘ Väyrynenite | BeMn2+(PO4)(OH) |
| Mn | ⓘ Wyllieite | (Na,Ca,Mn)(Mn,Fe)(Fe,Mg)Al(PO4)3 |
| Fe | Iron | |
| Fe | ⓘ Alluaudite | (Na,Ca)Mn2+(Fe3+,Mn2+,Fe2+,Mg)2(PO4)3 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Childrenite | Fe2+Al(PO4)(OH)2 · H2O |
| Fe | ⓘ Ferberite | FeWO4 |
| Fe | ⓘ Triphylite var. Ferrisicklerite | Li1-x(Fex3+Fe2+1-x)PO4 |
| Fe | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| Fe | ⓘ Graftonite | Fe2+Fe22+(PO4)2 |
| Fe | ⓘ Heterosite | (Fe3+,Mn3+)PO4 |
| Fe | ⓘ Messelite | Ca2Fe2+(PO4)2 · 2H2O |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Rockbridgeite | Fe2+Fe43+(PO4)3(OH)5 |
| Fe | ⓘ Rosemaryite | (Na,Ca,Mn)(Mn,Fe2+)(Fe3+,Mg)Al(PO4)3 |
| Fe | ⓘ Sarcopside | Fe32+(PO4)2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Stannite | Cu2FeSnS4 |
| Fe | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Fe | ⓘ Wyllieite | (Na,Ca,Mn)(Mn,Fe)(Fe,Mg)Al(PO4)3 |
| Fe | ⓘ Zwieselite | Fe22+(PO4)F |
| Cu | Copper | |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Stannite | Cu2FeSnS4 |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Zn | Zinc | |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| Nb | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| Nb | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sn | ⓘ Stannite | Cu2FeSnS4 |
| Sb | Antimony | |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Ta | Tantalum | |
| Ta | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| W | Tungsten | |
| W | ⓘ Ferberite | FeWO4 |
| Pb | Lead | |
| Pb | ⓘ Galena | PbS |
| Bi | Bismuth | |
| Bi | ⓘ Bismuth | Bi |
| Bi | ⓘ Bismuthinite | Bi2S3 |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/La_Fregeneda |
|---|---|
| Wikidata ID: | Q1768874 |
| GeoNames ID: | 6360375 |
Localities in this Region
- Castile and Leon
- Salamanca
Other Regions, Features and Areas that Intersect
Eurasian PlateTectonic Plate
Iberian PeninsulaPeninsula
Spain
- Castile and Leon
- Fregeneda–Almendra pegmatite fieldPegmatite Field
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther RegionsReferences
Alberto pit, La Fregeneda, Salamanca, Castile and Leon, Spain