Hellemobotn, Hamarøy, Nordland, Norwayi
| Regional Level Types | |
|---|---|
| Hellemobotn | Pegmatite |
| Hamarøy | Municipality |
| Nordland | County |
| Norway | Country |
Hellemobotn, Tysfjord, Nordland, Norway
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
67° 48' 43'' North , 16° 27' 39'' East
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Kjøpsvik | 960 (2010) | 31.9km |
Mindat Locality ID:
51567
Long-form identifier:
mindat:1:2:51567:5
GUID (UUID V4):
37c08c8f-1777-4094-bdd8-052839238ce6
Other/historical names associated with this locality:
Tysfjord
Other Languages:
Norwegian:
Hellemobotn, Hamarøy, Nordland, Norge
A granite pegmatite near Hellemofjorden, at Hellemobotn.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
33 valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Albite Formula: Na(AlSi3O8) |
| ⓘ Albite var. Cleavelandite Formula: Na(AlSi3O8) |
| ⓘ Anatase Formula: TiO2 |
| ⓘ Anglesite Formula: PbSO4 |
| ⓘ Arsenopyrite Formula: FeAsS |
| ⓘ Bertrandite Formula: Be4(Si2O7)(OH)2 |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ Bismoclite ? Formula: BiOCl Description: Analyzed with XRD, pattern similar to daubreeite |
| ⓘ Bismuth Formula: Bi |
| ⓘ Bismutite Formula: (BiO)2CO3 |
| ⓘ Danalite Formula: Be3Fe2+4(SiO4)3S |
| ⓘ Daubréeite ? Formula: BiO(OH) Description: Analyzed with XRD, pattern similar to bismoclite |
| ⓘ Fluorite Formula: CaF2 |
| ⓘ Genthelvite Formula: Be3Zn4(SiO4)3S |
| ⓘ Goethite Formula: α-Fe3+O(OH) |
| ⓘ Halloysite Formula: Al2(Si2O5)(OH)4 |
| ⓘ Hematite Formula: Fe2O3 |
| ⓘ Ilmenite Formula: Fe2+TiO3 |
| ⓘ Microcline Formula: K(AlSi3O8) |
| ⓘ Microcline var. Amazonite Formula: K(AlSi3O8) |
| ⓘ Milarite Formula: K(◻H2O)Ca2(Be2Al)[Si12O30] |
| ⓘ Mimetite Formula: Pb5(AsO4)3Cl |
| ⓘ Monazite-(Ce) Formula: Ce(PO4) |
| ⓘ Pharmacosiderite Formula: KFe3+4(AsO4)3(OH)4 · 6-7H2O |
| ⓘ Pyrophanite Formula: Mn2+TiO3 |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Rynersonite Formula: CaTa2O6 |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Segnitite Formula: PbFe3+3AsO4(AsO3OH)(OH)6 |
| ⓘ Spessartine Formula: Mn2+3Al2(SiO4)3 |
| ⓘ Sphalerite Formula: ZnS |
| ⓘ Sulphur Formula: S8 |
| ⓘ Svabite Formula: Ca5(AsO4)3F Habit: Hexagonal Colour: White Description: In a sample found by P.Chr. Sæbö, from a pegmatite in Hellmofjorden area, Raade identified svabite crystals (to a couple of mm large) in cavities in albite. (Raade 1982, Neumann 1985). References: |
| ⓘ Thorite Formula: Th(SiO4) |
| ⓘ Zavaritskite Formula: (BiO)F |
| ⓘ Zircon Formula: Zr(SiO4) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Bismuth | 1.CA.05 | Bi |
| ⓘ | Sulphur | 1.CC.05 | S8 |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| ⓘ | Bismoclite ? | 3.DC.25 | BiOCl |
| ⓘ | Zavaritskite | 3.DC.25 | (BiO)F |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | α-Fe3+O(OH) |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Pyrophanite | 4.CB.05 | Mn2+TiO3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Rynersonite | 4.DF.05 | CaTa2O6 |
| ⓘ | Daubréeite ? | 4.F0.25 | BiO(OH) |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Bismutite | 5.BE.25 | (BiO)2CO3 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| ⓘ | Segnitite | 8.BL.10 | PbFe3+3AsO4(AsO3OH)(OH)6 |
| ⓘ | Mimetite | 8.BN.05 | Pb5(AsO4)3Cl |
| ⓘ | Svabite | 8.BN.05 | Ca5(AsO4)3F |
| ⓘ | Pharmacosiderite | 8.DK.10 | KFe3+4(AsO4)3(OH)4 · 6-7H2O |
| Group 9 - Silicates | |||
| ⓘ | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| ⓘ | Thorite | 9.AD.30 | Th(SiO4) |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Bertrandite | 9.BD.05 | Be4(Si2O7)(OH)2 |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Milarite | 9.CM.05 | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| ⓘ | Halloysite | 9.ED.10 | Al2(Si2O5)(OH)4 |
| ⓘ | Microcline var. Amazonite | 9.FA.30 | K(AlSi3O8) |
| ⓘ | 9.FA.30 | K(AlSi3O8) | |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Cleavelandite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Genthelvite | 9.FB.10 | Be3Zn4(SiO4)3S |
| ⓘ | Danalite | 9.FB.10 | Be3Fe2+4(SiO4)3S |
| Unclassified | |||
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Daubréeite | BiO(OH) |
| H | ⓘ Goethite | α-Fe3+O(OH) |
| H | ⓘ Halloysite | Al2(Si2O5)(OH)4 |
| H | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| H | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
| Be | Beryllium | |
| Be | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| Be | ⓘ Danalite | Be3Fe42+(SiO4)3S |
| Be | ⓘ Genthelvite | Be3Zn4(SiO4)3S |
| Be | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Bismutite | (BiO)2CO3 |
| O | Oxygen | |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Microcline var. Amazonite | K(AlSi3O8) |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Bismoclite | BiOCl |
| O | ⓘ Bismutite | (BiO)2CO3 |
| O | ⓘ Daubréeite | BiO(OH) |
| O | ⓘ Danalite | Be3Fe42+(SiO4)3S |
| O | ⓘ Genthelvite | Be3Zn4(SiO4)3S |
| O | ⓘ Goethite | α-Fe3+O(OH) |
| O | ⓘ Halloysite | Al2(Si2O5)(OH)4 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| O | ⓘ Mimetite | Pb5(AsO4)3Cl |
| O | ⓘ Monazite-(Ce) | Ce(PO4) |
| O | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| O | ⓘ Pyrophanite | Mn2+TiO3 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rynersonite | CaTa2O6 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
| O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| O | ⓘ Svabite | Ca5(AsO4)3F |
| O | ⓘ Thorite | Th(SiO4) |
| O | ⓘ Zavaritskite | (BiO)F |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Svabite | Ca5(AsO4)3F |
| F | ⓘ Zavaritskite | (BiO)F |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Mg | Magnesium | |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Microcline var. Amazonite | K(AlSi3O8) |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Halloysite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Al | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Microcline var. Amazonite | K(AlSi3O8) |
| Si | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Danalite | Be3Fe42+(SiO4)3S |
| Si | ⓘ Genthelvite | Be3Zn4(SiO4)3S |
| Si | ⓘ Halloysite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Si | ⓘ Thorite | Th(SiO4) |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| P | Phosphorus | |
| P | ⓘ Monazite-(Ce) | Ce(PO4) |
| S | Sulfur | |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Danalite | Be3Fe42+(SiO4)3S |
| S | ⓘ Genthelvite | Be3Zn4(SiO4)3S |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Sulphur | S8 |
| Cl | Chlorine | |
| Cl | ⓘ Bismoclite | BiOCl |
| Cl | ⓘ Mimetite | Pb5(AsO4)3Cl |
| K | Potassium | |
| K | ⓘ Microcline var. Amazonite | K(AlSi3O8) |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| K | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| Ca | Calcium | |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| Ca | ⓘ Rynersonite | CaTa2O6 |
| Ca | ⓘ Svabite | Ca5(AsO4)3F |
| Ti | Titanium | |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Pyrophanite | Mn2+TiO3 |
| Mn | Manganese | |
| Mn | ⓘ Pyrophanite | Mn2+TiO3 |
| Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Fe | Iron | |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Danalite | Be3Fe42+(SiO4)3S |
| Fe | ⓘ Goethite | α-Fe3+O(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
| Zn | Zinc | |
| Zn | ⓘ Genthelvite | Be3Zn4(SiO4)3S |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Mimetite | Pb5(AsO4)3Cl |
| As | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| As | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
| As | ⓘ Svabite | Ca5(AsO4)3F |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Ce | Cerium | |
| Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
| Ta | Tantalum | |
| Ta | ⓘ Rynersonite | CaTa2O6 |
| Pb | Lead | |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Pb | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
| Bi | Bismuth | |
| Bi | ⓘ Bismoclite | BiOCl |
| Bi | ⓘ Bismuth | Bi |
| Bi | ⓘ Bismutite | (BiO)2CO3 |
| Bi | ⓘ Daubréeite | BiO(OH) |
| Bi | ⓘ Zavaritskite | (BiO)F |
| Th | Thorium | |
| Th | ⓘ Thorite | Th(SiO4) |
Other Databases
| Link to Geological Survey of Norway: | 1850 - 307 |
|---|
Other Regions, Features and Areas containing this locality
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
