Kalinovskoe porphyry Cu deposit, Sosnovsky District, Chelyabinsk Oblast, Russiai
Regional Level Types | |
---|---|
Kalinovskoe porphyry Cu deposit | Deposit |
Sosnovsky District | District |
Chelyabinsk Oblast | Oblast |
Russia | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
54° 52' 10'' North , 61° 8' 12'' East
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Nearest Settlements:
Place | Population | Distance |
---|---|---|
Yemanzhelinka | 4,117 (2014) | 12.9km |
Korkino | 40,046 (2017) | 16.8km |
Yemanzhelinsk | 29,849 (2017) | 17.4km |
Sargazy | 1,827 (2013) | 18.3km |
Poletayevo | 6,532 (2012) | 18.3km |
Mindat Locality ID:
333062
Long-form identifier:
mindat:1:2:333062:6
GUID (UUID V4):
d883866e-dafb-4586-899d-9f5e7c1e440b
10 km southeast from the Michurino occurrence. Coordinates are based upon this assumption.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded at this locality.Mineral List
18 valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
ⓘ Albite Formula: Na(AlSi3O8) |
ⓘ Anhydrite Formula: CaSO4 |
ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
ⓘ Bornite Formula: Cu5FeS4 |
ⓘ Calcite Formula: CaCO3 |
ⓘ Chalcopyrite Formula: CuFeS2 |
ⓘ 'Chlorite Group' |
ⓘ Dravite Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
ⓘ Foitite Formula: ◻(Fe2+2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
ⓘ Gold var. Electrum Formula: (Au,Ag) |
ⓘ Hematite Formula: Fe2O3 |
ⓘ Hematite var. Specularite Formula: Fe2O3 |
ⓘ Magnesio-foitite Formula: ◻(Mg2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
ⓘ Molybdenite Formula: MoS2 |
ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 |
ⓘ Oxy-schorl Formula: Na(Fe2+2Al)Al6(Si6O18)(BO3)3(OH)3O |
ⓘ Pyrite Formula: FeS2 |
ⓘ Quartz Formula: SiO2 |
ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
ⓘ Sphalerite Formula: ZnS |
ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S |
ⓘ 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z |
ⓘ 'White mica' |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
Group 1 - Elements | |||
---|---|---|---|
ⓘ | Gold var. Electrum | 1.AA.05 | (Au,Ag) |
Group 2 - Sulphides and Sulfosalts | |||
ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
ⓘ | Sphalerite | 2.CB.05a | ZnS |
ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
ⓘ | Molybdenite | 2.EA.30 | MoS2 |
ⓘ | Pyrite | 2.EB.05a | FeS2 |
ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
Group 4 - Oxides and Hydroxides | |||
ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
ⓘ | Hematite var. Specularite | 4.CB.05 | Fe2O3 |
ⓘ | 4.CB.05 | Fe2O3 | |
ⓘ | Quartz | 4.DA.05 | SiO2 |
Group 5 - Nitrates and Carbonates | |||
ⓘ | Calcite | 5.AB.05 | CaCO3 |
Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
ⓘ | Anhydrite | 7.AD.30 | CaSO4 |
Group 9 - Silicates | |||
ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
ⓘ | Foitite | 9.CK.05 | ◻(Fe2+2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
ⓘ | Oxy-schorl | 9.CK.05 | Na(Fe2+2Al)Al6(Si6O18)(BO3)3(OH)3O |
ⓘ | Magnesio-foitite | 9.CK.05 | ◻(Mg2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
ⓘ | var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
Unclassified | |||
ⓘ | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
ⓘ | 'Chlorite Group' | - | |
ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
ⓘ | 'White mica' | - |
List of minerals for each chemical element
H | Hydrogen | |
---|---|---|
H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
H | ⓘ Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
H | ⓘ Magnesio-foitite | ◻(Mg2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
H | ⓘ Oxy-schorl | Na(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3O |
B | Boron | |
B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
B | ⓘ Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
B | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
B | ⓘ Magnesio-foitite | ◻(Mg2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
B | ⓘ Oxy-schorl | Na(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3O |
C | Carbon | |
C | ⓘ Calcite | CaCO3 |
O | Oxygen | |
O | ⓘ Albite | Na(AlSi3O8) |
O | ⓘ Anhydrite | CaSO4 |
O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
O | ⓘ Calcite | CaCO3 |
O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
O | ⓘ Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
O | ⓘ Hematite | Fe2O3 |
O | ⓘ Magnetite | Fe2+Fe23+O4 |
O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
O | ⓘ Quartz | SiO2 |
O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
O | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
O | ⓘ Hematite var. Specularite | Fe2O3 |
O | ⓘ Magnesio-foitite | ◻(Mg2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
O | ⓘ Oxy-schorl | Na(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3O |
F | Fluorine | |
F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
Na | Sodium | |
Na | ⓘ Albite | Na(AlSi3O8) |
Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
Na | ⓘ Oxy-schorl | Na(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3O |
Mg | Magnesium | |
Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
Mg | ⓘ Magnesio-foitite | ◻(Mg2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
Al | Aluminium | |
Al | ⓘ Albite | Na(AlSi3O8) |
Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
Al | ⓘ Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
Al | ⓘ Magnesio-foitite | ◻(Mg2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
Al | ⓘ Oxy-schorl | Na(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3O |
Si | Silicon | |
Si | ⓘ Albite | Na(AlSi3O8) |
Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
Si | ⓘ Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
Si | ⓘ Quartz | SiO2 |
Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
Si | ⓘ Magnesio-foitite | ◻(Mg2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
Si | ⓘ Oxy-schorl | Na(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3O |
S | Sulfur | |
S | ⓘ Anhydrite | CaSO4 |
S | ⓘ Bornite | Cu5FeS4 |
S | ⓘ Chalcopyrite | CuFeS2 |
S | ⓘ Molybdenite | MoS2 |
S | ⓘ Pyrite | FeS2 |
S | ⓘ Sphalerite | ZnS |
S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
K | Potassium | |
K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
Ca | Calcium | |
Ca | ⓘ Anhydrite | CaSO4 |
Ca | ⓘ Calcite | CaCO3 |
Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
Ti | Titanium | |
Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
Fe | Iron | |
Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
Fe | ⓘ Bornite | Cu5FeS4 |
Fe | ⓘ Chalcopyrite | CuFeS2 |
Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
Fe | ⓘ Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
Fe | ⓘ Hematite | Fe2O3 |
Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
Fe | ⓘ Pyrite | FeS2 |
Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
Fe | ⓘ Hematite var. Specularite | Fe2O3 |
Fe | ⓘ Oxy-schorl | Na(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3O |
Cu | Copper | |
Cu | ⓘ Bornite | Cu5FeS4 |
Cu | ⓘ Chalcopyrite | CuFeS2 |
Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
Zn | Zinc | |
Zn | ⓘ Sphalerite | ZnS |
Mo | Molybdenum | |
Mo | ⓘ Molybdenite | MoS2 |
Ag | Silver | |
Ag | ⓘ Gold var. Electrum | (Au,Ag) |
Sb | Antimony | |
Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
Au | Gold | |
Au | ⓘ Gold var. Electrum | (Au,Ag) |
Other Regions, Features and Areas containing this locality
AsiaContinent
Eurasian PlateTectonic Plate
Russia
- ⭔Ural Economic RegionEconomic Region
- Ural MountainsMountain Range
- Southern UralsMountain Range
- ⭔Western Siberian basin (Zapadno-Sibirskiy basin)Economic Region
Soviet Union (1922-1991)Country
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.