Poona Mine (Mattapara; Alameda Pty Ltd; EML 5525; ML 5524), Moonta, Yorke Peninsula, South Australia, Australiai
| Regional Level Types | |
|---|---|
| Poona Mine (Mattapara; Alameda Pty Ltd; EML 5525; ML 5524) | Mine |
| Moonta | Town |
| Yorke Peninsula | Peninsula |
| South Australia | State |
| Australia | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
34° 2' 24'' South , 137° 36' 59'' East
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Moonta | 336 (2015) | 3.9km |
| Port Hughes | 225 (2012) | 7.8km |
| Wallaroo Mines | 396 (2014) | 10.4km |
| Wallaroo | 2,779 (2013) | 11.4km |
| Kadina | 2,213 (2013) | 12.4km |
Nearest Clubs:
Local clubs are the best way to get access to collecting localities
Local clubs are the best way to get access to collecting localities
| Club | Location | Distance |
|---|---|---|
| Yorke Peninsula Gem and Mineral Club | Moonta, South Australia | 4km |
Mindat Locality ID:
126175
Long-form identifier:
mindat:1:2:126175:5
GUID (UUID V4):
2486b9eb-a20a-466f-8a51-d1c45ffc7fd8
Poona and the nearby Wheal Hughes deposits were fairly recent discoveries in the historical Moonta-Wallaroo district. They were discovered in 1985 by surface electromagnetic surveys followed by drilling, and were mined by open cut from 1988-1994. The modern Poona mine was at/near the same site of an old mine of the same name which was discovered in 1862 during excavations for the Moonta to Wallaroo railway.
They are narrow, high-grade, shear-hosted hydrothermal Cu-Au deposits within the Palaeoproterozoic Moonta Porphyry. Main ore minerals were primary chalcopyrite and secondary chalcocite, covellite and minor native copper. Combined production from Poona and Wheal Hughs was 450,000 tonnes ore grading 4.6-5.3% Cu and 0.7-1.5 g/t Au.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
| ⓘ Alunite Formula: KAl3(SO4)2(OH)6 |
| ⓘ Aragonite Formula: CaCO3 |
| ⓘ Arsenopyrite Formula: FeAsS |
| ⓘ Atacamite Formula: Cu2(OH)3Cl |
| ⓘ Bismuth Formula: Bi |
| ⓘ Bornite Formula: Cu5FeS4 |
| ⓘ Boulangerite ? Formula: Pb5Sb4S11 Description: "ID'd at Mineralogical Society of SA - Plumose specimen" (Paul Stahl) References: |
| ⓘ Carrollite Formula: CuCo2S4 |
| ⓘ Chalcocite Formula: Cu2S |
| ✪ Chalcopyrite Formula: CuFeS2 Habit: Massive in a lot of the mine but some 1-4 kg specimens of large crystals Colour: Bright brassy yellow with iridescence to fiery copper orange. Description: The brightest and purest chalcopyrite I have seen, easily rivalling the South American deposits |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ Copper Formula: Cu |
| ⓘ Covellite Formula: CuS |
| ⓘ Cuprite Formula: Cu2O References: |
| ⓘ Digenite Formula: Cu9S5 |
| ⓘ Djurleite Formula: Cu31S16 References: |
| ⓘ Fluorite Formula: CaF2 |
| ⓘ Galena Formula: PbS |
| ⓘ Goethite Formula: α-Fe3+O(OH) |
| ⓘ Gold Formula: Au |
| ⓘ Halloysite Formula: Al2(Si2O5)(OH)4 |
| ⓘ Hematite Formula: Fe2O3 |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 References: |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 |
| ⓘ Marcasite Formula: FeS2 |
| ⓘ Marshite Formula: CuI |
| ⓘ Mcguinnessite Formula: (Mg,Cu)2(CO3)(OH)2 References: |
| ⓘ Molybdenite Formula: MoS2 |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Pyrrhotite Formula: Fe1-xS |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Quartz var. Amethyst Formula: SiO2 References: |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 References: |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) References: |
| ⓘ Silver Formula: Ag |
| ⓘ Sphalerite Formula: ZnS |
| ⓘ Sulphur Formula: S8 |
| ⓘ Torbernite Formula: Cu(UO2)2(PO4)2 · 12H2O References: |
| ⓘ Uraninite Formula: UO2 |
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Gold | 1.AA.05 | Au |
| ⓘ | Silver | 1.AA.05 | Ag |
| ⓘ | Copper | 1.AA.05 | Cu |
| ⓘ | Bismuth | 1.CA.05 | Bi |
| ⓘ | Sulphur | 1.CC.05 | S8 |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Djurleite | 2.BA.05 | Cu31S16 |
| ⓘ | Digenite | 2.BA.10 | Cu9S5 |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Carrollite | 2.DA.05 | CuCo2S4 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Boulangerite ? | 2.HC.15 | Pb5Sb4S11 |
| Group 3 - Halides | |||
| ⓘ | Marshite | 3.AA.05 | CuI |
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| ⓘ | Atacamite | 3.DA.10a | Cu2(OH)3Cl |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | α-Fe3+O(OH) |
| ⓘ | Cuprite | 4.AA.10 | Cu2O |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Quartz var. Amethyst | 4.DA.05 | SiO2 |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | Uraninite | 4.DL.05 | UO2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Mcguinnessite | 5.BA.10 | (Mg,Cu)2(CO3)(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Alunite | 7.BC.10 | KAl3(SO4)2(OH)6 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Torbernite | 8.EB.05 | Cu(UO2)2(PO4)2 · 12H2O |
| Group 9 - Silicates | |||
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Halloysite | 9.ED.10 | Al2(Si2O5)(OH)4 |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| H | ⓘ Atacamite | Cu2(OH)3Cl |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Goethite | α-Fe3+O(OH) |
| H | ⓘ Halloysite | Al2(Si2O5)(OH)4 |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Mcguinnessite | (Mg,Cu)2(CO3)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Mcguinnessite | (Mg,Cu)2(CO3)(OH)2 |
| O | Oxygen | |
| O | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| O | ⓘ Quartz var. Amethyst | SiO2 |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Atacamite | Cu2(OH)3Cl |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Goethite | α-Fe3+O(OH) |
| O | ⓘ Halloysite | Al2(Si2O5)(OH)4 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Mcguinnessite | (Mg,Cu)2(CO3)(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| O | ⓘ Uraninite | UO2 |
| F | Fluorine | |
| F | ⓘ Fluorite | CaF2 |
| Na | Sodium | |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Mcguinnessite | (Mg,Cu)2(CO3)(OH)2 |
| Al | Aluminium | |
| Al | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Halloysite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | Silicon | |
| Si | ⓘ Quartz var. Amethyst | SiO2 |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Halloysite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| P | Phosphorus | |
| P | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| S | Sulfur | |
| S | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Boulangerite | Pb5Sb4S11 |
| S | ⓘ Carrollite | CuCo2S4 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Covellite | CuS |
| S | ⓘ Digenite | Cu9S5 |
| S | ⓘ Djurleite | Cu31S16 |
| S | ⓘ Galena | PbS |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Sulphur | S8 |
| Cl | Chlorine | |
| Cl | ⓘ Atacamite | Cu2(OH)3Cl |
| K | Potassium | |
| K | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| Ca | Calcium | |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Fluorite | CaF2 |
| Fe | Iron | |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Goethite | α-Fe3+O(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Co | Cobalt | |
| Co | ⓘ Carrollite | CuCo2S4 |
| Cu | Copper | |
| Cu | ⓘ Atacamite | Cu2(OH)3Cl |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Carrollite | CuCo2S4 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Copper | Cu |
| Cu | ⓘ Digenite | Cu9S5 |
| Cu | ⓘ Djurleite | Cu31S16 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Marshite | CuI |
| Cu | ⓘ Mcguinnessite | (Mg,Cu)2(CO3)(OH)2 |
| Cu | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| Zn | Zinc | |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Ag | Silver | |
| Ag | ⓘ Silver | Ag |
| Sb | Antimony | |
| Sb | ⓘ Boulangerite | Pb5Sb4S11 |
| I | Iodine | |
| I | ⓘ Marshite | CuI |
| Au | Gold | |
| Au | ⓘ Gold | Au |
| Pb | Lead | |
| Pb | ⓘ Boulangerite | Pb5Sb4S11 |
| Pb | ⓘ Galena | PbS |
| Bi | Bismuth | |
| Bi | ⓘ Bismuth | Bi |
| U | Uranium | |
| U | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| U | ⓘ Uraninite | UO2 |
Other Regions, Features and Areas containing this locality
Australia
- Adelaide SuperbasinBasin
- South Australia
- Gawler CratonCraton
- Olympic DomainCraton
- Stansbury BasinBasin
- Gawler CratonCraton
Australian PlateTectonic Plate
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
