Le Grand Valtin, Ban-sur-Meurthe-Clefcy, Saint-Dié-des-Vosges, Vosges, Grand Est, Francei
| Regional Level Types | |
|---|---|
| Le Grand Valtin | - not defined - |
| Ban-sur-Meurthe-Clefcy | Commune |
| Saint-Dié-des-Vosges | Arrondissement |
| Vosges | Department |
| Grand Est | Region |
| France | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
48° 5' 51'' North , 6° 59' 16'' East
Latitude & Longitude (decimal):
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Xonrupt-Longemer | 1,542 (2016) | 4.7km |
| Gerbépal | 517 (2016) | 7.6km |
| Gérardmer | 10,084 (2016) | 8.6km |
| Plainfaing | 1,783 (2016) | 8.6km |
| Soultzeren | 1,145 (2018) | 9.3km |
Mindat Locality ID:
284509
Long-form identifier:
mindat:1:2:284509:1
GUID (UUID V4):
c9c26d4e-a474-4829-a9e1-b3a4e5d0cf80
Other/historical names associated with this locality:
Lorraine
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities7 valid minerals.
Detailed Mineral List:
| ⓘ 'Amphibole Supergroup' Formula: AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ Arsenopyrite Formula: FeAsS |
| ⓘ Chalcopyrite Formula: CuFeS2 |
| ⓘ Hematite Formula: Fe2O3 |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ 'Pyroxene Group' Formula: ADSi2O6 |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Quartz var. Eisenkiesel Formula: SiO2 |
| ⓘ Safflorite Formula: (Co,Ni,Fe)As2 |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) References: Quentin Fenoy CollectionIdentified by Quentin Fenoy: Visual Identification, Inferred (explain how) |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Safflorite | 2.EB.15a | (Co,Ni,Fe)As2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Eisenkiesel | 4.DA.05 | SiO2 |
| Group 9 - Silicates | |||
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Unclassified | |||
| ⓘ | 'Amphibole Supergroup' | - | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ | 'Pyroxene Group' | - | ADSi2O6 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | Oxygen | |
| O | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Quartz var. Eisenkiesel | SiO2 |
| O | ⓘ Pyroxene Group | ADSi2O6 |
| F | Fluorine | |
| F | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Na | Sodium | |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | Aluminium | |
| Al | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | Silicon | |
| Si | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Quartz var. Eisenkiesel | SiO2 |
| Si | ⓘ Pyroxene Group | ADSi2O6 |
| S | Sulfur | |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cl | Chlorine | |
| Cl | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Ti | Titanium | |
| Ti | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Fe | Iron | |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Co | Cobalt | |
| Co | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| Ni | Nickel | |
| Ni | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| Cu | Copper | |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| Sb | Antimony | |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
Localities in this Region
Other Regions, Features and Areas containing this locality
Eurasian PlateTectonic Plate
EuropeContinent
France
- Grand Est
- Vosges
- Vosges Volcanic FieldVolcanic Field
- Vosges
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
