Irfersgrün, Lengenfeld, Vogtlandkreis, Saxony, Germanyi
| Regional Level Types | |
|---|---|
| Irfersgrün | Village |
| Lengenfeld | Municipality |
| Vogtlandkreis | District |
| Saxony | State |
| Germany | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
50° 36' 42'' North , 12° 25' 35'' East
Latitude & Longitude (decimal):
Locality type:
Köppen climate type:
Other Languages:
German:
Irfersgrün, Lengenfeld, Vogtlandkreis, Sachsen, Deutschland
Since 1994 part of the municipality of Lengenfeld.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities6 valid minerals.
Detailed Mineral List:
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) Reference: Linde, C. (1992): Apatit und Aqamarin von Irfersgrün/Vogtland. Lapis 17 (7/8), 79. |
| ⓘ Beryl Formula: Be3Al2(Si6O18) Reference: H. Vollstädt, R. Baumgärtel: "Einheimische Edelsteine", 2nd. ed., Steinkopff (Dresden), 1977 |
| ⓘ Beryl var. Aquamarine Formula: Be3Al2Si6O18 Reference: H. Vollstädt, R. Baumgärtel: "Einheimische Edelsteine", 2nd. ed., Steinkopff (Dresden), 1977; Linde, C. (1992): Apatit und Aqamarin von Irfersgrün/Vogtland. Lapis 17 (7/8), 79. |
| ⓘ Cordierite Formula: (Mg,Fe)2Al3(AlSi5O18) Reference: J. Müller, Werdau, Saxony |
| ⓘ 'Feldspar Group' Reference: M Adelt collection |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Reference: J. Müller, Werdau, Saxony |
| ⓘ Quartz Formula: SiO2 Reference: J. Müller, Werdau, Saxony |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 Reference: H. Vollstädt, R. Baumgärtel: "Einheimische Edelsteine", 2nd. ed., Steinkopff (Dresden), 1977 |
| ⓘ Rutile Formula: TiO2 Reference: J. Müller, Werdau, Saxony |
| ⓘ Rutile var. Sagenite (of Saussure) Formula: TiO2 Reference: M Adelt collection |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Reference: J. Müller, Werdau, Saxony; Uwe Kolitsch & Andreas Ertl (single-crystal structure refinement) |
List of minerals arranged by Strunz 10th Edition classification
| Group 4 - Oxides and Hydroxides | |||
|---|---|---|---|
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | var. Sagenite (of Saussure) | 4.DB.05 | TiO2 |
| Group 9 - Silicates | |||
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | var. Aquamarine | 9.CJ.05 | Be3Al2Si6O18 |
| ⓘ | Cordierite | 9.CJ.10 | (Mg,Fe)2Al3(AlSi5O18) |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Unclassified Minerals, Rocks, etc. | |||
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| ⓘ | 'Feldspar Group' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Be | Beryllium | |
| Be | ⓘ Beryl var. Aquamarine | Be3Al2Si6O18 |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | Oxygen | |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Beryl var. Aquamarine | Be3Al2Si6O18 |
| O | ⓘ Rutile var. Sagenite (of Saussure) | TiO2 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | Fluorine | |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Al | Aluminium | |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Beryl var. Aquamarine | Be3Al2Si6O18 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | Silicon | |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Beryl var. Aquamarine | Be3Al2Si6O18 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| P | Phosphorus | |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Cl | Chlorine | |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ti | Titanium | |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Rutile var. Sagenite (of Saussure) | TiO2 |
| Fe | Iron | |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
Localities in this Region
- Saxony
- Vogtlandkreis
- Lengenfeld
- Vogtlandkreis
Other Regions, Features and Areas containing this locality
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Granite outcrops, Irfersgrün, Lengenfeld, Vogtlandkreis, Saxony, Germany