Naundorf Granite quarry, Bobritzsch-Hilbersdorf, Mittelsachsen, Saxony, Germanyi
Regional Level Types | |
---|---|
Naundorf Granite quarry | Quarry |
Bobritzsch-Hilbersdorf | Municipality |
Mittelsachsen | District |
Saxony | State |
Germany | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
50° 55' 38'' North , 13° 25' 33'' East
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Nearest Settlements:
Place | Population | Distance |
---|---|---|
Niederschöna | 2,108 (2015) | 4.4km |
Halsbrücke | 3,619 (2015) | 5.9km |
Freiberg | 43,670 (2015) | 6.4km |
Pretzschendorf | 4,440 (2015) | 9.1km |
Obercunnersdorf | 2,249 (2015) | 9.5km |
Mindat Locality ID:
13852
Long-form identifier:
mindat:1:2:13852:8
GUID (UUID V4):
42bd0622-81bc-4970-9ebd-05f9515744d0
Other Languages:
German:
Granitbruch, Bobritzsch-Hilbersdorf, Mittelsachsen, Sachsen, Deutschland
Active granite quarry that includes an outcrop of a hydrothermal vein ("Gottlob Morgengang") of the 'fba' formation.
Located 3 km east of Freiberg. Collecting is prohibited.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded at this locality.Mineral List
35 valid minerals.
Detailed Mineral List:
ⓘ Albite Formula: Na(AlSi3O8) |
ⓘ Albite var. Oligoclase Formula: (Na,Ca)[Al(Si,Al)Si2O8] |
ⓘ Allanite-(Ce) Formula: (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
ⓘ 'Amphibole Supergroup' Formula: AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) |
ⓘ Arsenopyrite Formula: FeAsS |
ⓘ Baryte Formula: BaSO4 |
ⓘ Bertrandite Formula: Be4(Si2O7)(OH)2 |
ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
ⓘ Bismuthinite Formula: Bi2S3 |
ⓘ Bornite Formula: Cu5FeS4 |
ⓘ Calcite Formula: CaCO3 |
ⓘ Cassiterite Formula: SnO2 |
ⓘ Chalcopyrite Formula: CuFeS2 |
ⓘ 'Chlorite Group' |
ⓘ Dolomite Formula: CaMg(CO3)2 |
ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
ⓘ Ferrimolybdite Formula: Fe2(MoO4)3 · nH2O |
ⓘ Fluorapatite Formula: Ca5(PO4)3F |
ⓘ Fluorite Formula: CaF2 |
ⓘ Galena Formula: PbS |
ⓘ Gustavite Formula: AgPbBi3S6 |
ⓘ Hematite Formula: Fe2O3 |
ⓘ Julgoldite-(Fe2+) Formula: Ca2Fe2+Fe3+2[Si2O6OH][SiO4](OH)2(OH) |
ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 |
ⓘ 'K Feldspar' |
ⓘ 'K Feldspar var. Adularia' Formula: KAlSi3O8 |
ⓘ Kutnohorite Formula: CaMn2+(CO3)2 |
ⓘ 'Limonite' |
ⓘ Malachite Formula: Cu2(CO3)(OH)2 |
ⓘ Marcasite Formula: FeS2 |
ⓘ Molybdenite Formula: MoS2 |
ⓘ Molybdite Formula: MoO3 |
ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
ⓘ Orthoclase Formula: K(AlSi3O8) |
ⓘ Pyrite Formula: FeS2 |
ⓘ 'Pyroxene Group' Formula: ADSi2O6 |
ⓘ Quartz Formula: SiO2 |
ⓘ Quartz var. Chalcedony Formula: SiO2 |
ⓘ Quartz var. Smoky Quartz Formula: SiO2 |
ⓘ Rhodochrosite Formula: MnCO3 |
ⓘ Scheelite Formula: Ca(WO4) |
ⓘ Siderite Formula: FeCO3 |
ⓘ Sphalerite Formula: ZnS |
ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S |
ⓘ Titanite Formula: CaTi(SiO4)O |
ⓘ Topaz Formula: Al2(SiO4)(F,OH)2 |
ⓘ 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z |
List of minerals arranged by Strunz 10th Edition classification
Group 2 - Sulphides and Sulfosalts | |||
---|---|---|---|
ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
ⓘ | Sphalerite | 2.CB.05a | ZnS |
ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
ⓘ | Galena | 2.CD.10 | PbS |
ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
ⓘ | Molybdenite | 2.EA.30 | MoS2 |
ⓘ | Pyrite | 2.EB.05a | FeS2 |
ⓘ | Marcasite | 2.EB.10a | FeS2 |
ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
ⓘ | Gustavite | 2.JB.40a | AgPbBi3S6 |
Group 3 - Halides | |||
ⓘ | Fluorite | 3.AB.25 | CaF2 |
Group 4 - Oxides and Hydroxides | |||
ⓘ | Hematite | 4.CB.05 | Fe2O3 |
ⓘ | Quartz var. Chalcedony | 4.DA.05 | SiO2 |
ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
ⓘ | 4.DA.05 | SiO2 | |
ⓘ | Cassiterite | 4.DB.05 | SnO2 |
ⓘ | Molybdite | 4.E0.10 | MoO3 |
Group 5 - Nitrates and Carbonates | |||
ⓘ | Rhodochrosite | 5.AB.05 | MnCO3 |
ⓘ | Siderite | 5.AB.05 | FeCO3 |
ⓘ | Calcite | 5.AB.05 | CaCO3 |
ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
ⓘ | Kutnohorite | 5.AB.10 | CaMn2+(CO3)2 |
ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
ⓘ | Baryte | 7.AD.35 | BaSO4 |
ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
ⓘ | Ferrimolybdite | 7.GB.30 | Fe2(MoO4)3 · nH2O |
Group 8 - Phosphates, Arsenates and Vanadates | |||
ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
Group 9 - Silicates | |||
ⓘ | Topaz | 9.AF.35 | Al2(SiO4)(F,OH)2 |
ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
ⓘ | Bertrandite | 9.BD.05 | Be4(Si2O7)(OH)2 |
ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
ⓘ | Allanite-(Ce) | 9.BG.05b | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
ⓘ | Julgoldite-(Fe2+) | 9.BG.20 | Ca2Fe2+Fe3+2[Si2O6OH][SiO4](OH)2(OH) |
ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
ⓘ | var. Oligoclase | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
Unclassified | |||
ⓘ | 'Pyroxene Group' | - | ADSi2O6 |
ⓘ | 'K Feldspar' | - | |
ⓘ | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
ⓘ | 'K Feldspar var. Adularia' | - | KAlSi3O8 |
ⓘ | 'Limonite' | - | |
ⓘ | 'Chlorite Group' | - | |
ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
ⓘ | 'Amphibole Supergroup' | - | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
List of minerals for each chemical element
H | Hydrogen | |
---|---|---|
H | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
H | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
H | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
H | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
H | ⓘ Julgoldite-(Fe2+) | Ca2Fe2+Fe23+[Si2O6OH][SiO4](OH)2(OH) |
H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
H | ⓘ Malachite | Cu2(CO3)(OH)2 |
H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
H | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
Be | Beryllium | |
Be | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
B | Boron | |
B | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
C | Carbon | |
C | ⓘ Calcite | CaCO3 |
C | ⓘ Dolomite | CaMg(CO3)2 |
C | ⓘ Kutnohorite | CaMn2+(CO3)2 |
C | ⓘ Malachite | Cu2(CO3)(OH)2 |
C | ⓘ Rhodochrosite | MnCO3 |
C | ⓘ Siderite | FeCO3 |
O | Oxygen | |
O | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
O | ⓘ Albite | Na(AlSi3O8) |
O | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
O | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
O | ⓘ Baryte | BaSO4 |
O | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
O | ⓘ Calcite | CaCO3 |
O | ⓘ Cassiterite | SnO2 |
O | ⓘ Quartz var. Chalcedony | SiO2 |
O | ⓘ Dolomite | CaMg(CO3)2 |
O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
O | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
O | ⓘ Fluorapatite | Ca5(PO4)3F |
O | ⓘ Hematite | Fe2O3 |
O | ⓘ Julgoldite-(Fe2+) | Ca2Fe2+Fe23+[Si2O6OH][SiO4](OH)2(OH) |
O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
O | ⓘ Kutnohorite | CaMn2+(CO3)2 |
O | ⓘ Malachite | Cu2(CO3)(OH)2 |
O | ⓘ Molybdite | MoO3 |
O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
O | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
O | ⓘ Orthoclase | K(AlSi3O8) |
O | ⓘ Quartz | SiO2 |
O | ⓘ Rhodochrosite | MnCO3 |
O | ⓘ Scheelite | Ca(WO4) |
O | ⓘ Siderite | FeCO3 |
O | ⓘ Quartz var. Smoky Quartz | SiO2 |
O | ⓘ Titanite | CaTi(SiO4)O |
O | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
O | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
O | ⓘ Pyroxene Group | ADSi2O6 |
O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
F | Fluorine | |
F | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
F | ⓘ Fluorapatite | Ca5(PO4)3F |
F | ⓘ Fluorite | CaF2 |
F | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
Na | Sodium | |
Na | ⓘ Albite | Na(AlSi3O8) |
Na | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
Mg | Magnesium | |
Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
Mg | ⓘ Dolomite | CaMg(CO3)2 |
Al | Aluminium | |
Al | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
Al | ⓘ Albite | Na(AlSi3O8) |
Al | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
Al | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
Al | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
Al | ⓘ Orthoclase | K(AlSi3O8) |
Al | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
Si | Silicon | |
Si | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
Si | ⓘ Albite | Na(AlSi3O8) |
Si | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
Si | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
Si | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
Si | ⓘ Quartz var. Chalcedony | SiO2 |
Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
Si | ⓘ Julgoldite-(Fe2+) | Ca2Fe2+Fe23+[Si2O6OH][SiO4](OH)2(OH) |
Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
Si | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
Si | ⓘ Orthoclase | K(AlSi3O8) |
Si | ⓘ Quartz | SiO2 |
Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
Si | ⓘ Titanite | CaTi(SiO4)O |
Si | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
Si | ⓘ Pyroxene Group | ADSi2O6 |
P | Phosphorus | |
P | ⓘ Fluorapatite | Ca5(PO4)3F |
P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
S | Sulfur | |
S | ⓘ Arsenopyrite | FeAsS |
S | ⓘ Baryte | BaSO4 |
S | ⓘ Bismuthinite | Bi2S3 |
S | ⓘ Bornite | Cu5FeS4 |
S | ⓘ Chalcopyrite | CuFeS2 |
S | ⓘ Galena | PbS |
S | ⓘ Gustavite | AgPbBi3S6 |
S | ⓘ Marcasite | FeS2 |
S | ⓘ Molybdenite | MoS2 |
S | ⓘ Pyrite | FeS2 |
S | ⓘ Sphalerite | ZnS |
S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
Cl | Chlorine | |
Cl | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
K | Potassium | |
K | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
K | ⓘ Orthoclase | K(AlSi3O8) |
Ca | Calcium | |
Ca | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
Ca | ⓘ Calcite | CaCO3 |
Ca | ⓘ Dolomite | CaMg(CO3)2 |
Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
Ca | ⓘ Fluorite | CaF2 |
Ca | ⓘ Julgoldite-(Fe2+) | Ca2Fe2+Fe23+[Si2O6OH][SiO4](OH)2(OH) |
Ca | ⓘ Kutnohorite | CaMn2+(CO3)2 |
Ca | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
Ca | ⓘ Scheelite | Ca(WO4) |
Ca | ⓘ Titanite | CaTi(SiO4)O |
Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
Ti | Titanium | |
Ti | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
Ti | ⓘ Titanite | CaTi(SiO4)O |
Mn | Manganese | |
Mn | ⓘ Kutnohorite | CaMn2+(CO3)2 |
Mn | ⓘ Rhodochrosite | MnCO3 |
Fe | Iron | |
Fe | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
Fe | ⓘ Arsenopyrite | FeAsS |
Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
Fe | ⓘ Bornite | Cu5FeS4 |
Fe | ⓘ Chalcopyrite | CuFeS2 |
Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
Fe | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
Fe | ⓘ Hematite | Fe2O3 |
Fe | ⓘ Julgoldite-(Fe2+) | Ca2Fe2+Fe23+[Si2O6OH][SiO4](OH)2(OH) |
Fe | ⓘ Marcasite | FeS2 |
Fe | ⓘ Pyrite | FeS2 |
Fe | ⓘ Siderite | FeCO3 |
Cu | Copper | |
Cu | ⓘ Bornite | Cu5FeS4 |
Cu | ⓘ Chalcopyrite | CuFeS2 |
Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
Zn | Zinc | |
Zn | ⓘ Sphalerite | ZnS |
As | Arsenic | |
As | ⓘ Arsenopyrite | FeAsS |
Mo | Molybdenum | |
Mo | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
Mo | ⓘ Molybdenite | MoS2 |
Mo | ⓘ Molybdite | MoO3 |
Ag | Silver | |
Ag | ⓘ Gustavite | AgPbBi3S6 |
Sn | Tin | |
Sn | ⓘ Cassiterite | SnO2 |
Sb | Antimony | |
Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
Ba | Barium | |
Ba | ⓘ Baryte | BaSO4 |
Ce | Cerium | |
Ce | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
W | Tungsten | |
W | ⓘ Scheelite | Ca(WO4) |
Pb | Lead | |
Pb | ⓘ Galena | PbS |
Pb | ⓘ Gustavite | AgPbBi3S6 |
Bi | Bismuth | |
Bi | ⓘ Bismuthinite | Bi2S3 |
Bi | ⓘ Gustavite | AgPbBi3S6 |
Other Regions, Features and Areas containing this locality
Eurasian PlateTectonic Plate
EuropeContinent
- Bohemian MassifMassif
- Ore MountainsMountain Range
Germany
- Saxony
- Mittelsachsen
- Freiberg Mining DistrictMining District
- Mittelsachsen
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.