Montbrison, Loire, Auvergne-Rhône-Alpes, Francei
| Regional Level Types | |
|---|---|
| Montbrison | Arrondissement |
| Loire | Department |
| Auvergne-Rhône-Alpes | Region |
| France | Country |
This page is currently not sponsored. Click here to sponsor this page.
Neighbouring regions:
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Montbrison | 16,164 (2016) |
| Saint-Just-Saint-Rambert | 14,313 (2016) |
| Veauche | 8,189 (2016) |
| Feurs | 7,901 (2016) |
| Saint-Galmier | 5,485 (2016) |
| Sury-le-Comtal | 5,046 (2016) |
Mindat Locality ID:
144380
Long-form identifier:
mindat:1:2:144380:9
GUID (UUID V4):
3d7bf0ef-6ab3-41e1-9ded-14ef952dcb29
Other/historical names associated with this locality:
Rhône-Alpes
Other Languages:
French:
arrondissement de Montbrison, Loire, Auvergne-Rhône-Alpes, France
German:
Arrondissement Montbrison, Département Loire, Auvergne-Rhône-Alpes, Frankreich
Italian:
arrondissement di Montbrison, Loira, Alvernia-Rodano-Alpi, Francia
Russian:
Монбризон, Луара, Овернь — Рона — Альпы, Франция
Simplified Chinese:
蒙布里松区, 卢瓦尔省, 奥弗涅-罗讷-阿尔卑斯大区, 法国
Spanish:
Distrito de Montbrison, Loira, Región de Auvernia-Ródano-Alpes, Francia
Albanian:
Qarku Montbrison, Loire, Auvernia-Rhône-Alpes, Franca
Aragonese:
Destrito de Montbrison, Loira, Auvernia-Roine-Alpes, Francia
Azeri:
Monbrizon , Luara , Overn-Rona-Alp, Fransa
Basque:
Montbrisoneko barrutia, Loire, Auvernia-Rhône-Alpeak, Frantzia
Bavarian:
Arrondissement Montbrison, Auvergne-Rhône-Alpes, Frankreich
Breton:
arondisamant Montbrison, Liger, Auvergne-Rhône-Alpes, Bro-C'hall
Catalan:
Districte de Montbrison, Loira, Alvèrnia-Roine-Alps, França
Cebuano:
Arrondissement de Montbrison, Loire, Auvergne-Rhône-Alpes, Pransiya
Czech:
Arrondissement Montbrison, Loire, Auvergne-Rhône-Alpes, Francie
Dutch:
Arrondissement Montbrison, Loire, Auvergne-Rhône-Alpes, Frankrijk
Esperanto:
Arondismento Montbrison, Loire, Aŭvernjo-Rodano-Alpoj, Francio
Farsi/Persian:
بخش مونتبریزون, لوآر, اوورنی-رون-آلپ, فرانسه
Greek:
Διαμέρισμα του Μονμπριζόν, Λουάρ, Ωβέρνη-Ρον-Αλπ, Γαλλία
Luxembourgish:
Arrondissement Montbrison, Departement Loire, Auvergne-Rhône-Alpes, Frankräich
Minnan / Hokkien-Taiwanese:
Montbrison Kūn, Loire, Auvergne-Rhône-Alpes, Hoat-kok
Occitan:
Arrondiment de Montbrison, Léger, Auvèrnhe Ròse Aups, França
Polish:
Okręg Montbrison, Loara, Owernia-Rodan-Alpy, Francja
Romanian:
Arondismentul Montbrison, Loire, Auverge-Ron-Alpi, Franța
Slovak:
Montbrison, Loire, Auvergne-Rhône-Alpes, Francúzsko
Vietnamese:
Montbrison, Loire, Auvergne-Rhône-Alpes, Pháp
The arrondissement of Montbrison is located in the Loire department in the Auvergne-Rhône-Alpes region of France. It has 135 communes. Its area is 1,943.2 km² (750.3 sq mi).
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities53 valid minerals. 2 (TL) - type locality of valid minerals. 1 erroneous literature entry.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Sulphur | 1.CC.05 | S8 |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Stibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Berthierite | 2.HA.20 | FeSb2S4 |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | α-Fe3+O(OH) |
| ⓘ | Magnetite var. Titanium-bearing Magnetite | 4.BB.05 | Fe2+(Fe3+,Ti)2O4 |
| ⓘ | Spinel | 4.BB.05 | MgAl2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Corundum | 4.CB.05 | Al2O3 |
| ⓘ | var. Sapphire | 4.CB.05 | Al2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Perovskite | 4.CC.30 | CaTiO3 |
| ⓘ | Quartz var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Amethyst | 4.DA.05 | SiO2 |
| ⓘ | var. Ferruginous Quartz | 4.DA.05 | SiO2 |
| ⓘ | Opal | 4.DA.10 | SiO2 · nH2O |
| ⓘ | var. Opal-AN | 4.DA.10 | SiO2 · nH2O |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | var. Manganese-bearing Calcite | 5.AB.05 | (Ca,Mn)CO3 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| Group 9 - Silicates | |||
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Sillimanite | 9.AF.05 | Al2(SiO4)O |
| ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | Staurolite | 9.AF.30 | Fe2+2Al9Si4O23(OH) |
| ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Cordierite | 9.CJ.10 | (Mg,Fe)2Al3(AlSi5O18) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Diopside var. Ti Salite | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Augite | 9.DA.15 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Nontronite | 9.EC.40 | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| ⓘ | Montmorillonite | 9.EC.40 | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ | Nepheline | 9.FA.05 | Na3K(Al4Si4O16) |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Anorthite | 9.FA.35 | Ca(Al2Si2O8) |
| ⓘ | Albite var. Anorthoclase | 9.FA.35 | (Na,K)AlSi3O8 |
| ⓘ | var. Oligoclase | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ | Haüyne | 9.FB.10 | Na3Ca(Si3Al3)O12(SO4) |
| ⓘ | Mesolite ? | 9.GA.05 | Na2Ca2Si9Al6O30 · 8H2O |
| ⓘ | Natrolite | 9.GA.05 | Na2Al2Si3O10 · 2H2O |
| ⓘ | Analcime | 9.GB.05 | Na(AlSi2O6) · H2O |
| ⓘ | Gismondine-Ca | 9.GC.05 | CaAl2Si2O8 · 4H2O |
| ⓘ | Mazzite-Mg (TL) | 9.GC.20 | (Mg,K,Ca)5(Si26Al10)O72 · 28H2O |
| ⓘ | Chabazite-Na | 9.GD.10 | (Na2,K2,Ca,Sr,Mg)2[Al2Si4O12]2 · 12H2O |
| ⓘ | Offretite (TL) | 9.GD.25 | KCaMg(Si13Al5)O36 · 15H2O |
| Unclassified | |||
| ⓘ | 'Phillipsite Subgroup' | - | |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Pyroxene Group' | - | ADSi2O6 |
| ⓘ | 'Glass' | - | |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'Alkali Feldspar' | - | |
| ⓘ | 'Thomsonite Subgroup' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| ⓘ | 'Melilite Group' | - | Ca2M(XSiO7) |
| ⓘ | 'Pinite' | - | |
| ⓘ | 'Leucoxene' | - | |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| ⓘ | 'Fayalite-Forsterite Series' | - | |
| ⓘ | 'Clinopyroxene Subgroup' | - | |
| ⓘ | 'Mica Group' | - | |
| ⓘ | 'Amphibole Supergroup' | - | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chabazite' | - | |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Erionite Subgroup' | - | M2[Al4Si14O36] · 15H2O |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Monazite' | - | REE(PO4) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| H | ⓘ Analcime | Na(AlSi2O6) · H2O |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Erionite Subgroup | M2[Al4Si14O36] · 15H2O |
| H | ⓘ Gismondine-Ca | CaAl2Si2O8 · 4H2O |
| H | ⓘ Goethite | α-Fe3+O(OH) |
| H | ⓘ Opal var. Opal-AN | SiO2 · nH2O |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Mazzite-Mg | (Mg,K,Ca)5(Si26Al10)O72 · 28H2O |
| H | ⓘ Mesolite | Na2Ca2Si9Al6O30 · 8H2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| H | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| H | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| H | ⓘ Offretite | KCaMg(Si13Al5)O36 · 15H2O |
| H | ⓘ Opal | SiO2 · nH2O |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| H | ⓘ Chabazite-Na | (Na2,K2,Ca,Sr,Mg)2[Al2Si4O12]2 · 12H2O |
| H | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Siderite | FeCO3 |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Quartz var. Amethyst | SiO2 |
| O | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| O | ⓘ Analcime | Na(AlSi2O6) · H2O |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Andalusite | Al2(SiO4)O |
| O | ⓘ Anorthite | Ca(Al2Si2O8) |
| O | ⓘ Albite var. Anorthoclase | (Na,K)AlSi3O8 |
| O | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| O | ⓘ Corundum | Al2O3 |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Erionite Subgroup | M2[Al4Si14O36] · 15H2O |
| O | ⓘ Gismondine-Ca | CaAl2Si2O8 · 4H2O |
| O | ⓘ Goethite | α-Fe3+O(OH) |
| O | ⓘ Haüyne | Na3Ca(Si3Al3)O12(SO4) |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Opal var. Opal-AN | SiO2 · nH2O |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Mazzite-Mg | (Mg,K,Ca)5(Si26Al10)O72 · 28H2O |
| O | ⓘ Mesolite | Na2Ca2Si9Al6O30 · 8H2O |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Monazite | REE(PO4) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| O | ⓘ Nepheline | Na3K(Al4Si4O16) |
| O | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| O | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| O | ⓘ Offretite | KCaMg(Si13Al5)O36 · 15H2O |
| O | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Opal | SiO2 · nH2O |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Perovskite | CaTiO3 |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Corundum var. Sapphire | Al2O3 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Sillimanite | Al2(SiO4)O |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Spinel | MgAl2O4 |
| O | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| O | ⓘ Titanite | CaTi(SiO4)O |
| O | ⓘ Magnetite var. Titanium-bearing Magnetite | Fe2+(Fe3+,Ti)2O4 |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Chabazite-Na | (Na2,K2,Ca,Sr,Mg)2[Al2Si4O12]2 · 12H2O |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Pyroxene Group | ADSi2O6 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Quartz var. Ferruginous Quartz | SiO2 |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| O | ⓘ Melilite Group | Ca2M(XSiO7) |
| F | Fluorine | |
| F | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Analcime | Na(AlSi2O6) · H2O |
| Na | ⓘ Albite var. Anorthoclase | (Na,K)AlSi3O8 |
| Na | ⓘ Haüyne | Na3Ca(Si3Al3)O12(SO4) |
| Na | ⓘ Mesolite | Na2Ca2Si9Al6O30 · 8H2O |
| Na | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Na | ⓘ Nepheline | Na3K(Al4Si4O16) |
| Na | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Na | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Na | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Chabazite-Na | (Na2,K2,Ca,Sr,Mg)2[Al2Si4O12]2 · 12H2O |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Mazzite-Mg | (Mg,K,Ca)5(Si26Al10)O72 · 28H2O |
| Mg | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Mg | ⓘ Offretite | KCaMg(Si13Al5)O36 · 15H2O |
| Mg | ⓘ Spinel | MgAl2O4 |
| Mg | ⓘ Chabazite-Na | (Na2,K2,Ca,Sr,Mg)2[Al2Si4O12]2 · 12H2O |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Al | ⓘ Analcime | Na(AlSi2O6) · H2O |
| Al | ⓘ Andalusite | Al2(SiO4)O |
| Al | ⓘ Anorthite | Ca(Al2Si2O8) |
| Al | ⓘ Albite var. Anorthoclase | (Na,K)AlSi3O8 |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Al | ⓘ Corundum | Al2O3 |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Erionite Subgroup | M2[Al4Si14O36] · 15H2O |
| Al | ⓘ Gismondine-Ca | CaAl2Si2O8 · 4H2O |
| Al | ⓘ Haüyne | Na3Ca(Si3Al3)O12(SO4) |
| Al | ⓘ Mazzite-Mg | (Mg,K,Ca)5(Si26Al10)O72 · 28H2O |
| Al | ⓘ Mesolite | Na2Ca2Si9Al6O30 · 8H2O |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Al | ⓘ Nepheline | Na3K(Al4Si4O16) |
| Al | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Al | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Al | ⓘ Offretite | KCaMg(Si13Al5)O36 · 15H2O |
| Al | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Corundum var. Sapphire | Al2O3 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Sillimanite | Al2(SiO4)O |
| Al | ⓘ Spinel | MgAl2O4 |
| Al | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Al | ⓘ Chabazite-Na | (Na2,K2,Ca,Sr,Mg)2[Al2Si4O12]2 · 12H2O |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Quartz var. Amethyst | SiO2 |
| Si | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Si | ⓘ Analcime | Na(AlSi2O6) · H2O |
| Si | ⓘ Andalusite | Al2(SiO4)O |
| Si | ⓘ Anorthite | Ca(Al2Si2O8) |
| Si | ⓘ Albite var. Anorthoclase | (Na,K)AlSi3O8 |
| Si | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Erionite Subgroup | M2[Al4Si14O36] · 15H2O |
| Si | ⓘ Gismondine-Ca | CaAl2Si2O8 · 4H2O |
| Si | ⓘ Haüyne | Na3Ca(Si3Al3)O12(SO4) |
| Si | ⓘ Opal var. Opal-AN | SiO2 · nH2O |
| Si | ⓘ Mazzite-Mg | (Mg,K,Ca)5(Si26Al10)O72 · 28H2O |
| Si | ⓘ Mesolite | Na2Ca2Si9Al6O30 · 8H2O |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Si | ⓘ Nepheline | Na3K(Al4Si4O16) |
| Si | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Si | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Si | ⓘ Offretite | KCaMg(Si13Al5)O36 · 15H2O |
| Si | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Opal | SiO2 · nH2O |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Sillimanite | Al2(SiO4)O |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Si | ⓘ Titanite | CaTi(SiO4)O |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Chabazite-Na | (Na2,K2,Ca,Sr,Mg)2[Al2Si4O12]2 · 12H2O |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Pyroxene Group | ADSi2O6 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Quartz var. Ferruginous Quartz | SiO2 |
| Si | ⓘ Melilite Group | Ca2M(XSiO7) |
| P | Phosphorus | |
| P | ⓘ Monazite | REE(PO4) |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Berthierite | FeSb2S4 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Galena | PbS |
| S | ⓘ Haüyne | Na3Ca(Si3Al3)O12(SO4) |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Sulphur | S8 |
| Cl | Chlorine | |
| Cl | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Cl | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ Albite var. Anorthoclase | (Na,K)AlSi3O8 |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Mazzite-Mg | (Mg,K,Ca)5(Si26Al10)O72 · 28H2O |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Nepheline | Na3K(Al4Si4O16) |
| K | ⓘ Offretite | KCaMg(Si13Al5)O36 · 15H2O |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Chabazite-Na | (Na2,K2,Ca,Sr,Mg)2[Al2Si4O12]2 · 12H2O |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Anorthite | Ca(Al2Si2O8) |
| Ca | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Gismondine-Ca | CaAl2Si2O8 · 4H2O |
| Ca | ⓘ Haüyne | Na3Ca(Si3Al3)O12(SO4) |
| Ca | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| Ca | ⓘ Mazzite-Mg | (Mg,K,Ca)5(Si26Al10)O72 · 28H2O |
| Ca | ⓘ Mesolite | Na2Ca2Si9Al6O30 · 8H2O |
| Ca | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Ca | ⓘ Offretite | KCaMg(Si13Al5)O36 · 15H2O |
| Ca | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Perovskite | CaTiO3 |
| Ca | ⓘ Titanite | CaTi(SiO4)O |
| Ca | ⓘ Chabazite-Na | (Na2,K2,Ca,Sr,Mg)2[Al2Si4O12]2 · 12H2O |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ca | ⓘ Melilite Group | Ca2M(XSiO7) |
| Ti | Titanium | |
| Ti | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Perovskite | CaTiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTi(SiO4)O |
| Ti | ⓘ Magnetite var. Titanium-bearing Magnetite | Fe2+(Fe3+,Ti)2O4 |
| Mn | Manganese | |
| Mn | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Berthierite | FeSb2S4 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Goethite | α-Fe3+O(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Fe | ⓘ Magnetite var. Titanium-bearing Magnetite | Fe2+(Fe3+,Ti)2O4 |
| Cu | Copper | |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Sr | Strontium | |
| Sr | ⓘ Chabazite-Na | (Na2,K2,Ca,Sr,Mg)2[Al2Si4O12]2 · 12H2O |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Sb | Antimony | |
| Sb | ⓘ Berthierite | FeSb2S4 |
| Sb | ⓘ Stibnite | Sb2S3 |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Pb | Lead | |
| Pb | ⓘ Galena | PbS |
Geochronology
Mineralization age: Cenozoic : 62.3 ± 1.4 Ma to 20.0 ± 0.5 MaImportant note: This table is based only on rock and mineral ages recorded on mindat.org for this locality and is not necessarily a complete representation of the geochronology, but does give an indication of possible mineralization events relevant to this locality. As more age information is added this table may expand in the future. A break in the table simply indicates a lack of data entered here, not necessarily a break in the geologic sequence. Grey background entries are from different, related, localities.
| Geologic Time | Rocks, Minerals and Events | ||||||
|---|---|---|---|---|---|---|---|
| Phanerozoic | |||||||
| Cenozoic | |||||||
| Neogene | |||||||
| Miocene |
| ||||||
| Paleogene | |||||||
| Paleocene |
| ||||||
Fossils
There are 2 fossil localities from the PaleoBioDB database within this region.BETA TEST - These data are provided on an experimental basis and are taken from external databases. Mindat.org has no control currently over the accuracy of these data.
| Occurrences | 200 |
|---|---|
| Youngest Fossil Listed | 23.0 Ma (Oligocene) |
| Oldest Fossil Listed | 101 Ma (Late/Upper Cretaceous) |
| Fossils from Region | Click here to show the list. |
| Fossil Localities | Click to show 2 fossil localities |
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Arrondissement_of_Montbrison |
|---|---|
| Wikidata ID: | Q701760 |
| GeoNames ID: | 2992889 |
Localities in this Region
- Auvergne-Rhône-Alpes
- Loire
- Montbrison
- ⭔Aboën
- ⭔Ailleux
- ⭔Apinac
- ⭔Arthun
- ⭔Aveizieux
- ⭔Bard
- ⭔Bellegarde-en-Forez
- ⭔Boën-sur-Lignon
- ⭔Boisset-lès-Montrond
- ⭔Boisset-Saint-Priest
- ⭔Bonson
- ⭔Bussy-Albieux
- ⭔Cervières
- ⭔Cezay
- ⭔Chalain-d'Uzore
- ⭔Chalain-le-Comtal
- ⭔Chalmazel-Jeansagnière
- ⭔Chambéon
- ⭔Chambles
- ⭔Chambœuf
- ⭔Champdieu
- ⭔Châtelneuf
- ⭔Châtelus
- ⭔Chazelles-sur-Lavieu
- ⭔Chazelles-sur-Lyon
- ⭔Chenereilles
- ⭔Chevrières
- ⭔Civens
- ⭔Cleppé
- ⭔Cottance
- ⭔Craintilleux
- ⭔Cuzieu
- ⭔Débats-Rivière-d'Orpra
- ⭔Écotay-l'Olme
- ⭔Épercieux-Saint-Paul
- ⭔Essertines-en-Châtelneuf
- ⭔Essertines-en-Donzy
- ⭔Estivareilles
- ⭔Feurs
- ⭔Grammond
- ⭔Grézieux-le-Fromental
- ⭔Gumières
- Imbert's pegmatite
- ⭔Jas
- ⭔L'Hôpital-le-Grand
- ⭔L'Hôpital-sous-Rochefort
- ⭔La Chamba
- ⭔La Chambonie
- ⭔La Chapelle-en-Lafaye
- ⭔La Côte-en-Couzan
- ⭔La Gimond
- ⭔La Tourette
- ⭔La Valla-sur-Rochefort
- ⭔Lavieu
- ⭔Leigneux
- ⭔Lérigneux
- ⭔Les Salles
- ⭔Lézigneux
- ⭔Luriecq
- ⭔Magneux-Haute-Rive
- ⭔Marcilly-le-Châtel
- ⭔Marclopt
- ⭔Marcoux
- ⭔Margerie-Chantagret
- ⭔Maringes
- ⭔Marols
- ⭔Merle-Leignec
- Montbrison
- Loire
- Auvergne-Rhône-Alpes
- Loire
- Montbrison
- ⭔Mizérieux
- ⭔Montarcher
- ⭔Montbrison
- ⭔Montchal
- ⭔Montrond-les-Bains
- ⭔Montverdun
- ⭔Mornand-en-Forez
- ⭔Nervieux
- ⭔Noirétable
- ⭔Palogneux
- ⭔Panissières
- ⭔Périgneux
- ⭔Poncins
- ⭔Pouilly-lès-Feurs
- ⭔Pralong
- ⭔Précieux
- ⭔Rivas
- ⭔Roche
- ⭔Rozier-Côtes-d'Aurec
- ⭔Rozier-en-Donzy
- ⭔Sail-sous-Couzan
- ⭔Saint-André-le-Puy
- ⭔Saint-Barthélemy-Lestra
- ⭔Saint-Bonnet-le-Château
- ⭔Saint-Bonnet-le-Courreau
- ⭔Saint-Bonnet-les-Oules
- ⭔Saint-Cyprien
- ⭔Saint-Cyr-les-Vignes
- ⭔Saint-Denis-sur-Coise
- ⭔Saint-Didier-sur-Rochefort
- ⭔Saint-Étienne-le-Molard
- ⭔Saint-Galmier
- Saint-Héand
- ⭔Saint-Georges-en-Couzan
- ⭔Saint-Georges-Haute-Ville
- ⭔Saint-Hilaire-Cusson-la-Valmitte
- ⭔Saint-Jean-la-Vêtre
- ⭔Saint-Jean-Soleymieux
- ⭔Saint-Just-en-Bas
- ⭔Saint-Just-Saint-Rambert
- ⭔Saint-Laurent-la-Conche
- ⭔Saint-Laurent-Rochefort
- ⭔Saint-Marcellin-en-Forez
- ⭔Saint-Martin-Lestra
- ⭔Saint-Maurice-en-Gourgois
- ⭔Saint-Médard-en-Forez
- ⭔Saint-Nizier-de-Fornas
- ⭔Saint-Paul-d'Uzore
- ⭔Saint-Priest-la-Vêtre
- ⭔Saint-Romain-le-Puy
- ⭔Saint-Sixte
- ⭔Saint-Thomas-la-Garde
- ⭔Sainte-Agathe-la-Bouteresse
- ⭔Sainte-Foy-Saint-Sulpice
- ⭔Salt-en-Donzy
- ⭔Salvizinet
- ⭔Sauvain
- ⭔Savigneux
- ⭔Soleymieux
- ⭔Sury-le-Comtal
- ⭔Trelins
- ⭔Unias
- ⭔Usson-en-Forez
- ⭔Valeille
- ⭔Veauche
- ⭔Veauchette
- ⭔Verrières-en-Forez
- ⭔Vêtre-sur-Anzon
- ⭔Viricelles
- ⭔Virigneux
- Vizézy brook alluvials
- Montbrison
- Loire
Other Regions, Features and Areas that Intersect
Eurasian PlateTectonic Plate
France
- Auvergne-Rhône-Alpes
- Loire
- Montbrison
- Forez Volcanic FieldGroup of Occurrences
- Montbrison
- Loire
- Massif CentralHighland Region
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Quick NavTopMineral ListRock TypesGeochronologyFossilsOther DatabasesLocalities in RegionOther Regions
Montclaret quarry, Saint-Georges-Haute-Ville, Montbrison, Loire, Auvergne-Rhône-Alpes, France