Fitchburg, Worcester County, Massachusetts, USAi
| Regional Level Types | |
|---|---|
| Fitchburg | - not defined - |
| Worcester County | County |
| Massachusetts | State |
| USA | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
42° 35' 0'' North , 71° 48' 10'' West
Latitude & Longitude (decimal):
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Fitchburg | 40,545 (2017) | 0.0km |
| Lunenburg | 1,760 (2017) | 6.5km |
| Leominster | 41,569 (2017) | 7.4km |
| Westminster | 7,028 (2017) | 9.8km |
| Ashburnham | 5,643 (2017) | 10.4km |
Nearest Clubs:
Local clubs are the best way to get access to collecting localities
Local clubs are the best way to get access to collecting localities
| Club | Location | Distance |
|---|---|---|
| Nashoba Valley Mineralogical Society | Westford, Massachusetts | 30km |
| Worcester Mineral Club | Worcester, Massachusetts | 36km |
Mindat Locality ID:
22561
Long-form identifier:
mindat:1:2:22561:1
GUID (UUID V4):
125ff46c-edec-4d14-bfb8-1df3cf560ab9
Fitchburg was incorporated as a town in 1764 and later became a city.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities32 valid minerals.
Detailed Mineral List:
| ⓘ Albite Formula: Na(AlSi3O8) Habit: Small crystals occur in the titanite pegmatites and in calcite veins (Hitchen, 1935). |
| ⓘ Albite var. Oligoclase Formula: (Na,Ca)[Al(Si,Al)Si2O8] Habit: "Primary oligoclase occurs along with microcline as phenocrysts in the Type II [tourmaline type] pegmatites. (Hitchen, 1935) |
| ⓘ Allanite-(Ce) Formula: (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) Habit: crystal habit similar to epidote, with e(101) prominent (Hitchen, 1935) Colour: dark green to black, sometimes weathered superficially to red-brown Fluorescence: none Description: Crystals to at least 30mm. |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 Localities: Habit: "Trapezohedron n(211) and the dodechedron d(110)in combination, the former being usually dominant" (Hitchen, 1935) Colour: red, orange-red, orange, pink Description: According to Hitchen (1935), the garnets on Rollstone Hill are "spessartitic almandite." He gave an analysis of 52.29% almandine, 41.53 % spessartine, 0.92 % pyrope, and 3.55% andradite.
The results of an SEM-EDS analysis by Kerry Day 2008 for a garnet specimen collected by Peter Cristofono showed approximately ~ 55% almandine, 45% spessartine. |
| ⓘ 'Almandine-Spessartine Series' |
| ⓘ Andalusite Formula: Al2(SiO4)O |
| ⓘ Arsenopyrite Formula: FeAsS Habit: massive and in crystals (see comments) Colour: gray Description: Crystals commonly show the forms m(110), q(011), e(101), k(021), t(013). "Certain crystals ...recently acquired by the Harvard Museum, are somewhat complex and show, in addition to the above, the forms: g(111), o(112), i(312), n(012), Φ(023), τ(031), x(321), B(514)." (Hitchen, 1935) |
| ⓘ Beryl Formula: Be3Al2(Si6O18) Localities: Habit: Individual crystals measure from 0.3 to 2 cms, in diameter (Hitchen, 1935) Colour: golden yellow, pale green, aquamarine References: |
| ⓘ Beryl var. Aquamarine Formula: Be3Al2Si6O18 Localities: |
| ⓘ Beryl var. Goshenite Formula: Be3Al2(Si6O18) Localities: References: |
| ⓘ Beryl var. Heliodor Formula: Be3Al2(Si6O18) Localities: Description: "At the quarries at Fitchburg, beryl of a rich golden hue, approaching the chrysoberyl and topaz in color and hardness, and closely resembling the yellow diamond in lustre, have been blasted out." -- Hamlin, A. C. (1870): The Gems of the United States in Proceedings of the American Association for the Advancement of Science, Eighteenth Meeting, p. 212. |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 Habit: usually not well crystallized Colour: black Description: "The refractive indices are: α =1.640 β and γ = 1.645, and suggest siderophyllite." (Hitchen, 1935) |
| ⓘ Calcite Formula: CaCO3 Habit: massive Colour: white Description: Rare calcite veins occur in the granite. |
| ⓘ Chalcopyrite Formula: CuFeS2 Habit: grains of chalcopyrite are frequently grown upon pyrrhotite (Hitchen, 1935) Colour: brassy |
| ⓘ Chamosite Formula: (Fe2+)5Al(Si,Al)4O10(OH,O)8 Colour: dark green Description: Occurs as an alteration of biotite.
|
| ⓘ 'Columbite-(Fe)-Columbite-(Mn) Series' ? Description: Probably misidentified; likely ilmenite. |
| ⓘ Elbaite ? Formula: Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) Habit: as accessory grains in granite |
| ⓘ 'Feldspar Group' |
| ⓘ 'Feldspar Group var. Perthite' |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F Habit: hexagonal prisms Colour: gray Fluorescence: yellow (SW) |
| ⓘ Fluorite Formula: CaF2 Habit: "Small light purple to colourless cubes, 0.3 cm along an edge, occur on the selvages of the calcite veins (Hitchen, 1935). Colour: colorless, purple |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 |
| ⓘ 'Gummite' ? Description: Reported as an alteration product of allanite by Emerson (1917). |
| ⓘ Ilmenite Formula: Fe2+TiO3 Habit: as large platy crystals in quartz, and delicate hexagonal plates in calcite (Hitchen, 1935) Colour: black |
| ⓘ Marcasite Formula: FeS2 Description: Noted as concretionary masses resulting from supergene alteration of pyrrhotite (Hitchen, 1935). |
| ⓘ Microcline Formula: K(AlSi3O8) Localities: |
| ⓘ Molybdenite Formula: MoS2 Localities: Description: Found only in the beryl pegmatite (Hitchen, 1935). References: |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Opal Formula: SiO2 · nH2O Localities: Habit: amorphous coating Colour: cololress Fluorescence: green References: |
| ⓘ Opal var. Opal-AN Formula: SiO2 · nH2O Localities: Habit: amorphous coating Colour: cololress Fluorescence: green References: |
| ⓘ Pyrite Formula: FeS2 Description: Pyrite is very rare. Arsenopyrite is the most common sulfide at Rollstone Hill, followed by pyrrhotite. |
| ⓘ Pyrrhotite Formula: Fe1-xS Description: Associated with chalcopyrite. |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 Habit: massive Colour: smoky |
| ⓘ Rutile Formula: TiO2 Habit: microscopic rutile needles in quartz occurs in the granite (Hitchen, 1935) |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Localities: Habit: Crystals to 10 cm long. (Hitchen, 1935) Colour: black Fluorescence: none References: |
| ⓘ Siderophyllite ? Formula: KFe2+2Al(Al2Si2O10)(OH)2 Colour: black Description: "The refractive indices are: α =1.640 β and γ = 1.645, and suggest siderophyllite." (Hitchen, 1935) |
| ⓘ Sillimanite Formula: Al2(SiO4)O |
| ⓘ Spodumene Formula: LiAlSi2O6 |
| ⓘ Staurolite Formula: Fe2+2Al9Si4O23(OH) Localities: |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 |
| ⓘ Titanite Formula: CaTi(SiO4)O Localities: Habit: simple, tabular crystals to 2 cm (Hitchen, 1935) Colour: brown, cinnamon brown References: |
| ⓘ 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z |
| ⓘ Uraninite Formula: UO2 Description: Lane (1933) gives a microchemical analysis of a sample of uraninite. |
| ⓘ Zircon Formula: Zr(SiO4) Habit: as small crystals in biotite or microcline |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Quartz var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | Opal var. Opal-AN | 4.DA.10 | SiO2 · nH2O |
| ⓘ | 4.DA.10 | SiO2 · nH2O | |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Uraninite | 4.DL.05 | UO2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| Group 9 - Silicates | |||
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Sillimanite | 9.AF.05 | Al2(SiO4)O |
| ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | Staurolite | 9.AF.30 | Fe2+2Al9Si4O23(OH) |
| ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Allanite-(Ce) | 9.BG.05b | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ | Beryl var. Heliodor | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | var. Goshenite | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | var. Aquamarine | 9.CJ.05 | Be3Al2Si6O18 |
| ⓘ | 9.CJ.05 | Be3Al2(Si6O18) | |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Elbaite ? | 9.CK.05 | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Spodumene | 9.DA.30 | LiAlSi2O6 |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Muscovite var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | Siderophyllite ? | 9.EC.20 | KFe2+2Al(Al2Si2O10)(OH)2 |
| ⓘ | Chamosite | 9.EC.55 | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Oligoclase | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| Unclassified | |||
| ⓘ | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
| ⓘ | 'Feldspar Group var. Perthite' | - | |
| ⓘ | 'Gummite' ? | - | |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Almandine-Spessartine Series' | - | |
| ⓘ | 'Columbite-(Fe)-Columbite-(Mn) Series' ? | - | |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| H | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Opal var. Opal-AN | SiO2 · nH2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Opal | SiO2 · nH2O |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| H | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Li | Lithium | |
| Li | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Li | ⓘ Spodumene | LiAlSi2O6 |
| Be | Beryllium | |
| Be | ⓘ Beryl var. Aquamarine | Be3Al2Si6O18 |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| Be | ⓘ Beryl var. Heliodor | Be3Al2(Si6O18) |
| Be | ⓘ Beryl var. Goshenite | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Calcite | CaCO3 |
| O | Oxygen | |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| O | ⓘ Andalusite | Al2(SiO4)O |
| O | ⓘ Beryl var. Aquamarine | Be3Al2Si6O18 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| O | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Opal var. Opal-AN | SiO2 · nH2O |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Opal | SiO2 · nH2O |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| O | ⓘ Sillimanite | Al2(SiO4)O |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Spodumene | LiAlSi2O6 |
| O | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Titanite | CaTi(SiO4)O |
| O | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Beryl var. Heliodor | Be3Al2(Si6O18) |
| O | ⓘ Beryl var. Goshenite | Be3Al2(Si6O18) |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorite | CaF2 |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Andalusite | Al2(SiO4)O |
| Al | ⓘ Beryl var. Aquamarine | Be3Al2Si6O18 |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| Al | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| Al | ⓘ Sillimanite | Al2(SiO4)O |
| Al | ⓘ Spodumene | LiAlSi2O6 |
| Al | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Al | ⓘ Beryl var. Heliodor | Be3Al2(Si6O18) |
| Al | ⓘ Beryl var. Goshenite | Be3Al2(Si6O18) |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Andalusite | Al2(SiO4)O |
| Si | ⓘ Beryl var. Aquamarine | Be3Al2Si6O18 |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| Si | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Opal var. Opal-AN | SiO2 · nH2O |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Opal | SiO2 · nH2O |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| Si | ⓘ Sillimanite | Al2(SiO4)O |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Spodumene | LiAlSi2O6 |
| Si | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Titanite | CaTi(SiO4)O |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Beryl var. Heliodor | Be3Al2(Si6O18) |
| Si | ⓘ Beryl var. Goshenite | Be3Al2(Si6O18) |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| P | Phosphorus | |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| S | Sulfur | |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Titanite | CaTi(SiO4)O |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTi(SiO4)O |
| Fe | Iron | |
| Fe | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| Fe | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Cu | Copper | |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Ce | Cerium | |
| Ce | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| U | Uranium | |
| U | ⓘ Uraninite | UO2 |
Localities in this Region
- Massachusetts
- Worcester County
Other Regions, Features and Areas containing this locality
North America PlateTectonic Plate
- Ganderia DomainDomain
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Fitchburg, Worcester County, Massachusetts, USA