Sörhällan quarry, Råneå, Luleå, Norrbotten County, Swedeni
| Regional Level Types | |
|---|---|
| Sörhällan quarry | Quarry |
| Råneå | Village |
| Luleå | Municipality |
| Norrbotten County | County |
| Sweden | Country |
Sörhällan quarry, Råneå, Norrbotten Province, Sweden
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
65° 48' 37'' North , 22° 17' 44'' East
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Mindat Locality ID:
158988
Long-form identifier:
mindat:1:2:158988:0
GUID (UUID V4):
ef95db10-ce29-451e-b8b8-46c32c1c2272
Name(s) in local language(s):
Sörhällan, Råneå, Norrbotten, Sverige
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 References: |
| ⓘ Beryl Formula: Be3Al2(Si6O18) References: |
| ⓘ Columbite-(Fe) Formula: Fe2+Nb2O6 References: |
| ⓘ Fergusonite-(Y) Formula: YNbO4 References: |
| ⓘ Huttonite Formula: ThSiO4 References: |
| ⓘ Huttonite var. Cerphosphorhuttonite Formula: (Ce,LREE)Th[PO4]SiO4 References: |
| ⓘ Liandratite Formula: U(Nb,Ta)2O8 References: |
| ⓘ Microcline Formula: K(AlSi3O8) References: |
| ⓘ Monazite-(Ce) Formula: Ce(PO4) References: |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 References: |
| ⓘ Quartz Formula: SiO2 References: |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) References: |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 4 - Oxides and Hydroxides | |||
|---|---|---|---|
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Columbite-(Fe) | 4.DB.35 | Fe2+Nb2O6 |
| ⓘ | Liandratite | 4.DH.35 | U(Nb,Ta)2O8 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Fergusonite-(Y) | 7.GA.05 | YNbO4 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| Group 9 - Silicates | |||
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Huttonite | 9.AD.35 | ThSiO4 |
| ⓘ | var. Cerphosphorhuttonite | 9.AD.35 | (Ce,LREE)Th[PO4]SiO4 |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | Oxygen | |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Fergusonite-(Y) | YNbO4 |
| O | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| O | ⓘ Huttonite | ThSiO4 |
| O | ⓘ Liandratite | U(Nb,Ta)2O8 |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Monazite-(Ce) | Ce(PO4) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Huttonite var. Cerphosphorhuttonite | (Ce,LREE)Th[PO4]SiO4 |
| Na | Sodium | |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | Aluminium | |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | Silicon | |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Huttonite | ThSiO4 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Huttonite var. Cerphosphorhuttonite | (Ce,LREE)Th[PO4]SiO4 |
| P | Phosphorus | |
| P | ⓘ Monazite-(Ce) | Ce(PO4) |
| P | ⓘ Huttonite var. Cerphosphorhuttonite | (Ce,LREE)Th[PO4]SiO4 |
| K | Potassium | |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Fe | Iron | |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Y | Yttrium | |
| Y | ⓘ Fergusonite-(Y) | YNbO4 |
| Nb | Niobium | |
| Nb | ⓘ Fergusonite-(Y) | YNbO4 |
| Nb | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| Nb | ⓘ Liandratite | U(Nb,Ta)2O8 |
| Ce | Cerium | |
| Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
| Ce | ⓘ Huttonite var. Cerphosphorhuttonite | (Ce,LREE)Th[PO4]SiO4 |
| Ta | Tantalum | |
| Ta | ⓘ Liandratite | U(Nb,Ta)2O8 |
| Th | Thorium | |
| Th | ⓘ Huttonite | ThSiO4 |
| Th | ⓘ Huttonite var. Cerphosphorhuttonite | (Ce,LREE)Th[PO4]SiO4 |
| U | Uranium | |
| U | ⓘ Liandratite | U(Nb,Ta)2O8 |
Other Regions, Features and Areas containing this locality
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
