Rhodonite occurrence, Muzeinyi Valley, Inyl'chek Range, Issyk-Kul Region, Kyrgyzstani
Regional Level Types | |
---|---|
Rhodonite occurrence | Occurrence |
Muzeinyi Valley | Valley |
Inyl'chek Range | Mountain Range |
Issyk-Kul Region | Region |
Kyrgyzstan | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude:
42° North , 77° East (est.)
Estimate based on other nearby localities or region boundaries.
Margin of Error:
~191km
Type:
Mindat Locality ID:
20449
Long-form identifier:
mindat:1:2:20449:6
GUID (UUID V4):
4e2a6397-559e-4024-af6b-e80b6f56c387
Name(s) in local language(s):
Родонитовое проявление, Музейный сай, , Иссык-Кульская область (Ысык-Көл облусу; Issyk-Kul'skaja oblast'; Isıq-Köl oblusu), Кыргызстан (Киргизия; Кыргыз Республикасы; Киргизская Республика)
A rhodonite body located in a highland valley (sai = valley) some km from the Trudovoe (Trudovoye) tin deposit.
The ore body is located on the northern slope of the Inyl'chek Range (exocontact of the Inyl'chek Sn-bearing granite massif).
Now this body is almost competely mined for jewellery rhodonite.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
ⓘ Alabandite Formula: MnS References: |
ⓘ Alleghanyite Formula: Mn2+5(SiO4)2(OH)2 |
ⓘ Baryte Formula: BaSO4 |
ⓘ Cassiterite Formula: SnO2 References: |
ⓘ Galena Formula: PbS |
ⓘ Hejtmanite Formula: Ba2Mn2+4Ti2(Si2O7)2O2(OH)2F2 |
ⓘ Helvine Formula: Be3Mn2+4(SiO4)3S References: |
ⓘ Hübnerite Formula: MnWO4 |
ⓘ Khristovite-(Ce) (TL) Formula: (CaCe)(MgAlMn2+)F[Si2O7][SiO4](OH) Type Locality: Habit: elongate subhedral grains up to 1.5 mm long Colour: brown References: |
ⓘ Kinoshitalite Formula: (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 References: |
ⓘ Manganosite Formula: MnO References: |
ⓘ Microcline var. Hyalophane Formula: (K,Ba)[Al(Si,Al)Si2O8] |
ⓘ Monazite-(Ce) Formula: Ce(PO4) References: |
ⓘ Pabstite Formula: Ba(Sn,Ti)(Si3O9) |
ⓘ Pyrolusite Formula: Mn4+O2 References: |
ⓘ Pyrophanite Formula: Mn2+TiO3 References: |
ⓘ Quartz Formula: SiO2 |
ⓘ Rhodochrosite Formula: MnCO3 |
ⓘ Rhodonite Formula: CaMn3Mn[Si5O15] |
ⓘ Scheelite Formula: Ca(WO4) References: |
ⓘ Sonolite Formula: Mn2+9(SiO4)4(OH)2 |
ⓘ Spessartine Formula: Mn2+3Al2(SiO4)3 References: |
ⓘ Tephroite Formula: Mn2+2SiO4 |
ⓘ Vistepite (TL) Formula: SnMn4B2Si4O16(OH)2 Type Locality: Description: Found in rhodonite ores localized in biotite-quartz hornfels at the exocontact of the Inyl'chek Sn-bearing granite massif. |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
Group 2 - Sulphides and Sulfosalts | |||
---|---|---|---|
ⓘ | Alabandite | 2.CD.10 | MnS |
ⓘ | Galena | 2.CD.10 | PbS |
Group 4 - Oxides and Hydroxides | |||
ⓘ | Manganosite | 4.AB.25 | MnO |
ⓘ | Pyrophanite | 4.CB.05 | Mn2+TiO3 |
ⓘ | Quartz | 4.DA.05 | SiO2 |
ⓘ | Cassiterite | 4.DB.05 | SnO2 |
ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
ⓘ | Hübnerite | 4.DB.30 | MnWO4 |
Group 5 - Nitrates and Carbonates | |||
ⓘ | Rhodochrosite | 5.AB.05 | MnCO3 |
Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
ⓘ | Baryte | 7.AD.35 | BaSO4 |
ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
Group 8 - Phosphates, Arsenates and Vanadates | |||
ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
Group 9 - Silicates | |||
ⓘ | Tephroite | 9.AC.05 | Mn2+2SiO4 |
ⓘ | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
ⓘ | Alleghanyite | 9.AF.45 | Mn2+5(SiO4)2(OH)2 |
ⓘ | Sonolite | 9.AF.55 | Mn2+9(SiO4)4(OH)2 |
ⓘ | Vistepite (TL) | 9.BD.25 | SnMn4B2Si4O16(OH)2 |
ⓘ | Hejtmanite | 9.BE.55 | Ba2Mn2+4Ti2(Si2O7)2O2(OH)2F2 |
ⓘ | Khristovite-(Ce) (TL) | 9.BG.05 | (CaCe)(MgAlMn2+)F[Si2O7][SiO4](OH) |
ⓘ | Pabstite | 9.CA.05 | Ba(Sn,Ti)(Si3O9) |
ⓘ | Rhodonite | 9.DK.05 | CaMn3Mn[Si5O15] |
ⓘ | Kinoshitalite | 9.EC.35 | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
ⓘ | Microcline var. Hyalophane | 9.FA.30 | (K,Ba)[Al(Si,Al)Si2O8] |
ⓘ | Helvine | 9.FB.10 | Be3Mn2+4(SiO4)3S |
List of minerals for each chemical element
H | Hydrogen | |
---|---|---|
H | ⓘ Alleghanyite | Mn52+(SiO4)2(OH)2 |
H | ⓘ Hejtmanite | Ba2Mn42+Ti2(Si2O7)2O2(OH)2F2 |
H | ⓘ Khristovite-(Ce) | (CaCe)(MgAlMn2+)F[Si2O7][SiO4](OH) |
H | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
H | ⓘ Sonolite | Mn92+(SiO4)4(OH)2 |
H | ⓘ Vistepite | SnMn4B2Si4O16(OH)2 |
Be | Beryllium | |
Be | ⓘ Helvine | Be3Mn42+(SiO4)3S |
B | Boron | |
B | ⓘ Vistepite | SnMn4B2Si4O16(OH)2 |
C | Carbon | |
C | ⓘ Rhodochrosite | MnCO3 |
O | Oxygen | |
O | ⓘ Alleghanyite | Mn52+(SiO4)2(OH)2 |
O | ⓘ Baryte | BaSO4 |
O | ⓘ Cassiterite | SnO2 |
O | ⓘ Hejtmanite | Ba2Mn42+Ti2(Si2O7)2O2(OH)2F2 |
O | ⓘ Helvine | Be3Mn42+(SiO4)3S |
O | ⓘ Hübnerite | MnWO4 |
O | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
O | ⓘ Khristovite-(Ce) | (CaCe)(MgAlMn2+)F[Si2O7][SiO4](OH) |
O | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
O | ⓘ Manganosite | MnO |
O | ⓘ Monazite-(Ce) | Ce(PO4) |
O | ⓘ Pabstite | Ba(Sn,Ti)(Si3O9) |
O | ⓘ Pyrolusite | Mn4+O2 |
O | ⓘ Pyrophanite | Mn2+TiO3 |
O | ⓘ Quartz | SiO2 |
O | ⓘ Rhodochrosite | MnCO3 |
O | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
O | ⓘ Scheelite | Ca(WO4) |
O | ⓘ Sonolite | Mn92+(SiO4)4(OH)2 |
O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
O | ⓘ Tephroite | Mn22+SiO4 |
O | ⓘ Vistepite | SnMn4B2Si4O16(OH)2 |
F | Fluorine | |
F | ⓘ Hejtmanite | Ba2Mn42+Ti2(Si2O7)2O2(OH)2F2 |
F | ⓘ Khristovite-(Ce) | (CaCe)(MgAlMn2+)F[Si2O7][SiO4](OH) |
Mg | Magnesium | |
Mg | ⓘ Khristovite-(Ce) | (CaCe)(MgAlMn2+)F[Si2O7][SiO4](OH) |
Mg | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
Al | Aluminium | |
Al | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
Al | ⓘ Khristovite-(Ce) | (CaCe)(MgAlMn2+)F[Si2O7][SiO4](OH) |
Al | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
Si | Silicon | |
Si | ⓘ Alleghanyite | Mn52+(SiO4)2(OH)2 |
Si | ⓘ Hejtmanite | Ba2Mn42+Ti2(Si2O7)2O2(OH)2F2 |
Si | ⓘ Helvine | Be3Mn42+(SiO4)3S |
Si | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
Si | ⓘ Khristovite-(Ce) | (CaCe)(MgAlMn2+)F[Si2O7][SiO4](OH) |
Si | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
Si | ⓘ Pabstite | Ba(Sn,Ti)(Si3O9) |
Si | ⓘ Quartz | SiO2 |
Si | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
Si | ⓘ Sonolite | Mn92+(SiO4)4(OH)2 |
Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
Si | ⓘ Tephroite | Mn22+SiO4 |
Si | ⓘ Vistepite | SnMn4B2Si4O16(OH)2 |
P | Phosphorus | |
P | ⓘ Monazite-(Ce) | Ce(PO4) |
S | Sulfur | |
S | ⓘ Alabandite | MnS |
S | ⓘ Baryte | BaSO4 |
S | ⓘ Galena | PbS |
S | ⓘ Helvine | Be3Mn42+(SiO4)3S |
K | Potassium | |
K | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
K | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
Ca | Calcium | |
Ca | ⓘ Khristovite-(Ce) | (CaCe)(MgAlMn2+)F[Si2O7][SiO4](OH) |
Ca | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
Ca | ⓘ Scheelite | Ca(WO4) |
Ti | Titanium | |
Ti | ⓘ Hejtmanite | Ba2Mn42+Ti2(Si2O7)2O2(OH)2F2 |
Ti | ⓘ Pabstite | Ba(Sn,Ti)(Si3O9) |
Ti | ⓘ Pyrophanite | Mn2+TiO3 |
Mn | Manganese | |
Mn | ⓘ Alabandite | MnS |
Mn | ⓘ Alleghanyite | Mn52+(SiO4)2(OH)2 |
Mn | ⓘ Hejtmanite | Ba2Mn42+Ti2(Si2O7)2O2(OH)2F2 |
Mn | ⓘ Helvine | Be3Mn42+(SiO4)3S |
Mn | ⓘ Hübnerite | MnWO4 |
Mn | ⓘ Khristovite-(Ce) | (CaCe)(MgAlMn2+)F[Si2O7][SiO4](OH) |
Mn | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
Mn | ⓘ Manganosite | MnO |
Mn | ⓘ Pyrolusite | Mn4+O2 |
Mn | ⓘ Pyrophanite | Mn2+TiO3 |
Mn | ⓘ Rhodochrosite | MnCO3 |
Mn | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
Mn | ⓘ Sonolite | Mn92+(SiO4)4(OH)2 |
Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
Mn | ⓘ Tephroite | Mn22+SiO4 |
Mn | ⓘ Vistepite | SnMn4B2Si4O16(OH)2 |
Sn | Tin | |
Sn | ⓘ Cassiterite | SnO2 |
Sn | ⓘ Pabstite | Ba(Sn,Ti)(Si3O9) |
Sn | ⓘ Vistepite | SnMn4B2Si4O16(OH)2 |
Ba | Barium | |
Ba | ⓘ Baryte | BaSO4 |
Ba | ⓘ Hejtmanite | Ba2Mn42+Ti2(Si2O7)2O2(OH)2F2 |
Ba | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
Ba | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
Ba | ⓘ Pabstite | Ba(Sn,Ti)(Si3O9) |
Ce | Cerium | |
Ce | ⓘ Khristovite-(Ce) | (CaCe)(MgAlMn2+)F[Si2O7][SiO4](OH) |
Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
W | Tungsten | |
W | ⓘ Hübnerite | MnWO4 |
W | ⓘ Scheelite | Ca(WO4) |
Pb | Lead | |
Pb | ⓘ Galena | PbS |
Other Regions, Features and Areas containing this locality
AsiaContinent
- Tian ShanGroup of Mountain Ranges
Eurasian PlateTectonic Plate
Soviet Union (1922-1991)Country
TurkestanArea
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.