Windeckberg, Spitz, Krems-Land District, Lower Austria, Austriai
Regional Level Types | |
---|---|
Windeckberg | - not defined - |
Spitz | Municipality |
Krems-Land District | District |
Lower Austria | State |
Austria | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
48° 23' 13'' North , 15° 24' 6'' East
Latitude & Longitude (decimal):
Köppen climate type:
Nearest Settlements:
Place | Population | Distance |
---|---|---|
Spitz | 1,270 (2018) | 2.6km |
Mitterarnsdorf | 172 (2018) | 3.5km |
Gut am Steg | 129 (2018) | 3.6km |
Joching | 169 (2018) | 3.6km |
Oberarnsdorf | 182 (2018) | 3.9km |
Mindat Locality ID:
58179
Long-form identifier:
mindat:1:2:58179:3
GUID (UUID V4):
4ff130c7-a711-48e5-9120-0f3a058d8714
Name(s) in local language(s):
Windeckberg, Mieslingtal, Spitz, Wachau, Niederösterreich, Österreich
Pegmatite outcrops and loose pegmatite boulders (individual sublocalities are named "Spitz 20" etc.).
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
ⓘ Albite Formula: Na(AlSi3O8) |
ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 References: |
ⓘ 'Almandine-Spessartine Series' |
ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) |
ⓘ Bavenite Formula: Ca4Be2Al2Si9O26(OH)2 References: |
ⓘ Bertrandite Formula: Be4(Si2O7)(OH)2 |
ⓘ Beryl Formula: Be3Al2(Si6O18) |
ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
ⓘ Cassiterite Formula: SnO2 |
ⓘ Cheralite ? Formula: CaTh(PO4)2 |
ⓘ Chrysoberyl Formula: BeAl2O4 |
ⓘ Columbite-(Fe) Formula: Fe2+Nb2O6 |
ⓘ 'Columbite-(Fe)-Columbite-(Mn) Series' Description: Originally reported as unconfirmed; columbite-(Fe) was later confirmed by Kolitsch and Löffler (2020). |
ⓘ Graftonite Formula: Fe2+Fe2+2(PO4)2 References: |
ⓘ 'Limonite' |
ⓘ Lithiophilite Formula: LiMn2+PO4 |
ⓘ 'Manganese Oxides' |
ⓘ Microcline Formula: K(AlSi3O8) References: |
ⓘ 'Monazite' ? Formula: REE(PO4) |
ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
ⓘ Orthoclase Formula: K(AlSi3O8) |
ⓘ Quartz Formula: SiO2 |
ⓘ Quartz var. Smoky Quartz Formula: SiO2 |
ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
ⓘ Topaz Formula: Al2(SiO4)(F,OH)2 References: |
ⓘ Triphylite Formula: LiFe2+PO4 |
ⓘ Triplite Formula: Mn2+2(PO4)F |
ⓘ Zircon Formula: Zr(SiO4) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
Group 4 - Oxides and Hydroxides | |||
---|---|---|---|
ⓘ | Chrysoberyl | 4.BA.05 | BeAl2O4 |
ⓘ | Quartz var. Smoky Quartz | 4.DA.05 | SiO2 |
ⓘ | 4.DA.05 | SiO2 | |
ⓘ | Cassiterite | 4.DB.05 | SnO2 |
ⓘ | Columbite-(Fe) | 4.DB.35 | Fe2+Nb2O6 |
Group 8 - Phosphates, Arsenates and Vanadates | |||
ⓘ | Triphylite | 8.AB.10 | LiFe2+PO4 |
ⓘ | Lithiophilite | 8.AB.10 | LiMn2+PO4 |
ⓘ | Graftonite | 8.AB.20 | Fe2+Fe2+2(PO4)2 |
ⓘ | Cheralite ? | 8.AD.50 | CaTh(PO4)2 |
ⓘ | Triplite | 8.BB.10 | Mn2+2(PO4)F |
Group 9 - Silicates | |||
ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
ⓘ | Topaz | 9.AF.35 | Al2(SiO4)(F,OH)2 |
ⓘ | Bertrandite | 9.BD.05 | Be4(Si2O7)(OH)2 |
ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
ⓘ | Bavenite | 9.DF.25 | Ca4Be2Al2Si9O26(OH)2 |
ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
Unclassified | |||
ⓘ | 'Monazite' ? | - | REE(PO4) |
ⓘ | 'Limonite' | - | |
ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
ⓘ | 'Almandine-Spessartine Series' | - | |
ⓘ | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
ⓘ | 'Manganese Oxides' | - | |
ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
List of minerals for each chemical element
H | Hydrogen | |
---|---|---|
H | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
H | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
H | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
Li | Lithium | |
Li | ⓘ Lithiophilite | LiMn2+PO4 |
Li | ⓘ Triphylite | LiFe2+PO4 |
Be | Beryllium | |
Be | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
Be | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
Be | ⓘ Beryl | Be3Al2(Si6O18) |
Be | ⓘ Chrysoberyl | BeAl2O4 |
B | Boron | |
B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
O | Oxygen | |
O | ⓘ Albite | Na(AlSi3O8) |
O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
O | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
O | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
O | ⓘ Beryl | Be3Al2(Si6O18) |
O | ⓘ Cassiterite | SnO2 |
O | ⓘ Chrysoberyl | BeAl2O4 |
O | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
O | ⓘ Graftonite | Fe2+Fe22+(PO4)2 |
O | ⓘ Lithiophilite | LiMn2+PO4 |
O | ⓘ Microcline | K(AlSi3O8) |
O | ⓘ Monazite | REE(PO4) |
O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
O | ⓘ Orthoclase | K(AlSi3O8) |
O | ⓘ Quartz | SiO2 |
O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
O | ⓘ Quartz var. Smoky Quartz | SiO2 |
O | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
O | ⓘ Triphylite | LiFe2+PO4 |
O | ⓘ Triplite | Mn22+(PO4)F |
O | ⓘ Zircon | Zr(SiO4) |
O | ⓘ Cheralite | CaTh(PO4)2 |
O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
F | Fluorine | |
F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
F | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
F | ⓘ Triplite | Mn22+(PO4)F |
F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
Na | Sodium | |
Na | ⓘ Albite | Na(AlSi3O8) |
Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
Mg | Magnesium | |
Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
Al | Aluminium | |
Al | ⓘ Albite | Na(AlSi3O8) |
Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
Al | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
Al | ⓘ Beryl | Be3Al2(Si6O18) |
Al | ⓘ Chrysoberyl | BeAl2O4 |
Al | ⓘ Microcline | K(AlSi3O8) |
Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
Al | ⓘ Orthoclase | K(AlSi3O8) |
Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
Al | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
Si | Silicon | |
Si | ⓘ Albite | Na(AlSi3O8) |
Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
Si | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
Si | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
Si | ⓘ Beryl | Be3Al2(Si6O18) |
Si | ⓘ Microcline | K(AlSi3O8) |
Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
Si | ⓘ Orthoclase | K(AlSi3O8) |
Si | ⓘ Quartz | SiO2 |
Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
Si | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
Si | ⓘ Zircon | Zr(SiO4) |
P | Phosphorus | |
P | ⓘ Graftonite | Fe2+Fe22+(PO4)2 |
P | ⓘ Lithiophilite | LiMn2+PO4 |
P | ⓘ Monazite | REE(PO4) |
P | ⓘ Triphylite | LiFe2+PO4 |
P | ⓘ Triplite | Mn22+(PO4)F |
P | ⓘ Cheralite | CaTh(PO4)2 |
P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
Cl | Chlorine | |
Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
K | Potassium | |
K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
K | ⓘ Microcline | K(AlSi3O8) |
K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
K | ⓘ Orthoclase | K(AlSi3O8) |
Ca | Calcium | |
Ca | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
Ca | ⓘ Cheralite | CaTh(PO4)2 |
Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
Ti | Titanium | |
Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
Mn | Manganese | |
Mn | ⓘ Lithiophilite | LiMn2+PO4 |
Mn | ⓘ Triplite | Mn22+(PO4)F |
Fe | Iron | |
Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
Fe | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
Fe | ⓘ Graftonite | Fe2+Fe22+(PO4)2 |
Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
Fe | ⓘ Triphylite | LiFe2+PO4 |
Zr | Zirconium | |
Zr | ⓘ Zircon | Zr(SiO4) |
Nb | Niobium | |
Nb | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
Sn | Tin | |
Sn | ⓘ Cassiterite | SnO2 |
Th | Thorium | |
Th | ⓘ Cheralite | CaTh(PO4)2 |
Other Regions, Features and Areas containing this locality
Austria
- Lower Austria
- Krems-Land District
- Miesling valleyValley
- WachauValley
- ⭔WaldviertelQuarter
- Krems-Land District
Eurasian PlateTectonic Plate
EuropeContinent
- Bohemian MassifMassif
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Windeckberg, Spitz, Krems-Land District, Lower Austria, Austria