Treverbyn, Cornwall, England, UKi
| Regional Level Types | |
|---|---|
| Treverbyn | Civil Parish |
| Cornwall | County |
| England | Constituent Country |
| UK | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Bugle | 2,873 (2017) |
Mindat Locality ID:
14226
Long-form identifier:
mindat:1:2:14226:6
GUID (UUID V4):
3a116f90-8d72-46e7-8c10-e54999da2b81
Other Languages:
French:
Treverbyn, Cornouailles, Angleterre, Royaume-Uni
German:
Treverbyn, Cornwall, England, Vereinigtes Königreich
Russian:
Тревербин, Корнуолл, Англия, Великобритания
Spanish:
Treverbyn, Cornualles, Inglaterra, Reino Unido
Basque:
Treverbyn, Kornualles, Ingalaterra, Erresuma Batua
Bengali:
ট্রেবেরব্রি, কর্নওয়াল, ইংল্যান্ড, যুক্তরাজ্য
Bulgarian:
Тревербйн, Корнуол, Англия, Обединено кралство Великобритания и Северна Ирландия
Cebuano:
Treverbyn, Cornwall, Inglatera, Hiniusang Gingharian
Dutch:
Treverbyn, Cornwall, Engeland, Verenigd Koninkrijk
Gujarati:
ટ્રેવરબીન, કોર્નવોલ, ઈંગ્લેન્ડ, યુનાઇટેડ કિંગડમ
Japanese:
トレバービン, コーンウォール, イングランド, イギリス
Kannada:
ಟ್ರೆವರ್ಬಿನ್, ಕಾರ್ನ್ವಾಲ್, ಇಂಗ್ಲೆಂಡ್, ಯುನೈಟೆಡ್ ಕಿಂಗ್ಡಂ
Korean:
트레버빈, 콘월주, 잉글랜드, 영국
Lithuanian:
Treverblinas, Kornvalis, Anglija, Jungtinė Karalystė
Polish:
Treverbyn, Kornwalia, Anglia, Wielka Brytania
Portuguese:
Treverbyn, Cornualha, Inglaterra, Reino Unido
Swedish:
Treverbyn, Cornwall, England, Storbritannien
Tamil:
ட்ரேவேர்ப்யன், கோர்ன்வால், இங்கிலாந்து, ஐக்கிய இராச்சியம்
Telugu:
త్రేవెర్బిన్, కార్న్వాల్, ఇంగ్లాండు, యునైటెడ్ కింగ్డమ్
Urdu:
تریویربین, کورنوال, انگلستان, مملکت متحدہ
Welsh:
Treverbyn, Cernyw, Lloegr, Y Deyrnas Unedig
Treverbyn is a civil parish and village in mid-Cornwall. It was formed from part of St Austell parish in 1984 and includes the villages of Treverbyn, Stenalees, Penwithick, Bugle, Rescorla, Kerrow Moor, Carthew, Ruddlemoor, Bowling Green, Resugga Green, Scredda and parts of Trethurgy.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities76 valid minerals. 1 erroneous literature entry.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Aheylite ? Formula: (Fe2+,Zn)Al6(PO4)4(OH)8 · 4H2O |
| ⓘ Albite Formula: Na(AlSi3O8) Description: Inclusions in topaz. |
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) |
| ⓘ Arsenopyrite Formula: FeAsS |
| ⓘ Arthurite Formula: CuFe3+2(AsO4)2(OH)2 · 4H2O |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 |
| ⓘ Barbosalite Formula: Fe2+Fe3+2(PO4)2(OH)2 |
| ⓘ Beraunite Formula: Fe3+6(PO4)4O(OH)4 · 6H2O |
| ⓘ Beryl Formula: Be3Al2(Si6O18) Localities: |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ Bismuthinite Formula: Bi2S3 |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 |
| ⓘ Cacoxenite Formula: Fe3+24AlO6(PO4)17(OH)12 · 75H2O |
| ⓘ Cassiterite Formula: SnO2 Localities: Reported from at least 13 localities in this region. |
| ⓘ Cassiterite var. Toad's Eye Tin |
| ⓘ Cassiterite var. Wood Tin Formula: SnO2 |
| ⓘ Chalcocite Formula: Cu2S Description: Reported from tin lodes in the deepest part of the mine, together with olivenite (Smyth, Reeks & Rudler, 1864). |
| ⓘ Chalcopyrite Formula: CuFeS2 |
| ⓘ Chalcosiderite Formula: CuFe3+6(PO4)4(OH)8 · 4H2O |
| ⓘ 'Columbite-(Fe)-Columbite-(Mn) Series' Description: Inclusions in topaz. |
| ⓘ Columbite-(Mn) Formula: Mn2+Nb2O6 |
| ⓘ Connellite Formula: Cu19(SO4)(OH)32Cl4 · 3H2O |
| ⓘ Copper Formula: Cu |
| ⓘ Corundum Formula: Al2O3 |
| ⓘ Covellite Formula: CuS |
| ⓘ Cuprite Formula: Cu2O |
| ⓘ Cuprite var. Chalcotrichite Formula: Cu2O |
| ⓘ Cuprotungstite Formula: Cu2(WO4)(OH)2 |
| ⓘ Cyrilovite Formula: NaFe3+3(PO4)2(OH)4 · 2H2O |
| ⓘ Digenite Formula: Cu9S5 |
| ⓘ Dravite Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Dufrénite Formula: Ca0.5Fe2+Fe3+5(PO4)4(OH)6 · 2H2O |
| ⓘ Elbaite Formula: Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Ferberite Formula: FeWO4 |
| ⓘ Florencite-(La) Formula: LaAl3(PO4)2(OH)6 |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F Localities: |
| ⓘ Fluorite Formula: CaF2 Localities: |
| ⓘ Frondelite Formula: Mn2+Fe3+4(PO4)3(OH)5 |
| ⓘ Goyazite Formula: SrAl3(PO4)(PO3OH)(OH)6 |
| ⓘ Hematite Formula: Fe2O3 |
| ⓘ Hentschelite Formula: CuFe3+2(PO4)2(OH)2 |
| ⓘ 'Jasper' |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 Localities: Gunheath China Clay Pit, Stenalees, Treverbyn, Cornwall, England, UK Hensbarrow China Clay Pit, Stenalees, Treverbyn, Cornwall, England, UK Carclaze Old Tin Pit, Carclaze China Clay Pit (Baal China Clay Pit), Carluddon, Treverbyn, Cornwall, England, UK Old Beam Mine (Great Beam Mine), Bugle, Treverbyn, Cornwall, England, UK Goonbarrow China Clay Pit, Bugle, Treverbyn, Cornwall, England, UK References: |
| ⓘ Kuramite Formula: Cu3SnS4 |
| ⓘ 'Lepidolite' |
| ⓘ Leucophosphite Formula: KFe3+2(PO4)2(OH) · 2H2O |
| ⓘ Libethenite Formula: Cu2(PO4)(OH) |
| ⓘ 'Limonite' |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 |
| ⓘ Mawsonite Formula: Cu6Fe2SnS8 |
| ⓘ Metatorbernite Formula: Cu(UO2)2(PO4)2 · 8H2O |
| ⓘ Metavariscite Formula: AlPO4 · 2H2O |
| ⓘ 'Mica Group' |
| ⓘ Microcline Formula: K(AlSi3O8) |
| ⓘ Mitridatite Formula: Ca2Fe3+3(PO4)3O2 · 3H2O |
| ⓘ Morinite Formula: NaCa2Al2(PO4)2(OH)F4 · 2H2O |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: References: |
| ⓘ Muscovite var. Gilbertite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Nontronite Formula: Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| ⓘ Olivenite Formula: Cu2(AsO4)(OH) Description: Reported from tin lodes in the deepest part of the mine, together with chalcocite (Smyth, Reeks & Rudler, 1864). |
| ⓘ Opal Formula: SiO2 · nH2O Localities: Carclaze Old Tin Pit, Carclaze China Clay Pit (Baal China Clay Pit), Carluddon, Treverbyn, Cornwall, England, UK Rock Hill China Clay Pit, Bugle, Treverbyn, Cornwall, England, UK Gunheath China Clay Pit, Stenalees, Treverbyn, Cornwall, England, UK Goonbarrow China Clay Pit, Bugle, Treverbyn, Cornwall, England, UK |
| ⓘ Opal var. Hydrophane Formula: SiO2 · nH2O |
| ⓘ Opal var. Opal-CT Formula: SiO2 · nH2O |
| ⓘ Orthoclase Formula: K(AlSi3O8) Localities: References: |
| ⓘ Pharmacosiderite Formula: KFe3+4(AsO4)3(OH)4 · 6-7H2O Localities: References: |
| ⓘ 'Pig's Egg' |
| ⓘ Formula: Cu8(Si8O22)(OH)4 · H2O Locality: Gunheath China Clay Pit, Stenalees, Treverbyn, Cornwall, England, UK - erroneously reported |
| ⓘ Pseudomalachite Formula: Cu5(PO4)2(OH)4 |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl |
| ⓘ Qitianlingite ? Formula: (Fe,Mn)2(Nb,Ta)2WO10 Description: Microscopic inclusion in topaz. Inclusions in topaz analyzed only by ICP-OES and Raman spectrometry. Without XRD orthorhombic qitianlingite can not be distinguished from monoclinic "wolframoixiolite". Qitianlingite must be therefore regarded as unconfirmed. |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 8 localities in this region. |
| ⓘ Quartz var. Amethyst Formula: SiO2 Localities: |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 |
| ⓘ Rockbridgeite Formula: Fe2+Fe3+4(PO4)3(OH)5 |
| ⓘ Rutile Formula: TiO2 Description: Inclusions in topaz. |
| ⓘ Rutile var. Ilmenorutile Formula: (Ti,Nb)O2 Description: Inclusions in topaz. |
| ⓘ Scheelite Formula: Ca(WO4) |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Localities: Reported from at least 6 localities in this region. |
| ⓘ Scorodite Formula: Fe3+AsO4 · 2H2O Localities: |
| ⓘ Sphalerite Formula: ZnS |
| ⓘ Stannite Formula: Cu2FeSnS4 Localities: References: |
| ⓘ Stannoidite Formula: Cu+6Cu2+2(Fe2+,Zn)3Sn2S12 |
| ⓘ Strunzite Formula: Mn2+Fe3+2(PO4)2(OH)2 · 6H2O |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 |
| ⓘ 'Tantalite' Formula: (Mn,Fe)(Ta,Nb)2O6 |
| ⓘ 'Tennantite Subgroup' Formula: Cu6(Cu4C2+2)As4S12S |
| ⓘ Tenorite Formula: CuO |
| ⓘ Topaz Formula: Al2(SiO4)(F,OH)2 Localities: |
| ⓘ Torbernite Formula: Cu(UO2)2(PO4)2 · 12H2O |
| ⓘ 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z Localities: Carclaze Old Tin Pit, Carclaze China Clay Pit (Baal China Clay Pit), Carluddon, Treverbyn, Cornwall, England, UK Goonbarrow China Clay Pit, Bugle, Treverbyn, Cornwall, England, UK Gunheath China Clay Pit, Stenalees, Treverbyn, Cornwall, England, UK Rocks Tin Mine, Rocks and Treverbyn United Tin Mines, Bugle, Treverbyn, Cornwall, England, UK Rock Hill China Clay Pit, Bugle, Treverbyn, Cornwall, England, UK |
| ⓘ 'Tourmaline var. Achroite' Formula: A(D3)G6(T6O18)(BO3)3X3Z Localities: |
| ⓘ Turquoise Formula: CuAl6(PO4)4(OH)8 · 4H2O Localities: |
| ⓘ Turquoise var. Rashleighite Formula: Cu(Al,Fe)6(PO4)4(OH)8 · 5H2O Localities: |
| ⓘ Variscite Formula: AlPO4 · 2H2O Localities: |
| ⓘ Varlamoffite Formula: (Sn,Fe)(O,OH)2 Localities: References: |
| ⓘ Wavellite Formula: Al3(PO4)2(OH,F)3 · 5H2O Localities: References: |
| ⓘ Waylandite Formula: BiAl3(PO4)2(OH)6 |
| ⓘ 'Wolframite Group' Localities: Gunheath China Clay Pit, Stenalees, Treverbyn, Cornwall, England, UK Bunny Mine (Bonny Mine; Wheal Eliza; St Austell Hills Mine; Shelton Mine), Stenalees, Treverbyn, Cornwall, England, UK Old Beam Mine (Great Beam Mine), Bugle, Treverbyn, Cornwall, England, UK Hensbarrow China Clay Pit, Stenalees, Treverbyn, Cornwall, England, UK Goonbarrow China Clay Pit, Bugle, Treverbyn, Cornwall, England, UK References: |
| ⓘ Wurtzite Formula: (Zn,Fe)S |
| ⓘ 'Zinnwaldite' Localities: |
| ⓘ Zircon Formula: Zr(SiO4) Description: Inclusions in topaz. |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Copper | 1.AA.05 | Cu |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Digenite | 2.BA.10 | Cu9S5 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Stannite | 2.CB.15a | Cu2FeSnS4 |
| ⓘ | Kuramite | 2.CB.15a | Cu3SnS4 |
| ⓘ | Stannoidite | 2.CB.15c | Cu+6Cu2+2(Fe2+,Zn)3Sn2S12 |
| ⓘ | Mawsonite | 2.CB.20 | Cu6Fe2SnS8 |
| ⓘ | Wurtzite | 2.CB.45 | (Zn,Fe)S |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | 'Tennantite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)As4S12S |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| ⓘ | Connellite | 3.DA.25 | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Cuprite var. Chalcotrichite | 4.AA.10 | Cu2O |
| ⓘ | 4.AA.10 | Cu2O | |
| ⓘ | Tenorite | 4.AB.10 | CuO |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Corundum | 4.CB.05 | Al2O3 |
| ⓘ | Quartz var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Amethyst | 4.DA.05 | SiO2 |
| ⓘ | Opal | 4.DA.10 | SiO2 · nH2O |
| ⓘ | var. Hydrophane | 4.DA.10 | SiO2 · nH2O |
| ⓘ | var. Opal-CT | 4.DA.10 | SiO2 · nH2O |
| ⓘ | Rutile var. Ilmenorutile | 4.DB.05 | (Ti,Nb)O2 |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Cassiterite var. Toad's Eye Tin | 4.DB.05 | SnO2 |
| ⓘ | Varlamoffite | 4.DB.05 | (Sn,Fe)(O,OH)2 |
| ⓘ | Cassiterite var. Wood Tin | 4.DB.05 | SnO2 |
| ⓘ | Ferberite | 4.DB.30 | FeWO4 |
| ⓘ | 'Wolframite Group' | 4.DB.30 va | |
| ⓘ | Qitianlingite ? | 4.DB.35 | (Fe,Mn)2(Nb,Ta)2WO10 |
| ⓘ | Columbite-(Mn) | 4.DB.35 | Mn2+Nb2O6 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| ⓘ | Cuprotungstite | 7.GB.15 | Cu2(WO4)(OH)2 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Libethenite | 8.BB.30 | Cu2(PO4)(OH) |
| ⓘ | Olivenite | 8.BB.30 | Cu2(AsO4)(OH) |
| ⓘ | Barbosalite | 8.BB.40 | Fe2+Fe3+2(PO4)2(OH)2 |
| ⓘ | Hentschelite | 8.BB.40 | CuFe3+2(PO4)2(OH)2 |
| ⓘ | Frondelite | 8.BC.10 | Mn2+Fe3+4(PO4)3(OH)5 |
| ⓘ | Rockbridgeite | 8.BC.10 | Fe2+Fe3+4(PO4)3(OH)5 |
| ⓘ | Pseudomalachite | 8.BD.05 | Cu5(PO4)2(OH)4 |
| ⓘ | Goyazite | 8.BL.10 | SrAl3(PO4)(PO3OH)(OH)6 |
| ⓘ | Florencite-(La) | 8.BL.13 | LaAl3(PO4)2(OH)6 |
| ⓘ | Waylandite | 8.BL.13 | BiAl3(PO4)2(OH)6 |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| ⓘ | Metavariscite | 8.CD.05 | AlPO4 · 2H2O |
| ⓘ | Variscite | 8.CD.10 | AlPO4 · 2H2O |
| ⓘ | Scorodite | 8.CD.10 | Fe3+AsO4 · 2H2O |
| ⓘ | Arthurite | 8.DC.15 | CuFe3+2(AsO4)2(OH)2 · 4H2O |
| ⓘ | Strunzite | 8.DC.25 | Mn2+Fe3+2(PO4)2(OH)2 · 6H2O |
| ⓘ | Beraunite | 8.DC.27 | Fe3+6(PO4)4O(OH)4 · 6H2O |
| ⓘ | Cacoxenite | 8.DC.40 | Fe3+24AlO6(PO4)17(OH)12 · 75H2O |
| ⓘ | Wavellite | 8.DC.50 | Al3(PO4)2(OH,F)3 · 5H2O |
| ⓘ | Turquoise var. Rashleighite | 8.DD.15 | Cu(Al,Fe)6(PO4)4(OH)8 · 5H2O |
| ⓘ | Chalcosiderite | 8.DD.15 | CuFe3+6(PO4)4(OH)8 · 4H2O |
| ⓘ | Turquoise | 8.DD.15 | CuAl6(PO4)4(OH)8 · 4H2O |
| ⓘ | Aheylite ? | 8.DD.15 | (Fe2+,Zn)Al6(PO4)4(OH)8 · 4H2O |
| ⓘ | Leucophosphite | 8.DH.10 | KFe3+2(PO4)2(OH) · 2H2O |
| ⓘ | Mitridatite | 8.DH.30 | Ca2Fe3+3(PO4)3O2 · 3H2O |
| ⓘ | Pharmacosiderite | 8.DK.10 | KFe3+4(AsO4)3(OH)4 · 6-7H2O |
| ⓘ | Dufrénite | 8.DK.15 | Ca0.5Fe2+Fe3+5(PO4)4(OH)6 · 2H2O |
| ⓘ | Cyrilovite | 8.DL.10 | NaFe3+3(PO4)2(OH)4 · 2H2O |
| ⓘ | Morinite | 8.DM.05 | NaCa2Al2(PO4)2(OH)F4 · 2H2O |
| ⓘ | Torbernite | 8.EB.05 | Cu(UO2)2(PO4)2 · 12H2O |
| ⓘ | Metatorbernite | 8.EB.10 | Cu(UO2)2(PO4)2 · 8H2O |
| Group 9 - Silicates | |||
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Topaz | 9.AF.35 | Al2(SiO4)(F,OH)2 |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Elbaite | 9.CK.05 | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Plancheite ? | 9.DB.35 | Cu8(Si8O22)(OH)4 · H2O |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Muscovite var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | var. Gilbertite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Nontronite | 9.EC.40 | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| Unclassified | |||
| ⓘ | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| ⓘ | 'Tourmaline var. Achroite' | - | A(D3)G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
| ⓘ | 'Mica Group' | - | |
| ⓘ | 'Pig's Egg' | - | |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Zinnwaldite' | - | |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Lepidolite' | - | |
| ⓘ | 'Jasper' | - | |
| ⓘ | 'Tantalite' | - | (Mn,Fe)(Ta,Nb)2O6 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Aheylite | (Fe2+,Zn)Al6(PO4)4(OH)8 · 4H2O |
| H | ⓘ Arthurite | CuFe23+(AsO4)2(OH)2 · 4H2O |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Barbosalite | Fe2+Fe23+(PO4)2(OH)2 |
| H | ⓘ Beraunite | Fe63+(PO4)4O(OH)4 · 6H2O |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| H | ⓘ Chalcosiderite | CuFe63+(PO4)4(OH)8 · 4H2O |
| H | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| H | ⓘ Cuprotungstite | Cu2(WO4)(OH)2 |
| H | ⓘ Cyrilovite | NaFe33+(PO4)2(OH)4 · 2H2O |
| H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Dufrénite | Ca0.5Fe2+Fe53+(PO4)4(OH)6 · 2H2O |
| H | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Florencite-(La) | LaAl3(PO4)2(OH)6 |
| H | ⓘ Frondelite | Mn2+Fe43+(PO4)3(OH)5 |
| H | ⓘ Muscovite var. Gilbertite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Hentschelite | CuFe23+(PO4)2(OH)2 |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Leucophosphite | KFe23+(PO4)2(OH) · 2H2O |
| H | ⓘ Libethenite | Cu2(PO4)(OH) |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| H | ⓘ Metavariscite | AlPO4 · 2H2O |
| H | ⓘ Mitridatite | Ca2Fe33+(PO4)3O2 · 3H2O |
| H | ⓘ Morinite | NaCa2Al2(PO4)2(OH)F4 · 2H2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| H | ⓘ Olivenite | Cu2(AsO4)(OH) |
| H | ⓘ Opal | SiO2 · nH2O |
| H | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| H | ⓘ Plancheite | Cu8(Si8O22)(OH)4 · H2O |
| H | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| H | ⓘ Turquoise var. Rashleighite | Cu(Al,Fe)6(PO4)4(OH)8 · 5H2O |
| H | ⓘ Rockbridgeite | Fe2+Fe43+(PO4)3(OH)5 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| H | ⓘ Strunzite | Mn2+Fe23+(PO4)2(OH)2 · 6H2O |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| H | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| H | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| H | ⓘ Variscite | AlPO4 · 2H2O |
| H | ⓘ Varlamoffite | (Sn,Fe)(O,OH)2 |
| H | ⓘ Wavellite | Al3(PO4)2(OH,F)3 · 5H2O |
| H | ⓘ Waylandite | BiAl3(PO4)2(OH)6 |
| H | ⓘ Opal var. Hydrophane | SiO2 · nH2O |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| H | ⓘ Opal var. Opal-CT | SiO2 · nH2O |
| Li | Lithium | |
| Li | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Tourmaline var. Achroite | A(D3)G6(T6O18)(BO3)3X3Z |
| B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | Oxygen | |
| O | ⓘ Aheylite | (Fe2+,Zn)Al6(PO4)4(OH)8 · 4H2O |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Quartz var. Amethyst | SiO2 |
| O | ⓘ Arthurite | CuFe23+(AsO4)2(OH)2 · 4H2O |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Tourmaline var. Achroite | A(D3)G6(T6O18)(BO3)3X3Z |
| O | ⓘ Barbosalite | Fe2+Fe23+(PO4)2(OH)2 |
| O | ⓘ Beraunite | Fe63+(PO4)4O(OH)4 · 6H2O |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Chalcosiderite | CuFe63+(PO4)4(OH)8 · 4H2O |
| O | ⓘ Cuprite var. Chalcotrichite | Cu2O |
| O | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| O | ⓘ Corundum | Al2O3 |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Cuprotungstite | Cu2(WO4)(OH)2 |
| O | ⓘ Cyrilovite | NaFe33+(PO4)2(OH)4 · 2H2O |
| O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Dufrénite | Ca0.5Fe2+Fe53+(PO4)4(OH)6 · 2H2O |
| O | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Ferberite | FeWO4 |
| O | ⓘ Florencite-(La) | LaAl3(PO4)2(OH)6 |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Frondelite | Mn2+Fe43+(PO4)3(OH)5 |
| O | ⓘ Muscovite var. Gilbertite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hentschelite | CuFe23+(PO4)2(OH)2 |
| O | ⓘ Rutile var. Ilmenorutile | (Ti,Nb)O2 |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Leucophosphite | KFe23+(PO4)2(OH) · 2H2O |
| O | ⓘ Libethenite | Cu2(PO4)(OH) |
| O | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| O | ⓘ Metavariscite | AlPO4 · 2H2O |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Mitridatite | Ca2Fe33+(PO4)3O2 · 3H2O |
| O | ⓘ Morinite | NaCa2Al2(PO4)2(OH)F4 · 2H2O |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| O | ⓘ Olivenite | Cu2(AsO4)(OH) |
| O | ⓘ Opal | SiO2 · nH2O |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| O | ⓘ Plancheite | Cu8(Si8O22)(OH)4 · H2O |
| O | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Qitianlingite | (Fe,Mn)2(Nb,Ta)2WO10 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Turquoise var. Rashleighite | Cu(Al,Fe)6(PO4)4(OH)8 · 5H2O |
| O | ⓘ Rockbridgeite | Fe2+Fe43+(PO4)3(OH)5 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Strunzite | Mn2+Fe23+(PO4)2(OH)2 · 6H2O |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| O | ⓘ Tenorite | CuO |
| O | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| O | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| O | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| O | ⓘ Variscite | AlPO4 · 2H2O |
| O | ⓘ Varlamoffite | (Sn,Fe)(O,OH)2 |
| O | ⓘ Wavellite | Al3(PO4)2(OH,F)3 · 5H2O |
| O | ⓘ Waylandite | BiAl3(PO4)2(OH)6 |
| O | ⓘ Cassiterite var. Wood Tin | SnO2 |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Opal var. Hydrophane | SiO2 · nH2O |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| O | ⓘ Opal var. Opal-CT | SiO2 · nH2O |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Morinite | NaCa2Al2(PO4)2(OH)F4 · 2H2O |
| F | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| F | ⓘ Wavellite | Al3(PO4)2(OH,F)3 · 5H2O |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Cyrilovite | NaFe33+(PO4)2(OH)4 · 2H2O |
| Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Morinite | NaCa2Al2(PO4)2(OH)F4 · 2H2O |
| Na | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Al | Aluminium | |
| Al | ⓘ Aheylite | (Fe2+,Zn)Al6(PO4)4(OH)8 · 4H2O |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| Al | ⓘ Corundum | Al2O3 |
| Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Florencite-(La) | LaAl3(PO4)2(OH)6 |
| Al | ⓘ Muscovite var. Gilbertite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Metavariscite | AlPO4 · 2H2O |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Morinite | NaCa2Al2(PO4)2(OH)F4 · 2H2O |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Turquoise var. Rashleighite | Cu(Al,Fe)6(PO4)4(OH)8 · 5H2O |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Al | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| Al | ⓘ Variscite | AlPO4 · 2H2O |
| Al | ⓘ Wavellite | Al3(PO4)2(OH,F)3 · 5H2O |
| Al | ⓘ Waylandite | BiAl3(PO4)2(OH)6 |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Quartz var. Amethyst | SiO2 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Muscovite var. Gilbertite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Si | ⓘ Opal | SiO2 · nH2O |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Plancheite | Cu8(Si8O22)(OH)4 · H2O |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Opal var. Hydrophane | SiO2 · nH2O |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Opal var. Opal-CT | SiO2 · nH2O |
| P | Phosphorus | |
| P | ⓘ Aheylite | (Fe2+,Zn)Al6(PO4)4(OH)8 · 4H2O |
| P | ⓘ Barbosalite | Fe2+Fe23+(PO4)2(OH)2 |
| P | ⓘ Beraunite | Fe63+(PO4)4O(OH)4 · 6H2O |
| P | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| P | ⓘ Chalcosiderite | CuFe63+(PO4)4(OH)8 · 4H2O |
| P | ⓘ Cyrilovite | NaFe33+(PO4)2(OH)4 · 2H2O |
| P | ⓘ Dufrénite | Ca0.5Fe2+Fe53+(PO4)4(OH)6 · 2H2O |
| P | ⓘ Florencite-(La) | LaAl3(PO4)2(OH)6 |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Frondelite | Mn2+Fe43+(PO4)3(OH)5 |
| P | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Hentschelite | CuFe23+(PO4)2(OH)2 |
| P | ⓘ Leucophosphite | KFe23+(PO4)2(OH) · 2H2O |
| P | ⓘ Libethenite | Cu2(PO4)(OH) |
| P | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| P | ⓘ Metavariscite | AlPO4 · 2H2O |
| P | ⓘ Mitridatite | Ca2Fe33+(PO4)3O2 · 3H2O |
| P | ⓘ Morinite | NaCa2Al2(PO4)2(OH)F4 · 2H2O |
| P | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| P | ⓘ Turquoise var. Rashleighite | Cu(Al,Fe)6(PO4)4(OH)8 · 5H2O |
| P | ⓘ Rockbridgeite | Fe2+Fe43+(PO4)3(OH)5 |
| P | ⓘ Strunzite | Mn2+Fe23+(PO4)2(OH)2 · 6H2O |
| P | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| P | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| P | ⓘ Variscite | AlPO4 · 2H2O |
| P | ⓘ Wavellite | Al3(PO4)2(OH,F)3 · 5H2O |
| P | ⓘ Waylandite | BiAl3(PO4)2(OH)6 |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| S | ⓘ Covellite | CuS |
| S | ⓘ Digenite | Cu9S5 |
| S | ⓘ Kuramite | Cu3SnS4 |
| S | ⓘ Mawsonite | Cu6Fe2SnS8 |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stannite | Cu2FeSnS4 |
| S | ⓘ Stannoidite | Cu6+Cu22+(Fe2+,Zn)3Sn2S12 |
| S | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| S | ⓘ Wurtzite | (Zn,Fe)S |
| Cl | Chlorine | |
| Cl | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Muscovite var. Gilbertite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Leucophosphite | KFe23+(PO4)2(OH) · 2H2O |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Dufrénite | Ca0.5Fe2+Fe53+(PO4)4(OH)6 · 2H2O |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Mitridatite | Ca2Fe33+(PO4)3O2 · 3H2O |
| Ca | ⓘ Morinite | NaCa2Al2(PO4)2(OH)F4 · 2H2O |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Rutile var. Ilmenorutile | (Ti,Nb)O2 |
| Ti | ⓘ Rutile | TiO2 |
| Mn | Manganese | |
| Mn | ⓘ Frondelite | Mn2+Fe43+(PO4)3(OH)5 |
| Mn | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| Mn | ⓘ Qitianlingite | (Fe,Mn)2(Nb,Ta)2WO10 |
| Mn | ⓘ Strunzite | Mn2+Fe23+(PO4)2(OH)2 · 6H2O |
| Mn | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Fe | Iron | |
| Fe | ⓘ Aheylite | (Fe2+,Zn)Al6(PO4)4(OH)8 · 4H2O |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Arthurite | CuFe23+(AsO4)2(OH)2 · 4H2O |
| Fe | ⓘ Barbosalite | Fe2+Fe23+(PO4)2(OH)2 |
| Fe | ⓘ Beraunite | Fe63+(PO4)4O(OH)4 · 6H2O |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| Fe | ⓘ Chalcosiderite | CuFe63+(PO4)4(OH)8 · 4H2O |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Cyrilovite | NaFe33+(PO4)2(OH)4 · 2H2O |
| Fe | ⓘ Dufrénite | Ca0.5Fe2+Fe53+(PO4)4(OH)6 · 2H2O |
| Fe | ⓘ Ferberite | FeWO4 |
| Fe | ⓘ Frondelite | Mn2+Fe43+(PO4)3(OH)5 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Hentschelite | CuFe23+(PO4)2(OH)2 |
| Fe | ⓘ Leucophosphite | KFe23+(PO4)2(OH) · 2H2O |
| Fe | ⓘ Mawsonite | Cu6Fe2SnS8 |
| Fe | ⓘ Mitridatite | Ca2Fe33+(PO4)3O2 · 3H2O |
| Fe | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Fe | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| Fe | ⓘ Qitianlingite | (Fe,Mn)2(Nb,Ta)2WO10 |
| Fe | ⓘ Turquoise var. Rashleighite | Cu(Al,Fe)6(PO4)4(OH)8 · 5H2O |
| Fe | ⓘ Rockbridgeite | Fe2+Fe43+(PO4)3(OH)5 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| Fe | ⓘ Stannite | Cu2FeSnS4 |
| Fe | ⓘ Stannoidite | Cu6+Cu22+(Fe2+,Zn)3Sn2S12 |
| Fe | ⓘ Strunzite | Mn2+Fe23+(PO4)2(OH)2 · 6H2O |
| Fe | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Fe | ⓘ Varlamoffite | (Sn,Fe)(O,OH)2 |
| Fe | ⓘ Wurtzite | (Zn,Fe)S |
| Cu | Copper | |
| Cu | ⓘ Arthurite | CuFe23+(AsO4)2(OH)2 · 4H2O |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Chalcosiderite | CuFe63+(PO4)4(OH)8 · 4H2O |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Cuprite var. Chalcotrichite | Cu2O |
| Cu | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Cuprotungstite | Cu2(WO4)(OH)2 |
| Cu | ⓘ Copper | Cu |
| Cu | ⓘ Digenite | Cu9S5 |
| Cu | ⓘ Hentschelite | CuFe23+(PO4)2(OH)2 |
| Cu | ⓘ Kuramite | Cu3SnS4 |
| Cu | ⓘ Libethenite | Cu2(PO4)(OH) |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Mawsonite | Cu6Fe2SnS8 |
| Cu | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| Cu | ⓘ Olivenite | Cu2(AsO4)(OH) |
| Cu | ⓘ Plancheite | Cu8(Si8O22)(OH)4 · H2O |
| Cu | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| Cu | ⓘ Turquoise var. Rashleighite | Cu(Al,Fe)6(PO4)4(OH)8 · 5H2O |
| Cu | ⓘ Stannite | Cu2FeSnS4 |
| Cu | ⓘ Stannoidite | Cu6+Cu22+(Fe2+,Zn)3Sn2S12 |
| Cu | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Cu | ⓘ Tenorite | CuO |
| Cu | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| Cu | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| Zn | Zinc | |
| Zn | ⓘ Aheylite | (Fe2+,Zn)Al6(PO4)4(OH)8 · 4H2O |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Stannoidite | Cu6+Cu22+(Fe2+,Zn)3Sn2S12 |
| Zn | ⓘ Wurtzite | (Zn,Fe)S |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Arthurite | CuFe23+(AsO4)2(OH)2 · 4H2O |
| As | ⓘ Olivenite | Cu2(AsO4)(OH) |
| As | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| As | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| As | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Sr | Strontium | |
| Sr | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | ⓘ Rutile var. Ilmenorutile | (Ti,Nb)O2 |
| Nb | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| Nb | ⓘ Qitianlingite | (Fe,Mn)2(Nb,Ta)2WO10 |
| Nb | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sn | ⓘ Kuramite | Cu3SnS4 |
| Sn | ⓘ Mawsonite | Cu6Fe2SnS8 |
| Sn | ⓘ Stannite | Cu2FeSnS4 |
| Sn | ⓘ Stannoidite | Cu6+Cu22+(Fe2+,Zn)3Sn2S12 |
| Sn | ⓘ Varlamoffite | (Sn,Fe)(O,OH)2 |
| Sn | ⓘ Cassiterite var. Wood Tin | SnO2 |
| La | Lanthanum | |
| La | ⓘ Florencite-(La) | LaAl3(PO4)2(OH)6 |
| Ta | Tantalum | |
| Ta | ⓘ Qitianlingite | (Fe,Mn)2(Nb,Ta)2WO10 |
| Ta | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| W | Tungsten | |
| W | ⓘ Cuprotungstite | Cu2(WO4)(OH)2 |
| W | ⓘ Ferberite | FeWO4 |
| W | ⓘ Qitianlingite | (Fe,Mn)2(Nb,Ta)2WO10 |
| W | ⓘ Scheelite | Ca(WO4) |
| Pb | Lead | |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Bi | Bismuth | |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Waylandite | BiAl3(PO4)2(OH)6 |
| U | Uranium | |
| U | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| U | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Treverbyn |
|---|---|
| Wikidata ID: | Q7838962 |
| GeoNames ID: | 7294455 |
Localities in this Region
- England
- Cornwall
- Treverbyn
- Cornwall
- England
- Cornwall
- Treverbyn
- Cornwall
Other Regions, Features and Areas that Intersect
British and Irish IslesGroup of Islands
Eurasian PlateTectonic Plate
UK
- England
- Cornwall
- St Austell Mining DistrictMining District
- Devon and Cornwall metalliferous mining districtMining District
- Cornwall
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther Regions
Gunheath China Clay Pit, Stenalees, Treverbyn, Cornwall, England, UK