Devon, England, UKi
| Regional Level Types | |
|---|---|
| Devon | County |
| England | Constituent Country |
| UK | Country |
This page is currently not sponsored. Click here to sponsor this page.
Neighbouring regions:
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Exeter | 117,763 (2017) |
| Newton Abbot | 36,474 (2018) |
| Exmouth | 34,432 (2018) |
| Barnstaple | 31,616 (2018) |
| Bideford | 28,672 (2018) |
| Heavitree | 22,000 (2011) |
Mindat Locality ID:
1620
Long-form identifier:
mindat:1:2:1620:2
GUID (UUID V4):
88ca94fa-1fd9-4aba-84c9-b37d32ee0f1a
Other/historical names associated with this locality:
Devonshire
Other Languages:
French:
Devon, Angleterre, Royaume-Uni
German:
Devon, England, Vereinigtes Königreich
Italian:
Devon, Inghilterra, Regno Unito
Russian:
Девон, Англия, Великобритания
Simplified Chinese:
德文郡, 英格兰, 英国
Spanish:
Devon, Inglaterra, Reino Unido
Afrikaans:
Devon, Engeland, Verenigde Koninkryk
Anglo-Saxon:
Defenascīr, Englaland, Geāned Cynerīce
Arabic:
ديفون, إنجلترا, المملكة المتحدة
Aragonese:
Devon, Anglaterra, Reino Unito
Armenian:
Դևոն, Անգլիա, Միացյալ Թագավորություն
Asturian:
Devon, Inglaterra, Reinu Xuníu
Azeri:
Devon, İngiltərə, Böyük Britaniya
Basque:
Devon, Ingalaterra, Erresuma Batua
Belarusian:
Дэваншыр, Англія, Вялікабрытанія
Bengali:
ডেভন, ইংল্যান্ড, যুক্তরাজ্য
Breton:
Devon, Bro-Saoz, Rouantelezh-Unanet
Bulgarian:
Девън, Англия, Обединено кралство Великобритания и Северна Ирландия
Catalan:
Devon, Anglaterra, Regne Unit
Cornish:
Dewnens, Pow Sows, Ruwvaneth Unys
Croatian:
Devon, Engleska, Ujedinjeno Kraljevstvo
Czech:
Devon, Anglie, Spojené království
Danish:
Devon, England, Storbritannien
Dutch:
Devon, Engeland, Verenigd Koninkrijk
Egyptian Arabic:
ديڤون, انجلترا, المملكه المتحده
Esperanto:
Devon, Anglio, Unuiĝinta Reĝlando
Estonian:
Devoni krahvkond, Inglismaa, Suurbritannia
Farsi/Persian:
دوون, انگلستان, بریتانیا
Finnish:
Devon, Englanti, Yhdistynyt kuningaskunta
Galician:
Devon, Inglaterra, Reino Unido
Greek:
Ντέβον, Αγγλία, Ηνωμένο Βασίλειο
Gujarati:
ડેવોન, ઈંગ્લેન્ડ, યુનાઇટેડ કિંગડમ
Hakka:
Devon, England, Yîn-koet
Hebrew:
דבון, אנגליה, הממלכה המאוחדת
Hindi:
डेवन, इंग्लैण्ड, यूनाइटेड किंगडम
Hungarian:
Devon, Anglia, Egyesült Királyság
Icelandic:
Devon, England, Bretland
Ido:
Devon, Anglia, Unionita Rejio
Indonesian:
Devon, Inggris, Britania Raya
Interlingua:
Devon, Anglaterra, Regno Unite
Irish Gaelic:
Devon, Sasana, An Ríocht Aontaithe
Japanese:
デヴォン, イングランド, イギリス
Kannada:
ಡೆವೊನ್, ಇಂಗ್ಲೆಂಡ್, ಯುನೈಟೆಡ್ ಕಿಂಗ್ಡಂ
Korean:
데번주, 잉글랜드, 영국
Latin:
Devonia, Anglia, Britanniarum regnum
Latvian:
Devona, Anglija, Apvienotā Karaliste
Lithuanian:
Devonas, Anglija, Jungtinė Karalystė
Luxembourgish:
Devon, England, Vereenegt Kinnekräich
Macedonian:
Девон, Англија, Обединето Кралство
Malayalam:
ഡെവൺ, ഇംഗ്ലണ്ട്, യുണൈറ്റഡ് കിങ്ഡം
Manx:
Devon, Sostyn, Reeriaght Unnaneysit
Marathi:
डेव्हॉन, इंग्लंड, युनायटेड किंग्डम
Minnan / Hokkien-Taiwanese:
Devon, Eng-tē, Liân-ha̍p Ông-kok
Mirandese:
Devon, Reino Ounido
Northern Frisian:
Devon, Ingelun, Feriind Kiningrik
Norwegian:
Devon, England, Storbritannia
Norwegian (Nynorsk):
Devon, England, Storbritannia
Occitan:
Devon, Anglatèrra, Reialme Unit
Ossetian:
Девон, Англис, Стыр Британи
Polish:
Devon, Anglia, Wielka Brytania
Portuguese:
Devon, Inglaterra, Reino Unido
Quechua:
Devon, Inlatirra, Hukllachasqa Qhapaq Suyu
Romanian:
Devon, Anglia, Regatul Unit al Marii Britanii și al Irlandei de Nord
Scots:
Devon, Ingland, Unitit Kinrick
Serbian:
Девон, Енглеска, Уједињено Краљевство
Serbo-Croatian:
Devon, Engleska, Ujedinjeno Kraljevstvo
Sicilian:
Devon, Nglaterra, Regnu Unitu
Slovak:
Devon, Anglicko, Spojené kráľovstvo
Slovenian:
Devon, Anglija, Združeno kraljestvo Velike Britanije in Severne Irske
Swedish:
Devon, England, Storbritannien
Tajik (Cyrillic Script):
Девон, Англия, Британия
Tamil:
டேவன், இங்கிலாந்து, ஐக்கிய இராச்சியம்
Telugu:
డెవన్, ఇంగ్లాండు, యునైటెడ్ కింగ్డమ్
Thai:
เดวอน, ประเทศอังกฤษ, สหราชอาณาจักร
Traditional Chinese:
德雲郡, 英倫, 英國
Turkish:
Devon, İngiltere, Birleşik Krallık
Ukrainian:
Девон, Англія, Велика Британія
Urdu:
ڈیون, انگلستان, مملکت متحدہ
Uyghur:
Déwonshir, بۈيۈك بېرىتانىيە
Vietnamese:
Devon, Anh, Vương quốc Liên hiệp Anh và Bắc Ireland
Volapük:
Devon, Linglän, Regän Pebalöl
Waray:
Devon, Inglaterra, Reino Unido
Welsh:
Dyfnaint, Lloegr, Y Deyrnas Unedig
West Frisian:
Devon, Ingelân, Feriene Keninkryk
Western Punjabi:
ڈیون, انگلستان, برطانیہ
Wu Chinese:
德文郡, 英格兰, 英国
Yiddish:
דעוון, ענגלאנד, פאראייניגטע קעניגרייך
County in southwest England. Previously the name Devonshire was commonly used on mineral labels with Devon becoming standard following local government reorganisation in the 1970's.
Mining dates back to pre-history with significant archaeological evidence (particularly alluvial workings on Dartmoor) to suggest the county was an important bronze-age tin producer.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities259 valid minerals. 3 (TL) - type locality of valid minerals. 18 erroneous literature entries.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Acanthite Formula: Ag2S Localities: |
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 Localities: Reported from at least 9 localities in this region. |
| ⓘ Aegirine-augite Formula: (NaaCabFe2+cMgd)(Fe3+eAlfFe2+gMgh)Si2O6 |
| ⓘ Aikinite Formula: PbCuBiS3 |
| ⓘ Ajoite ? Formula: (K,Na)Cu7AlSi9O24(OH)6 · 3H2O |
| ⓘ Albite Formula: Na(AlSi3O8) Localities: Reported from at least 6 localities in this region. |
| ⓘ Albite var. Oligoclase Formula: (Na,Ca)[Al(Si,Al)Si2O8] Localities: |
| ⓘ Algodonite Formula: (Cu1-xAsx) |
| ⓘ 'Alkali Feldspar' |
| ⓘ Allanite-(Ce) Formula: (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ Allophane Formula: (Al2O3)(SiO2)1.3-2 · 2.5-3H2O Localities: Reported from at least 8 localities in this region. |
| ⓘ Aluminite Formula: Al2(SO4)(OH)4 · 7H2O |
| ⓘ 'Alumotungstite' Formula: ◻2W2O6(H2O) |
| ⓘ Formula: LiAl(PO4)F Locality: Meldon Aplite Quarry, Okehampton Hamlets, West Devon, Devon, England, UK - erroneously reported |
| ⓘ 'Amphibole Supergroup' Formula: AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ 'Amphibole Supergroup var. Byssolite' Formula: AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ Analcime Formula: Na(AlSi2O6) · H2O Localities: References: |
| ⓘ Anatase Formula: TiO2 Localities: Reported from at least 13 localities in this region. |
| ⓘ Andalusite Formula: Al2(SiO4)O Localities: |
| ⓘ Andalusite var. Chiastolite Formula: Al2(SiO4)O Localities: |
| ⓘ Andersonite Formula: Na2Ca(UO2)(CO3)3 · 6H2O Habit: Distorted rhombohedra, indistinct; also massive, encrusting Colour: Yellowish Fluorescence: Reacts strongly to Long Wave UV light, emitting a diagnostic bluish-green. Description: Sparse, microscopic grains scattered across weathered surfaces associated with other fluorescent material.
Visible as tiny points of blue-green fluorescence under Long Wave UV.
Only observable at x45 and above. |
| ⓘ Andradite Formula: Ca3Fe3+2(SiO4)3 |
| ⓘ Anglesite Formula: PbSO4 Localities: Reported from at least 6 localities in this region. |
| ⓘ Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 Localities: Reported from at least 9 localities in this region. References: |
| ⓘ Annabergite Formula: Ni3(AsO4)2 · 8H2O Description:
Article in the Russell Society newsletter (2000). All have been confirmed by XRD from my own specimens. There are also articles on the Native Copper, etc from Dr. R. K.Harrison et al. |
| ⓘ Annite Formula: KFe2+3(AlSi3O10)(OH)2 |
| ⓘ Anorthite Formula: Ca(Al2Si2O8) |
| ⓘ Anorthite var. Labradorite Formula: (Ca,Na)[Al(Al,Si)Si2O8] |
| ⓘ Anthophyllite Formula: ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| ⓘ Antimony Formula: Sb |
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) Localities: Reported from at least 13 localities in this region. |
| ⓘ 'Apatite var. Collophane' |
| ⓘ 'Apophyllite Group' Formula: AB4[Si8O22]X · 8H2O |
| ⓘ Aragonite Formula: CaCO3 Localities: Reported from at least 28 localities in this region. References: |
| ⓘ Arfvedsonite Formula: [Na][Na2][Fe2+4Fe3+]Si8O22(OH)2 |
| ⓘ Arsenic Formula: As |
| ⓘ Formula: Ca2Fe3+3(AsO4)3O2 · 3H2O Locality: Willsworthy Mine, Sampford Spiney, West Devon, Devon, England, UK - erroneously reported |
| ⓘ Arsenolite Formula: As2O3 Localities: Reported from at least 6 localities in this region. |
| ⓘ Arsenopyrite Formula: FeAsS Localities: Reported from at least 50 localities in this region. |
| ⓘ 'Asbestos' |
| ⓘ Atacamite Formula: Cu2(OH)3Cl |
| ⓘ Augite Formula: (CaxMgyFez)(Mgy1Fez1)Si2O6 Localities: References: |
| ⓘ Augite var. Titanium-bearing Augite Formula: (Ca,Na)(Mg,Ti, Fe,Al,)(Si,Al)2O6 |
| ⓘ Aurichalcite Formula: (Zn,Cu)5(CO3)2(OH)6 |
| ⓘ Autunite Formula: Ca(UO2)2(PO4)2 · 10-12H2O |
| ⓘ Axinite-(Fe) Formula: Ca2Fe2+Al2BSi4O15OH |
| ⓘ 'Axinite Group' Localities: Reported from at least 6 localities in this region. |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 Localities: Reported from at least 7 localities in this region. References: |
| ⓘ Baryte Formula: BaSO4 Localities: Reported from at least 14 localities in this region. Habit: Tabular with large c (0.0.1) faces Colour: Honey brown, colourless, pale blue Fluorescence: Yellow fluorescent under short and long wave also phosphorescent Description: Visual identification and XRD analysis used. |
| ⓘ Bassetite ? Formula: Fe2+(UO2)2(PO4)2 · 10H2O Habit: Somewhat earthy in appearance Colour: dun-coloured Fluorescence: none Description: Inferred presence of Bassetite comes from the presence of a non-fluorescent, dun-coloured, earthy encrustation in direct contact with uraninite and weathered pyrite grains in the granite.
|
| ⓘ Bavenite Formula: Ca4Be2Al2Si9O26(OH)2 Localities: |
| ⓘ Beaverite-(Cu) Formula: Pb(Fe3+2Cu)(SO4)2(OH)6 |
| ⓘ Becquerelite ? Formula: Ca(UO2)6O4(OH)6 · 8H2O Habit: Indeterminate - semi-crustose. Colour: brownish-yellow, appears very pale due to size of crystals. Fluorescence: Reacts under Long Wave UV: dim brownish orange Description: Appears as sparse, somewhat earthy encrustations of miniscule, brownish-yellow crystals on more exposed and weathered surfaces. As with other uranium minerals, this is associated with the weathering of uraninite in the granite.
Crystals are transparent and sufficiently small to give the impression of a pale colouration at moderate magnification (x45). |
| ⓘ Bementite Formula: Mn7Si6O15(OH)8 |
| ⓘ Beraunite ? Formula: Fe3+6(PO4)4O(OH)4 · 6H2O Habit: Massive, bladed masses. Colour: reddish-brown to clove brown Description: Some reddish-brown areas of a small number of specimens show the bladed forms resembling those of eleonorite.
Further work is required for confirmation. |
| ⓘ Beryl Formula: Be3Al2(Si6O18) |
| ⓘ Formula: NaBePO4 Locality: Meldon Aplite Quarry, Okehampton Hamlets, West Devon, Devon, England, UK - erroneously reported Description: Kingsbury, A.W.G. (1964) in Mineralogical Magazine 35, lviii states: "Colourless isolated crystals (2cm) from a pegmatite vein in the old aplite quarry at Meldon, Okehampton, Devon".
However, von Knorring, O. and Condliffe, E. (1984): On the occurrence of niobium-tantalum and other rare-element minerals in the Meldon aplite, Devonshire. Mineralogical Magazine 48, 443-448, states "Beryllonite occurs in whitish grains some 2 mm across and is mostly enclosed in elbaite with some lepidolite and quartz. It is fibrous and silky in appearance and is closely associated with pollucite, orthoclase, petalite, and lepidolite."
2cm vs. 2mm...
Size is irrelevant. Only reports are from Kingsbury and not to be believed. |
| ⓘ 'Bindheimite' Formula: Pb2Sb2O6O Description: Forms resinous to powdery pale yellow replacements of Tetrahedrite. |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 Localities: Meldon Quarry, Okehampton Hamlets, West Devon, Devon, England, UK North Mine (East Wheal Friendship), Devon United Mines, Peter Tavy, West Devon, Devon, England, UK Leusdon Common, Widecombe-in-the-Moor, Teignbridge, Devon, England, UK Isle of Lundy, Torridge, Devon, England, UK Exeter Volcanic Series, Exeter, Devon, England, UK |
| ⓘ Bismite Formula: Bi2O3 |
| ⓘ Bismuth Formula: Bi Localities: Reported from at least 6 localities in this region. |
| ⓘ Bismuthinite Formula: Bi2S3 Localities: |
| ⓘ Bismutite Formula: (BiO)2CO3 |
| ⓘ Boltwoodite Formula: (K,Na)(UO2)(SiO3OH) · 1.5H2O Habit: Radial acicular groups to ~0.3mm across; also earthy, encrusting. Colour: Yellowish-brown to dull orange Fluorescence: Reacts weakly under Long Wave UV, emitting a dull brownish colour. Description: Minute earthy crusts in miarolitic cavities associated with uraninite, also with gummite crusts. |
| ⓘ Bornite Formula: Cu5FeS4 Localities: Reported from at least 10 localities in this region. |
| ⓘ Boulangerite Formula: Pb5Sb4S11 Localities: |
| ⓘ Bournonite Formula: PbCuSbS3 Localities: Colour: grey |
| ⓘ Formula: Ca2Mn2+(AsO4)2 · 2H2O Locality: Meldon Aplite Quarry, Okehampton Hamlets, West Devon, Devon, England, UK - erroneously reported Description: Fraudulent Kingsbury locality. |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 Localities: Reported from at least 13 localities in this region. |
| ⓘ Brookite Formula: TiO2 |
| ⓘ Bustamite Formula: CaMn2+(Si2O6) |
| ⓘ Cacoxenite Formula: Fe3+24AlO6(PO4)17(OH)12 · 75H2O Habit: massive, botryoidal, encrusting Colour: yellow Description: Cacoxenite is found as a bright yellow encrustation in fractures in the rock of the quarry, often in association with porous quartz veins.
Where it is found, it is locally abundant but is absent through most of the quarry.
Larger plates showing the phosphatic mineralisation vary across the suface between clove-brown and bright yellow, occasionally to orange and red. The cacoxenite is generally between a deep yellow-brown and bright yellow. |
| ⓘ Calcite Formula: CaCO3 Localities: Reported from at least 53 localities in this region. |
| ⓘ Calcite var. Iron-bearing Calcite Formula: (Ca,Fe)CO3 Localities: Foreland Cliffs (incl. Foreland Point), Countisbury, Lynton, North Devon, Devon, England, UK Hollerday Hill, Lynton, North Devon, Devon, England, UK Upton Pyne, East Devon, Devon, England, UK Desolation Point, Countisbury, Lynton, North Devon, Devon, England, UK Countisbury Beach, Countisbury, Lynton, North Devon, Devon, England, UK References: |
| ⓘ Calcite var. Manganese-bearing Calcite Formula: (Ca,Mn)CO3 |
| ⓘ Carbonatecyanotrichite ? Formula: Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| ⓘ Carnotite Formula: K2(UO2)2(VO4)2 · 3H2O |
| ⓘ Cassiterite Formula: SnO2 Localities: Reported from at least 52 localities in this region. Description: Rarely found as black well formed crystals to 1.5cms, occasionally as sparable tin micro-crystals to 1.5mm. Also as small veinlets to over 20cms long, and small clots to afew cms. The deposite is said to contain about 0.2% tin concentrate. References: |
| ⓘ Cassiterite var. Wood Tin Formula: SnO2 |
| ⓘ Celestine Formula: SrSO4 Localities: References: |
| ⓘ Cerussite Formula: PbCO3 Localities: Reported from at least 13 localities in this region. |
| ⓘ 'Chabazite' Localities: |
| ⓘ Chalcoalumite Formula: CuAl4(SO4)(OH)12 · 3H2O |
| ⓘ Chalcocite Formula: Cu2S Localities: Reported from at least 19 localities in this region. |
| ⓘ Chalcophyllite Formula: Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Reported from at least 73 localities in this region. |
| ⓘ Chalcosiderite Formula: CuFe3+6(PO4)4(OH)8 · 4H2O |
| ⓘ Chamosite Formula: (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| ⓘ Childrenite (TL) Formula: Fe2+Al(PO4)(OH)2 · H2O Localities: Reported from at least 20 localities in this region. Type Locality: Devon, England, UK References: |
| ⓘ 'Chlorite Group' Localities: Reported from at least 25 localities in this region. |
| ⓘ Chrisstanleyite (TL) Formula: Ag2Pd3Se4 Type Locality: |
| ⓘ Formula: BeAl2O4 Locality: Meldon Aplite Quarry, Okehampton Hamlets, West Devon, Devon, England, UK - erroneously reported Description: Green crystal plates ( < 2 cm) with feldspar. |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 Description: As small pastel green deposits without any discernable form rarely found between faces in the black shale. I have tried to photograph it but without success. |
| ⓘ Clausthalite Formula: PbSe Localities: |
| ⓘ Clinochlore var. Corundophilite Formula: (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| ⓘ Clinoclase Formula: Cu3(AsO4)(OH)3 |
| ⓘ Cobaltite Formula: CoAsS |
| ⓘ Coffinite Formula: U(SiO4) · nH2O Localities: |
| ⓘ 'Columbite-(Fe)-Columbite-(Mn) Series' |
| ⓘ Columbite-(Mn) Formula: Mn2+Nb2O6 |
| ⓘ 'Columbite-Tantalite' |
| ⓘ Connellite Formula: Cu19(SO4)(OH)32Cl4 · 3H2O Description: Tiny micro-radial blue compact crystal groups with bladed emerald green Brochantite microcrystals on metallic dark grey Chalcocite/Digenite in a Quartz/Hematite/Goethite matrix with minor Malachite. |
| ⓘ Copper Formula: Cu Localities: Reported from at least 8 localities in this region. References: |
| ⓘ Cordierite Formula: (Mg,Fe)2Al3(AlSi5O18) Localities: |
| ⓘ Cornubite Formula: Cu5(AsO4)2(OH)4 Localities: |
| ⓘ Cornwallite Formula: Cu5(AsO4)2(OH)4 Localities: Bedford United Mine, Gulworthy, West Devon, Devon, England, UK Wheal Emma, Devon Great Consols, Gulworthy, West Devon, Devon, England, UK Wheal Maria, Devon Great Consols, Gulworthy, West Devon, Devon, England, UK Bampfylde Mine (Prince Regent Mine; Poltimore Mine; North Molton copper mine), North Molton, North Devon, Devon, England, UK ? (more information) |
| ⓘ Cotunnite Formula: PbCl2 |
| ⓘ Covellite Formula: CuS Localities: Belstone Consols (Mid-Devon Copper Mine), Belstone, West Devon, Devon, England, UK Bampfylde Mine (Prince Regent Mine; Poltimore Mine; North Molton copper mine), North Molton, North Devon, Devon, England, UK Virtuous Lady Mine, Buckland Monachorum, West Devon, Devon, England, UK Littleham Bay, Budleigh Salterton, East Devon, Devon, England, UK |
| ⓘ Cuprite Formula: Cu2O Localities: Reported from at least 8 localities in this region. |
| ⓘ Cuprite var. Chalcotrichite Formula: Cu2O |
| ⓘ Cyanotrichite Formula: Cu4Al2(SO4)(OH)12 · 2H2O |
| ⓘ Danburite Formula: CaB2Si2O8 Localities: Meldon Quarry, Okehampton Hamlets, West Devon, Devon, England, UK Fluorescence: weak blue-violet SW-UV fluorescence |
| ⓘ Datolite Formula: CaB(SiO4)(OH) Localities: Meldon Quarry, Okehampton Hamlets, West Devon, Devon, England, UK Haytor Mine, Ilsington, Teignbridge, Devon, England, UK Meldon Aplite Quarry, Okehampton Hamlets, West Devon, Devon, England, UK Meldon Mine, Okehampton Hamlets, West Devon, Devon, England, UK Ramsley Mine (Fursdon Mine), South Tawton, West Devon, Devon, England, UK ? (more information) |
| ⓘ Devilline Formula: CaCu4(SO4)2(OH)6 · 3H2O |
| ⓘ Dickite Formula: Al2(Si2O5)(OH)4 |
| ⓘ Digenite Formula: Cu9S5 Localities: Description: Small masses to a few cms in Veinstone are Digenite/Chalcocite from the dump. References: |
| ⓘ Diopside Formula: CaMgSi2O6 Localities: |
| ⓘ Diopside var. Diallage Formula: CaMgSi2O6 |
| ⓘ Djurleite Formula: Cu31S16 |
| ⓘ Dolomite Formula: CaMg(CO3)2 Localities: Reported from at least 24 localities in this region. |
| ⓘ Domeykite Formula: Cu3As |
| ⓘ Dufrénite ? Formula: Ca0.5Fe2+Fe3+5(PO4)4(OH)6 · 2H2O Description: Kingsbury reference. |
| ⓘ Dumortierite Formula: Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| ⓘ Elbaite Formula: Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Emplectite Formula: CuBiS2 |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) Localities: |
| ⓘ Erythrite Formula: Co3(AsO4)2 · 8H2O Localities: Reported from at least 8 localities in this region. |
| ⓘ Eucairite Formula: AgCuSe |
| ⓘ Formula: BeAl(SiO4)(OH) Locality: Meldon Aplite Quarry, Okehampton Hamlets, West Devon, Devon, England, UK - erroneously reported Description: Fraudulent Kingsbury locality. |
| ⓘ Formula: LiAlSiO4 Locality: Meldon Aplite Quarry, Okehampton Hamlets, West Devon, Devon, England, UK - erroneously reported |
| ⓘ Formula: Na2Be2Si6O15 · H2O Locality: Meldon Aplite Quarry, Okehampton Hamlets, West Devon, Devon, England, UK - erroneously reported Description: Fraudulent Kingsbury locality. |
| ⓘ Evansite ? Formula: Al3(PO4)(OH)6 · 6H2O Habit: Amorphous. Colour: Milk white to creamy white, also various light to mid browns when stained by 'limonite' Description: Many fracture surfaces in the Wavellite-rich mudstones are coated with a milky-white, amorphous material, often stained with 'limonite'. No crystalline structure has been observed in this material to date. Some fractures completely infilled with this material.
Placement on the outside of wavellite balls places formation late in the mineralisation of the site.
While still wet, the texture is somewhat greasy and reminiscent of fungal growth, but on drying, a fine, earthy texture is revealed, with a hardness of around 2.5 - 3
Tentative identification requires further investigation. |
| ⓘ 'Fayalite-Forsterite Series' Localities: References: |
| ⓘ 'Feldspar Group' |
| ⓘ 'Feldspar Group var. Perthite' |
| ⓘ Ferberite Formula: FeWO4 Localities: Description: Extreamly rare as free grown crystals to 1.5cm, common as micro-crystals. Also common as bladed crystals to over 10cm embeded in quartz. |
| ⓘ Ferro-actinolite Formula: ◻Ca2Fe2+5(Si8O22)(OH)2 |
| ⓘ Fersmite Formula: (Ca,Ce,Na)(Nb,Ta,Ti)2(O,OH,F)6 |
| ⓘ Fischesserite Formula: Ag3AuSe2 |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F Localities: Reported from at least 19 localities in this region. |
| ⓘ Fluorapatite var. Carbonate-rich Fluorapatite Formula: Ca5(PO4,CO3)3(F,O) Localities: Reported from at least 17 localities in this region. |
| ⓘ Fluorite Formula: CaF2 Localities: Reported from at least 26 localities in this region. |
| ⓘ Galena Formula: PbS Localities: Reported from at least 46 localities in this region. References: |
| ⓘ Galena var. Silver-bearing Galena Formula: PbS with Ag Localities: Wheal Exmouth, Christow, Teignbridge, Devon, England, UK Old Combe Martin Mine, Combe Martin, North Devon, Devon, England, UK Lead-silver mine, Newton St Cyres, Exeter, Devon, England, UK South Hooe Mine (Tamar Silver-Lead Mine), Tamar Consols (Tamar Mines), Bere Alston Mines, Bere Ferrers, West Devon, Devon, England, UK References: |
| ⓘ Galenobismutite ? Formula: PbBi2S4 |
| ⓘ 'Ganomatite' |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 Localities: Reported from at least 8 localities in this region. |
| ⓘ Gersdorffite Formula: NiAsS |
| ⓘ Gibbsite Formula: Al(OH)3 |
| ⓘ 'Glauconite' Formula: K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 Localities: References: |
| ⓘ Goethite Formula: α-Fe3+O(OH) Localities: Reported from at least 29 localities in this region. |
| ⓘ Gold Formula: Au Localities: Reported from at least 8 localities in this region. Habit: Delicate dendritic fronds to 5 cm are leached out of calcite. Russel (1929 reports rare open pockets. Colour: Buttery yellow to tan palladian Gold |
| ⓘ Gold var. Palladium-bearing Gold Formula: (Au,Pd) |
| ⓘ Goslarite Formula: ZnSO4 · 7H2O |
| ⓘ Grossular Formula: Ca3Al2(SiO4)3 |
| ⓘ 'Gummite' Habit: Massive Colour: Brownish - may be mistaken for iron-stains. Description: Brown haloes associated with uraninite, often dusted with Saléeite. |
| ⓘ Gypsum Formula: CaSO4 · 2H2O Localities: Reported from at least 15 localities in this region. |
| ⓘ Gypsum var. Selenite Formula: CaSO4 · 2H2O |
| ⓘ Hastingsite Formula: NaCa2(Fe2+4Fe3+)(Si6Al2)O22(OH)2 |
| ⓘ Hausmannite Formula: Mn2+Mn3+2O4 |
| ⓘ Hedenbergite Formula: CaFe2+Si2O6 Localities: |
| ⓘ Formula: Be3Mn2+4(SiO4)3S Locality: Meldon Mine, Okehampton Hamlets, West Devon, Devon, England, UK - erroneously reported |
| ⓘ Hematite Formula: Fe2O3 Localities: Reported from at least 64 localities in this region. |
| ⓘ Hematite var. Kidney Ore Formula: Fe2O3 |
| ⓘ Hematite var. Specularite Formula: Fe2O3 Localities: Reported from at least 13 localities in this region. |
| ⓘ Hemimorphite Formula: Zn4Si2O7(OH)2 · H2O |
| ⓘ Formula: CaBe(PO4)F Locality: Meldon Aplite Quarry, Okehampton Hamlets, West Devon, Devon, England, UK - erroneously reported |
| ⓘ 'Heulandite Subgroup' Formula: (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O Localities: Meldon Quarry, Okehampton Hamlets, West Devon, Devon, England, UK Meldon Aplite Quarry, Okehampton Hamlets, West Devon, Devon, England, UK Meldon Mine, Okehampton Hamlets, West Devon, Devon, England, UK Ramsley Mine (Fursdon Mine), South Tawton, West Devon, Devon, England, UK Wheal Forest, Okehampton Hamlets, West Devon, Devon, England, UK |
| ⓘ 'Hornblende Root Name Group' Formula: ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| ⓘ Huemulite Formula: Na4Mg(V10O28) · 24H2O |
| ⓘ Hydrokenoelsmoreite Formula: ◻2W2O6(H2O) Description: Occasionally found associated with ferberite or near to this mineral. Hydrokenoelsmoreite is very esaly over looked at this location due to its mica like habit, or looks like kaolinite. Thin platy micro-crystals have been found covering several cms. The colour varies from white to light yellow and pale brown, probably due to Fe contamination. |
| ⓘ Hydrokenoelsmoreite var. Ferritungstite |
| ⓘ Hydrozincite Formula: Zn5(CO3)2(OH)6 Localities: Silverbrook Mine, Ilsington, Teignbridge, Devon, England, UK South Tamar Consols (South Tamar Mine; Cowes Mine; incl. Cleave Mine; Birch Mine), Bere Alston Mines, Bere Ferrers, West Devon, Devon, England, UK Lockridge Mine (Goldstreet Mine), East Tamar Consols, Bere Alston Mines, Bere Ferrers, West Devon, Devon, England, UK ? (more information) References: |
| ⓘ Ikunolite Formula: Bi4S3 |
| ⓘ Ilmenite Formula: Fe2+TiO3 Localities: |
| ⓘ Formula: CaFe3+Fe2+2(Si2O7)O(OH) Localities: Description: A.W.G. Kingsbury specimen |
| ⓘ Isomertieite Formula: Pd11Sb2As2 |
| ⓘ Jamesonite Formula: Pb4FeSb6S14 Localities: |
| ⓘ Jarosite Formula: KFe3+3(SO4)2(OH)6 |
| ⓘ 'Jasper' Localities: |
| ⓘ Johannsenite Formula: CaMn2+Si2O6 |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 Localities: Description: A very common white clay in the deposit making it difacult to procces the ore. References: |
| ⓘ 'K Feldspar' Localities: |
| ⓘ Klockmannite Formula: CuSe |
| ⓘ Langisite Formula: CoAs |
| ⓘ Langite Formula: Cu4(SO4)(OH)6 · 2H2O Localities: Reported from at least 10 localities in this region. |
| ⓘ Laumontite Formula: CaAl2Si4O12 · 4H2O Localities: |
| ⓘ Lavendulan Formula: NaCaCu5(AsO4)4Cl · 5H2O Localities: |
| ⓘ Lead Formula: Pb Localities: |
| ⓘ Leadhillite ? Formula: Pb4(CO3)2(SO4)(OH)2 Description: Forms tiny colourless to white micro-crystals <0.2mm associated with Anglesite and Cerussite in corroded Galena and Quartz. The crystals have not been analysed so could be Susannite. |
| ⓘ Lepidocrocite Formula: γ-Fe3+O(OH) Localities: References: |
| ⓘ 'Lepidolite' Localities: |
| ⓘ Leucite Formula: K(AlSi2O6) |
| ⓘ Formula: NaCaBeSi2O6F Locality: Meldon Aplite Quarry, Okehampton Hamlets, West Devon, Devon, England, UK - erroneously reported |
| ⓘ Libethenite Formula: Cu2(PO4)(OH) Localities: Description: Olive green crystalline balls-hemispheres of Libethenite and small crystal druses associated with Pseudomalachite and Malachite. References: |
| ⓘ 'Limonite' Localities: Reported from at least 29 localities in this region. |
| ⓘ Linarite Formula: PbCu(SO4)(OH)2 Localities: Wheal Friendship, Mary Tavy, West Devon, Devon, England, UK Wheal Exmouth, Christow, Teignbridge, Devon, England, UK South Tamar Consols (South Tamar Mine; Cowes Mine; incl. Cleave Mine; Birch Mine), Bere Alston Mines, Bere Ferrers, West Devon, Devon, England, UK North Mine (East Wheal Friendship), Devon United Mines, Peter Tavy, West Devon, Devon, England, UK Frank Mills Mine (Frankmills Mine), Christow, Teignbridge, Devon, England, UK |
| ⓘ Löllingite Formula: FeAs2 Localities: Reported from at least 9 localities in this region. |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 Localities: |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 Localities: Reported from at least 37 localities in this region. |
| ⓘ Malayaite Formula: CaSn(SiO4)O Localities: References: |
| ⓘ 'Manganese Oxides' Localities: Reported from at least 6 localities in this region. References: |
| ⓘ 'Manganese Oxides var. Manganese Dendrites' Habit: Dendritic - coarsely crystalline to lacy dendritic encrustations. Colour: Black Description: The development of manganese dendrites is particularly varied in this quarry - ranging from coarse, tangible crystals infilling fracture voids down to delicate, mossy developments across the siltstone surfaces.
In places, these developments do present a particular aesthetic appeal.
|
| ⓘ Manganite Formula: Mn3+O(OH) Localities: |
| ⓘ Manganosite Formula: MnO |
| ⓘ Marcasite Formula: FeS2 Localities: |
| ⓘ Marialite Formula: Na4Al3Si9O24Cl |
| ⓘ Maucherite Formula: Ni11As8 Description: Brian Craik-Smith: "Article in the Russell Society newsletter (2000). All have been confirmed by XRD from my own specimens. There are also articles on the native copper, etc. from Dr. R.K. Harrison et al." |
| ⓘ Melanterite Formula: Fe2+(H2O)6SO4 · H2O Localities: |
| ⓘ Meneghinite Formula: Pb13CuSb7S24 Localities: |
| ⓘ Mertieite Formula: Pd8Sb2.5As0.5 |
| ⓘ Meta-autunite Formula: Ca(UO2)2(PO4)2 · 6H2O Habit: Tabular, highly metamict; encrusting Colour: Pale, dull green to greenish yellow Fluorescence: Rects strongly under Long Wave UV light with characteristic yellowish green. Description: Dull green to yellow metamict crystal groups found on weathered granite surfaces, also crustiform coatings.
Crystals to 0.5mm |
| ⓘ Metatyuyamunite Formula: Ca(UO2)2(VO4)2 · 3H2O Localities: |
| ⓘ Metavivianite ? Formula: Fe2+Fe3+2(PO4)2(OH)2 · 6H2O Localities: Habit: botryoidal, encrusting Colour: bottle green to greenish-black Description: Seen as bottle-green to greenish-black encrustations on surfaces and within fractures.
Tentatively identified as metavivianite through inference from understood local chemistry and similarity to other occurrances. References: |
| ⓘ 'Mica Group' Localities: Description: vanadian. References: |
| ⓘ Microcline Formula: K(AlSi3O8) |
| ⓘ 'Microlite Group' Formula: A2-mTa2X6-wZ-n Localities: References: |
| ⓘ Milarite Formula: K(◻H2O)Ca2(Be2Al)[Si12O30] Description: "Milarite" reported by A.W.G. Kingsbury may be considered doubtful, but milarite was later confirmed (Peter Edwards collection, analysis by Peter Tandy at NHM London, see https://www.mindat.org/mesg-618726.html). |
| ⓘ Millerite Formula: NiS Localities: |
| ⓘ Mimetite Formula: Pb5(AsO4)3Cl Localities: References: |
| ⓘ Modderite Formula: (Co,Fe)As |
| ⓘ Molybdenite Formula: MoS2 Localities: |
| ⓘ Molybdomenite Formula: PbSeO3 |
| ⓘ 'Monazite' Formula: REE(PO4) Localities: |
| ⓘ Montebrasite Formula: LiAl(PO4)(OH) |
| ⓘ Montmorillonite Formula: (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O Localities: |
| ⓘ Montroseite Formula: (V3+,Fe3+)O(OH) |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 7 localities in this region. |
| ⓘ Muscovite var. Gilbertite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Muscovite var. Illite Formula: K0.65Al2.0[Al0.65Si3.35O10](OH)2 Localities: References: |
| ⓘ Nacrite Formula: Al2(Si2O5)(OH)4 |
| ⓘ Natrojarosite Formula: NaFe3(SO4)2(OH)6 |
| ⓘ Naumannite Formula: Ag2Se |
| ⓘ Nickeline Formula: NiAs Localities: |
| ⓘ Nickelskutterudite Formula: (Ni,Co,Fe)As3 |
| ⓘ Nontronite Formula: Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O Localities: Description: as "gramenite". |
| ⓘ Olivenite Formula: Cu2(AsO4)(OH) |
| ⓘ Opal Formula: SiO2 · nH2O Localities: Reported from at least 6 localities in this region. References: |
| ⓘ Opal var. Common Opal Formula: SiO2 · nH2O Habit: none: massive Colour: white to off-white Fluorescence: none Description: Redeposited silica tubes formed in cracks in the Codden Hill Cherts which host a number of phosphate species.
These thin-walled tubes appear to have formed in much the same way as speleothem 'straws', and various walls and ramifications appear across the rock surfaces. These same cracks also play host to the various phosphate minerals found at this location. |
| ⓘ Orthoclase Formula: K(AlSi3O8) Localities: Reported from at least 10 localities in this region. |
| ⓘ Palygorskite Formula: ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O Localities: |
| ⓘ Paramelaconite Formula: Cu1+2Cu2+2O3 |
| ⓘ Paramontroseite Formula: V4+O2 |
| ⓘ Pararammelsbergite Formula: NiAs2 |
| ⓘ Parkerite Formula: Ni3(Bi,Pb)2S2 |
| ⓘ Pascoite Formula: Ca2Ca(V10O28) · 17H2O |
| ⓘ Penroseite Formula: (Ni,Co,Cu)Se2 |
| ⓘ Petalite Formula: LiAl(Si4O10) |
| ⓘ 'Petroleum var. Bitumen' |
| ⓘ Pharmacosiderite Formula: KFe3+4(AsO4)3(OH)4 · 6-7H2O Localities: Description: Not uncommon as cubic crystals to 1mm, rare as crystals over 1.5mm. The colour varies from almost colourless to light green, yellow-brown, and yellow. References: |
| ⓘ Phurcalite Formula: Ca2(UO2)3(PO4)2O2 · 7H2O |
| ⓘ 'Pilolite' Formula: Mg4Al2Si10O27 · 15H2O Localities: References: |
| ⓘ 'Pinite' |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 Localities: |
| ⓘ 'Plumbogummite Group' Description: The partly defined mineral forms tiny micro-crystals to 0.25mm with a pseudocubic habit, and a white to flesh pink colouration. Associated with cassiterite and tourmaline on quartz. |
| ⓘ Formula: (Cs,Na)2(Al2Si4O12) · 2H2O Locality: Meldon Aplite Quarry, Okehampton Hamlets, West Devon, Devon, England, UK - erroneously reported |
| ⓘ Posnjakite Formula: Cu4(SO4)(OH)6 · H2O |
| ⓘ Prehnite Formula: Ca2Al2Si3O10(OH)2 Localities: |
| ⓘ Formula: Ca2B5O7(OH)5 · H2O Locality: Meldon Aplite Quarry, Okehampton Hamlets, West Devon, Devon, England, UK - erroneously reported Description: Fraudulent Kingsbury locality. |
| ⓘ Pseudomalachite Formula: Cu5(PO4)2(OH)4 Localities: |
| ⓘ 'Psilomelane' Localities: Reported from at least 13 localities in this region. |
| ⓘ Pyrargyrite Formula: Ag3SbS3 Description: So far only found on one specimen as a group of three translucent red divergent micro-crystals measuring to 0.3mm tall In close association with Tetrahedrite and Chalcopyrite in a Siderite matrix. Other associated minerals are Sphalerite, Lollingite, Pyrite/Marcasite, and Quartz. |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 80 localities in this region. References: |
| ⓘ 'Pyrochlore Group' Formula: A2Nb2(O,OH)6Z |
| ⓘ Pyrochroite Formula: Mn(OH)2 Habit: none Description: Green earthy patches with occasional microscopic bright crystals. |
| ⓘ Pyrolusite Formula: Mn4+O2 Localities: Reported from at least 17 localities in this region. |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl Localities: References: |
| ⓘ 'Pyroxene Group' Formula: ADSi2O6 Localities: |
| ⓘ Pyrrhotite Formula: Fe1-xS Localities: Reported from at least 7 localities in this region. |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 139 localities in this region. References: |
| ⓘ Quartz var. Agate |
| ⓘ Quartz var. Amethyst Formula: SiO2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Quartz var. Beekite Formula: SiO2 |
| ⓘ Quartz var. Capped Quartz |
| ⓘ Quartz var. Chalcedony Formula: SiO2 Localities: Reported from at least 16 localities in this region. |
| ⓘ Quartz var. Haytorite Formula: SiO2 |
| ⓘ Quartz var. Rock Crystal Formula: SiO2 Localities: |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 |
| ⓘ Rammelsbergite Formula: NiAs2 Localities: References: |
| ⓘ Rauenthalite Formula: Ca3(AsO4)2 · 10H2O |
| ⓘ Rauvite Formula: Ca(UO2)2(V10O28) · 16H2O |
| ⓘ 'Retinite' |
| ⓘ Formula: (K,Cs)Al4Be4(B,Be)12O28 Locality: Meldon Aplite Quarry, Okehampton Hamlets, West Devon, Devon, England, UK - erroneously reported Description: Fraudulent Kingsbury locality. |
| ⓘ Rhodochrosite Formula: MnCO3 Localities: Chillaton and Hogstor Mine, Milton Abbot, West Devon, Devon, England, UK Meldon Quarry, Okehampton Hamlets, West Devon, Devon, England, UK Quither Mine, Milton Abbot, West Devon, Devon, England, UK Scanniclift Manganese Mine, Doddiscombsleigh, Teignbridge, Devon, England, UK Allerford mine, Marystow, West Devon, Devon, England, UK |
| ⓘ Rhodonite Formula: CaMn3Mn[Si5O15] Localities: Reported from at least 7 localities in this region. |
| ⓘ Rockbridgeite ? Formula: Fe2+Fe3+4(PO4)3(OH)5 Localities: References: |
| ⓘ Roscoelite Formula: K(V3+,Al)2(AlSi3O10)(OH)2 Description: Brian Craik-Smith: "Article in the Russell Society newsletter (2000). All have been confirmed by XRD from my own specimens. There are also articles on the native copper, etc. from Dr. R.K. Harrison et al." |
| ⓘ Russellite Formula: Bi2WO6 Description: Rarely found as pale to light yellow botryoidal crusts to 1cm, or as scattered balls to 0.75mm dia. |
| ⓘ Rutile Formula: TiO2 |
| ⓘ Sabugalite ? Formula: HAl(UO2)4(PO4)4 · 16H2O |
| ⓘ Saléeite Formula: Mg(UO2)2(PO4)2 · 10H2O Habit: Tabular; crustiform Colour: Lemon yellow Fluorescence: Brilliant yellow reaction under Long Wave UV.
Some yellow reaction under blue (LED) light. Description: Minute crystals and crusts on surfaces within recent cracks in miarolitic granite, also within some miarolitic voids.
Associated with uraninite and gummite. |
| ⓘ Sanidine Formula: K(AlSi3O8) |
| ⓘ 'Scapolite' |
| ⓘ Scheelite Formula: Ca(WO4) Localities: Reported from at least 8 localities in this region. |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Localities: Reported from at least 11 localities in this region. |
| ⓘ Schulenbergite ? Formula: (Cu,Zn)7(SO4)2(OH)10 · 3H2O Description: Minutely crystalline light blue crusts on corroded Sphalerite, covering ares to a few mm. |
| ⓘ Scorodite Formula: Fe3+AsO4 · 2H2O Localities: Reported from at least 6 localities in this region. Description: Some of the best examples of scorodite have come from this mine over the years, and it looks set to produce further specimens when mining starts in 2012/13. Exceptional scorodite crystals have been found to about 1cm, more usual as blue to greenish druse of crystals lining cavities to many cms in the quartz veinstone. References: |
| ⓘ Semseyite Formula: Pb9Sb8S21 |
| ⓘ Serpierite Formula: Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| ⓘ Siderite Formula: FeCO3 Localities: Reported from at least 61 localities in this region. Description: Also as "Lady Slipper" pseudomorphs, but of inferior quality compared to those from Virtuous Lady Mine. |
| ⓘ Sideronatrite Formula: Na2Fe(SO4)2(OH) · 3H2O Localities: References: |
| ⓘ Silver Formula: Ag Localities: Reported from at least 6 localities in this region. References: |
| ⓘ Skutterudite Formula: CoAs3 |
| ⓘ 'Smectite Group' Formula: A0.3D2-3[T4O10]Z2 · nH2O Localities: |
| ⓘ Smithsonite Formula: ZnCO3 |
| ⓘ Spessartine Formula: Mn2+3Al2(SiO4)3 |
| ⓘ Sphalerite Formula: ZnS Localities: Reported from at least 33 localities in this region. |
| ⓘ Formula: LiAlSi2O6 Locality: Meldon Aplite Quarry, Okehampton Hamlets, West Devon, Devon, England, UK - erroneously reported Description: Erroneously reported by Kingsbury; see http://www.mindat.org/mesg-7-92300.html. |
| ⓘ Stannite Formula: Cu2FeSnS4 |
| ⓘ 'Stibiconite' Formula: Sb3+Sb5+2O6(OH) |
| ⓘ Stibnite ? Formula: Sb2S3 Localities: Description: Kingsbury (1965): "The Geological Survey Memoir on the Metalliferous Mining Region of South-West England (1956, vol. 2, p. 760, under ' Combe') refers to what are apparently the same dumps, but I have been unable to confirm the record of mispickel, stibnite, and jamesonite." References: |
| ⓘ Stilbite-Ca Formula: NaCa4(Si27Al9)O72 · 28H2O |
| ⓘ Strengite ? Formula: FePO4 · 2H2O Habit: botryoidal, encrusting; massive Colour: pale purple Description: Areas of purple phosphatic encrustations strongly resemble strengite. |
| ⓘ Strontianite Formula: SrCO3 Localities: References: |
| ⓘ Sulphur Formula: S8 Localities: Reported from at least 6 localities in this region. References: |
| ⓘ Synchysite-(Ce) Formula: CaCe(CO3)2F |
| ⓘ Talmessite Formula: Ca2Mg(AsO4)2 · 2H2O Description: Found on the mine dump. |
| ⓘ Tantalite-(Mn) Formula: Mn2+Ta2O6 |
| ⓘ 'Tennantite Subgroup' Formula: Cu6(Cu4C2+2)As4S12S |
| ⓘ Tenorite Formula: CuO Localities: References: |
| ⓘ Tephroite Formula: Mn2+2SiO4 |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S Localities: Reported from at least 7 localities in this region. |
| ⓘ 'Tetrahedrite Subgroup var. Silver-bearing Tetrahedrite' Formula: (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| ⓘ Tiemannite Formula: HgSe |
| ⓘ Tilkerodeite Formula: Pd2HgSe3 |
| ⓘ Titanite Formula: CaTi(SiO4)O Localities: |
| ⓘ Formula: CaTi(SiO4)O Locality: Meldon Quarry, Okehampton Hamlets, West Devon, Devon, England, UK - erroneously reported |
| ⓘ Topaz Formula: Al2(SiO4)(F,OH)2 |
| ⓘ Torbernite Formula: Cu(UO2)2(PO4)2 · 12H2O Localities: References: |
| ⓘ 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z Localities: Reported from at least 20 localities in this region. |
| ⓘ 'Tourmaline var. Rubellite' Formula: A(D3)G6(T6O18)(BO3)3X3Z |
| ⓘ 'Tourmaline var. Verdelite' Formula: A(D3)G6(T6O18)(BO3)3X3Z |
| ⓘ Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ Trona Formula: Na3H(CO3)2 · 2H2O Description:
Article in the Russell Society newsletter (2000). All have been confirmed by XRD from my own specimens. There are also articles on the Native Copper, etc from Dr. R. K.Harrison et al. |
| ⓘ Trüstedtite Formula: Ni3Se4 |
| ⓘ Tyrolite Formula: Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| ⓘ Tyrrellite Formula: Cu(Co3+,Ni3+)2Se4 |
| ⓘ Tyuyamunite Formula: Ca(UO2)2(VO4)2 · 5-8H2O Description: Brian Craik-Smith: "Article in the Russell Society newsletter (2000). All have been confirmed by XRD from my own specimens. There are also articles on the native copper, etc. from Dr. R.K. Harrison et al." |
| ⓘ Ullmannite Formula: NiSbS |
| ⓘ Umangite Formula: Cu3Se2 |
| ⓘ Uraninite Formula: UO2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Uraninite var. Pitchblende Formula: UO2 Localities: Habit: Massive, crumbly masses Colour: Black Description: Samples collected Dec 2003 with counts > 1000/sec. |
| ⓘ Uraninite var. Sooty Uraninite Formula: UO2 |
| ⓘ Uranophane Formula: Ca(UO2)2(SiO3OH)2 · 5H2O Localities: References: |
| ⓘ Variscite Formula: AlPO4 · 2H2O Localities: |
| ⓘ Verbeekite Formula: PdSe2 |
| ⓘ Vésigniéite Formula: BaCu3(VO4)2(OH)2 |
| ⓘ Vesuvianite Formula: Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 Localities: |
| ⓘ Vivianite Formula: Fe2+Fe2+2(PO4)2 · 8H2O Localities: References: |
| ⓘ Volborthite Formula: Cu3(V2O7)(OH)2 · 2H2O Habit: spherules up to about 0.4 mm across in fractures and cavities in dark coloured vanadium-bearing nodules to ca. 50 mm across. Colour: yellow-green to yellow-brown |
| ⓘ 'Wad' |
| ⓘ Wavellite (TL) Formula: Al3(PO4)2(OH,F)3 · 5H2O Localities: References: |
| ⓘ Witherite Formula: BaCO3 |
| ⓘ 'Wolframite Group' Localities: Wheal Frementor, Devon Great Consols, Gulworthy, West Devon, Devon, England, UK South Bedford Mine (South Gunnislake Mine; in part: South Bedford and East Gunnislake Mine), Gulworthy, West Devon, Devon, England, UK Wheal Emma, Devon Great Consols, Gulworthy, West Devon, Devon, England, UK Florence Mine, Plympton, Plymouth, Devon, England, UK References: |
| ⓘ Wollastonite Formula: Ca3(Si3O9) Localities: |
| ⓘ Wroewolfeite Formula: Cu4(SO4)(OH)6 · 2H2O |
| ⓘ Wurtzite Formula: (Zn,Fe)S Localities: References: |
| ⓘ 'Zeolite Group' |
| ⓘ Formula: K3(UO2)4(SO4)2O3(OH) · 3H2O Locality: Merrivale Quarry, Whitchurch, West Devon, Devon, England, UK - erroneously reported |
| ⓘ Zircon Formula: Zr(SiO4) |
| ⓘ Zoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Gold | 1.AA.05 | Au |
| ⓘ | Silver | 1.AA.05 | Ag |
| ⓘ | Lead | 1.AA.05 | Pb |
| ⓘ | Copper | 1.AA.05 | Cu |
| ⓘ | Gold var. Palladium-bearing Gold | 1.AA.05 | (Au,Pd) |
| ⓘ | Antimony | 1.CA.05 | Sb |
| ⓘ | Arsenic | 1.CA.05 | As |
| ⓘ | Bismuth | 1.CA.05 | Bi |
| ⓘ | Sulphur | 1.CC.05 | S8 |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Algodonite | 2.AA.10a | (Cu1-xAsx) |
| ⓘ | Domeykite | 2.AA.10b | Cu3As |
| ⓘ | Maucherite | 2.AB.15 | Ni11As8 |
| ⓘ | Mertieite | 2.AC.10b | Pd8Sb2.5As0.5 |
| ⓘ | Isomertieite | 2.AC.15a | Pd11Sb2As2 |
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Djurleite | 2.BA.05 | Cu31S16 |
| ⓘ | Digenite | 2.BA.10 | Cu9S5 |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Umangite | 2.BA.25 | Cu3Se2 |
| ⓘ | Acanthite | 2.BA.35 | Ag2S |
| ⓘ | Eucairite | 2.BA.50 | AgCuSe |
| ⓘ | Naumannite | 2.BA.55 | Ag2Se |
| ⓘ | Fischesserite | 2.BA.75 | Ag3AuSe2 |
| ⓘ | Chrisstanleyite (TL) | 2.BC.15 | Ag2Pd3Se4 |
| ⓘ | Parkerite | 2.BE.20 | Ni3(Bi,Pb)2S2 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Klockmannite | 2.CA.05b | CuSe |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Tiemannite | 2.CB.05a | HgSe |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Stannite | 2.CB.15a | Cu2FeSnS4 |
| ⓘ | Wurtzite | 2.CB.45 | (Zn,Fe)S |
| ⓘ | Tilkerodeite | 2.CC. | Pd2HgSe3 |
| ⓘ | Nickeline | 2.CC.05 | NiAs |
| ⓘ | Langisite | 2.CC.05 | CoAs |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Modderite | 2.CC.15 | (Co,Fe)As |
| ⓘ | Millerite | 2.CC.20 | NiS |
| ⓘ | Clausthalite | 2.CD.10 | PbSe |
| ⓘ | Galena var. Silver-bearing Galena | 2.CD.10 | PbS with Ag |
| ⓘ | 2.CD.10 | PbS | |
| ⓘ | Trüstedtite | 2.DA.05 | Ni3Se4 |
| ⓘ | Tyrrellite | 2.DA.05 | Cu(Co3+,Ni3+)2Se4 |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Stibnite ? | 2.DB.05 | Sb2S3 |
| ⓘ | Ikunolite | 2.DC.05 | Bi4S3 |
| ⓘ | Verbeekite | 2.EA.25 | PdSe2 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Penroseite | 2.EB.05a | (Ni,Co,Cu)Se2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Pararammelsbergite | 2.EB.10e | NiAs2 |
| ⓘ | Rammelsbergite | 2.EB.15a | NiAs2 |
| ⓘ | Löllingite | 2.EB.15a | FeAs2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Cobaltite | 2.EB.25 | CoAsS |
| ⓘ | Ullmannite | 2.EB.25 | NiSbS |
| ⓘ | Gersdorffite | 2.EB.25 | NiAsS |
| ⓘ | Skutterudite | 2.EC.05 | CoAs3 |
| ⓘ | Nickelskutterudite | 2.EC.05 | (Ni,Co,Fe)As3 |
| ⓘ | Pyrargyrite | 2.GA.05 | Ag3SbS3 |
| ⓘ | Bournonite | 2.GA.50 | PbCuSbS3 |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | 'Tennantite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)As4S12S |
| ⓘ | 'Tetrahedrite Subgroup var. Silver-bearing Tetrahedrite' | 2.GB.05 | (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| ⓘ | Emplectite | 2.HA.05 | CuBiS2 |
| ⓘ | Aikinite | 2.HB.05a | PbCuBiS3 |
| ⓘ | Meneghinite | 2.HB.05b | Pb13CuSb7S24 |
| ⓘ | Jamesonite | 2.HB.15 | Pb4FeSb6S14 |
| ⓘ | Semseyite | 2.HC.10d | Pb9Sb8S21 |
| ⓘ | Boulangerite | 2.HC.15 | Pb5Sb4S11 |
| ⓘ | Galenobismutite ? | 2.JC.25e | PbBi2S4 |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| ⓘ | Cotunnite | 3.AB.85 | PbCl2 |
| ⓘ | Atacamite | 3.DA.10a | Cu2(OH)3Cl |
| ⓘ | Connellite | 3.DA.25 | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | α-Fe3+O(OH) |
| ⓘ | 'Microlite Group' | 4.00. | A2-mTa2X6-wZ-n |
| ⓘ | 'Pyrochlore Group' | 4.00. | A2Nb2(O,OH)6Z |
| ⓘ | Cuprite | 4.AA.10 | Cu2O |
| ⓘ | var. Chalcotrichite | 4.AA.10 | Cu2O |
| ⓘ | Paramelaconite | 4.AA.15 | Cu1+2Cu2+2O3 |
| ⓘ | Tenorite | 4.AB.10 | CuO |
| ⓘ | Manganosite | 4.AB.25 | MnO |
| ⓘ | Chrysoberyl ? | 4.BA.05 | BeAl2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Hausmannite | 4.BB.10 | Mn2+Mn3+2O4 |
| ⓘ | Hematite var. Specularite | 4.CB.05 | Fe2O3 |
| ⓘ | 4.CB.05 | Fe2O3 | |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Hematite var. Kidney Ore | 4.CB.05 | Fe2O3 |
| ⓘ | Arsenolite | 4.CB.50 | As2O3 |
| ⓘ | Bismite | 4.CB.60 | Bi2O3 |
| ⓘ | Quartz var. Agate | 4.DA.05 | SiO2 |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Haytorite | 4.DA.05 | SiO2 |
| ⓘ | var. Amethyst | 4.DA.05 | SiO2 |
| ⓘ | var. Rock Crystal | 4.DA.05 | SiO2 |
| ⓘ | var. Capped Quartz | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | var. Beekite | 4.DA.05 | SiO2 |
| ⓘ | Opal var. Common Opal | 4.DA.10 | SiO2 · nH2O |
| ⓘ | 4.DA.10 | SiO2 · nH2O | |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | var. Wood Tin | 4.DB.05 | SnO2 |
| ⓘ | Paramontroseite | 4.DB.15a | V4+O2 |
| ⓘ | Ferberite | 4.DB.30 | FeWO4 |
| ⓘ | 'Wolframite Group' | 4.DB.30 va | |
| ⓘ | Columbite-(Mn) | 4.DB.35 | Mn2+Nb2O6 |
| ⓘ | Tantalite-(Mn) | 4.DB.35 | Mn2+Ta2O6 |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Brookite | 4.DD.10 | TiO2 |
| ⓘ | Russellite | 4.DE.15 | Bi2WO6 |
| ⓘ | Fersmite | 4.DG.05 | (Ca,Ce,Na)(Nb,Ta,Ti)2(O,OH,F)6 |
| ⓘ | Hydrokenoelsmoreite var. Ferritungstite | 4.DH.15 | ◻2W2O6(H2O) |
| ⓘ | 4.DH.15 | ◻2W2O6(H2O) | |
| ⓘ | 'Alumotungstite' | 4.DH.15 va | ◻2W2O6(H2O) |
| ⓘ | 'Stibiconite' | 4.DH.20 | Sb3+Sb5+2O6(OH) |
| ⓘ | 'Bindheimite' | 4.DH.20 | Pb2Sb2O6O |
| ⓘ | Uraninite var. Sooty Uraninite | 4.DL.05 | UO2 |
| ⓘ | var. Pitchblende | 4.DL.05 | UO2 |
| ⓘ | 4.DL.05 | UO2 | |
| ⓘ | Montroseite | 4.FD.10 | (V3+,Fe3+)O(OH) |
| ⓘ | Manganite | 4.FD.15 | Mn3+O(OH) |
| ⓘ | Pyrochroite | 4.FE.05 | Mn(OH)2 |
| ⓘ | Gibbsite | 4.FE.10 | Al(OH)3 |
| ⓘ | Lepidocrocite | 4.FE.15 | γ-Fe3+O(OH) |
| ⓘ | Becquerelite ? | 4.GB.10 | Ca(UO2)6O4(OH)6 · 8H2O |
| ⓘ | Carnotite | 4.HB.05 | K2(UO2)2(VO4)2 · 3H2O |
| ⓘ | Tyuyamunite | 4.HB.25 | Ca(UO2)2(VO4)2 · 5-8H2O |
| ⓘ | Metatyuyamunite | 4.HB.25 | Ca(UO2)2(VO4)2 · 3H2O |
| ⓘ | Rauvite | 4.HB.40 | Ca(UO2)2(V10O28) · 16H2O |
| ⓘ | Pascoite | 4.HC.05 | Ca2Ca(V10O28) · 17H2O |
| ⓘ | Huemulite | 4.HG.10 | Na4Mg(V10O28) · 24H2O |
| ⓘ | Molybdomenite | 4.JF.05 | PbSeO3 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Rhodochrosite | 5.AB.05 | MnCO3 |
| ⓘ | Smithsonite | 5.AB.05 | ZnCO3 |
| ⓘ | Calcite var. Manganese-bearing Calcite | 5.AB.05 | (Ca,Mn)CO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Calcite var. Iron-bearing Calcite | 5.AB.05 | (Ca,Fe)CO3 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Witherite | 5.AB.15 | BaCO3 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Strontianite | 5.AB.15 | SrCO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Aurichalcite | 5.BA.15 | (Zn,Cu)5(CO3)2(OH)6 |
| ⓘ | Hydrozincite | 5.BA.15 | Zn5(CO3)2(OH)6 |
| ⓘ | Synchysite-(Ce) | 5.BD.20c | CaCe(CO3)2F |
| ⓘ | Bismutite | 5.BE.25 | (BiO)2CO3 |
| ⓘ | Leadhillite ? | 5.BF.40 | Pb4(CO3)2(SO4)(OH)2 |
| ⓘ | Trona | 5.CB.15 | Na3H(CO3)2 · 2H2O |
| ⓘ | Andersonite | 5.ED.30 | Na2Ca(UO2)(CO3)3 · 6H2O |
| Group 6 - Borates | |||
| ⓘ | Priceite ? | 6.EB.25 | Ca2B5O7(OH)5 · H2O |
| ⓘ | Rhodizite ? | 6.GC.05 | (K,Cs)Al4Be4(B,Be)12O28 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Celestine | 7.AD.35 | SrSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Beaverite-(Cu) | 7.BC.10 | Pb(Fe3+2Cu)(SO4)2(OH)6 |
| ⓘ | Natrojarosite | 7.BC.10 | NaFe3(SO4)2(OH)6 |
| ⓘ | Linarite | 7.BC.65 | PbCu(SO4)(OH)2 |
| ⓘ | Melanterite | 7.CB.35 | Fe2+(H2O)6SO4 · H2O |
| ⓘ | Goslarite | 7.CB.40 | ZnSO4 · 7H2O |
| ⓘ | Gypsum var. Selenite | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | 7.CD.40 | CaSO4 · 2H2O | |
| ⓘ | Aluminite | 7.DC.05 | Al2(SO4)(OH)4 · 7H2O |
| ⓘ | Wroewolfeite | 7.DD.10 | Cu4(SO4)(OH)6 · 2H2O |
| ⓘ | Langite | 7.DD.10 | Cu4(SO4)(OH)6 · 2H2O |
| ⓘ | Posnjakite | 7.DD.10 | Cu4(SO4)(OH)6 · H2O |
| ⓘ | Devilline | 7.DD.30 | CaCu4(SO4)2(OH)6 · 3H2O |
| ⓘ | Serpierite | 7.DD.30 | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| ⓘ | Chalcoalumite | 7.DD.75 | CuAl4(SO4)(OH)12 · 3H2O |
| ⓘ | Schulenbergite ? | 7.DD.80 | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| ⓘ | Cyanotrichite | 7.DE.10 | Cu4Al2(SO4)(OH)12 · 2H2O |
| ⓘ | Carbonatecyanotrichite ? | 7.DE.10 | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| ⓘ | Sideronatrite | 7.DF.20 | Na2Fe(SO4)2(OH) · 3H2O |
| ⓘ | Zippeite ? | 7.EC.05 | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Beryllonite ? | 8.AA.10 | NaBePO4 |
| ⓘ | Herderite ? | 8.BA.10 | CaBe(PO4)F |
| ⓘ | Amblygonite ? | 8.BB.05 | LiAl(PO4)F |
| ⓘ | Montebrasite | 8.BB.05 | LiAl(PO4)(OH) |
| ⓘ | Libethenite | 8.BB.30 | Cu2(PO4)(OH) |
| ⓘ | Olivenite | 8.BB.30 | Cu2(AsO4)(OH) |
| ⓘ | Rockbridgeite ? | 8.BC.10 | Fe2+Fe3+4(PO4)3(OH)5 |
| ⓘ | Cornwallite | 8.BD.05 | Cu5(AsO4)2(OH)4 |
| ⓘ | Pseudomalachite | 8.BD.05 | Cu5(PO4)2(OH)4 |
| ⓘ | Cornubite | 8.BD.30 | Cu5(AsO4)2(OH)4 |
| ⓘ | Clinoclase | 8.BE.20 | Cu3(AsO4)(OH)3 |
| ⓘ | Vésigniéite | 8.BH.45 | BaCu3(VO4)2(OH)2 |
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| ⓘ | Fluorapatite var. Carbonate-rich Fluorapatite | 8.BN.05 | Ca5(PO4,CO3)3(F,O) |
| ⓘ | Mimetite | 8.BN.05 | Pb5(AsO4)3Cl |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Variscite | 8.CD.10 | AlPO4 · 2H2O |
| ⓘ | Scorodite | 8.CD.10 | Fe3+AsO4 · 2H2O |
| ⓘ | Strengite ? | 8.CD.10 | FePO4 · 2H2O |
| ⓘ | Annabergite | 8.CE.40 | Ni3(AsO4)2 · 8H2O |
| ⓘ | Erythrite | 8.CE.40 | Co3(AsO4)2 · 8H2O |
| ⓘ | Vivianite | 8.CE.40 | Fe2+Fe2+2(PO4)2 · 8H2O |
| ⓘ | Talmessite | 8.CG.05 | Ca2Mg(AsO4)2 · 2H2O |
| ⓘ | Brandtite ? | 8.CG.10 | Ca2Mn2+(AsO4)2 · 2H2O |
| ⓘ | Rauenthalite | 8.CJ.40 | Ca3(AsO4)2 · 10H2O |
| ⓘ | Metavivianite ? | 8.DC.25 | Fe2+Fe3+2(PO4)2(OH)2 · 6H2O |
| ⓘ | Beraunite ? | 8.DC.27 | Fe3+6(PO4)4O(OH)4 · 6H2O |
| ⓘ | Cacoxenite | 8.DC.40 | Fe3+24AlO6(PO4)17(OH)12 · 75H2O |
| ⓘ | Wavellite (TL) | 8.DC.50 | Al3(PO4)2(OH,F)3 · 5H2O |
| ⓘ | Chalcosiderite | 8.DD.15 | CuFe3+6(PO4)4(OH)8 · 4H2O |
| ⓘ | Childrenite (TL) | 8.DD.20 | Fe2+Al(PO4)(OH)2 · H2O |
| ⓘ | Evansite ? | 8.DF.10 | Al3(PO4)(OH)6 · 6H2O |
| ⓘ | Chalcophyllite | 8.DF.30 | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| ⓘ | Lavendulan | 8.DG.05 | NaCaCu5(AsO4)4Cl · 5H2O |
| ⓘ | Arseniosiderite ? | 8.DH.30 | Ca2Fe3+3(AsO4)3O2 · 3H2O |
| ⓘ | Pharmacosiderite | 8.DK.10 | KFe3+4(AsO4)3(OH)4 · 6-7H2O |
| ⓘ | Dufrénite ? | 8.DK.15 | Ca0.5Fe2+Fe3+5(PO4)4(OH)6 · 2H2O |
| ⓘ | Tyrolite | 8.DM.10 | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| ⓘ | Saléeite | 8.EB.05 | Mg(UO2)2(PO4)2 · 10H2O |
| ⓘ | Torbernite | 8.EB.05 | Cu(UO2)2(PO4)2 · 12H2O |
| ⓘ | Autunite | 8.EB.05 | Ca(UO2)2(PO4)2 · 10-12H2O |
| ⓘ | Bassetite ? | 8.EB.10 | Fe2+(UO2)2(PO4)2 · 10H2O |
| ⓘ | Meta-autunite | 8.EB.10 | Ca(UO2)2(PO4)2 · 6H2O |
| ⓘ | Sabugalite ? | 8.EB.55 | HAl(UO2)4(PO4)4 · 16H2O |
| ⓘ | Phurcalite | 8.EC.35 | Ca2(UO2)3(PO4)2O2 · 7H2O |
| ⓘ | Volborthite | 8.FD.05 | Cu3(V2O7)(OH)2 · 2H2O |
| Group 9 - Silicates | |||
| ⓘ | Eucryptite ? | 9.AA.05 | LiAlSiO4 |
| ⓘ | Tephroite | 9.AC.05 | Mn2+2SiO4 |
| ⓘ | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| ⓘ | Grossular | 9.AD.25 | Ca3Al2(SiO4)3 |
| ⓘ | Andradite | 9.AD.25 | Ca3Fe3+2(SiO4)3 |
| ⓘ | Coffinite | 9.AD.30 | U(SiO4) · nH2O |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Euclase ? | 9.AE.10 | BeAl(SiO4)(OH) |
| ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | var. Chiastolite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | Topaz | 9.AF.35 | Al2(SiO4)(F,OH)2 |
| ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
| ⓘ | Malayaite | 9.AG.15 | CaSn(SiO4)O |
| ⓘ | Titanite var. Greenovite ? | 9.AG.15 | CaTi(SiO4)O |
| ⓘ | Dumortierite | 9.AJ.10 | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| ⓘ | Datolite | 9.AJ.20 | CaB(SiO4)(OH) |
| ⓘ | Boltwoodite | 9.AK.15 | (K,Na)(UO2)(SiO3OH) · 1.5H2O |
| ⓘ | Uranophane | 9.AK.15 | Ca(UO2)2(SiO3OH)2 · 5H2O |
| ⓘ | Hemimorphite | 9.BD.10 | Zn4Si2O7(OH)2 · H2O |
| ⓘ | Axinite-(Fe) | 9.BD.20 | Ca2Fe2+Al2BSi4O15OH |
| ⓘ | Ilvaite ? | 9.BE.07 | CaFe3+Fe2+2(Si2O7)O(OH) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Allanite-(Ce) | 9.BG.05b | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ | Zoisite | 9.BG.10 | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Vesuvianite | 9.BG.35 | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Cordierite | 9.CJ.10 | (Mg,Fe)2Al3(AlSi5O18) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Elbaite | 9.CK.05 | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Milarite | 9.CM.05 | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| ⓘ | Johannsenite | 9.DA.15 | CaMn2+Si2O6 |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Augite var. Titanium-bearing Augite | 9.DA.15 | (Ca,Na)(Mg,Ti, Fe,Al,)(Si,Al)2O6 |
| ⓘ | Diopside var. Diallage | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Hedenbergite | 9.DA.15 | CaFe2+Si2O6 |
| ⓘ | Augite | 9.DA.15 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ | Aegirine-augite | 9.DA.20 | (NaaCabFe2+cMgd)(Fe3+eAlfFe2+gMgh)Si2O6 |
| ⓘ | Spodumene ? | 9.DA.30 | LiAlSi2O6 |
| ⓘ | Anthophyllite | 9.DD.05 | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Ferro-actinolite | 9.DE.10 | ◻Ca2Fe2+5(Si8O22)(OH)2 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Hastingsite | 9.DE.15 | NaCa2(Fe2+4Fe3+)(Si6Al2)O22(OH)2 |
| ⓘ | Arfvedsonite | 9.DE.25 | [Na][Na2][Fe2+4Fe3+]Si8O22(OH)2 |
| ⓘ | Bavenite | 9.DF.25 | Ca4Be2Al2Si9O26(OH)2 |
| ⓘ | Wollastonite | 9.DG.05 | Ca3(Si3O9) |
| ⓘ | Bustamite | 9.DG.05 | CaMn2+(Si2O6) |
| ⓘ | Eudidymite ? | 9.DG.60 | Na2Be2Si6O15 · H2O |
| ⓘ | Leucophanite ? | 9.DH.05 | NaCaBeSi2O6F |
| ⓘ | Rhodonite | 9.DK.05 | CaMn3Mn[Si5O15] |
| ⓘ | Prehnite | 9.DP.20 | Ca2Al2Si3O10(OH)2 |
| ⓘ | Ajoite ? | 9.EA.70 | (K,Na)Cu7AlSi9O24(OH)6 · 3H2O |
| ⓘ | Muscovite var. Illite | 9.EC.15 | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ | Roscoelite | 9.EC.15 | K(V3+,Al)2(AlSi3O10)(OH)2 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | var. Gilbertite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Annite | 9.EC.20 | KFe2+3(AlSi3O10)(OH)2 |
| ⓘ | Montmorillonite | 9.EC.40 | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ | Nontronite | 9.EC.40 | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| ⓘ | Chamosite | 9.EC.55 | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| ⓘ | Clinochlore var. Corundophilite | 9.EC.55 | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| ⓘ | Dickite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Nacrite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Allophane | 9.ED.20 | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Bementite | 9.EE.05 | Mn7Si6O15(OH)8 |
| ⓘ | Palygorskite | 9.EE.20 | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| ⓘ | Petalite | 9.EF.05 | LiAl(Si4O10) |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Sanidine | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Anorthite | 9.FA.35 | Ca(Al2Si2O8) |
| ⓘ | Albite var. Oligoclase | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ | 9.FA.35 | Na(AlSi3O8) | |
| ⓘ | Anorthite var. Labradorite | 9.FA.35 | (Ca,Na)[Al(Al,Si)Si2O8] |
| ⓘ | Danburite | 9.FA.65 | CaB2Si2O8 |
| ⓘ | Helvine ? | 9.FB.10 | Be3Mn2+4(SiO4)3S |
| ⓘ | Marialite | 9.FB.15 | Na4Al3Si9O24Cl |
| ⓘ | 'Zeolite Group' | 9.G0. | |
| ⓘ | Leucite | 9.GB.05 | K(AlSi2O6) |
| ⓘ | Analcime | 9.GB.05 | Na(AlSi2O6) · H2O |
| ⓘ | Pollucite ? | 9.GB.05 | (Cs,Na)2(Al2Si4O12) · 2H2O |
| ⓘ | Laumontite | 9.GB.10 | CaAl2Si4O12 · 4H2O |
| ⓘ | Stilbite-Ca | 9.GE.10 | NaCa4(Si27Al9)O72 · 28H2O |
| Unclassified | |||
| ⓘ | 'Amphibole Supergroup var. Byssolite' | - | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ | 'Columbite-Tantalite' | - | |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Apatite var. Collophane' | - | Ca5(PO4)3(Cl/F/OH) |
| ⓘ | 'Pyroxene Group' | - | ADSi2O6 |
| ⓘ | 'Smectite Group' | - | A0.3D2-3[T4O10]Z2 · nH2O |
| ⓘ | 'Jasper' | - | |
| ⓘ | 'Petroleum var. Bitumen' | - | |
| ⓘ | 'Heulandite Subgroup' | - | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| ⓘ | 'Manganese Oxides var. Manganese Dendrites' | - | |
| ⓘ | '' | - | |
| ⓘ | 'Gummite' | - | |
| ⓘ | 'Plumbogummite Group' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| ⓘ | 'Axinite Group' | - | |
| ⓘ | 'Glauconite' | - | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| ⓘ | 'Asbestos' | - | |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Feldspar Group var. Perthite' | - | |
| ⓘ | 'Pinite' | - | |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Alkali Feldspar' | - | |
| ⓘ | 'Chabazite' | - | |
| ⓘ | 'Tourmaline var. Rubellite' | - | A(D3)G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Apophyllite Group' | - | AB4[Si8O22]X · 8H2O |
| ⓘ | 'Ganomatite' | - | |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Psilomelane' | - | |
| ⓘ | 'Tourmaline var. Verdelite' | - | A(D3)G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Pilolite' | - | Mg4Al2Si10O27 · 15H2O |
| ⓘ | 'Wad' | - | |
| ⓘ | 'Monazite' | - | REE(PO4) |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Lepidolite' | - | |
| ⓘ | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
| ⓘ | 'Mica Group' | - | |
| ⓘ | 'Amphibole Supergroup' | - | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ | 'Fayalite-Forsterite Series' | - | |
| ⓘ | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
| ⓘ | 'Scapolite' | - | |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| ⓘ | 'Retinite' | - | |
| ⓘ | 'Feldspar Group' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Ajoite | (K,Na)Cu7AlSi9O24(OH)6 · 3H2O |
| H | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| H | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| H | ⓘ Aluminite | Al2(SO4)(OH)4 · 7H2O |
| H | ⓘ Alumotungstite | ◻2W2O6(H2O) |
| H | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| H | ⓘ Analcime | Na(AlSi2O6) · H2O |
| H | ⓘ Andersonite | Na2Ca(UO2)(CO3)3 · 6H2O |
| H | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| H | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| H | ⓘ Anthophyllite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| H | ⓘ Apophyllite Group | AB4[Si8O22]X · 8H2O |
| H | ⓘ Arfvedsonite | [Na][Na2][Fe42+Fe3+]Si8O22(OH)2 |
| H | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| H | ⓘ Atacamite | Cu2(OH)3Cl |
| H | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| H | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Bassetite | Fe2+(UO2)2(PO4)2 · 10H2O |
| H | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| H | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| H | ⓘ Becquerelite | Ca(UO2)6O4(OH)6 · 8H2O |
| H | ⓘ Bementite | Mn7Si6O15(OH)8 |
| H | ⓘ Beraunite | Fe63+(PO4)4O(OH)4 · 6H2O |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Boltwoodite | (K,Na)(UO2)(SiO3OH) · 1.5H2O |
| H | ⓘ Brandtite | Ca2Mn2+(AsO4)2 · 2H2O |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| H | ⓘ Carbonatecyanotrichite | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| H | ⓘ Carnotite | K2(UO2)2(VO4)2 · 3H2O |
| H | ⓘ Chalcosiderite | CuFe63+(PO4)4(OH)8 · 4H2O |
| H | ⓘ Chalcoalumite | CuAl4(SO4)(OH)12 · 3H2O |
| H | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| H | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| H | ⓘ Childrenite | Fe2+Al(PO4)(OH)2 · H2O |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Clinoclase | Cu3(AsO4)(OH)3 |
| H | ⓘ Coffinite | U(SiO4) · nH2O |
| H | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| H | ⓘ Cornubite | Cu5(AsO4)2(OH)4 |
| H | ⓘ Cornwallite | Cu5(AsO4)2(OH)4 |
| H | ⓘ Clinochlore var. Corundophilite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| H | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| H | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| H | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| H | ⓘ Dufrénite | Ca0.5Fe2+Fe53+(PO4)4(OH)6 · 2H2O |
| H | ⓘ Datolite | CaB(SiO4)(OH) |
| H | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| H | ⓘ Euclase | BeAl(SiO4)(OH) |
| H | ⓘ Eudidymite | Na2Be2Si6O15 · H2O |
| H | ⓘ Evansite | Al3(PO4)(OH)6 · 6H2O |
| H | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| H | ⓘ Ferro-actinolite | ◻Ca2Fe52+(Si8O22)(OH)2 |
| H | ⓘ Fersmite | (Ca,Ce,Na)(Nb,Ta,Ti)2(O,OH,F)6 |
| H | ⓘ Gibbsite | Al(OH)3 |
| H | ⓘ Muscovite var. Gilbertite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Glauconite | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| H | ⓘ Goethite | α-Fe3+O(OH) |
| H | ⓘ Goslarite | ZnSO4 · 7H2O |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| H | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| H | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| H | ⓘ Huemulite | Na4Mg(V10O28) · 24H2O |
| H | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| H | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| H | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| H | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| H | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| H | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| H | ⓘ Lepidocrocite | γ-Fe3+O(OH) |
| H | ⓘ Libethenite | Cu2(PO4)(OH) |
| H | ⓘ Linarite | PbCu(SO4)(OH)2 |
| H | ⓘ Manganite | Mn3+O(OH) |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
| H | ⓘ Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| H | ⓘ Metatyuyamunite | Ca(UO2)2(VO4)2 · 3H2O |
| H | ⓘ Metavivianite | Fe2+Fe23+(PO4)2(OH)2 · 6H2O |
| H | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| H | ⓘ Montebrasite | LiAl(PO4)(OH) |
| H | ⓘ Montroseite | (V3+,Fe3+)O(OH) |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| H | ⓘ Nacrite | Al2(Si2O5)(OH)4 |
| H | ⓘ Natrojarosite | NaFe3(SO4)2(OH)6 |
| H | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| H | ⓘ Olivenite | Cu2(AsO4)(OH) |
| H | ⓘ Opal | SiO2 · nH2O |
| H | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| H | ⓘ Pascoite | Ca2Ca(V10O28) · 17H2O |
| H | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| H | ⓘ Phurcalite | Ca2(UO2)3(PO4)2O2 · 7H2O |
| H | ⓘ Pilolite | Mg4Al2Si10O27 · 15H2O |
| H | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| H | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| H | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| H | ⓘ Priceite | Ca2B5O7(OH)5 · H2O |
| H | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| H | ⓘ Pyrochlore Group | A2Nb2(O,OH)6Z |
| H | ⓘ Pyrochroite | Mn(OH)2 |
| H | ⓘ Rauenthalite | Ca3(AsO4)2 · 10H2O |
| H | ⓘ Rauvite | Ca(UO2)2(V10O28) · 16H2O |
| H | ⓘ Rockbridgeite | Fe2+Fe43+(PO4)3(OH)5 |
| H | ⓘ Roscoelite | K(V3+,Al)2(AlSi3O10)(OH)2 |
| H | ⓘ Sabugalite | HAl(UO2)4(PO4)4 · 16H2O |
| H | ⓘ Saléeite | Mg(UO2)2(PO4)2 · 10H2O |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| H | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| H | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| H | ⓘ Sideronatrite | Na2Fe(SO4)2(OH) · 3H2O |
| H | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| H | ⓘ Strengite | FePO4 · 2H2O |
| H | ⓘ Talmessite | Ca2Mg(AsO4)2 · 2H2O |
| H | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| H | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Trona | Na3H(CO3)2 · 2H2O |
| H | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| H | ⓘ Tyuyamunite | Ca(UO2)2(VO4)2 · 5-8H2O |
| H | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| H | ⓘ Variscite | AlPO4 · 2H2O |
| H | ⓘ Vésigniéite | BaCu3(VO4)2(OH)2 |
| H | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| H | ⓘ Volborthite | Cu3(V2O7)(OH)2 · 2H2O |
| H | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| H | ⓘ Wavellite | Al3(PO4)2(OH,F)3 · 5H2O |
| H | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| H | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| H | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| H | ⓘ Opal var. Common Opal | SiO2 · nH2O |
| H | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| H | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| H | ⓘ Amphibole Supergroup var. Byssolite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| H | ⓘ Smectite Group | A0.3D2-3[T4O10]Z2 · nH2O |
| H | ⓘ Hydrokenoelsmoreite | ◻2W2O6(H2O) |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Li | Lithium | |
| Li | ⓘ Amblygonite | LiAl(PO4)F |
| Li | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Li | ⓘ Eucryptite | LiAlSiO4 |
| Li | ⓘ Montebrasite | LiAl(PO4)(OH) |
| Li | ⓘ Petalite | LiAl(Si4O10) |
| Li | ⓘ Spodumene | LiAlSi2O6 |
| Be | Beryllium | |
| Be | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| Be | ⓘ Beryllonite | NaBePO4 |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| Be | ⓘ Chrysoberyl | BeAl2O4 |
| Be | ⓘ Euclase | BeAl(SiO4)(OH) |
| Be | ⓘ Eudidymite | Na2Be2Si6O15 · H2O |
| Be | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| Be | ⓘ Herderite | CaBe(PO4)F |
| Be | ⓘ Leucophanite | NaCaBeSi2O6F |
| Be | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| Be | ⓘ Rhodizite | (K,Cs)Al4Be4(B,Be)12O28 |
| B | Boron | |
| B | ⓘ Danburite | CaB2Si2O8 |
| B | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| B | ⓘ Datolite | CaB(SiO4)(OH) |
| B | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| B | ⓘ Priceite | Ca2B5O7(OH)5 · H2O |
| B | ⓘ Rhodizite | (K,Cs)Al4Be4(B,Be)12O28 |
| B | ⓘ Tourmaline var. Rubellite | A(D3)G6(T6O18)(BO3)3X3Z |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| B | ⓘ Tourmaline var. Verdelite | A(D3)G6(T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Andersonite | Na2Ca(UO2)(CO3)3 · 6H2O |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Bismutite | (BiO)2CO3 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Carbonatecyanotrichite | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| C | ⓘ Fluorapatite var. Carbonate-rich Fluorapatite | Ca5(PO4,CO3)3(F,O) |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| C | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| C | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Rhodochrosite | MnCO3 |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Smithsonite | ZnCO3 |
| C | ⓘ Strontianite | SrCO3 |
| C | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| C | ⓘ Trona | Na3H(CO3)2 · 2H2O |
| C | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| C | ⓘ Witherite | BaCO3 |
| C | ⓘ Calcite var. Iron-bearing Calcite | (Ca,Fe)CO3 |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| O | ⓘ Ajoite | (K,Na)Cu7AlSi9O24(OH)6 · 3H2O |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| O | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| O | ⓘ Aluminite | Al2(SO4)(OH)4 · 7H2O |
| O | ⓘ Alumotungstite | ◻2W2O6(H2O) |
| O | ⓘ Amblygonite | LiAl(PO4)F |
| O | ⓘ Quartz var. Amethyst | SiO2 |
| O | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| O | ⓘ Analcime | Na(AlSi2O6) · H2O |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Andalusite | Al2(SiO4)O |
| O | ⓘ Andersonite | Na2Ca(UO2)(CO3)3 · 6H2O |
| O | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| O | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| O | ⓘ Anorthite | Ca(Al2Si2O8) |
| O | ⓘ Anthophyllite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| O | ⓘ Apophyllite Group | AB4[Si8O22]X · 8H2O |
| O | ⓘ Arsenolite | As2O3 |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Arfvedsonite | [Na][Na2][Fe42+Fe3+]Si8O22(OH)2 |
| O | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| O | ⓘ Atacamite | Cu2(OH)3Cl |
| O | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| O | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| O | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Bassetite | Fe2+(UO2)2(PO4)2 · 10H2O |
| O | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| O | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| O | ⓘ Becquerelite | Ca(UO2)6O4(OH)6 · 8H2O |
| O | ⓘ Quartz var. Beekite | SiO2 |
| O | ⓘ Bementite | Mn7Si6O15(OH)8 |
| O | ⓘ Beraunite | Fe63+(PO4)4O(OH)4 · 6H2O |
| O | ⓘ Beryllonite | NaBePO4 |
| O | ⓘ Bindheimite | Pb2Sb2O6O |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Bismite | Bi2O3 |
| O | ⓘ Bismutite | (BiO)2CO3 |
| O | ⓘ Boltwoodite | (K,Na)(UO2)(SiO3OH) · 1.5H2O |
| O | ⓘ Brandtite | Ca2Mn2+(AsO4)2 · 2H2O |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Brookite | TiO2 |
| O | ⓘ Bustamite | CaMn2+(Si2O6) |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Carbonatecyanotrichite | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| O | ⓘ Fluorapatite var. Carbonate-rich Fluorapatite | Ca5(PO4,CO3)3(F,O) |
| O | ⓘ Carnotite | K2(UO2)2(VO4)2 · 3H2O |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Celestine | SrSO4 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Chalcosiderite | CuFe63+(PO4)4(OH)8 · 4H2O |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Chalcoalumite | CuAl4(SO4)(OH)12 · 3H2O |
| O | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| O | ⓘ Cuprite var. Chalcotrichite | Cu2O |
| O | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| O | ⓘ Andalusite var. Chiastolite | Al2(SiO4)O |
| O | ⓘ Childrenite | Fe2+Al(PO4)(OH)2 · H2O |
| O | ⓘ Chrysoberyl | BeAl2O4 |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Clinoclase | Cu3(AsO4)(OH)3 |
| O | ⓘ Coffinite | U(SiO4) · nH2O |
| O | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| O | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| O | ⓘ Cornubite | Cu5(AsO4)2(OH)4 |
| O | ⓘ Cornwallite | Cu5(AsO4)2(OH)4 |
| O | ⓘ Clinochlore var. Corundophilite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| O | ⓘ Danburite | CaB2Si2O8 |
| O | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| O | ⓘ Diopside var. Diallage | CaMgSi2O6 |
| O | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Dufrénite | Ca0.5Fe2+Fe53+(PO4)4(OH)6 · 2H2O |
| O | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| O | ⓘ Datolite | CaB(SiO4)(OH) |
| O | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| O | ⓘ Euclase | BeAl(SiO4)(OH) |
| O | ⓘ Eucryptite | LiAlSiO4 |
| O | ⓘ Eudidymite | Na2Be2Si6O15 · H2O |
| O | ⓘ Evansite | Al3(PO4)(OH)6 · 6H2O |
| O | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| O | ⓘ Ferberite | FeWO4 |
| O | ⓘ Ferro-actinolite | ◻Ca2Fe52+(Si8O22)(OH)2 |
| O | ⓘ Fersmite | (Ca,Ce,Na)(Nb,Ta,Ti)2(O,OH,F)6 |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Gibbsite | Al(OH)3 |
| O | ⓘ Muscovite var. Gilbertite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Glauconite | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| O | ⓘ Goethite | α-Fe3+O(OH) |
| O | ⓘ Goslarite | ZnSO4 · 7H2O |
| O | ⓘ Grossular | Ca3Al2(SiO4)3 |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| O | ⓘ Hausmannite | Mn2+Mn23+O4 |
| O | ⓘ Hedenbergite | CaFe2+Si2O6 |
| O | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| O | ⓘ Herderite | CaBe(PO4)F |
| O | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| O | ⓘ Huemulite | Na4Mg(V10O28) · 24H2O |
| O | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| O | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| O | ⓘ Johannsenite | CaMn2+Si2O6 |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| O | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| O | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| O | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| O | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| O | ⓘ Lepidocrocite | γ-Fe3+O(OH) |
| O | ⓘ Leucophanite | NaCaBeSi2O6F |
| O | ⓘ Libethenite | Cu2(PO4)(OH) |
| O | ⓘ Linarite | PbCu(SO4)(OH)2 |
| O | ⓘ Leucite | K(AlSi2O6) |
| O | ⓘ Manganosite | MnO |
| O | ⓘ Manganite | Mn3+O(OH) |
| O | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| O | ⓘ Tantalite-(Mn) | Mn2+Ta2O6 |
| O | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Malayaite | CaSn(SiO4)O |
| O | ⓘ Marialite | Na4Al3Si9O24Cl |
| O | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
| O | ⓘ Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| O | ⓘ Metatyuyamunite | Ca(UO2)2(VO4)2 · 3H2O |
| O | ⓘ Metavivianite | Fe2+Fe23+(PO4)2(OH)2 · 6H2O |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| O | ⓘ Mimetite | Pb5(AsO4)3Cl |
| O | ⓘ Molybdomenite | PbSeO3 |
| O | ⓘ Monazite | REE(PO4) |
| O | ⓘ Montebrasite | LiAl(PO4)(OH) |
| O | ⓘ Montroseite | (V3+,Fe3+)O(OH) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| O | ⓘ Nacrite | Al2(Si2O5)(OH)4 |
| O | ⓘ Natrojarosite | NaFe3(SO4)2(OH)6 |
| O | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| O | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Olivenite | Cu2(AsO4)(OH) |
| O | ⓘ Opal | SiO2 · nH2O |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| O | ⓘ Paramelaconite | Cu21+Cu22+O3 |
| O | ⓘ Paramontroseite | V4+O2 |
| O | ⓘ Pascoite | Ca2Ca(V10O28) · 17H2O |
| O | ⓘ Petalite | LiAl(Si4O10) |
| O | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| O | ⓘ Phurcalite | Ca2(UO2)3(PO4)2O2 · 7H2O |
| O | ⓘ Pilolite | Mg4Al2Si10O27 · 15H2O |
| O | ⓘ Uraninite var. Pitchblende | UO2 |
| O | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| O | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| O | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| O | ⓘ Priceite | Ca2B5O7(OH)5 · H2O |
| O | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| O | ⓘ Pyrochlore Group | A2Nb2(O,OH)6Z |
| O | ⓘ Pyrochroite | Mn(OH)2 |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rauenthalite | Ca3(AsO4)2 · 10H2O |
| O | ⓘ Rauvite | Ca(UO2)2(V10O28) · 16H2O |
| O | ⓘ Rhodizite | (K,Cs)Al4Be4(B,Be)12O28 |
| O | ⓘ Rhodochrosite | MnCO3 |
| O | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| O | ⓘ Rockbridgeite | Fe2+Fe43+(PO4)3(OH)5 |
| O | ⓘ Roscoelite | K(V3+,Al)2(AlSi3O10)(OH)2 |
| O | ⓘ Tourmaline var. Rubellite | A(D3)G6(T6O18)(BO3)3X3Z |
| O | ⓘ Russellite | Bi2WO6 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Sabugalite | HAl(UO2)4(PO4)4 · 16H2O |
| O | ⓘ Saléeite | Mg(UO2)2(PO4)2 · 10H2O |
| O | ⓘ Sanidine | K(AlSi3O8) |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| O | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| O | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Sideronatrite | Na2Fe(SO4)2(OH) · 3H2O |
| O | ⓘ Smithsonite | ZnCO3 |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| O | ⓘ Spodumene | LiAlSi2O6 |
| O | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| O | ⓘ Strengite | FePO4 · 2H2O |
| O | ⓘ Strontianite | SrCO3 |
| O | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| O | ⓘ Talmessite | Ca2Mg(AsO4)2 · 2H2O |
| O | ⓘ Tenorite | CuO |
| O | ⓘ Tephroite | Mn22+SiO4 |
| O | ⓘ Titanite | CaTi(SiO4)O |
| O | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| O | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| O | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Trona | Na3H(CO3)2 · 2H2O |
| O | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| O | ⓘ Tyuyamunite | Ca(UO2)2(VO4)2 · 5-8H2O |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| O | ⓘ Variscite | AlPO4 · 2H2O |
| O | ⓘ Tourmaline var. Verdelite | A(D3)G6(T6O18)(BO3)3X3Z |
| O | ⓘ Vésigniéite | BaCu3(VO4)2(OH)2 |
| O | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| O | ⓘ Volborthite | Cu3(V2O7)(OH)2 · 2H2O |
| O | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| O | ⓘ Wavellite | Al3(PO4)2(OH,F)3 · 5H2O |
| O | ⓘ Witherite | BaCO3 |
| O | ⓘ Cassiterite var. Wood Tin | SnO2 |
| O | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| O | ⓘ Wollastonite | Ca3(Si3O9) |
| O | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| O | ⓘ Hematite var. Specularite | Fe2O3 |
| O | ⓘ Hematite var. Kidney Ore | Fe2O3 |
| O | ⓘ Opal var. Common Opal | SiO2 · nH2O |
| O | ⓘ Quartz var. Rock Crystal | SiO2 |
| O | ⓘ Quartz var. Haytorite | SiO2 |
| O | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Pyroxene Group | ADSi2O6 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Calcite var. Iron-bearing Calcite | (Ca,Fe)CO3 |
| O | ⓘ Amphibole Supergroup var. Byssolite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| O | ⓘ Augite var. Titanium-bearing Augite | (Ca,Na)(Mg,Ti, Fe,Al,)(Si,Al)2O6 |
| O | ⓘ Smectite Group | A0.3D2-3[T4O10]Z2 · nH2O |
| O | ⓘ Titanite var. Greenovite | CaTi(SiO4)O |
| O | ⓘ Hydrokenoelsmoreite | ◻2W2O6(H2O) |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| O | ⓘ Uraninite var. Sooty Uraninite | UO2 |
| F | Fluorine | |
| F | ⓘ Amblygonite | LiAl(PO4)F |
| F | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorapatite var. Carbonate-rich Fluorapatite | Ca5(PO4,CO3)3(F,O) |
| F | ⓘ Fersmite | (Ca,Ce,Na)(Nb,Ta,Ti)2(O,OH,F)6 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Herderite | CaBe(PO4)F |
| F | ⓘ Leucophanite | NaCaBeSi2O6F |
| F | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| F | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| F | ⓘ Wavellite | Al3(PO4)2(OH,F)3 · 5H2O |
| F | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| F | ⓘ Amphibole Supergroup var. Byssolite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Na | ⓘ Ajoite | (K,Na)Cu7AlSi9O24(OH)6 · 3H2O |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Analcime | Na(AlSi2O6) · H2O |
| Na | ⓘ Andersonite | Na2Ca(UO2)(CO3)3 · 6H2O |
| Na | ⓘ Arfvedsonite | [Na][Na2][Fe42+Fe3+]Si8O22(OH)2 |
| Na | ⓘ Beryllonite | NaBePO4 |
| Na | ⓘ Boltwoodite | (K,Na)(UO2)(SiO3OH) · 1.5H2O |
| Na | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Eudidymite | Na2Be2Si6O15 · H2O |
| Na | ⓘ Fersmite | (Ca,Ce,Na)(Nb,Ta,Ti)2(O,OH,F)6 |
| Na | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Na | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Na | ⓘ Huemulite | Na4Mg(V10O28) · 24H2O |
| Na | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Na | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| Na | ⓘ Leucophanite | NaCaBeSi2O6F |
| Na | ⓘ Marialite | Na4Al3Si9O24Cl |
| Na | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Na | ⓘ Natrojarosite | NaFe3(SO4)2(OH)6 |
| Na | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Na | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Sideronatrite | Na2Fe(SO4)2(OH) · 3H2O |
| Na | ⓘ Trona | Na3H(CO3)2 · 2H2O |
| Na | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Na | ⓘ Augite var. Titanium-bearing Augite | (Ca,Na)(Mg,Ti, Fe,Al,)(Si,Al)2O6 |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Anthophyllite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| Mg | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Mg | ⓘ Clinochlore var. Corundophilite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| Mg | ⓘ Diopside var. Diallage | CaMgSi2O6 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Glauconite | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| Mg | ⓘ Huemulite | Na4Mg(V10O28) · 24H2O |
| Mg | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Mg | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| Mg | ⓘ Pilolite | Mg4Al2Si10O27 · 15H2O |
| Mg | ⓘ Saléeite | Mg(UO2)2(PO4)2 · 10H2O |
| Mg | ⓘ Talmessite | Ca2Mg(AsO4)2 · 2H2O |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Mg | ⓘ Augite var. Titanium-bearing Augite | (Ca,Na)(Mg,Ti, Fe,Al,)(Si,Al)2O6 |
| Al | Aluminium | |
| Al | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Al | ⓘ Ajoite | (K,Na)Cu7AlSi9O24(OH)6 · 3H2O |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| Al | ⓘ Aluminite | Al2(SO4)(OH)4 · 7H2O |
| Al | ⓘ Amblygonite | LiAl(PO4)F |
| Al | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Al | ⓘ Analcime | Na(AlSi2O6) · H2O |
| Al | ⓘ Andalusite | Al2(SiO4)O |
| Al | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| Al | ⓘ Anorthite | Ca(Al2Si2O8) |
| Al | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| Al | ⓘ Carbonatecyanotrichite | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| Al | ⓘ Chalcoalumite | CuAl4(SO4)(OH)12 · 3H2O |
| Al | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| Al | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| Al | ⓘ Andalusite var. Chiastolite | Al2(SiO4)O |
| Al | ⓘ Childrenite | Fe2+Al(PO4)(OH)2 · H2O |
| Al | ⓘ Chrysoberyl | BeAl2O4 |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Al | ⓘ Clinochlore var. Corundophilite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| Al | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| Al | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| Al | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Euclase | BeAl(SiO4)(OH) |
| Al | ⓘ Eucryptite | LiAlSiO4 |
| Al | ⓘ Evansite | Al3(PO4)(OH)6 · 6H2O |
| Al | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Al | ⓘ Gibbsite | Al(OH)3 |
| Al | ⓘ Muscovite var. Gilbertite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Glauconite | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| Al | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Al | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Al | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Al | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Al | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Al | ⓘ Leucite | K(AlSi2O6) |
| Al | ⓘ Marialite | Na4Al3Si9O24Cl |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| Al | ⓘ Montebrasite | LiAl(PO4)(OH) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Al | ⓘ Nacrite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Al | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| Al | ⓘ Petalite | LiAl(Si4O10) |
| Al | ⓘ Pilolite | Mg4Al2Si10O27 · 15H2O |
| Al | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| Al | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Al | ⓘ Rhodizite | (K,Cs)Al4Be4(B,Be)12O28 |
| Al | ⓘ Roscoelite | K(V3+,Al)2(AlSi3O10)(OH)2 |
| Al | ⓘ Sabugalite | HAl(UO2)4(PO4)4 · 16H2O |
| Al | ⓘ Sanidine | K(AlSi3O8) |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Al | ⓘ Spodumene | LiAlSi2O6 |
| Al | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Al | ⓘ Variscite | AlPO4 · 2H2O |
| Al | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | ⓘ Wavellite | Al3(PO4)2(OH,F)3 · 5H2O |
| Al | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Al | ⓘ Amphibole Supergroup var. Byssolite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Al | ⓘ Augite var. Titanium-bearing Augite | (Ca,Na)(Mg,Ti, Fe,Al,)(Si,Al)2O6 |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Si | ⓘ Ajoite | (K,Na)Cu7AlSi9O24(OH)6 · 3H2O |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| Si | ⓘ Quartz var. Amethyst | SiO2 |
| Si | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Si | ⓘ Analcime | Na(AlSi2O6) · H2O |
| Si | ⓘ Andalusite | Al2(SiO4)O |
| Si | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Si | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| Si | ⓘ Anorthite | Ca(Al2Si2O8) |
| Si | ⓘ Anthophyllite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| Si | ⓘ Apophyllite Group | AB4[Si8O22]X · 8H2O |
| Si | ⓘ Arfvedsonite | [Na][Na2][Fe42+Fe3+]Si8O22(OH)2 |
| Si | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Si | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| Si | ⓘ Quartz var. Beekite | SiO2 |
| Si | ⓘ Bementite | Mn7Si6O15(OH)8 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Boltwoodite | (K,Na)(UO2)(SiO3OH) · 1.5H2O |
| Si | ⓘ Bustamite | CaMn2+(Si2O6) |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| Si | ⓘ Andalusite var. Chiastolite | Al2(SiO4)O |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Coffinite | U(SiO4) · nH2O |
| Si | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Si | ⓘ Clinochlore var. Corundophilite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| Si | ⓘ Danburite | CaB2Si2O8 |
| Si | ⓘ Diopside var. Diallage | CaMgSi2O6 |
| Si | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| Si | ⓘ Datolite | CaB(SiO4)(OH) |
| Si | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Euclase | BeAl(SiO4)(OH) |
| Si | ⓘ Eucryptite | LiAlSiO4 |
| Si | ⓘ Eudidymite | Na2Be2Si6O15 · H2O |
| Si | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Si | ⓘ Ferro-actinolite | ◻Ca2Fe52+(Si8O22)(OH)2 |
| Si | ⓘ Muscovite var. Gilbertite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Glauconite | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| Si | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Si | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Si | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Si | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| Si | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Si | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Si | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Si | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| Si | ⓘ Johannsenite | CaMn2+Si2O6 |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Si | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Si | ⓘ Leucophanite | NaCaBeSi2O6F |
| Si | ⓘ Leucite | K(AlSi2O6) |
| Si | ⓘ Malayaite | CaSn(SiO4)O |
| Si | ⓘ Marialite | Na4Al3Si9O24Cl |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Si | ⓘ Nacrite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Si | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Opal | SiO2 · nH2O |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| Si | ⓘ Petalite | LiAl(Si4O10) |
| Si | ⓘ Pilolite | Mg4Al2Si10O27 · 15H2O |
| Si | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| Si | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Si | ⓘ Roscoelite | K(V3+,Al)2(AlSi3O10)(OH)2 |
| Si | ⓘ Sanidine | K(AlSi3O8) |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Si | ⓘ Spodumene | LiAlSi2O6 |
| Si | ⓘ Tephroite | Mn22+SiO4 |
| Si | ⓘ Titanite | CaTi(SiO4)O |
| Si | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| Si | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Si | ⓘ Wollastonite | Ca3(Si3O9) |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Opal var. Common Opal | SiO2 · nH2O |
| Si | ⓘ Quartz var. Rock Crystal | SiO2 |
| Si | ⓘ Quartz var. Haytorite | SiO2 |
| Si | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Pyroxene Group | ADSi2O6 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Amphibole Supergroup var. Byssolite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Si | ⓘ Augite var. Titanium-bearing Augite | (Ca,Na)(Mg,Ti, Fe,Al,)(Si,Al)2O6 |
| Si | ⓘ Titanite var. Greenovite | CaTi(SiO4)O |
| P | Phosphorus | |
| P | ⓘ Amblygonite | LiAl(PO4)F |
| P | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| P | ⓘ Bassetite | Fe2+(UO2)2(PO4)2 · 10H2O |
| P | ⓘ Beraunite | Fe63+(PO4)4O(OH)4 · 6H2O |
| P | ⓘ Beryllonite | NaBePO4 |
| P | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| P | ⓘ Fluorapatite var. Carbonate-rich Fluorapatite | Ca5(PO4,CO3)3(F,O) |
| P | ⓘ Chalcosiderite | CuFe63+(PO4)4(OH)8 · 4H2O |
| P | ⓘ Childrenite | Fe2+Al(PO4)(OH)2 · H2O |
| P | ⓘ Dufrénite | Ca0.5Fe2+Fe53+(PO4)4(OH)6 · 2H2O |
| P | ⓘ Evansite | Al3(PO4)(OH)6 · 6H2O |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Herderite | CaBe(PO4)F |
| P | ⓘ Libethenite | Cu2(PO4)(OH) |
| P | ⓘ Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| P | ⓘ Metavivianite | Fe2+Fe23+(PO4)2(OH)2 · 6H2O |
| P | ⓘ Monazite | REE(PO4) |
| P | ⓘ Montebrasite | LiAl(PO4)(OH) |
| P | ⓘ Phurcalite | Ca2(UO2)3(PO4)2O2 · 7H2O |
| P | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| P | ⓘ Rockbridgeite | Fe2+Fe43+(PO4)3(OH)5 |
| P | ⓘ Sabugalite | HAl(UO2)4(PO4)4 · 16H2O |
| P | ⓘ Saléeite | Mg(UO2)2(PO4)2 · 10H2O |
| P | ⓘ Strengite | FePO4 · 2H2O |
| P | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| P | ⓘ Variscite | AlPO4 · 2H2O |
| P | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| P | ⓘ Wavellite | Al3(PO4)2(OH,F)3 · 5H2O |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Aikinite | PbCuBiS3 |
| S | ⓘ Aluminite | Al2(SO4)(OH)4 · 7H2O |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Boulangerite | Pb5Sb4S11 |
| S | ⓘ Bournonite | PbCuSbS3 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Carbonatecyanotrichite | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| S | ⓘ Celestine | SrSO4 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcoalumite | CuAl4(SO4)(OH)12 · 3H2O |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| S | ⓘ Cobaltite | CoAsS |
| S | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| S | ⓘ Covellite | CuS |
| S | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| S | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| S | ⓘ Digenite | Cu9S5 |
| S | ⓘ Djurleite | Cu31S16 |
| S | ⓘ Emplectite | CuBiS2 |
| S | ⓘ Galena | PbS |
| S | ⓘ Galenobismutite | PbBi2S4 |
| S | ⓘ Gersdorffite | NiAsS |
| S | ⓘ Goslarite | ZnSO4 · 7H2O |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| S | ⓘ Ikunolite | Bi4S3 |
| S | ⓘ Jamesonite | Pb4FeSb6S14 |
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| S | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| S | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| S | ⓘ Linarite | PbCu(SO4)(OH)2 |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
| S | ⓘ Meneghinite | Pb13CuSb7S24 |
| S | ⓘ Millerite | NiS |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Natrojarosite | NaFe3(SO4)2(OH)6 |
| S | ⓘ Parkerite | Ni3(Bi,Pb)2S2 |
| S | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| S | ⓘ Pyrargyrite | Ag3SbS3 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| S | ⓘ Semseyite | Pb9Sb8S21 |
| S | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| S | ⓘ Sideronatrite | Na2Fe(SO4)2(OH) · 3H2O |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stannite | Cu2FeSnS4 |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Sulphur | S8 |
| S | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Ullmannite | NiSbS |
| S | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| S | ⓘ Wurtzite | (Zn,Fe)S |
| S | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| S | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| S | ⓘ Tetrahedrite Subgroup var. Silver-bearing Tetrahedrite | (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| S | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| Cl | Chlorine | |
| Cl | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Cl | ⓘ Atacamite | Cu2(OH)3Cl |
| Cl | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Cl | ⓘ Cotunnite | PbCl2 |
| Cl | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| Cl | ⓘ Marialite | Na4Al3Si9O24Cl |
| Cl | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Cl | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Cl | ⓘ Amphibole Supergroup var. Byssolite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ Ajoite | (K,Na)Cu7AlSi9O24(OH)6 · 3H2O |
| K | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Boltwoodite | (K,Na)(UO2)(SiO3OH) · 1.5H2O |
| K | ⓘ Carnotite | K2(UO2)2(VO4)2 · 3H2O |
| K | ⓘ Muscovite var. Gilbertite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Glauconite | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| K | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| K | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| K | ⓘ Leucite | K(AlSi2O6) |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| K | ⓘ Rhodizite | (K,Cs)Al4Be4(B,Be)12O28 |
| K | ⓘ Roscoelite | K(V3+,Al)2(AlSi3O10)(OH)2 |
| K | ⓘ Sanidine | K(AlSi3O8) |
| K | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Ca | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Andersonite | Na2Ca(UO2)(CO3)3 · 6H2O |
| Ca | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Anorthite | Ca(Al2Si2O8) |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| Ca | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Ca | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| Ca | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| Ca | ⓘ Becquerelite | Ca(UO2)6O4(OH)6 · 8H2O |
| Ca | ⓘ Brandtite | Ca2Mn2+(AsO4)2 · 2H2O |
| Ca | ⓘ Bustamite | CaMn2+(Si2O6) |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Fluorapatite var. Carbonate-rich Fluorapatite | Ca5(PO4,CO3)3(F,O) |
| Ca | ⓘ Danburite | CaB2Si2O8 |
| Ca | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Ca | ⓘ Diopside var. Diallage | CaMgSi2O6 |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Dufrénite | Ca0.5Fe2+Fe53+(PO4)4(OH)6 · 2H2O |
| Ca | ⓘ Datolite | CaB(SiO4)(OH) |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Ca | ⓘ Ferro-actinolite | ◻Ca2Fe52+(Si8O22)(OH)2 |
| Ca | ⓘ Fersmite | (Ca,Ce,Na)(Nb,Ta,Ti)2(O,OH,F)6 |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Ca | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Ca | ⓘ Herderite | CaBe(PO4)F |
| Ca | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Ca | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| Ca | ⓘ Johannsenite | CaMn2+Si2O6 |
| Ca | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Ca | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Ca | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| Ca | ⓘ Leucophanite | NaCaBeSi2O6F |
| Ca | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| Ca | ⓘ Malayaite | CaSn(SiO4)O |
| Ca | ⓘ Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| Ca | ⓘ Metatyuyamunite | Ca(UO2)2(VO4)2 · 3H2O |
| Ca | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| Ca | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Ca | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Pascoite | Ca2Ca(V10O28) · 17H2O |
| Ca | ⓘ Phurcalite | Ca2(UO2)3(PO4)2O2 · 7H2O |
| Ca | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Ca | ⓘ Priceite | Ca2B5O7(OH)5 · H2O |
| Ca | ⓘ Rauenthalite | Ca3(AsO4)2 · 10H2O |
| Ca | ⓘ Rauvite | Ca(UO2)2(V10O28) · 16H2O |
| Ca | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| Ca | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| Ca | ⓘ Talmessite | Ca2Mg(AsO4)2 · 2H2O |
| Ca | ⓘ Titanite | CaTi(SiO4)O |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| Ca | ⓘ Tyuyamunite | Ca(UO2)2(VO4)2 · 5-8H2O |
| Ca | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| Ca | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Ca | ⓘ Wollastonite | Ca3(Si3O9) |
| Ca | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| Ca | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Calcite var. Iron-bearing Calcite | (Ca,Fe)CO3 |
| Ca | ⓘ Augite var. Titanium-bearing Augite | (Ca,Na)(Mg,Ti, Fe,Al,)(Si,Al)2O6 |
| Ca | ⓘ Titanite var. Greenovite | CaTi(SiO4)O |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ti | Titanium | |
| Ti | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Brookite | TiO2 |
| Ti | ⓘ Fersmite | (Ca,Ce,Na)(Nb,Ta,Ti)2(O,OH,F)6 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTi(SiO4)O |
| Ti | ⓘ Amphibole Supergroup var. Byssolite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Ti | ⓘ Augite var. Titanium-bearing Augite | (Ca,Na)(Mg,Ti, Fe,Al,)(Si,Al)2O6 |
| Ti | ⓘ Titanite var. Greenovite | CaTi(SiO4)O |
| V | Vanadium | |
| V | ⓘ Carnotite | K2(UO2)2(VO4)2 · 3H2O |
| V | ⓘ Huemulite | Na4Mg(V10O28) · 24H2O |
| V | ⓘ Metatyuyamunite | Ca(UO2)2(VO4)2 · 3H2O |
| V | ⓘ Montroseite | (V3+,Fe3+)O(OH) |
| V | ⓘ Paramontroseite | V4+O2 |
| V | ⓘ Pascoite | Ca2Ca(V10O28) · 17H2O |
| V | ⓘ Rauvite | Ca(UO2)2(V10O28) · 16H2O |
| V | ⓘ Roscoelite | K(V3+,Al)2(AlSi3O10)(OH)2 |
| V | ⓘ Tyuyamunite | Ca(UO2)2(VO4)2 · 5-8H2O |
| V | ⓘ Vésigniéite | BaCu3(VO4)2(OH)2 |
| V | ⓘ Volborthite | Cu3(V2O7)(OH)2 · 2H2O |
| Mn | Manganese | |
| Mn | ⓘ Bementite | Mn7Si6O15(OH)8 |
| Mn | ⓘ Brandtite | Ca2Mn2+(AsO4)2 · 2H2O |
| Mn | ⓘ Bustamite | CaMn2+(Si2O6) |
| Mn | ⓘ Hausmannite | Mn2+Mn23+O4 |
| Mn | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| Mn | ⓘ Johannsenite | CaMn2+Si2O6 |
| Mn | ⓘ Manganosite | MnO |
| Mn | ⓘ Manganite | Mn3+O(OH) |
| Mn | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| Mn | ⓘ Tantalite-(Mn) | Mn2+Ta2O6 |
| Mn | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| Mn | ⓘ Pyrochroite | Mn(OH)2 |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Mn | ⓘ Rhodochrosite | MnCO3 |
| Mn | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Mn | ⓘ Tephroite | Mn22+SiO4 |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Fe | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Arfvedsonite | [Na][Na2][Fe42+Fe3+]Si8O22(OH)2 |
| Fe | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| Fe | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Fe | ⓘ Bassetite | Fe2+(UO2)2(PO4)2 · 10H2O |
| Fe | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| Fe | ⓘ Beraunite | Fe63+(PO4)4O(OH)4 · 6H2O |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| Fe | ⓘ Chalcosiderite | CuFe63+(PO4)4(OH)8 · 4H2O |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| Fe | ⓘ Childrenite | Fe2+Al(PO4)(OH)2 · H2O |
| Fe | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Fe | ⓘ Clinochlore var. Corundophilite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| Fe | ⓘ Dufrénite | Ca0.5Fe2+Fe53+(PO4)4(OH)6 · 2H2O |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Fe | ⓘ Ferberite | FeWO4 |
| Fe | ⓘ Ferro-actinolite | ◻Ca2Fe52+(Si8O22)(OH)2 |
| Fe | ⓘ Glauconite | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| Fe | ⓘ Goethite | α-Fe3+O(OH) |
| Fe | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Fe | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| Fe | ⓘ Jamesonite | Pb4FeSb6S14 |
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | ⓘ Lepidocrocite | γ-Fe3+O(OH) |
| Fe | ⓘ Löllingite | FeAs2 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
| Fe | ⓘ Metavivianite | Fe2+Fe23+(PO4)2(OH)2 · 6H2O |
| Fe | ⓘ Modderite | (Co,Fe)As |
| Fe | ⓘ Montroseite | (V3+,Fe3+)O(OH) |
| Fe | ⓘ Natrojarosite | NaFe3(SO4)2(OH)6 |
| Fe | ⓘ Nickelskutterudite | (Ni,Co,Fe)As3 |
| Fe | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Fe | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Rockbridgeite | Fe2+Fe43+(PO4)3(OH)5 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Sideronatrite | Na2Fe(SO4)2(OH) · 3H2O |
| Fe | ⓘ Stannite | Cu2FeSnS4 |
| Fe | ⓘ Strengite | FePO4 · 2H2O |
| Fe | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| Fe | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Fe | ⓘ Wurtzite | (Zn,Fe)S |
| Fe | ⓘ Hematite var. Specularite | Fe2O3 |
| Fe | ⓘ Hematite var. Kidney Ore | Fe2O3 |
| Fe | ⓘ Calcite var. Iron-bearing Calcite | (Ca,Fe)CO3 |
| Fe | ⓘ Tetrahedrite Subgroup var. Silver-bearing Tetrahedrite | (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| Fe | ⓘ Augite var. Titanium-bearing Augite | (Ca,Na)(Mg,Ti, Fe,Al,)(Si,Al)2O6 |
| Co | Cobalt | |
| Co | ⓘ Cobaltite | CoAsS |
| Co | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| Co | ⓘ Langisite | CoAs |
| Co | ⓘ Modderite | (Co,Fe)As |
| Co | ⓘ Nickelskutterudite | (Ni,Co,Fe)As3 |
| Co | ⓘ Penroseite | (Ni,Co,Cu)Se2 |
| Co | ⓘ Skutterudite | CoAs3 |
| Co | ⓘ Tyrrellite | Cu(Co3+,Ni3+)2Se4 |
| Ni | Nickel | |
| Ni | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| Ni | ⓘ Gersdorffite | NiAsS |
| Ni | ⓘ Maucherite | Ni11As8 |
| Ni | ⓘ Millerite | NiS |
| Ni | ⓘ Nickelskutterudite | (Ni,Co,Fe)As3 |
| Ni | ⓘ Nickeline | NiAs |
| Ni | ⓘ Pararammelsbergite | NiAs2 |
| Ni | ⓘ Parkerite | Ni3(Bi,Pb)2S2 |
| Ni | ⓘ Penroseite | (Ni,Co,Cu)Se2 |
| Ni | ⓘ Rammelsbergite | NiAs2 |
| Ni | ⓘ Trüstedtite | Ni3Se4 |
| Ni | ⓘ Tyrrellite | Cu(Co3+,Ni3+)2Se4 |
| Ni | ⓘ Ullmannite | NiSbS |
| Cu | Copper | |
| Cu | ⓘ Aikinite | PbCuBiS3 |
| Cu | ⓘ Ajoite | (K,Na)Cu7AlSi9O24(OH)6 · 3H2O |
| Cu | ⓘ Algodonite | (Cu1-xAsx) |
| Cu | ⓘ Atacamite | Cu2(OH)3Cl |
| Cu | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Bournonite | PbCuSbS3 |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Carbonatecyanotrichite | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| Cu | ⓘ Chalcosiderite | CuFe63+(PO4)4(OH)8 · 4H2O |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcoalumite | CuAl4(SO4)(OH)12 · 3H2O |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Cuprite var. Chalcotrichite | Cu2O |
| Cu | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Clinoclase | Cu3(AsO4)(OH)3 |
| Cu | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Cu | ⓘ Cornubite | Cu5(AsO4)2(OH)4 |
| Cu | ⓘ Cornwallite | Cu5(AsO4)2(OH)4 |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| Cu | ⓘ Copper | Cu |
| Cu | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Cu | ⓘ Digenite | Cu9S5 |
| Cu | ⓘ Djurleite | Cu31S16 |
| Cu | ⓘ Domeykite | Cu3As |
| Cu | ⓘ Emplectite | CuBiS2 |
| Cu | ⓘ Eucairite | AgCuSe |
| Cu | ⓘ Klockmannite | CuSe |
| Cu | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| Cu | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| Cu | ⓘ Libethenite | Cu2(PO4)(OH) |
| Cu | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Meneghinite | Pb13CuSb7S24 |
| Cu | ⓘ Olivenite | Cu2(AsO4)(OH) |
| Cu | ⓘ Paramelaconite | Cu21+Cu22+O3 |
| Cu | ⓘ Penroseite | (Ni,Co,Cu)Se2 |
| Cu | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| Cu | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| Cu | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| Cu | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| Cu | ⓘ Stannite | Cu2FeSnS4 |
| Cu | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Cu | ⓘ Tenorite | CuO |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| Cu | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| Cu | ⓘ Tyrrellite | Cu(Co3+,Ni3+)2Se4 |
| Cu | ⓘ Umangite | Cu3Se2 |
| Cu | ⓘ Vésigniéite | BaCu3(VO4)2(OH)2 |
| Cu | ⓘ Volborthite | Cu3(V2O7)(OH)2 · 2H2O |
| Cu | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| Cu | ⓘ Tetrahedrite Subgroup var. Silver-bearing Tetrahedrite | (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| Zn | Zinc | |
| Zn | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Zn | ⓘ Goslarite | ZnSO4 · 7H2O |
| Zn | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Zn | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| Zn | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| Zn | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| Zn | ⓘ Smithsonite | ZnCO3 |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Wurtzite | (Zn,Fe)S |
| Zn | ⓘ Tetrahedrite Subgroup var. Silver-bearing Tetrahedrite | (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| As | Arsenic | |
| As | ⓘ Algodonite | (Cu1-xAsx) |
| As | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| As | ⓘ Arsenolite | As2O3 |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Arsenic | As |
| As | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| As | ⓘ Brandtite | Ca2Mn2+(AsO4)2 · 2H2O |
| As | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| As | ⓘ Clinoclase | Cu3(AsO4)(OH)3 |
| As | ⓘ Cobaltite | CoAsS |
| As | ⓘ Cornubite | Cu5(AsO4)2(OH)4 |
| As | ⓘ Cornwallite | Cu5(AsO4)2(OH)4 |
| As | ⓘ Domeykite | Cu3As |
| As | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| As | ⓘ Gersdorffite | NiAsS |
| As | ⓘ Isomertieite | Pd11Sb2As2 |
| As | ⓘ Langisite | CoAs |
| As | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| As | ⓘ Löllingite | FeAs2 |
| As | ⓘ Maucherite | Ni11As8 |
| As | ⓘ Mertieite | Pd8Sb2.5As0.5 |
| As | ⓘ Mimetite | Pb5(AsO4)3Cl |
| As | ⓘ Modderite | (Co,Fe)As |
| As | ⓘ Nickelskutterudite | (Ni,Co,Fe)As3 |
| As | ⓘ Nickeline | NiAs |
| As | ⓘ Olivenite | Cu2(AsO4)(OH) |
| As | ⓘ Pararammelsbergite | NiAs2 |
| As | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| As | ⓘ Rammelsbergite | NiAs2 |
| As | ⓘ Rauenthalite | Ca3(AsO4)2 · 10H2O |
| As | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| As | ⓘ Skutterudite | CoAs3 |
| As | ⓘ Talmessite | Ca2Mg(AsO4)2 · 2H2O |
| As | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| As | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| Se | Selenium | |
| Se | ⓘ Chrisstanleyite | Ag2Pd3Se4 |
| Se | ⓘ Clausthalite | PbSe |
| Se | ⓘ Eucairite | AgCuSe |
| Se | ⓘ Fischesserite | Ag3AuSe2 |
| Se | ⓘ Klockmannite | CuSe |
| Se | ⓘ Molybdomenite | PbSeO3 |
| Se | ⓘ Naumannite | Ag2Se |
| Se | ⓘ Penroseite | (Ni,Co,Cu)Se2 |
| Se | ⓘ Tiemannite | HgSe |
| Se | ⓘ Trüstedtite | Ni3Se4 |
| Se | ⓘ Tyrrellite | Cu(Co3+,Ni3+)2Se4 |
| Se | ⓘ Umangite | Cu3Se2 |
| Se | ⓘ Verbeekite | PdSe2 |
| Se | ⓘ Tilkerodeite | Pd2HgSe3 |
| Sr | Strontium | |
| Sr | ⓘ Celestine | SrSO4 |
| Sr | ⓘ Strontianite | SrCO3 |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | ⓘ Fersmite | (Ca,Ce,Na)(Nb,Ta,Ti)2(O,OH,F)6 |
| Nb | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| Nb | ⓘ Pyrochlore Group | A2Nb2(O,OH)6Z |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Pd | Palladium | |
| Pd | ⓘ Chrisstanleyite | Ag2Pd3Se4 |
| Pd | ⓘ Isomertieite | Pd11Sb2As2 |
| Pd | ⓘ Mertieite | Pd8Sb2.5As0.5 |
| Pd | ⓘ Gold var. Palladium-bearing Gold | (Au,Pd) |
| Pd | ⓘ Verbeekite | PdSe2 |
| Pd | ⓘ Tilkerodeite | Pd2HgSe3 |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
| Ag | ⓘ Chrisstanleyite | Ag2Pd3Se4 |
| Ag | ⓘ Eucairite | AgCuSe |
| Ag | ⓘ Fischesserite | Ag3AuSe2 |
| Ag | ⓘ Naumannite | Ag2Se |
| Ag | ⓘ Pyrargyrite | Ag3SbS3 |
| Ag | ⓘ Silver | Ag |
| Ag | ⓘ Tetrahedrite Subgroup var. Silver-bearing Tetrahedrite | (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| Ag | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sn | ⓘ Malayaite | CaSn(SiO4)O |
| Sn | ⓘ Stannite | Cu2FeSnS4 |
| Sn | ⓘ Cassiterite var. Wood Tin | SnO2 |
| Sb | Antimony | |
| Sb | ⓘ Antimony | Sb |
| Sb | ⓘ Bindheimite | Pb2Sb2O6O |
| Sb | ⓘ Boulangerite | Pb5Sb4S11 |
| Sb | ⓘ Bournonite | PbCuSbS3 |
| Sb | ⓘ Isomertieite | Pd11Sb2As2 |
| Sb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Sb | ⓘ Meneghinite | Pb13CuSb7S24 |
| Sb | ⓘ Mertieite | Pd8Sb2.5As0.5 |
| Sb | ⓘ Pyrargyrite | Ag3SbS3 |
| Sb | ⓘ Semseyite | Pb9Sb8S21 |
| Sb | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| Sb | ⓘ Stibnite | Sb2S3 |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Sb | ⓘ Ullmannite | NiSbS |
| Sb | ⓘ Tetrahedrite Subgroup var. Silver-bearing Tetrahedrite | (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| Cs | Caesium | |
| Cs | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| Cs | ⓘ Rhodizite | (K,Cs)Al4Be4(B,Be)12O28 |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Vésigniéite | BaCu3(VO4)2(OH)2 |
| Ba | ⓘ Witherite | BaCO3 |
| Ce | Cerium | |
| Ce | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ce | ⓘ Fersmite | (Ca,Ce,Na)(Nb,Ta,Ti)2(O,OH,F)6 |
| Ce | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| Ta | Tantalum | |
| Ta | ⓘ Fersmite | (Ca,Ce,Na)(Nb,Ta,Ti)2(O,OH,F)6 |
| Ta | ⓘ Tantalite-(Mn) | Mn2+Ta2O6 |
| Ta | ⓘ Microlite Group | A2-mTa2X6-wZ-n |
| W | Tungsten | |
| W | ⓘ Alumotungstite | ◻2W2O6(H2O) |
| W | ⓘ Ferberite | FeWO4 |
| W | ⓘ Russellite | Bi2WO6 |
| W | ⓘ Scheelite | Ca(WO4) |
| W | ⓘ Hydrokenoelsmoreite | ◻2W2O6(H2O) |
| Au | Gold | |
| Au | ⓘ Fischesserite | Ag3AuSe2 |
| Au | ⓘ Gold | Au |
| Au | ⓘ Gold var. Palladium-bearing Gold | (Au,Pd) |
| Hg | Mercury | |
| Hg | ⓘ Tiemannite | HgSe |
| Hg | ⓘ Tilkerodeite | Pd2HgSe3 |
| Pb | Lead | |
| Pb | ⓘ Aikinite | PbCuBiS3 |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| Pb | ⓘ Bindheimite | Pb2Sb2O6O |
| Pb | ⓘ Boulangerite | Pb5Sb4S11 |
| Pb | ⓘ Bournonite | PbCuSbS3 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Clausthalite | PbSe |
| Pb | ⓘ Cotunnite | PbCl2 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Galenobismutite | PbBi2S4 |
| Pb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Pb | ⓘ Lead | Pb |
| Pb | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| Pb | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Pb | ⓘ Meneghinite | Pb13CuSb7S24 |
| Pb | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Pb | ⓘ Molybdomenite | PbSeO3 |
| Pb | ⓘ Parkerite | Ni3(Bi,Pb)2S2 |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Pb | ⓘ Semseyite | Pb9Sb8S21 |
| Pb | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| Bi | Bismuth | |
| Bi | ⓘ Aikinite | PbCuBiS3 |
| Bi | ⓘ Bismite | Bi2O3 |
| Bi | ⓘ Bismuth | Bi |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Bismutite | (BiO)2CO3 |
| Bi | ⓘ Emplectite | CuBiS2 |
| Bi | ⓘ Galenobismutite | PbBi2S4 |
| Bi | ⓘ Ikunolite | Bi4S3 |
| Bi | ⓘ Parkerite | Ni3(Bi,Pb)2S2 |
| Bi | ⓘ Russellite | Bi2WO6 |
| U | Uranium | |
| U | ⓘ Andersonite | Na2Ca(UO2)(CO3)3 · 6H2O |
| U | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| U | ⓘ Bassetite | Fe2+(UO2)2(PO4)2 · 10H2O |
| U | ⓘ Becquerelite | Ca(UO2)6O4(OH)6 · 8H2O |
| U | ⓘ Boltwoodite | (K,Na)(UO2)(SiO3OH) · 1.5H2O |
| U | ⓘ Carnotite | K2(UO2)2(VO4)2 · 3H2O |
| U | ⓘ Coffinite | U(SiO4) · nH2O |
| U | ⓘ Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| U | ⓘ Metatyuyamunite | Ca(UO2)2(VO4)2 · 3H2O |
| U | ⓘ Phurcalite | Ca2(UO2)3(PO4)2O2 · 7H2O |
| U | ⓘ Uraninite var. Pitchblende | UO2 |
| U | ⓘ Rauvite | Ca(UO2)2(V10O28) · 16H2O |
| U | ⓘ Sabugalite | HAl(UO2)4(PO4)4 · 16H2O |
| U | ⓘ Saléeite | Mg(UO2)2(PO4)2 · 10H2O |
| U | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| U | ⓘ Tyuyamunite | Ca(UO2)2(VO4)2 · 5-8H2O |
| U | ⓘ Uraninite | UO2 |
| U | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| U | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| U | ⓘ Uraninite var. Sooty Uraninite | UO2 |
Geochronology
Mineralization age: Phanerozoic : 341 Ma to 58.7 ± 1.6 MaImportant note: This table is based only on rock and mineral ages recorded on mindat.org for this locality and is not necessarily a complete representation of the geochronology, but does give an indication of possible mineralization events relevant to this locality. As more age information is added this table may expand in the future. A break in the table simply indicates a lack of data entered here, not necessarily a break in the geologic sequence. Grey background entries are from different, related, localities.
Fossils
There are 81 fossil localities from the PaleoBioDB database within this region.BETA TEST - These data are provided on an experimental basis and are taken from external databases. Mindat.org has no control currently over the accuracy of these data.
| Occurrences | 1012 |
|---|---|
| Youngest Fossil Listed | 0.01 Ma (Pleistocene) |
| Oldest Fossil Listed | 443 Ma (Silurian) |
| Stratigraphic Units | Click here to view 33 stratigraphic units. |
| Fossils from Region | Click here to show the list. |
| Fossil Localities | Click to show 81 fossil localities |
- England
- Devon
- East Devon
- Triassic🐚 Archosaur specimen
- Mesozoic🐚 Axminster bone bed
- Mesozoic🐚 Axmouth bone bed
- Late/Upper Cretaceous🐚 Beer Freestone Quarry
- Late/Upper Cretaceous🐚 Beer Head
- Late/Upper Cretaceous🐚 BeerHead Decapod
- Late/Upper Cretaceous🐚 Branscombe Coastguard station cliff
- Late/Upper Cretaceous🐚 Branscombe or Berry Cliffs
- Late/Upper Cretaceous🐚 Chardstock
- Late/Upper Cretaceous🐚 Chardstock
- Cretaceous🐚 Cowstones Layer
- Triassic🐚 Fodonyx
- Triassic🐚 Fodonyx specimens
- Triassic🐚 Fodonyx/archosaur specimens
- Triassic🐚 Green Point
- Triassic🐚 High Peak
- Late/Upper Cretaceous🐚 Holywell Nodular Chalk-Beer Roads
- Late/Upper Cretaceous🐚 Holywell Nodular Chalk-Hooken Cliff
- Late/Upper Cretaceous🐚 Holywell Nodular Chalk-Shapwick Grange Quarry
- Pleistocene🐚 Honiton
- Late/Upper Cretaceous🐚 Hooken Cliff
- Triassic🐚 Lade Foot
- Late/Upper Cretaceous🐚 New Pit Chalk-Lynch Cottage
- Triassic🐚 Otter Sst Formation
- Triassic🐚 Otterton Point
- Early Jurassic🐚 Pathologic Plesiosaur Site
- Triassic🐚 Pennington Point
- Triassic🐚 Picket Rock Cove
- Early Jurassic🐚 Pinhay Bay
- Mesozoic🐚 Pinhay Cliff
- Triassic🐚 Sandy Cove
- Late/Upper Cretaceous🐚 Seaton to Hooken beach
- East Devon
- Devon
- England
- Devon
- East Devon
- Mid Devon
- North Devon
- South Hams
- Teignbridge
- West Devon
- Devon
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Devon |
|---|---|
| Wikidata ID: | Q23156 |
| GeoNames ID: | 2651292 |
Localities in this Region
- England
- Devon
- England
- Devon
- Teignbridge
- ⭔Torbay
- ⭔Torridge
- ⭔West Devon
- ⭔Beaworthy
- Belstone
- Bere Ferrers
- ⭔Bondleigh
- ⭔Bradstone
- ⭔Bratton Clovelly
- Brentor
- Bridestowe
- ⭔Bridestowe and Sourton Common
- ⭔Broadwoodkelly
- Buckland Monachorum
- Chagford
- ⭔Coryton
- Dartmoor Forest
- Drewsteignton
- ⭔Dunterton
- ⭔Exbourne
- ⭔Germansweek
- Gidleigh
- Gulworthy
- ⭔Hatherleigh
- ⭔Highampton
- Horrabridge
- ⭔Iddesleigh
- ⭔Inwardleigh
- ⭔Jacobstowe
- ⭔Kelly
- Lamerton
- ⭔Lewtrenchard
- Lifton
- Lydford
- Mary Tavy
- Marystow
- ⭔Meavy
- Meeth
- Milton Abbot
- ⭔Monkokehampton
- North Tawton
- ⭔Northlew
- ⭔Okehampton
- Okehampton Hamlets
- Peter Tavy
- ⭔Sampford Courtenay
- Sampford Spiney
- Sheepstor
- Sourton
- South Tawton
- Spreyton
- ⭔Sticklepath
- ⭔Stowford
- Sydenham Damerel
- Tavistock
- ⭔Throwleigh
- ⭔Thrushelton
- Walkhampton
- Whitchurch
- Devon
Other Regions, Features and Areas that Intersect
British and Irish IslesGroup of Islands
Eurasian PlateTectonic Plate
UK
- England
- Callington and Tavistock Mining DistrictMining District
- Devon
- DartmoorNational Park
- Dartmouth and Teign Valley Mining DistrictMining District
- England
- Devon
- Exmoor National ParkNational Park
- Okehampton Mining DistrictMining District
- Teignbridge
- Newton AbbotTown
- Devon and Cornwall metalliferous mining districtMining District
- Jurassic Coast World Heritage SiteWorld Heritage Site (UNESCO)
- South-East England Sedimentary AreaGeologic Region
- Devon
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Quick NavTopCommoditiesMineral ListRock TypesGeochronologyFossilsOther DatabasesLocalities in RegionOther RegionsReferences
Devon, England, UK