Grand Etang alluvial deposits, Andelot River watershed, Saint-Didier-la-Forêt, Vichy, Allier, Auvergne-Rhône-Alpes, Francei
| Regional Level Types | |
|---|---|
| Grand Etang alluvial deposits | - not defined - |
| Andelot River watershed | - not defined - |
| Saint-Didier-la-Forêt | Commune |
| Vichy | Arrondissement |
| Allier | Department |
| Auvergne-Rhône-Alpes | Region |
| France | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
46° 13' 40'' North , 3° 18' 29'' East
Latitude & Longitude (decimal):
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Bayet | 651 (2016) | 3.8km |
| Barberier | 120 (2016) | 4.5km |
| Broût-Vernet | 1,124 (2016) | 5.2km |
| Loriges | 332 (2016) | 5.5km |
| Étroussat | 668 (2016) | 6.8km |
Mindat Locality ID:
304235
Long-form identifier:
mindat:1:2:304235:2
GUID (UUID V4):
f20cea65-a2e0-418c-9ff5-e60ce9fce32a
Other/historical names associated with this locality:
, Auvergne; Rhône-Alpes
Name(s) in local language(s):
Alluvions du Grand Etang, bassin versant de la rivière Andelot, St-Didier-la-Forêt, Vichy, Allier, Auvergne-Rhône-Alpes, France
Quarry for aggregates
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
| ⓘ Andalusite Formula: Al2(SiO4)O References: |
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) References: |
| ⓘ Arsenopyrite Formula: FeAsS References: |
| ⓘ Augite Formula: (CaxMgyFez)(Mgy1Fez1)Si2O6 References: |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 References: |
| ⓘ Cassiterite Formula: SnO2 References: |
| ⓘ Corundum Formula: Al2O3 References: |
| ⓘ Corundum var. Sapphire Formula: Al2O3 References: |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) References: |
| ⓘ 'Fayalite-Forsterite Series' References: |
| ⓘ 'Feldspar Group' References: |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 References: |
| ⓘ Gold Formula: Au References: |
| ⓘ 'Hornblende Root Name Group' Formula: ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| ⓘ Ilmenite Formula: Fe2+TiO3 References: |
| ⓘ Kyanite Formula: Al2(SiO4)O References: |
| ⓘ 'Leucoxene' References: |
| ⓘ 'Limonite' References: |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 References: |
| ⓘ 'Monazite' Formula: REE(PO4) References: |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 References: |
| ⓘ Pyrite Formula: FeS2 References: |
| ⓘ Quartz Formula: SiO2 References: |
| ⓘ Rutile Formula: TiO2 References: |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) References: |
| ⓘ Sillimanite Formula: Al2(SiO4)O References: |
| ⓘ Spinel Formula: MgAl2O4 References: |
| ⓘ Staurolite Formula: Fe2+2Al9Si4O23(OH) References: |
| ⓘ Titanite Formula: CaTi(SiO4)O References: |
| ⓘ Zircon Formula: Zr(SiO4) References: |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Gold | 1.AA.05 | Au |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Spinel | 4.BB.05 | MgAl2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Corundum | 4.CB.05 | Al2O3 |
| ⓘ | var. Sapphire | 4.CB.05 | Al2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| Group 9 - Silicates | |||
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Sillimanite | 9.AF.05 | Al2(SiO4)O |
| ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | Kyanite | 9.AF.15 | Al2(SiO4)O |
| ⓘ | Staurolite | 9.AF.30 | Fe2+2Al9Si4O23(OH) |
| ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Augite | 9.DA.15 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| Unclassified | |||
| ⓘ | 'Monazite' | - | REE(PO4) |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Leucoxene' | - | |
| ⓘ | 'Fayalite-Forsterite Series' | - | |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| H | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | Oxygen | |
| O | ⓘ Andalusite | Al2(SiO4)O |
| O | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Corundum | Al2O3 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Kyanite | Al2(SiO4)O |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Monazite | REE(PO4) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Corundum var. Sapphire | Al2O3 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Sillimanite | Al2(SiO4)O |
| O | ⓘ Spinel | MgAl2O4 |
| O | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| O | ⓘ Titanite | CaTi(SiO4)O |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Spinel | MgAl2O4 |
| Al | Aluminium | |
| Al | ⓘ Andalusite | Al2(SiO4)O |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Corundum | Al2O3 |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Kyanite | Al2(SiO4)O |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Corundum var. Sapphire | Al2O3 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Sillimanite | Al2(SiO4)O |
| Al | ⓘ Spinel | MgAl2O4 |
| Al | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Si | Silicon | |
| Si | ⓘ Andalusite | Al2(SiO4)O |
| Si | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Kyanite | Al2(SiO4)O |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Sillimanite | Al2(SiO4)O |
| Si | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Si | ⓘ Titanite | CaTi(SiO4)O |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| P | Phosphorus | |
| P | ⓘ Monazite | REE(PO4) |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Pyrite | FeS2 |
| Cl | Chlorine | |
| Cl | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Titanite | CaTi(SiO4)O |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTi(SiO4)O |
| Fe | Iron | |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Au | Gold | |
| Au | ⓘ Gold | Au |
Other Regions, Features and Areas containing this locality
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
