Les Chalanches Mine, Allemond, Grenoble, Isère, Auvergne-Rhône-Alpes, Francei
| Regional Level Types | |
|---|---|
| Les Chalanches Mine | Mine |
| Allemond | Commune |
| Grenoble | Arrondissement |
| Isère | Department |
| Auvergne-Rhône-Alpes | Region |
| France | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
45° 8' 5'' North , 5° 59' 7'' East
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Allemond | 827 (2016) | 3.8km |
| Livet-et-Gavet | 1,478 (2016) | 5.1km |
| Oz | 198 (2016) | 5.3km |
| OZ-Station | 250 (2016) | 6.9km |
| Vaujany | 333 (2016) | 7.9km |
Mindat Locality ID:
1668
Long-form identifier:
mindat:1:2:1668:4
GUID (UUID V4):
d12f2131-9852-4cf6-8292-7b257f6c2a9c
Other/historical names associated with this locality:
Rhône-Alpes
Name(s) in local language(s):
Mine des Chalanches, Allemont, Isère, Rhône-Alpes, France
It was discovered in 1767 by a shepherdess, who was going to throw a silver rich rock at a goat.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
| ⓘ Acanthite Formula: Ag2S |
| ⓘ Anglesite Formula: PbSO4 |
| ⓘ Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 |
| ⓘ Annabergite Formula: Ni3(AsO4)2 · 8H2O |
| ⓘ Antimony Formula: Sb |
| ⓘ Argentojarosite Formula: AgFe3+3(SO4)2(OH)6 |
| ⓘ Arsenic Formula: As |
| ⓘ Arsenolite Formula: As2O3 |
| ⓘ Arsenopyrite Formula: FeAsS |
| ⓘ Asbolane Formula: (Ni,Co)2-xMn4+(O,OH)4 · nH2O Description: Associated with Annabergite. |
| ⓘ 'Axinite Group' |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 |
| ⓘ Baryte Formula: BaSO4 |
| ⓘ Bieberite Formula: CoSO4 · 7H2O References: |
| ⓘ Bismuth Formula: Bi Description: in association with antimony. |
| ⓘ Calcite Formula: CaCO3 References: |
| ⓘ Calcite var. Manganese-bearing Calcite Formula: (Ca,Mn)CO3 |
| ⓘ Cervantite Formula: Sb3+Sb5+O4 |
| ⓘ Chalcopyrite Formula: CuFeS2 |
| ⓘ Chlorargyrite Formula: AgCl Description: Small cubic crystals. |
| ⓘ 'Chlorite Group' |
| ⓘ Cinnabar Formula: HgS |
| ⓘ Cobaltite Formula: CoAsS |
| ⓘ Dolomite Formula: CaMg(CO3)2 |
| ⓘ Dolomite var. Iron-bearing Dolomite Formula: Ca(Mg,Fe)(CO3)2 |
| ⓘ Dyscrasite Formula: Ag3Sb |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ Erythrite Formula: Co3(AsO4)2 · 8H2O Description: Earthy material. References: |
| ⓘ Galena Formula: PbS |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 |
| ⓘ Goethite ? Formula: α-Fe3+O(OH) References: |
| ⓘ Gold Formula: Au |
| ⓘ Gypsum Formula: CaSO4 · 2H2O |
| ⓘ 'Jasper' |
| ⓘ Kermesite Formula: Sb2S2O |
| ⓘ 'Limonite' |
| ⓘ Löllingite Formula: FeAs2 |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 |
| ⓘ Moschellandsbergite Formula: Ag2Hg3 References: |
| ⓘ Nickeline Formula: NiAs |
| ⓘ Proustite Formula: Ag3AsS3 |
| ⓘ Pyrargyrite Formula: Ag3SbS3 |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Safflorite Formula: (Co,Ni,Fe)As2 Description: in association with antimony and stibarsen References: |
| ⓘ Schachnerite Formula: Ag1.1Hg0.9 References: |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Senarmontite Formula: Sb2O3 Description: in association with valentinite and antimony. |
| ⓘ Silver Formula: Ag |
| ⓘ Silver var. Native Amalgam Formula: (Ag,Hg) |
| ⓘ Skutterudite Formula: CoAs3 Description: Fine crystals (0.5 centimeters). |
| ⓘ Stibarsen Formula: AsSb |
| ⓘ Stibnite Formula: Sb2S3 |
| ⓘ Sulphur Formula: S8 |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 |
| ⓘ Tučekite Formula: Ni9Sb2S8 Description: Symplectic associations with nickelite, from periphery towards the core, with evolution to ullmannite. |
| ⓘ Ullmannite Formula: NiSbS |
| ⓘ Valentinite (TL) Formula: Sb2O3 Type Locality: |
| ⓘ Wulfenite Formula: Pb(MoO4) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Gold | 1.AA.05 | Au |
| ⓘ | Silver | 1.AA.05 | Ag |
| ⓘ | var. Native Amalgam | 1.AA.05 | (Ag,Hg) |
| ⓘ | Schachnerite | 1.AD.15a | Ag1.1Hg0.9 |
| ⓘ | Moschellandsbergite | 1.AD.15d | Ag2Hg3 |
| ⓘ | Bismuth | 1.CA.05 | Bi |
| ⓘ | Stibarsen | 1.CA.05 | AsSb |
| ⓘ | Antimony | 1.CA.05 | Sb |
| ⓘ | Arsenic | 1.CA.05 | As |
| ⓘ | Sulphur | 1.CC.05 | S8 |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Dyscrasite | 2.AA.35 | Ag3Sb |
| ⓘ | Acanthite | 2.BA.35 | Ag2S |
| ⓘ | Tučekite | 2.BB.10 | Ni9Sb2S8 |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Nickeline | 2.CC.05 | NiAs |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Cinnabar | 2.CD.15a | HgS |
| ⓘ | Stibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Safflorite | 2.EB.15a | (Co,Ni,Fe)As2 |
| ⓘ | Löllingite | 2.EB.15a | FeAs2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Ullmannite | 2.EB.25 | NiSbS |
| ⓘ | Cobaltite | 2.EB.25 | CoAsS |
| ⓘ | Skutterudite | 2.EC.05 | CoAs3 |
| ⓘ | Kermesite | 2.FD.05 | Sb2S2O |
| ⓘ | Proustite | 2.GA.05 | Ag3AsS3 |
| ⓘ | Pyrargyrite | 2.GA.05 | Ag3SbS3 |
| Group 3 - Halides | |||
| ⓘ | Chlorargyrite | 3.AA.15 | AgCl |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite ? | 4.00. | α-Fe3+O(OH) |
| ⓘ | Senarmontite | 4.CB.50 | Sb2O3 |
| ⓘ | Arsenolite | 4.CB.50 | As2O3 |
| ⓘ | Valentinite (TL) | 4.CB.55 | Sb2O3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Cervantite | 4.DE.30 | Sb3+Sb5+O4 |
| ⓘ | Asbolane | 4.FL.30 | (Ni,Co)2-xMn4+(O,OH)4 · nH2O |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite var. Manganese-bearing Calcite | 5.AB.05 | (Ca,Mn)CO3 |
| ⓘ | 5.AB.05 | CaCO3 | |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | var. Iron-bearing Dolomite | 5.AB.10 | Ca(Mg,Fe)(CO3)2 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Argentojarosite | 7.BC.10 | AgFe3+3(SO4)2(OH)6 |
| ⓘ | Bieberite | 7.CB.35 | CoSO4 · 7H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| ⓘ | Annabergite | 8.CE.40 | Ni3(AsO4)2 · 8H2O |
| ⓘ | Erythrite | 8.CE.40 | Co3(AsO4)2 · 8H2O |
| Group 9 - Silicates | |||
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| Unclassified | |||
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Jasper' | - | |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Axinite Group' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| H | ⓘ Argentojarosite | AgFe33+(SO4)2(OH)6 |
| H | ⓘ Asbolane | (Ni,Co)2-xMn4+(O,OH)4 · nH2O |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Bieberite | CoSO4 · 7H2O |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| H | ⓘ Goethite | α-Fe3+O(OH) |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| O | Oxygen | |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| O | ⓘ Argentojarosite | AgFe33+(SO4)2(OH)6 |
| O | ⓘ Arsenolite | As2O3 |
| O | ⓘ Asbolane | (Ni,Co)2-xMn4+(O,OH)4 · nH2O |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Bieberite | CoSO4 · 7H2O |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Cervantite | Sb3+Sb5+O4 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| O | ⓘ Goethite | α-Fe3+O(OH) |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Kermesite | Sb2S2O |
| O | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Senarmontite | Sb2O3 |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Valentinite | Sb2O3 |
| O | ⓘ Wulfenite | Pb(MoO4) |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| Na | Sodium | |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| Al | Aluminium | |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | Silicon | |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| P | Phosphorus | |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| S | Sulfur | |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Argentojarosite | AgFe33+(SO4)2(OH)6 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Bieberite | CoSO4 · 7H2O |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Cinnabar | HgS |
| S | ⓘ Cobaltite | CoAsS |
| S | ⓘ Galena | PbS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Kermesite | Sb2S2O |
| S | ⓘ Proustite | Ag3AsS3 |
| S | ⓘ Pyrargyrite | Ag3SbS3 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Sulphur | S8 |
| S | ⓘ Tučekite | Ni9Sb2S8 |
| S | ⓘ Ullmannite | NiSbS |
| Cl | Chlorine | |
| Cl | ⓘ Chlorargyrite | AgCl |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Ca | Calcium | |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| Ca | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| Mn | Manganese | |
| Mn | ⓘ Asbolane | (Ni,Co)2-xMn4+(O,OH)4 · nH2O |
| Mn | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| Fe | Iron | |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Argentojarosite | AgFe33+(SO4)2(OH)6 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Goethite | α-Fe3+O(OH) |
| Fe | ⓘ Löllingite | FeAs2 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| Co | Cobalt | |
| Co | ⓘ Asbolane | (Ni,Co)2-xMn4+(O,OH)4 · nH2O |
| Co | ⓘ Bieberite | CoSO4 · 7H2O |
| Co | ⓘ Cobaltite | CoAsS |
| Co | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| Co | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| Co | ⓘ Skutterudite | CoAs3 |
| Ni | Nickel | |
| Ni | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| Ni | ⓘ Asbolane | (Ni,Co)2-xMn4+(O,OH)4 · nH2O |
| Ni | ⓘ Nickeline | NiAs |
| Ni | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| Ni | ⓘ Tučekite | Ni9Sb2S8 |
| Ni | ⓘ Ullmannite | NiSbS |
| Cu | Copper | |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| As | Arsenic | |
| As | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| As | ⓘ Arsenolite | As2O3 |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Arsenic | As |
| As | ⓘ Cobaltite | CoAsS |
| As | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| As | ⓘ Löllingite | FeAs2 |
| As | ⓘ Nickeline | NiAs |
| As | ⓘ Proustite | Ag3AsS3 |
| As | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| As | ⓘ Skutterudite | CoAs3 |
| As | ⓘ Stibarsen | AsSb |
| Mo | Molybdenum | |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
| Ag | ⓘ Silver var. Native Amalgam | (Ag,Hg) |
| Ag | ⓘ Argentojarosite | AgFe33+(SO4)2(OH)6 |
| Ag | ⓘ Chlorargyrite | AgCl |
| Ag | ⓘ Dyscrasite | Ag3Sb |
| Ag | ⓘ Moschellandsbergite | Ag2Hg3 |
| Ag | ⓘ Proustite | Ag3AsS3 |
| Ag | ⓘ Pyrargyrite | Ag3SbS3 |
| Ag | ⓘ Schachnerite | Ag1.1Hg0.9 |
| Ag | ⓘ Silver | Ag |
| Sb | Antimony | |
| Sb | ⓘ Antimony | Sb |
| Sb | ⓘ Cervantite | Sb3+Sb5+O4 |
| Sb | ⓘ Dyscrasite | Ag3Sb |
| Sb | ⓘ Kermesite | Sb2S2O |
| Sb | ⓘ Pyrargyrite | Ag3SbS3 |
| Sb | ⓘ Senarmontite | Sb2O3 |
| Sb | ⓘ Stibarsen | AsSb |
| Sb | ⓘ Stibnite | Sb2S3 |
| Sb | ⓘ Tučekite | Ni9Sb2S8 |
| Sb | ⓘ Ullmannite | NiSbS |
| Sb | ⓘ Valentinite | Sb2O3 |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Au | Gold | |
| Au | ⓘ Gold | Au |
| Hg | Mercury | |
| Hg | ⓘ Silver var. Native Amalgam | (Ag,Hg) |
| Hg | ⓘ Cinnabar | HgS |
| Hg | ⓘ Moschellandsbergite | Ag2Hg3 |
| Hg | ⓘ Schachnerite | Ag1.1Hg0.9 |
| Pb | Lead | |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
| Bi | Bismuth | |
| Bi | ⓘ Bismuth | Bi |
Other Regions, Features and Areas containing this locality
Eurasian PlateTectonic Plate
EuropeContinent
- The AlpsMountain Range
France
- Auvergne-Rhône-Alpes
- Isère
- Grenoble
- ⭔Oisans-RomancheCanton
- Grenoble
- Savoie
- Belledonne massifMassif
- Isère
- ⭔DauphinéProvince
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
