Brazil Lake pegmatite, Yarmouth Co., Nova Scotia, Canadai
Regional Level Types | |
---|---|
Brazil Lake pegmatite | Pegmatite |
Yarmouth Co. | County |
Nova Scotia | Province |
Canada | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
43° 59' 11'' North , 65° 59' 42'' West
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Nearest Settlements:
Place | Population | Distance |
---|---|---|
Yarmouth | 7,500 (2008) | 19.6km |
Mindat Locality ID:
231203
Long-form identifier:
mindat:1:2:231203:6
GUID (UUID V4):
3dc3d0b6-8188-4782-8d29-8beb28381722
A lithium-rich, albite-spodumene pegmatite. The pegmatite is exposed on both sides of Holley Road. The GPS coordinates are for the southern exposure. In the mid 2010s, a large sample from the mine was sent to China.
The large spodumene crystals are evident everywhere. They are reported to reach 2 m in length. Most are white but pink is common and green is rare.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded at this locality.Mineral List
22 valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
ⓘ Albite Formula: Na(AlSi3O8) |
ⓘ Beryl Formula: Be3Al2(Si6O18) |
ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
ⓘ Cassiterite Formula: SnO2 |
ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 |
ⓘ Clinochlore var. Ripidolite Formula: (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
ⓘ Cookeite Formula: (LiAl4◻)[AlSi3O10](OH)8 |
ⓘ Crandallite Formula: CaAl3(PO4)(PO3OH)(OH)6 |
ⓘ Elbaite Formula: Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
ⓘ 'Feldspar Group' References: |
ⓘ 'Feldspar Group var. Perthite' References: |
ⓘ Fillowite Formula: Na3CaMn2+11(PO4)9 |
ⓘ Fluorapatite Formula: Ca5(PO4)3F |
ⓘ Goyazite Formula: SrAl3(PO4)(PO3OH)(OH)6 |
ⓘ Holmquistite Formula: ◻{Li2}{Mg3Al2}(Si8O22)(OH)2 |
ⓘ 'Indicolite' Formula: A(D3)G6(T6O18)(BO3)3X3Z |
ⓘ Lithiophilite Formula: LiMn2+PO4 |
ⓘ Microcline Formula: K(AlSi3O8) |
ⓘ Montebrasite Formula: LiAl(PO4)(OH) |
ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
ⓘ Quartz Formula: SiO2 |
ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
ⓘ Spessartine Formula: Mn2+3Al2(SiO4)3 |
ⓘ Spodumene Formula: LiAlSi2O6 |
ⓘ 'Tantalite' Formula: (Mn,Fe)(Ta,Nb)2O6 |
ⓘ Titanite Formula: CaTi(SiO4)O |
ⓘ 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z |
ⓘ Zircon Formula: Zr(SiO4) |
List of minerals arranged by Strunz 10th Edition classification
Group 4 - Oxides and Hydroxides | |||
---|---|---|---|
ⓘ | Cassiterite | 4.DB.05 | SnO2 |
ⓘ | Quartz | 4.DA.05 | SiO2 |
Group 8 - Phosphates, Arsenates and Vanadates | |||
ⓘ | Crandallite | 8.BL.10 | CaAl3(PO4)(PO3OH)(OH)6 |
ⓘ | Fillowite | 8.AC.50 | Na3CaMn2+11(PO4)9 |
ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
ⓘ | Goyazite | 8.BL.10 | SrAl3(PO4)(PO3OH)(OH)6 |
ⓘ | Lithiophilite | 8.AB.10 | LiMn2+PO4 |
ⓘ | Montebrasite | 8.BB.05 | LiAl(PO4)(OH) |
Group 9 - Silicates | |||
ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
ⓘ | var. Ripidolite | 9.EC.55 | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
ⓘ | Cookeite | 9.EC.55 | (LiAl4◻)[AlSi3O10](OH)8 |
ⓘ | Elbaite | 9.CK.05 | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
ⓘ | Holmquistite | 9.DD.05 | ◻{Li2}{Mg3Al2}(Si8O22)(OH)2 |
ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
ⓘ | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
ⓘ | Spodumene | 9.DA.30 | LiAlSi2O6 |
ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
Unclassified Minerals, Rocks, etc. | |||
ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
ⓘ | 'Feldspar Group' | - | |
ⓘ | 'var. Perthite' | - | |
ⓘ | 'Indicolite' | - | A(D3)G6(T6O18)(BO3)3X3Z |
ⓘ | 'Tantalite' | - | (Mn,Fe)(Ta,Nb)2O6 |
ⓘ | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
List of minerals for each chemical element
H | Hydrogen | |
---|---|---|
H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
H | ⓘ Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
H | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
H | ⓘ Montebrasite | LiAl(PO4)(OH) |
H | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
H | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
H | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
H | ⓘ Holmquistite | ◻{Li2}{Mg3Al2}(Si8O22)(OH)2 |
H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
Li | Lithium | |
Li | ⓘ Spodumene | LiAlSi2O6 |
Li | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
Li | ⓘ Lithiophilite | LiMn2+PO4 |
Li | ⓘ Montebrasite | LiAl(PO4)(OH) |
Li | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
Li | ⓘ Holmquistite | ◻{Li2}{Mg3Al2}(Si8O22)(OH)2 |
Be | Beryllium | |
Be | ⓘ Beryl | Be3Al2(Si6O18) |
B | Boron | |
B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
B | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
B | ⓘ Indicolite | A(D3)G6(T6O18)(BO3)3X3Z |
B | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
O | Oxygen | |
O | ⓘ Quartz | SiO2 |
O | ⓘ Microcline | K(AlSi3O8) |
O | ⓘ Albite | Na(AlSi3O8) |
O | ⓘ Spodumene | LiAlSi2O6 |
O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
O | ⓘ Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
O | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
O | ⓘ Indicolite | A(D3)G6(T6O18)(BO3)3X3Z |
O | ⓘ Fluorapatite | Ca5(PO4)3F |
O | ⓘ Zircon | Zr(SiO4) |
O | ⓘ Cassiterite | SnO2 |
O | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
O | ⓘ Titanite | CaTi(SiO4)O |
O | ⓘ Lithiophilite | LiMn2+PO4 |
O | ⓘ Fillowite | Na3CaMn112+(PO4)9 |
O | ⓘ Montebrasite | LiAl(PO4)(OH) |
O | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
O | ⓘ Beryl | Be3Al2(Si6O18) |
O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
O | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
O | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
O | ⓘ Holmquistite | ◻{Li2}{Mg3Al2}(Si8O22)(OH)2 |
O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
O | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
F | Fluorine | |
F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
F | ⓘ Fluorapatite | Ca5(PO4)3F |
Na | Sodium | |
Na | ⓘ Albite | Na(AlSi3O8) |
Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
Na | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
Na | ⓘ Fillowite | Na3CaMn112+(PO4)9 |
Mg | Magnesium | |
Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
Mg | ⓘ Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
Mg | ⓘ Holmquistite | ◻{Li2}{Mg3Al2}(Si8O22)(OH)2 |
Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
Al | Aluminium | |
Al | ⓘ Microcline | K(AlSi3O8) |
Al | ⓘ Albite | Na(AlSi3O8) |
Al | ⓘ Spodumene | LiAlSi2O6 |
Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
Al | ⓘ Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
Al | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
Al | ⓘ Montebrasite | LiAl(PO4)(OH) |
Al | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
Al | ⓘ Beryl | Be3Al2(Si6O18) |
Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
Al | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
Al | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
Al | ⓘ Holmquistite | ◻{Li2}{Mg3Al2}(Si8O22)(OH)2 |
Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
Si | Silicon | |
Si | ⓘ Quartz | SiO2 |
Si | ⓘ Microcline | K(AlSi3O8) |
Si | ⓘ Albite | Na(AlSi3O8) |
Si | ⓘ Spodumene | LiAlSi2O6 |
Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
Si | ⓘ Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
Si | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
Si | ⓘ Zircon | Zr(SiO4) |
Si | ⓘ Titanite | CaTi(SiO4)O |
Si | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
Si | ⓘ Beryl | Be3Al2(Si6O18) |
Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
Si | ⓘ Holmquistite | ◻{Li2}{Mg3Al2}(Si8O22)(OH)2 |
Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
P | Phosphorus | |
P | ⓘ Fluorapatite | Ca5(PO4)3F |
P | ⓘ Lithiophilite | LiMn2+PO4 |
P | ⓘ Fillowite | Na3CaMn112+(PO4)9 |
P | ⓘ Montebrasite | LiAl(PO4)(OH) |
P | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
P | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
K | Potassium | |
K | ⓘ Microcline | K(AlSi3O8) |
K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
Ca | Calcium | |
Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
Ca | ⓘ Titanite | CaTi(SiO4)O |
Ca | ⓘ Fillowite | Na3CaMn112+(PO4)9 |
Ca | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
Ti | Titanium | |
Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
Ti | ⓘ Titanite | CaTi(SiO4)O |
Mn | Manganese | |
Mn | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
Mn | ⓘ Lithiophilite | LiMn2+PO4 |
Mn | ⓘ Fillowite | Na3CaMn112+(PO4)9 |
Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
Fe | Iron | |
Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 or Simplified: K(Mg,Fe)3AlSi3O10(OH)2 |
Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
Fe | ⓘ Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
Fe | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
Sr | Strontium | |
Sr | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
Zr | Zirconium | |
Zr | ⓘ Zircon | Zr(SiO4) |
Nb | Niobium | |
Nb | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
Sn | Tin | |
Sn | ⓘ Cassiterite | SnO2 |
Ta | Tantalum | |
Ta | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
Other Regions, Features and Areas containing this locality
North America PlateTectonic Plate
- Meguma DomainDomain
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Brazil Lake pegmatite, Yarmouth Co., Nova Scotia, Canada