Vekol Mining District, Vekol Mountains, Pinal County, Arizona, USAi
| Regional Level Types | |
|---|---|
| Vekol Mining District | Mining District |
| Vekol Mountains | Mountain Range |
| Pinal County | County |
| Arizona | State |
| USA | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
32° North , 112° West (est.)
Estimate based on other nearby localities or region boundaries.
Margin of Error:
~1km
Type:
Köppen climate type:
Mindat Locality ID:
59213
Long-form identifier:
mindat:1:2:59213:3
GUID (UUID V4):
ef21f820-bbb6-4e2d-acc3-351277d81684
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities36 valid minerals.
Detailed Mineral List:
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Silver | 1.AA.05 | Ag |
| ⓘ | Gold | 1.AA.05 | Au |
| ⓘ | Copper | 1.AA.05 | Cu |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Acanthite | 2.BA.35 | Ag2S |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Pyrargyrite | 2.GA.05 | Ag3SbS3 |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| Group 3 - Halides | |||
| ⓘ | Chlorargyrite | 3.AA.15 | AgCl |
| ⓘ | Boleite | 3.DB.15 | KPb26Ag9Cu24(OH)48Cl62 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Smithsonite | 5.AB.05 | ZnCO3 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | var. Iron-bearing Dolomite | 5.AB.10 | Ca(Mg,Fe)(CO3)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Aurichalcite | 5.BA.15 | (Zn,Cu)5(CO3)2(OH)6 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Fornacite | 7.FC.10 | Pb2Cu(CrO4)(AsO4)(OH) |
| ⓘ | Iranite | 7.FC.15 | Pb10Cu(CrO4)6(SiO4)2(OH)2 |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| Group 9 - Silicates | |||
| ⓘ | Willemite | 9.AA.05 | Zn2SiO4 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Dickite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Unclassified | |||
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Manganese Oxides' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| H | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| H | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Iranite | Pb10Cu(CrO4)6(SiO4)2(OH)2 |
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | Carbon | |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Smithsonite | ZnCO3 |
| C | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| O | Oxygen | |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| O | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Iranite | Pb10Cu(CrO4)6(SiO4)2(OH)2 |
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Smithsonite | ZnCO3 |
| O | ⓘ Willemite | Zn2SiO4 |
| O | ⓘ Wulfenite | Pb(MoO4) |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| Mg | Magnesium | |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| Al | Aluminium | |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | Silicon | |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Iranite | Pb10Cu(CrO4)6(SiO4)2(OH)2 |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Willemite | Zn2SiO4 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| S | Sulfur | |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Galena | PbS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Pyrargyrite | Ag3SbS3 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cl | Chlorine | |
| Cl | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| Cl | ⓘ Chlorargyrite | AgCl |
| K | Potassium | |
| K | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Ca | Calcium | |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| Cr | Chromium | |
| Cr | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| Cr | ⓘ Iranite | Pb10Cu(CrO4)6(SiO4)2(OH)2 |
| Mn | Manganese | |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Fe | Iron | |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| Cu | Copper | |
| Cu | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Cu | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Copper | Cu |
| Cu | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| Cu | ⓘ Iranite | Pb10Cu(CrO4)6(SiO4)2(OH)2 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Zn | Zinc | |
| Zn | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Zn | ⓘ Smithsonite | ZnCO3 |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Willemite | Zn2SiO4 |
| As | Arsenic | |
| As | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
| Ag | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| Ag | ⓘ Chlorargyrite | AgCl |
| Ag | ⓘ Pyrargyrite | Ag3SbS3 |
| Ag | ⓘ Silver | Ag |
| Sb | Antimony | |
| Sb | ⓘ Pyrargyrite | Ag3SbS3 |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Au | Gold | |
| Au | ⓘ Gold | Au |
| Pb | Lead | |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| Pb | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Iranite | Pb10Cu(CrO4)6(SiO4)2(OH)2 |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
Localities in this Region
- Arizona
- Pinal County
- Vekol Mountains
- Vekol Mining District
- Copperosity Hills (Cathedral Rock)
- Kohatk
- Christmas Gift Mine (Burnham and Chilson property; Acme group; Eals and Chamberlain property)
- Hill Top Mine
- Le La Mine
- Red Chief Mine
- Republic Mine (Republic Copper prospect; Ocotillo Copper Co. group; Super Six Mine; Super Six group; Lucky Ace Mine)
- Reward Mine (Bat tunnel; South Reward; Petrochis claim; Phenomenon)
- Spundulic Mine
- Vekol Mining District
- Vekol Mountains
- Pinal County
- Arizona
- Pinal County
- Vekol Mountains
- Vekol Mining District
- Kohatk
- ⭔Kohatk area
- ⭔Sif Vaya area
- Vekol Mining District
- Vekol Mountains
- Pinal County
Other Regions, Features and Areas containing this locality
Mexico
- Sierra Madre OccidentalMountain Range
North America
- Sonoran DesertDesert
North America PlateTectonic Plate
- Basin and Range BasinsBasin
- Mazatzal DomainDomain
USA
- Arizona
- ⭔Tohono O'odham ReservationReservation
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
