Senèze, Domeyrat, Brioude, Haute-Loire, Auvergne-Rhône-Alpes, Francei
| Regional Level Types | |
|---|---|
| Senèze | - not defined - |
| Domeyrat | Commune |
| Brioude | Arrondissement |
| Haute-Loire | Department |
| Auvergne-Rhône-Alpes | Region |
| France | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
45° North , 3° East (est.)
Estimate based on other nearby localities or region boundaries.
Margin of Error:
~3km
Köppen climate type:
Mindat Locality ID:
47264
Long-form identifier:
mindat:1:2:47264:4
GUID (UUID V4):
e09bed59-c2f9-49b8-9a55-e6f2c5f24049
Other/historical names associated with this locality:
Auvergne; Rhône-Alpes
Exposures of a pyrite-bearing quartz vein and of mylonites, hosted by anatectic biotite-sillimanite gneisses. Located 300 m NE of Senèze village besides the footpath ascending on the east slope of the Pié de Charenty volcano, about 2 km NE of La Chomette and 4.5 km NW of Paulhaguet.
Ref.: J.-J. Périchaud: "Les Minéraux d'Auvergne", Vol. 2, Clermont-Ferrand (1986)
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
| ⓘ Anatase Formula: TiO2 |
| ⓘ Chamosite var. Brunsvigite Formula: (Fe2+,Mg,Al)6(Si,Al)4O10(OH)8 Description: High-Fe, IIb-type chlorite, often altered in goethite. |
| ⓘ 'Chlorite Group' Description: High-Fe, IIb-type chlorite, often altered in goethite. |
| ⓘ Goethite Formula: α-Fe3+O(OH) Description: After pyrite and marcasite. |
| ⓘ Graphite Formula: C |
| ⓘ Marcasite Formula: FeS2 Description: Pseudomorph of pyrite |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Description: 2M2-type illite, forming small amber veins in quartz. |
| ⓘ Muscovite var. Illite Formula: K0.65Al2.0[Al0.65Si3.35O10](OH)2 Description: 2M2-type illite, forming small amber veins in quartz. |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Quartz Formula: SiO2 Description: Fetid quartz (rich in hydrocarbons). |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Graphite | 1.CB.05a | C |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | α-Fe3+O(OH) |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| Group 9 - Silicates | |||
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Muscovite var. Illite | 9.EC.15 | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | Chamosite var. Brunsvigite | 9.EC.55 | (Fe2+,Mg,Al)6(Si,Al)4O10(OH)8 |
| Unclassified | |||
| ⓘ | 'Chlorite Group' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Goethite | α-Fe3+O(OH) |
| H | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Chamosite var. Brunsvigite | (Fe2+,Mg,Al)6(Si,Al)4O10(OH)8 |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Graphite | C |
| O | Oxygen | |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Goethite | α-Fe3+O(OH) |
| O | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Chamosite var. Brunsvigite | (Fe2+,Mg,Al)6(Si,Al)4O10(OH)8 |
| Na | Sodium | |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Chamosite var. Brunsvigite | (Fe2+,Mg,Al)6(Si,Al)4O10(OH)8 |
| Al | Aluminium | |
| Al | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Chamosite var. Brunsvigite | (Fe2+,Mg,Al)6(Si,Al)4O10(OH)8 |
| Si | Silicon | |
| Si | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Chamosite var. Brunsvigite | (Fe2+,Mg,Al)6(Si,Al)4O10(OH)8 |
| S | Sulfur | |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Pyrite | FeS2 |
| K | Potassium | |
| K | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ti | Titanium | |
| Ti | ⓘ Anatase | TiO2 |
| Fe | Iron | |
| Fe | ⓘ Goethite | α-Fe3+O(OH) |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Chamosite var. Brunsvigite | (Fe2+,Mg,Al)6(Si,Al)4O10(OH)8 |
Other Regions, Features and Areas containing this locality
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
