Výsluní deposit, Výsluní, Chomutov District, Ústí nad Labem Region, Czech Republici
| Regional Level Types | |
|---|---|
| Výsluní deposit | Deposit |
| Výsluní | Municipality |
| Chomutov District | District |
| Ústí nad Labem Region | Region |
| Czech Republic | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
50° 27' 24'' North , 13° 14' 49'' East
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Výsluní | 219 (2018) | 1.3km |
| Místo | 335 (2018) | 1.8km |
| Křimov | 189 (2018) | 5.0km |
| Hora Svatého Šebestiána | 253 (2018) | 6.0km |
| Málkov | 539 (2018) | 6.2km |
Mindat Locality ID:
262806
Long-form identifier:
mindat:1:2:262806:9
GUID (UUID V4):
555d2fdd-bfc3-49ca-a15d-abfff616ae72
Other/historical names associated with this locality:
Sonnenberg
Name(s) in local language(s):
Výsluní
A small old silver deposit, where poor polymetallic (Pb-Zn-Cu-Ag) veins were mined. Some mining remnants are still evident in the land. In the deep valley of Pruneřov creek, there are numerous reefs and outcrops, where some quartz veins occur in gneisses. Also, simple pegmatite veins are locally frequent. In pegmatites, schorl and arsenopyrite occur.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
| ⓘ Arsenopyrite Formula: FeAsS References: |
| ⓘ Baryte Formula: BaSO4 References: |
| ⓘ Chalcopyrite Formula: CuFeS2 References: |
| ⓘ Dolomite Formula: CaMg(CO3)2 References: |
| ⓘ Fluorite Formula: CaF2 References: |
| ⓘ Galena Formula: PbS References: |
| ⓘ Hematite Formula: Fe2O3 References: |
| ⓘ 'Hornblende Root Name Group' Formula: ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| ⓘ Kaersutite Formula: NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 References: |
| ⓘ Microcline Formula: K(AlSi3O8) References: |
| ⓘ Orthoclase Formula: K(AlSi3O8) References: |
| ⓘ Pyrite Formula: FeS2 References: |
| ⓘ Quartz Formula: SiO2 References: |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) References: |
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| Group 9 - Silicates | |||
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Kaersutite | 9.DE.15 | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| Unclassified | |||
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| O | Oxygen | |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| F | Fluorine | |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Na | Sodium | |
| Na | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| Al | Aluminium | |
| Al | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Si | Silicon | |
| Si | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| S | Sulfur | |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Galena | PbS |
| S | ⓘ Pyrite | FeS2 |
| Cl | Chlorine | |
| Cl | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| K | Potassium | |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| Ca | Calcium | |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Ti | Titanium | |
| Ti | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| Fe | Iron | |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Cu | Copper | |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Pb | Lead | |
| Pb | ⓘ Galena | PbS |
Other Regions, Features and Areas containing this locality
Czech Republic
- ⭔Bohemia (Böhmen; Boehmen)Region
CzechoslovakiaCountry
Eurasian PlateTectonic Plate
EuropeContinent
- Bohemian MassifMassif
- Ore MountainsMountain Range
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Výsluní deposit, Výsluní, Chomutov District, Ústí nad Labem Region, Czech Republic